From 6ec31b4e0c89232f8a2e701102b7d29a7f88d899 Mon Sep 17 00:00:00 2001 From: matthieu Date: Sun, 26 Nov 2006 19:54:44 +0000 Subject: [PATCH] Importing xf86-input-mouse 1.1.2 --- driver/xf86-input-mouse/COPYING | 12 + driver/xf86-input-mouse/ChangeLog | 112 + driver/xf86-input-mouse/Makefile.am | 29 + driver/xf86-input-mouse/Makefile.in | 664 + driver/xf86-input-mouse/README | 1278 ++ driver/xf86-input-mouse/README.sgml | 1125 ++ driver/xf86-input-mouse/aclocal.m4 | 7898 ++++++++ driver/xf86-input-mouse/config.guess | 1411 ++ driver/xf86-input-mouse/config.h.in | 57 + driver/xf86-input-mouse/config.sub | 1500 ++ driver/xf86-input-mouse/configure | 21799 +++++++++++++++++++++ driver/xf86-input-mouse/configure.ac | 94 + driver/xf86-input-mouse/depcomp | 530 + driver/xf86-input-mouse/install-sh | 323 + driver/xf86-input-mouse/ltmain.sh | 6911 +++++++ driver/xf86-input-mouse/man/Makefile.am | 59 + driver/xf86-input-mouse/man/Makefile.in | 425 + driver/xf86-input-mouse/man/mousedrv.man | 248 + driver/xf86-input-mouse/missing | 360 + driver/xf86-input-mouse/src/Makefile.am | 31 + driver/xf86-input-mouse/src/Makefile.in | 511 + driver/xf86-input-mouse/src/mouse.c | 3796 ++++ driver/xf86-input-mouse/src/mouse.h | 15 + driver/xf86-input-mouse/src/mousePriv.h | 80 + driver/xf86-input-mouse/src/pnp.c | 792 + 25 files changed, 50060 insertions(+) create mode 100644 driver/xf86-input-mouse/COPYING create mode 100644 driver/xf86-input-mouse/ChangeLog create mode 100644 driver/xf86-input-mouse/Makefile.am create mode 100644 driver/xf86-input-mouse/Makefile.in create mode 100644 driver/xf86-input-mouse/README create mode 100644 driver/xf86-input-mouse/README.sgml create mode 100644 driver/xf86-input-mouse/aclocal.m4 create mode 100644 driver/xf86-input-mouse/config.guess create mode 100644 driver/xf86-input-mouse/config.h.in create mode 100644 driver/xf86-input-mouse/config.sub create mode 100644 driver/xf86-input-mouse/configure create mode 100644 driver/xf86-input-mouse/configure.ac create mode 100644 driver/xf86-input-mouse/depcomp create mode 100644 driver/xf86-input-mouse/install-sh create mode 100644 driver/xf86-input-mouse/ltmain.sh create mode 100644 driver/xf86-input-mouse/man/Makefile.am create mode 100644 driver/xf86-input-mouse/man/Makefile.in create mode 100644 driver/xf86-input-mouse/man/mousedrv.man create mode 100644 driver/xf86-input-mouse/missing create mode 100644 driver/xf86-input-mouse/src/Makefile.am create mode 100644 driver/xf86-input-mouse/src/Makefile.in create mode 100644 driver/xf86-input-mouse/src/mouse.c create mode 100644 driver/xf86-input-mouse/src/mouse.h create mode 100644 driver/xf86-input-mouse/src/mousePriv.h create mode 100644 driver/xf86-input-mouse/src/pnp.c diff --git a/driver/xf86-input-mouse/COPYING b/driver/xf86-input-mouse/COPYING new file mode 100644 index 000000000..7f33cbfd2 --- /dev/null +++ b/driver/xf86-input-mouse/COPYING @@ -0,0 +1,12 @@ +This is a stub file. This package has not yet had its complete licensing +information compiled. Please see the individual source files for details on +your rights to use and modify this software. + +Please submit updated COPYING files to the Xorg bugzilla: + +https://bugs.freedesktop.org/enter_bug.cgi?product=xorg + +All licensing questions regarding this software should be directed at the +Xorg mailing list: + +http://lists.freedesktop.org/mailman/listinfo/xorg diff --git a/driver/xf86-input-mouse/ChangeLog b/driver/xf86-input-mouse/ChangeLog new file mode 100644 index 000000000..b0ff39252 --- /dev/null +++ b/driver/xf86-input-mouse/ChangeLog @@ -0,0 +1,112 @@ +2006-05-15 Matthias Hopf + + * configure.ac,src/mouse.c: + Bump to 1.1.1. + +2006-04-21 Matthias Hopf + + * man/mouse.man: + Fixed default for YAxisMapping. + Changed default for ZAxisMapping. Added short explanation. + * src/mouse.c: (MouseCommonOptions), (MouseReadInput): + Autodetect (one way only) single wheel only for EXPS2. + Use singlebit protocol for multiwheel EXPS2 mice. + +2006-04-20 Matthias Hopf + + * src/mouse.c: (MousePostEvent): + Overhaul of wheel processing. Does work correctly with multibit + zaxis events now. + +2006-04-06 Adam Jackson + + * configure.ac: + * src/mouse.c: + * src/pnp.c: + Unlibcwrap. Bump server version requirement. Bump to 1.1.0. + +2006-03-09 Eric Anholt + + * src/mouse.c: (MouseCommonOptions): + Coverity #875: Correct several memory leaks in options parsing. + +2006-02-28 Adam Jackson + + * configure.ac: + * src/mouse.c: + Bump to 1.0.4. + +2006-02-02 Matthias Hopf + + * man/mouse.man: + Fixed ButtonMapping default. + +2006-01-17 Matthias Hopf + + * src/mouse.c: (MouseDoPostEvent): + Bug #5071: EmulateWheelTimeout didn't work as anticipated. + +2006-01-09 Daniel Stone + + * src/mouse.c: + Remove #ifdef PNP_MOUSE blocks, as it was always defined in the + monolith. + +2005-12-20 Kevin E. Martin + + * configure.ac: + Update package version for X11R7 release. + +2005-12-19 Alan Coopersmith + + * man/mouse.man: + Update URL for mouse docs online. + Add VUID to supported protocols (used on Solaris). + + * README.sgml: + Update docs for X11R6.9 & 7.0 releases. + Add note about new ButtonMapping option. + Explain changes due to "virtual mouse" support in Solaris 10. + Change "mices" to "mice". + +2005-12-14 Kevin E. Martin + + * configure.ac: + * src/mouse.c: + Update package version number for final X11R7 release candidate. + Bump driver version number. + +2005-12-06 Kevin E. Martin + + * man/Makefile.am: + Change *man_SOURCES ==> *man_PRE to fix autotools warnings. + +2005-12-03 Kevin E. Martin + + * configure.ac: + Update package version number for X11R7 RC3 release. + +2005-12-01 Kevin E. Martin + + * configure.ac: + Remove extraneous AC_MSG_RESULT. + +2005-11-29 Adam Jackson + + * configure.ac: + Only build dlloader modules by default. + +2005-11-22 Daniel Stone + + * configure.ac: + Update dependency on xorg-server to >= 0.99.3, for MouseDriverRec changes. + +2005-11-09 Kevin E. Martin + + * configure.ac: + Update package version number for X11R7 RC2 release. + +2005-11-01 Kevin E. Martin + + * configure.ac: + Update pkgcheck dependencies to work with separate build roots. diff --git a/driver/xf86-input-mouse/Makefile.am b/driver/xf86-input-mouse/Makefile.am new file mode 100644 index 000000000..2b6c46aa1 --- /dev/null +++ b/driver/xf86-input-mouse/Makefile.am @@ -0,0 +1,29 @@ +# Copyright 2005 Adam Jackson. +# +# Permission is hereby granted, free of charge, to any person obtaining a +# copy of this software and associated documentation files (the "Software"), +# to deal in the Software without restriction, including without limitation +# on the rights to use, copy, modify, merge, publish, distribute, sub +# license, and/or sell copies of the Software, and to permit persons to whom +# the Software is furnished to do so, subject to the following conditions: +# +# The above copyright notice and this permission notice (including the next +# paragraph) shall be included in all copies or substantial portions of the +# Software. +# +# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +# IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +# FITNESS FOR A PARTICULAR PURPOSE AND NON-INFRINGEMENT. IN NO EVENT SHALL +# ADAM JACKSON BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER +# IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +# CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +AUTOMAKE_OPTIONS = foreign +SUBDIRS = src man + +if BUILD_LINUXDOC +README: README.sgml + $(MAKE_TEXT) README.sgml && mv README.txt README +endif + +EXTRA_DIST = README.sgml diff --git a/driver/xf86-input-mouse/Makefile.in b/driver/xf86-input-mouse/Makefile.in new file mode 100644 index 000000000..1f24b2a47 --- /dev/null +++ b/driver/xf86-input-mouse/Makefile.in @@ -0,0 +1,664 @@ +# Makefile.in generated by automake 1.9.6 from Makefile.am. +# @configure_input@ + +# Copyright (C) 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001, 2002, +# 2003, 2004, 2005 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + +@SET_MAKE@ + +# Copyright 2005 Adam Jackson. +# +# Permission is hereby granted, free of charge, to any person obtaining a +# copy of this software and associated documentation files (the "Software"), +# to deal in the Software without restriction, including without limitation +# on the rights to use, copy, modify, merge, publish, distribute, sub +# license, and/or sell copies of the Software, and to permit persons to whom +# the Software is furnished to do so, subject to the following conditions: +# +# The above copyright notice and this permission notice (including the next +# paragraph) shall be included in all copies or substantial portions of the +# Software. +# +# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +# IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +# FITNESS FOR A PARTICULAR PURPOSE AND NON-INFRINGEMENT. IN NO EVENT SHALL +# ADAM JACKSON BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER +# IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +# CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ +top_builddir = . +am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd +INSTALL = @INSTALL@ +install_sh_DATA = $(install_sh) -c -m 644 +install_sh_PROGRAM = $(install_sh) -c +install_sh_SCRIPT = $(install_sh) -c +INSTALL_HEADER = $(INSTALL_DATA) +transform = $(program_transform_name) +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +build_triplet = @build@ +host_triplet = @host@ +DIST_COMMON = README $(am__configure_deps) $(srcdir)/Makefile.am \ + $(srcdir)/Makefile.in $(srcdir)/config.h.in \ + $(top_srcdir)/configure COPYING ChangeLog config.guess \ + config.sub depcomp install-sh ltmain.sh missing +subdir = . +ACLOCAL_M4 = $(top_srcdir)/aclocal.m4 +am__aclocal_m4_deps = $(top_srcdir)/configure.ac +am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \ + $(ACLOCAL_M4) +am__CONFIG_DISTCLEAN_FILES = config.status config.cache config.log \ + configure.lineno configure.status.lineno +mkinstalldirs = $(install_sh) -d +CONFIG_HEADER = config.h +CONFIG_CLEAN_FILES = +SOURCES = +DIST_SOURCES = +RECURSIVE_TARGETS = all-recursive check-recursive dvi-recursive \ + html-recursive info-recursive install-data-recursive \ + install-exec-recursive install-info-recursive \ + install-recursive installcheck-recursive installdirs-recursive \ + pdf-recursive ps-recursive uninstall-info-recursive \ + uninstall-recursive +ETAGS = etags +CTAGS = ctags +DIST_SUBDIRS = $(SUBDIRS) +DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST) +distdir = $(PACKAGE)-$(VERSION) +top_distdir = $(distdir) +am__remove_distdir = \ + { test ! -d $(distdir) \ + || { find $(distdir) -type d ! -perm -200 -exec chmod u+w {} ';' \ + && rm -fr $(distdir); }; } +DIST_ARCHIVES = $(distdir).tar.gz $(distdir).tar.bz2 +GZIP_ENV = --best +distuninstallcheck_listfiles = find . -type f -print +distcleancheck_listfiles = find . -type f -print +ACLOCAL = @ACLOCAL@ +ADMIN_MAN_DIR = @ADMIN_MAN_DIR@ +ADMIN_MAN_SUFFIX = @ADMIN_MAN_SUFFIX@ +AMDEP_FALSE = @AMDEP_FALSE@ +AMDEP_TRUE = @AMDEP_TRUE@ +AMTAR = @AMTAR@ +APP_MAN_DIR = @APP_MAN_DIR@ +APP_MAN_SUFFIX = @APP_MAN_SUFFIX@ +AR = @AR@ +AUTOCONF = @AUTOCONF@ +AUTOHEADER = @AUTOHEADER@ +AUTOMAKE = @AUTOMAKE@ +AWK = @AWK@ +BUILD_LINUXDOC_FALSE = @BUILD_LINUXDOC_FALSE@ +BUILD_LINUXDOC_TRUE = @BUILD_LINUXDOC_TRUE@ +BUILD_PDFDOC_FALSE = @BUILD_PDFDOC_FALSE@ +BUILD_PDFDOC_TRUE = @BUILD_PDFDOC_TRUE@ +CC = @CC@ +CCDEPMODE = @CCDEPMODE@ +CFLAGS = @CFLAGS@ +CPP = @CPP@ +CPPFLAGS = @CPPFLAGS@ +CXX = @CXX@ +CXXCPP = @CXXCPP@ +CXXDEPMODE = @CXXDEPMODE@ +CXXFLAGS = @CXXFLAGS@ +CYGPATH_W = @CYGPATH_W@ +DEFS = @DEFS@ +DEPDIR = @DEPDIR@ +DRIVER_MAN_DIR = @DRIVER_MAN_DIR@ +DRIVER_MAN_SUFFIX = @DRIVER_MAN_SUFFIX@ +DRIVER_NAME = @DRIVER_NAME@ +ECHO = @ECHO@ +ECHO_C = @ECHO_C@ +ECHO_N = @ECHO_N@ +ECHO_T = @ECHO_T@ +EGREP = @EGREP@ +EXEEXT = @EXEEXT@ +F77 = @F77@ +FFLAGS = @FFLAGS@ +FILE_MAN_DIR = @FILE_MAN_DIR@ +FILE_MAN_SUFFIX = @FILE_MAN_SUFFIX@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@ +LDFLAGS = @LDFLAGS@ +LIBOBJS = @LIBOBJS@ +LIBS = @LIBS@ +LIBTOOL = @LIBTOOL@ +LIB_MAN_DIR = @LIB_MAN_DIR@ +LIB_MAN_SUFFIX = @LIB_MAN_SUFFIX@ +LINUXDOC = @LINUXDOC@ +LN_S = @LN_S@ +LTLIBOBJS = @LTLIBOBJS@ +MAINT = @MAINT@ +MAINTAINER_MODE_FALSE = @MAINTAINER_MODE_FALSE@ +MAINTAINER_MODE_TRUE = @MAINTAINER_MODE_TRUE@ +MAKEINFO = @MAKEINFO@ +MAKE_HTML = @MAKE_HTML@ +MAKE_PDF = @MAKE_PDF@ +MAKE_PS = @MAKE_PS@ +MAKE_TEXT = @MAKE_TEXT@ +MISC_MAN_DIR = @MISC_MAN_DIR@ +MISC_MAN_SUFFIX = @MISC_MAN_SUFFIX@ +OBJEXT = @OBJEXT@ +PACKAGE = @PACKAGE@ +PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@ +PACKAGE_NAME = @PACKAGE_NAME@ +PACKAGE_STRING = @PACKAGE_STRING@ +PACKAGE_TARNAME = @PACKAGE_TARNAME@ +PACKAGE_VERSION = @PACKAGE_VERSION@ +PATH_SEPARATOR = @PATH_SEPARATOR@ +PKG_CONFIG = @PKG_CONFIG@ +PS2PDF = @PS2PDF@ +RANLIB = @RANLIB@ +SED = @SED@ +SET_MAKE = @SET_MAKE@ +SHELL = @SHELL@ +STRIP = @STRIP@ +VERSION = @VERSION@ +XORG_CFLAGS = @XORG_CFLAGS@ +XORG_LIBS = @XORG_LIBS@ +ac_ct_AR = @ac_ct_AR@ +ac_ct_CC = @ac_ct_CC@ +ac_ct_CXX = @ac_ct_CXX@ +ac_ct_F77 = @ac_ct_F77@ +ac_ct_RANLIB = @ac_ct_RANLIB@ +ac_ct_STRIP = @ac_ct_STRIP@ +ac_pt_PKG_CONFIG = @ac_pt_PKG_CONFIG@ +am__fastdepCC_FALSE = @am__fastdepCC_FALSE@ +am__fastdepCC_TRUE = @am__fastdepCC_TRUE@ +am__fastdepCXX_FALSE = @am__fastdepCXX_FALSE@ +am__fastdepCXX_TRUE = @am__fastdepCXX_TRUE@ +am__include = @am__include@ +am__leading_dot = @am__leading_dot@ +am__quote = @am__quote@ +am__tar = @am__tar@ +am__untar = @am__untar@ +bindir = @bindir@ +build = @build@ +build_alias = @build_alias@ +build_cpu = @build_cpu@ +build_os = @build_os@ +build_vendor = @build_vendor@ +datadir = @datadir@ +exec_prefix = @exec_prefix@ +host = @host@ +host_alias = @host_alias@ +host_cpu = @host_cpu@ +host_os = @host_os@ +host_vendor = @host_vendor@ +includedir = @includedir@ +infodir = @infodir@ +inputdir = @inputdir@ +install_sh = @install_sh@ +libdir = @libdir@ +libexecdir = @libexecdir@ +localstatedir = @localstatedir@ +mandir = @mandir@ +mkdir_p = @mkdir_p@ +oldincludedir = @oldincludedir@ +prefix = @prefix@ +program_transform_name = @program_transform_name@ +sbindir = @sbindir@ +sharedstatedir = @sharedstatedir@ +sysconfdir = @sysconfdir@ +target_alias = @target_alias@ +AUTOMAKE_OPTIONS = foreign +SUBDIRS = src man +EXTRA_DIST = README.sgml +all: config.h + $(MAKE) $(AM_MAKEFLAGS) all-recursive + +.SUFFIXES: +am--refresh: + @: +$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(am__configure_deps) + @for dep in $?; do \ + case '$(am__configure_deps)' in \ + *$$dep*) \ + echo ' cd $(srcdir) && $(AUTOMAKE) --foreign '; \ + cd $(srcdir) && $(AUTOMAKE) --foreign \ + && exit 0; \ + exit 1;; \ + esac; \ + done; \ + echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign Makefile'; \ + cd $(top_srcdir) && \ + $(AUTOMAKE) --foreign Makefile +.PRECIOUS: Makefile +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + @case '$?' in \ + *config.status*) \ + echo ' $(SHELL) ./config.status'; \ + $(SHELL) ./config.status;; \ + *) \ + echo ' cd $(top_builddir) && $(SHELL) ./config.status $@ $(am__depfiles_maybe)'; \ + cd $(top_builddir) && $(SHELL) ./config.status $@ $(am__depfiles_maybe);; \ + esac; + +$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES) + $(SHELL) ./config.status --recheck + +$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps) + cd $(srcdir) && $(AUTOCONF) +$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps) + cd $(srcdir) && $(ACLOCAL) $(ACLOCAL_AMFLAGS) + +config.h: stamp-h1 + @if test ! -f $@; then \ + rm -f stamp-h1; \ + $(MAKE) stamp-h1; \ + else :; fi + +stamp-h1: $(srcdir)/config.h.in $(top_builddir)/config.status + @rm -f stamp-h1 + cd $(top_builddir) && $(SHELL) ./config.status config.h +$(srcdir)/config.h.in: @MAINTAINER_MODE_TRUE@ $(am__configure_deps) + cd $(top_srcdir) && $(AUTOHEADER) + rm -f stamp-h1 + touch $@ + +distclean-hdr: + -rm -f config.h stamp-h1 + +mostlyclean-libtool: + -rm -f *.lo + +clean-libtool: + -rm -rf .libs _libs + +distclean-libtool: + -rm -f libtool +uninstall-info-am: + +# This directory's subdirectories are mostly independent; you can cd +# into them and run `make' without going through this Makefile. +# To change the values of `make' variables: instead of editing Makefiles, +# (1) if the variable is set in `config.status', edit `config.status' +# (which will cause the Makefiles to be regenerated when you run `make'); +# (2) otherwise, pass the desired values on the `make' command line. +$(RECURSIVE_TARGETS): + @failcom='exit 1'; \ + for f in x $$MAKEFLAGS; do \ + case $$f in \ + *=* | --[!k]*);; \ + *k*) failcom='fail=yes';; \ + esac; \ + done; \ + dot_seen=no; \ + target=`echo $@ | sed s/-recursive//`; \ + list='$(SUBDIRS)'; for subdir in $$list; do \ + echo "Making $$target in $$subdir"; \ + if test "$$subdir" = "."; then \ + dot_seen=yes; \ + local_target="$$target-am"; \ + else \ + local_target="$$target"; \ + fi; \ + (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$local_target) \ + || eval $$failcom; \ + done; \ + if test "$$dot_seen" = "no"; then \ + $(MAKE) $(AM_MAKEFLAGS) "$$target-am" || exit 1; \ + fi; test -z "$$fail" + +mostlyclean-recursive clean-recursive distclean-recursive \ +maintainer-clean-recursive: + @failcom='exit 1'; \ + for f in x $$MAKEFLAGS; do \ + case $$f in \ + *=* | --[!k]*);; \ + *k*) failcom='fail=yes';; \ + esac; \ + done; \ + dot_seen=no; \ + case "$@" in \ + distclean-* | maintainer-clean-*) list='$(DIST_SUBDIRS)' ;; \ + *) list='$(SUBDIRS)' ;; \ + esac; \ + rev=''; for subdir in $$list; do \ + if test "$$subdir" = "."; then :; else \ + rev="$$subdir $$rev"; \ + fi; \ + done; \ + rev="$$rev ."; \ + target=`echo $@ | sed s/-recursive//`; \ + for subdir in $$rev; do \ + echo "Making $$target in $$subdir"; \ + if test "$$subdir" = "."; then \ + local_target="$$target-am"; \ + else \ + local_target="$$target"; \ + fi; \ + (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$local_target) \ + || eval $$failcom; \ + done && test -z "$$fail" +tags-recursive: + list='$(SUBDIRS)'; for subdir in $$list; do \ + test "$$subdir" = . || (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) tags); \ + done +ctags-recursive: + list='$(SUBDIRS)'; for subdir in $$list; do \ + test "$$subdir" = . || (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) ctags); \ + done + +ID: $(HEADERS) $(SOURCES) $(LISP) $(TAGS_FILES) + list='$(SOURCES) $(HEADERS) $(LISP) $(TAGS_FILES)'; \ + unique=`for i in $$list; do \ + if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \ + done | \ + $(AWK) ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + mkid -fID $$unique +tags: TAGS + +TAGS: tags-recursive $(HEADERS) $(SOURCES) config.h.in $(TAGS_DEPENDENCIES) \ + $(TAGS_FILES) $(LISP) + tags=; \ + here=`pwd`; \ + if ($(ETAGS) --etags-include --version) >/dev/null 2>&1; then \ + include_option=--etags-include; \ + empty_fix=.; \ + else \ + include_option=--include; \ + empty_fix=; \ + fi; \ + list='$(SUBDIRS)'; for subdir in $$list; do \ + if test "$$subdir" = .; then :; else \ + test ! -f $$subdir/TAGS || \ + tags="$$tags $$include_option=$$here/$$subdir/TAGS"; \ + fi; \ + done; \ + list='$(SOURCES) $(HEADERS) config.h.in $(LISP) $(TAGS_FILES)'; \ + unique=`for i in $$list; do \ + if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \ + done | \ + $(AWK) ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + if test -z "$(ETAGS_ARGS)$$tags$$unique"; then :; else \ + test -n "$$unique" || unique=$$empty_fix; \ + $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \ + $$tags $$unique; \ + fi +ctags: CTAGS +CTAGS: ctags-recursive $(HEADERS) $(SOURCES) config.h.in $(TAGS_DEPENDENCIES) \ + $(TAGS_FILES) $(LISP) + tags=; \ + here=`pwd`; \ + list='$(SOURCES) $(HEADERS) config.h.in $(LISP) $(TAGS_FILES)'; \ + unique=`for i in $$list; do \ + if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \ + done | \ + $(AWK) ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + test -z "$(CTAGS_ARGS)$$tags$$unique" \ + || $(CTAGS) $(CTAGSFLAGS) $(AM_CTAGSFLAGS) $(CTAGS_ARGS) \ + $$tags $$unique + +GTAGS: + here=`$(am__cd) $(top_builddir) && pwd` \ + && cd $(top_srcdir) \ + && gtags -i $(GTAGS_ARGS) $$here + +distclean-tags: + -rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags + +distdir: $(DISTFILES) + $(am__remove_distdir) + mkdir $(distdir) + @srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`; \ + topsrcdirstrip=`echo "$(top_srcdir)" | sed 's|.|.|g'`; \ + list='$(DISTFILES)'; for file in $$list; do \ + case $$file in \ + $(srcdir)/*) file=`echo "$$file" | sed "s|^$$srcdirstrip/||"`;; \ + $(top_srcdir)/*) file=`echo "$$file" | sed "s|^$$topsrcdirstrip/|$(top_builddir)/|"`;; \ + esac; \ + if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \ + dir=`echo "$$file" | sed -e 's,/[^/]*$$,,'`; \ + if test "$$dir" != "$$file" && test "$$dir" != "."; then \ + dir="/$$dir"; \ + $(mkdir_p) "$(distdir)$$dir"; \ + else \ + dir=''; \ + fi; \ + if test -d $$d/$$file; then \ + if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \ + cp -pR $(srcdir)/$$file $(distdir)$$dir || exit 1; \ + fi; \ + cp -pR $$d/$$file $(distdir)$$dir || exit 1; \ + else \ + test -f $(distdir)/$$file \ + || cp -p $$d/$$file $(distdir)/$$file \ + || exit 1; \ + fi; \ + done + list='$(DIST_SUBDIRS)'; for subdir in $$list; do \ + if test "$$subdir" = .; then :; else \ + test -d "$(distdir)/$$subdir" \ + || $(mkdir_p) "$(distdir)/$$subdir" \ + || exit 1; \ + distdir=`$(am__cd) $(distdir) && pwd`; \ + top_distdir=`$(am__cd) $(top_distdir) && pwd`; \ + (cd $$subdir && \ + $(MAKE) $(AM_MAKEFLAGS) \ + top_distdir="$$top_distdir" \ + distdir="$$distdir/$$subdir" \ + distdir) \ + || exit 1; \ + fi; \ + done + -find $(distdir) -type d ! -perm -777 -exec chmod a+rwx {} \; -o \ + ! -type d ! -perm -444 -links 1 -exec chmod a+r {} \; -o \ + ! -type d ! -perm -400 -exec chmod a+r {} \; -o \ + ! -type d ! -perm -444 -exec $(SHELL) $(install_sh) -c -m a+r {} {} \; \ + || chmod -R a+r $(distdir) +dist-gzip: distdir + tardir=$(distdir) && $(am__tar) | GZIP=$(GZIP_ENV) gzip -c >$(distdir).tar.gz + $(am__remove_distdir) +dist-bzip2: distdir + tardir=$(distdir) && $(am__tar) | bzip2 -9 -c >$(distdir).tar.bz2 + $(am__remove_distdir) + +dist-tarZ: distdir + tardir=$(distdir) && $(am__tar) | compress -c >$(distdir).tar.Z + $(am__remove_distdir) + +dist-shar: distdir + shar $(distdir) | GZIP=$(GZIP_ENV) gzip -c >$(distdir).shar.gz + $(am__remove_distdir) + +dist-zip: distdir + -rm -f $(distdir).zip + zip -rq $(distdir).zip $(distdir) + $(am__remove_distdir) + +dist dist-all: distdir + tardir=$(distdir) && $(am__tar) | GZIP=$(GZIP_ENV) gzip -c >$(distdir).tar.gz + tardir=$(distdir) && $(am__tar) | bzip2 -9 -c >$(distdir).tar.bz2 + $(am__remove_distdir) + +# This target untars the dist file and tries a VPATH configuration. Then +# it guarantees that the distribution is self-contained by making another +# tarfile. +distcheck: dist + case '$(DIST_ARCHIVES)' in \ + *.tar.gz*) \ + GZIP=$(GZIP_ENV) gunzip -c $(distdir).tar.gz | $(am__untar) ;;\ + *.tar.bz2*) \ + bunzip2 -c $(distdir).tar.bz2 | $(am__untar) ;;\ + *.tar.Z*) \ + uncompress -c $(distdir).tar.Z | $(am__untar) ;;\ + *.shar.gz*) \ + GZIP=$(GZIP_ENV) gunzip -c $(distdir).shar.gz | unshar ;;\ + *.zip*) \ + unzip $(distdir).zip ;;\ + esac + chmod -R a-w $(distdir); chmod a+w $(distdir) + mkdir $(distdir)/_build + mkdir $(distdir)/_inst + chmod a-w $(distdir) + dc_install_base=`$(am__cd) $(distdir)/_inst && pwd | sed -e 's,^[^:\\/]:[\\/],/,'` \ + && dc_destdir="$${TMPDIR-/tmp}/am-dc-$$$$/" \ + && cd $(distdir)/_build \ + && ../configure --srcdir=.. --prefix="$$dc_install_base" \ + $(DISTCHECK_CONFIGURE_FLAGS) \ + && $(MAKE) $(AM_MAKEFLAGS) \ + && $(MAKE) $(AM_MAKEFLAGS) dvi \ + && $(MAKE) $(AM_MAKEFLAGS) check \ + && $(MAKE) $(AM_MAKEFLAGS) install \ + && $(MAKE) $(AM_MAKEFLAGS) installcheck \ + && $(MAKE) $(AM_MAKEFLAGS) uninstall \ + && $(MAKE) $(AM_MAKEFLAGS) distuninstallcheck_dir="$$dc_install_base" \ + distuninstallcheck \ + && chmod -R a-w "$$dc_install_base" \ + && ({ \ + (cd ../.. && umask 077 && mkdir "$$dc_destdir") \ + && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" install \ + && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" uninstall \ + && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" \ + distuninstallcheck_dir="$$dc_destdir" distuninstallcheck; \ + } || { rm -rf "$$dc_destdir"; exit 1; }) \ + && rm -rf "$$dc_destdir" \ + && $(MAKE) $(AM_MAKEFLAGS) dist \ + && rm -rf $(DIST_ARCHIVES) \ + && $(MAKE) $(AM_MAKEFLAGS) distcleancheck + $(am__remove_distdir) + @(echo "$(distdir) archives ready for distribution: "; \ + list='$(DIST_ARCHIVES)'; for i in $$list; do echo $$i; done) | \ + sed -e '1{h;s/./=/g;p;x;}' -e '$${p;x;}' +distuninstallcheck: + @cd $(distuninstallcheck_dir) \ + && test `$(distuninstallcheck_listfiles) | wc -l` -le 1 \ + || { echo "ERROR: files left after uninstall:" ; \ + if test -n "$(DESTDIR)"; then \ + echo " (check DESTDIR support)"; \ + fi ; \ + $(distuninstallcheck_listfiles) ; \ + exit 1; } >&2 +distcleancheck: distclean + @if test '$(srcdir)' = . ; then \ + echo "ERROR: distcleancheck can only run from a VPATH build" ; \ + exit 1 ; \ + fi + @test `$(distcleancheck_listfiles) | wc -l` -eq 0 \ + || { echo "ERROR: files left in build directory after distclean:" ; \ + $(distcleancheck_listfiles) ; \ + exit 1; } >&2 +check-am: all-am +check: check-recursive +all-am: Makefile config.h +installdirs: installdirs-recursive +installdirs-am: +install: install-recursive +install-exec: install-exec-recursive +install-data: install-data-recursive +uninstall: uninstall-recursive + +install-am: all-am + @$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am + +installcheck: installcheck-recursive +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \ + install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \ + `test -z '$(STRIP)' || \ + echo "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'"` install +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES) + +maintainer-clean-generic: + @echo "This command is intended for maintainers to use" + @echo "it deletes files that may require special tools to rebuild." +clean: clean-recursive + +clean-am: clean-generic clean-libtool mostlyclean-am + +distclean: distclean-recursive + -rm -f $(am__CONFIG_DISTCLEAN_FILES) + -rm -f Makefile +distclean-am: clean-am distclean-generic distclean-hdr \ + distclean-libtool distclean-tags + +dvi: dvi-recursive + +dvi-am: + +html: html-recursive + +info: info-recursive + +info-am: + +install-data-am: + +install-exec-am: + +install-info: install-info-recursive + +install-man: + +installcheck-am: + +maintainer-clean: maintainer-clean-recursive + -rm -f $(am__CONFIG_DISTCLEAN_FILES) + -rm -rf $(top_srcdir)/autom4te.cache + -rm -f Makefile +maintainer-clean-am: distclean-am maintainer-clean-generic + +mostlyclean: mostlyclean-recursive + +mostlyclean-am: mostlyclean-generic mostlyclean-libtool + +pdf: pdf-recursive + +pdf-am: + +ps: ps-recursive + +ps-am: + +uninstall-am: uninstall-info-am + +uninstall-info: uninstall-info-recursive + +.PHONY: $(RECURSIVE_TARGETS) CTAGS GTAGS all all-am am--refresh check \ + check-am clean clean-generic clean-libtool clean-recursive \ + ctags ctags-recursive dist dist-all dist-bzip2 dist-gzip \ + dist-shar dist-tarZ dist-zip distcheck distclean \ + distclean-generic distclean-hdr distclean-libtool \ + distclean-recursive distclean-tags distcleancheck distdir \ + distuninstallcheck dvi dvi-am html html-am info info-am \ + install install-am install-data install-data-am install-exec \ + install-exec-am install-info install-info-am install-man \ + install-strip installcheck installcheck-am installdirs \ + installdirs-am maintainer-clean maintainer-clean-generic \ + maintainer-clean-recursive mostlyclean mostlyclean-generic \ + mostlyclean-libtool mostlyclean-recursive pdf pdf-am ps ps-am \ + tags tags-recursive uninstall uninstall-am uninstall-info-am + + +@BUILD_LINUXDOC_TRUE@README: README.sgml +@BUILD_LINUXDOC_TRUE@ $(MAKE_TEXT) README.sgml && mv README.txt README +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/driver/xf86-input-mouse/README b/driver/xf86-input-mouse/README new file mode 100644 index 000000000..0ba8f7bc3 --- /dev/null +++ b/driver/xf86-input-mouse/README @@ -0,0 +1,1278 @@ + Mouse Support in X11R6.8 + Kazutaka Yokota + 17 December 2002 + ____________________________________________________________ + + Table of Contents + + + 1. Introduction + 2. Supported Hardware + 3. OS Support for Mice + 3.1 Summary of Supported Mouse Protocol Types + 3.2 BSD/OS + 3.3 FreeBSD + 3.4 FreeBSD(98) + 3.5 Interactive Unix + 3.6 Linux + 3.7 Linux/98 + 3.8 LynxOS + 3.9 NetBSD + 3.10 NetBSD/pc98 + 3.11 OpenBSD + 3.12 OS/2 + 3.13 SCO + 3.14 Solaris + 3.15 SVR4 + 3.16 PANIX + + 4. Configuring Your Mouse + 5. xorg.conf Options + 5.1 Buttons + 5.2 ZAxisMappping + 5.3 Resolution + 5.4 Drag Lock Buttons + + 6. Mouse Gallery + 6.1 MS IntelliMouse (serial, PS/2) + 6.2 MS IntelliMouse Explorer (PS/2, USB) + 6.3 Kensington Thinking Mouse and Kensington Expert Mouse (serial, PS/2) + 6.4 Genius NetScroll (PS/2) + 6.5 Genius NetMouse and NetMouse Pro (serial, PS/2) + 6.6 Genius NetScroll Optical (PS/2, USB) + 6.7 ALPS GlidePoint (serial, PS/2) + 6.8 ASCII MieMouse (serial, PS/2) + 6.9 Logitech MouseMan+ and FirstMouse+ (serial, PS/2) + 6.10 IBM ScrollPoint (PS/2) + 6.11 8D ScrollMouse (serial, PS/2) + 6.12 A4 Tech 4D mice (serial, PS/2, USB) + + 7. Configuration Examples + + + ______________________________________________________________________ + + 1. Introduction + + + This document describes mouse support in X.org Foundation's X11R6.8 + server. + + Mouse configuration has often been mysterious task for novice users. + However, once you learn several basics, it is straightforward to write + the mouse "InputDevice" section in the xorg.conf file by hand. + + + + 2. Supported Hardware + + + The X.org Foundation X server supports three classes of mice: serial, + bus and PS/2 mice. + + + Serial mouse + The serial mouse has been the most popular pointing device for + PCs. There have been numerous serial mouse models from a number + of manufactures. Despite the wide range of variations, there + have been relatively few protocols (data format) with which the + serial mouse talks to the host computer. + + The modern serial mouse conforms to the PnP COM device + specification so that the host computer can automatically detect + the mouse and load an appropriate driver. The X server supports + this specification and can detect popular PnP serial mouse + models on most platforms. + + + Bus mouse + The bus mouse connects to a dedicated interface card in an + expansion slot. Some video cards, notably those from ATI, and + integrated I/O cards may also have a bus mouse connector. Some + bus mice are known as `InPort mouse'. + + Note that some mouse manufactures have sold a package including + a serial mouse and a serial interface card. Don't confuse this + type of products with the genuine bus mouse. + + + PS/2 mouse + They are sometimes called `Mouse-port mouse'. The PS/2 mouse is + becoming increasingly common and popular. + + The PS/2 mouse is an intelligent device and may have more than + three buttons and a wheel or a roller. The PS/2 mouse is + usually compatible with the original PS/2 mouse from IBM + immediately after power up. The PS/2 mouse with additional + features requires a specialized initialization procedure to + enable these features. Without proper initialization, it + behaves as though it were an ordinary two or three button mouse. + + + USB mouse + USB (Universal Serial Bus) ports are present on most modern + computers. Several devices can be plugged into this bus, + including mices and keyboards. + + The server includes support for USB mices on some systems. + + Many mice nowadays can be used both as a serial mouse and as a PS/2 + mouse. They has a logic to distinguish which interface it is + connected to. However, the mouse which is not marketed as compatible + with both serial and PS/2 mouse interface lacks this logic and cannot + be used in such a way, even if you can find an appropriate adapter + with which you can connect the PS/2 mouse to a serial port or visa + versa. + + X11R6.8 supports the mouse with a wheel, a roller or a knob. Its + action is detected as the Z (third) axis motion of the mouse. As the + X server or clients normally do not use the Z axis movement of the + pointing device, a configuration option, "ZAxisMapping", is provided + to assign the Z axis movement to another axis or a pair of buttons + (see below). + 3. OS Support for Mice + + + + 3.1. Summary of Supported Mouse Protocol Types + + + Protocol Types + serial PnP BusMouse PS/2 Extended PS/2 + OS platforms protocols serial protocol protocol protocols + "Auto" "BusMouse" "PS/2" "xxxPS/2" USB + ------------------------------------------------------------------------- + BSD/OS Ok ? ? ? ? ? + FreeBSD Ok Ok Ok Ok SP*1 SP*1 + FreeBSD(98) Ok ? Ok NA NA ? + Interactive Unix Ok NA ?*1 ?*1 NA ? + Linux Ok Ok Ok Ok Ok ? + Linux/98 Ok ? Ok NA NA ? + LynxOS Ok NA Ok Ok NA ? + NetBSD Ok Ok Ok SP*1 SP*1 SP*1 + NetBSD/pc98 Ok ? Ok NA NA NA + OpenBSD Ok Ok Ok Ok*1 Ok*1 Ok*1 + OS/2 SP*2 SP*2 SP*2 SP*2 SP*2 ? + SCO Ok ? SP*1 SP*1 NA ? + Solaris 2.x Ok NA*1 ?*1 Ok Ok SP*1 + SVR4 Ok NA*1 SP*1 SP*1 NA ? + PANIX Ok ? SP*1 SP*1 NA ? + + Ok: support is available, NA: not available, ?: untested or unknown. + SP: support is available in a different form + + *1 Refer to the following sections for details. + *2 X11R6.8/OS2 will support any type of mouse that the OS supports, + whether it is serial, bus mouse, or PnP type. + + + + 3.2. BSD/OS + + No testing has been done with BSD/OS. + + + 3.3. FreeBSD + + FreeBSD supports the "SysMouse" protocol which must be specified when + the moused daemon is running in versions 2.2.1 or later. + + When running the mouseddaemon, you must always specify the + /dev/sysmouse device and the "SysMouse" protocol to the X server, + regardless of the actual type of your mouse. + + FreeBSD versions 2.2.6 or later include the kernel-level support for + extended PS/2 mouse protocols and there is no need to specify the + exact protocol name to the X server. Instead specify the "PS/2" or + "Auto" protocol and the X server will automatically make use of the + kernel-level support. + + In fact, "Auto" protocol support is really efficient in these + versions. You may always specify "Auto" to any mouse, serial, bus or + PS/2, unless the mouse is an old serial model which doesn't support + PnP. + + FreeBSD versions 2.2.5 or earlier do not support extended PS/2 mouse + protocols ("xxxPS/2"). Always specify the "PS/2" protocol for any + PS/2 mouse in these versions regardless of the brand of the mouse. + FreeBSD versions 3.1 or later have support for USB mice. Specify the + "Auto" protocol for the /dev/ums0 device. (If the moused daemon is + running for the USB mouse, you must use /dev/sysmouse instead of + /dev/ums0 as explained above.) See the ums(4) manual page for details. + + + 3.4. FreeBSD(98) + + The PS/2 mouse is not supported. + + + 3.5. Interactive Unix + + The PnP serial mouse support (the "Auto" protocol) is not supported + for the moment. + + The bus mouse and PS/2 mouse should be supported by using the + appropriate device drivers. Use /dev/mouse for the "BusMouse" + protocol and /dev/kdmouse for the "PS/2" protocol. These protocols + are untested but may work. Please send success/failure reports to + . + + + 3.6. Linux + + All protocol types should work. + + + 3.7. Linux/98 + + The PS/2 mouse is not supported. + + + 3.8. LynxOS + + The PnP serial mouse support (the "Auto" protocol) is disabled in + LynxOS, because of limited TTY device driver functionality. + + + 3.9. NetBSD + + NetBSD 1.3.x and former does not support extended PS/2 mouse protocols + ("xxxPS/2"). The PS/2 mouse device driver /dev/pms emulates the bus + mouse. Therefore, you should always specify the "BusMouse" protocol + for any PS/2 mouse regardless of the brand of the mouse. + + The "wsmouse" protocol introduced in NetBSD 1.4 along with the wscons + console driver is supported. You need to run binaries compiled on + NetBSD 1.4 to have support for it though. Use "/dev/wsmouse0" for the + device. Refer to the wsmouse(4) manual page for kernel configuration + informations. + + This driver also provides support for USB mices. See the ums(4) manual + page for details. + + + 3.10. NetBSD/pc98 + + The PS/2 mouse is not supported. + + + 3.11. OpenBSD + + The raw PS/2 mouse device driver /dev/psm0 uses the raw PS/2 mouse + protocol. + + OpenBSD 2.2 and earlier does not support extended PS/2 mouse protocols + ("xxxPS/2") . Therefore, you should specify the "PS/2" protocol for + any PS/2 mouse regardless of the brand of the mouse. + + OpenBSD 2.3 and later support all extended PS/2 mouse protocols. You + can select the "Auto" protocol for PnP PS/2 mice or any specific + extended ("xxxPS/2") protocol for non PnP mice. + + There is also a cooked PS/2 mouse device driver /dev/pms0 which + emulates the bus mouse. Specify the "BusMouse" protocol for any PS/2 + mouse regardless of the brand of the mouse when using this device. + + XFree86 3.3.6 support USB mices on OpenBSD 2.6 and later though the + generic Human Interface Device (hid) /dev/uhid*. Select the "usb" + protocol and the /dev/uhid* instance corresponding to your mouse as + the device name. + + + 3.12. OS/2 + + X11R6.8/OS2 always uses the native mouse driver of the operating + system and will support any type of pointer that the OS supports, + whether it is serial, bus mouse, or PnP type. If the mouse works + under Presentation Manager, it will also work under X11R6.8/OS2. + + Always specify "OSMouse" as the protocol type. + + + 3.13. SCO + + The bus and PS/2 mouse are supported with the "OSMouse" protocol type. + + The "OSMouse" may also be used with the serial mouse. + + + 3.14. Solaris + + Testing has been done with Solaris 2.5.1, 2.6, 7, 8, 9 and pre-release + versions of Solaris 10. Logitech and Microsoft bus mice have not been + tested, but might work with the /dev/logi and /dev/msm devices. + Standard 2 and 3 button PS/2 mice work with the "PS/2" protocol type + and the /dev/kdmouse device. USB mice work with the "VUID" protocol + type and the /dev/mouse device. The PnP serial mouse support (the + "Auto" protocol) has been tested and does not work. The "Auto" + protocol can however detect PS/2 and USB mice correctly. + + Additional USB mice can be connected using the "VUID" protocol type + and the appropriate "/dev/usb/hid" device with the Option + "StreamsModule" "usbms" line included in the associated "InputDevice" + section. + + + 3.15. SVR4 + + The bus and PS/2 mouse may be supported with the "Xqueue" protocol + type. + + The "Xqueue" may also be used with the serial mouse. + + The PnP serial mouse support (the "Auto" protocol) is not tested. + + + 3.16. PANIX + + The PC/AT version of PANIX supports the bus and PS/2 mouse with the + "Xqueue" protocol type. The PC-98 version of PANIX supports the bus + mouse with the "Xqueue" protocol type. + + + 4. Configuring Your Mouse + + + Before using the xorgconfig program to set up mouse configuration, you + must identify the interface type, the device name and the protocol + type of your mouse. Blindly trying every possible combination of + mouse settings will lead you nowhere. + + The first thing you need to know is the interface type of the mouse + you are going to use. It can be determined by looking at the + connector of the mouse. The serial mouse has a D-Sub female 9- or + 25-pin connector. The bus mice have either a D-Sub male 9-pin + connector or a round DIN 9-pin connector. The PS/2 mouse is equipped + with a small, round DIN 6-pin connector. Some mice come with adapters + with which the connector can be converted to another. If you are to + use such an adapter, remember that the connector at the very end of + the mouse/adapter pair is what matters. + + The next thing to decide is a device node to use for the given + interface. For the bus and PS/2 mice, there is little choice; your OS + most possibly offers just one device node each for the bus mouse and + PS/2 mouse. There may be more than one serial port to which the + serial mouse can be attached. + + The next step is to guess the appropriate protocol type for the mouse. + The X server may be able to select a protocol type for the given mouse + automatically in some cases. Otherwise, the user has to choose one + manually. Follow the guidelines below. + + + Bus mouse + The bus and InPort mice always use "BusMouse" protocol + regardless of the brand of the mouse. + + Some OSs may allow you to specify "Auto" as the protocol type + for the bus mouse. + + + PS/2 mouse + The "PS/2" protocol should always be tried first for the PS/2 + mouse regardless of the brand of the mouse. Any PS/2 mouse + should work with this protocol type, although wheels and other + additional features are unavailable in the X server. + + After verifying the mouse works with this protocol, you may + choose to specify one of "xxxPS/2" protocols so that extra + features are made available in the X server. However, support + for these PS/2 mice assumes certain behavior of the underlying + OS and may not always work as expected. Support for some PS/2 + mouse models may be disabled all together for some OS platforms + for this reason. + + Some OSs may allow you to specify "Auto" as the protocol type + for the PS/2 mouse and the X server will automatically adjust + itself. + + + Serial mouse + The server supports a wide range of mice, both old and new. If + your mouse is of a relatively new model, it may conform to the + PnP COM device specification and the X server may be able to + detect an appropriate protocol type for the mouse automatically. + + Specify "Auto" as the protocol type and start the X server. If + the mouse is not a PnP mouse, or the X server cannot determine a + suitable protocol type, the server will print the following + error message and abort. + + + : cannot determine the mouse protocol + + + + If the X server generates the above error message, you need to + manually specify a protocol type for your mouse. Choose one from + the following list: + + + +o GlidePoint + + +o IntelliMouse + + +o Logitech + + +o Microsoft + + +o MMHittab + + +o MMSeries + + +o MouseMan + + +o MouseSystems + + +o ThinkingMouse + + When you choose, keep in mind the following rule of thumb: + + + 1. "Logitech" protocol is for old serial mouse models from + Logitech. Modern Logitech mice use either "MouseMan" or + "Microsoft" protocol. + + 2. Most 2-button serial mice support the "Microsoft" protocol. + + 3. 3-button serial mice may work with the "Mousesystems" + protocol. If it doesn't, it may work instead with the + "Microsoft" protocol although the third (middle) button won't + function. 3-button serial mice may also work with the + "Mouseman" protocol under which the third button may function + as expected. + + 4. 3-button serial mice may have a small switch at the bottom of + the mouse to choose between ``MS'' and ``PC'', or ``2'' and + ``3''. ``MS'' or ``2'' usually mean the "Microsoft" + protocol. ``PC'' or ``3'' will choose the "MouseSystems" + protocol. + + 5. If the serial mouse has a roller or a wheel, it may be + compatible with the "IntelliMouse" protocol. + + 6. If the serial mouse has a roller or a wheel and it doesn't + work with the "IntelliMouse" protocol, you have to use it as + a regular 2- or 3-button serial mouse. + + If the "Auto" protocol is specified and the mouse seems working, + but you find that not all features of the mouse is available, that + is because the X server does not have native support for that model + of mouse and is using a ``compatible'' protocol according to PnP + information. + + If you suspect this is the case with your mouse, please enter a + bugreport in bugzilla.freedesktop.org, using the xorg product. + + + USB mouse + If your mouse is connected to the USB port, it can either be + supported by the "Auto" protocol, or by an OS-specific protocol + (see below), or as a generic Human Interface Device by the "usb" + protocol. + + + Standardized protocols + Mouse device drivers in your OS may use the standardized + protocol regardless of the model or the class of the mouse. For + example, SVR4 systems may support "Xqueue" protocol. In FreeBSD + the system mouse device /dev/sysmouse uses the "SysMouse" + protocol. Please refer to the OS support section of this file + for more information. + + + + 5. xorg.conf Options + + + The old Pointer section has been replaced by a more general + InputDevice section. The following is a minimal example of an + InputDevice section for a mouse: + + + ______________________________________________________________________ + Section "InputDevice" + Identifier "Mouse 1" + Driver "mouse" + Option "Device" "/dev/mouse" + Option "Protocol" "Auto" + EndSection + ______________________________________________________________________ + + + + The mouse driver supports the following config file options: + + + 5.1. Buttons + + This option tells the X server the number of buttons on the mouse. + Currently there is no reliable way to automatically detect the correct + number. This option is the only means for the X server to obtain it. + The default value is three. + + Note that if you intend to assign Z axis movement to button events + using the ZAxisMapping option below, you need to take account of those + buttons into N too. + + + Option "Buttons" "N" + + + + 5.2. ZAxisMappping + + This option maps the Z axis (wheel) motion to buttons or to another + axis. + Option "ZAxisMapping" "X" + Option "ZAxisMapping" "Y" + Option "ZAxisMapping" "N1 N2" + Option "ZAxisMapping" "N1 N2 N3 N4" + + + + The first example will map the Z axis motion to the X axis motion. + Whenever the user moves the wheel/roller, its movement is reported as + the X axis motion. When the wheel/roller stays still, the real X axis + motion is reported as is. The third example will map negative Z axis + motion to the button N1 and positive Z axis motion to the button N2. + If this option is used and the buttons N1 or N2 actually exists in the + mouse, their actions won't be detected by the X server. + + The last example is useful for the mouse with two wheels of which the + second wheel is used to generate horizontal scroll action, and the + mouse which has a knob or a stick which can detect the horizontal + force applied by the user. The motion of the second wheel will be + mapped to the buttons N3, for the negative direction, and N4, for the + positive direction. If the buttons N3 and N4 actually exist in this + mouse, their actions won't be detected by the X server. + + NOTE #1: horizontal movement may not always be detected by the current + version of the X11R6.8 X servers, because there appears to be no + accepted standard as to how the horizontal direction is encoded in + mouse data. + + NOTE #2: Some mice think left is the negative horizontal direction, + others may think otherwise. Moreover, there are some mice whose two + wheels are both mounted vertically, and the direction of the second + vertical wheel does not match the first one's. + + You need to edit the xorg.conf file by hand to change this option if + the default value of "4 5 6 7" does not match the needs of your + configuration. + + + 5.3. Resolution + + The following option will set the mouse device resolution to N counts + per inch, if possible: + + + Option "Resolution" "N" + + + + Not all mice and OSs can support this option. + + + 5.4. Drag Lock Buttons + + Some people find it difficult or inconvenient to hold a trackball + button down, while at the same time moving the ball. Drag lock buttons + simulate the holding down of another button. When a drag lock button + is first pressed, its target buttons is "locked" down until the + second time the lock button is released, or until the button itself is + pressed and released. This allows the starting of a drag, the movement + of the trackball, and the ending of the drag to be separate + operations. + + + Option "DragLockButtons" "W X Y Z" + + + This option consists of pairs of buttons. Each lock button number is + followed by the number of the button that it locks. In the above, + button number "W" is a drag lock button for button "X" and button + number "Y" is a drag lock button for button "Z". + + It may not be desirable to use multiple buttons as drag locks. + Instead, a "master drag lock button" may be defined. A master drag + lock button acts as a "META" key. After a master lock button is + released, the next button pressed is "locked" and not released until + the second time the real button is released. + + + Option "DragLockButtons" "M" + + + + Since button "M" is unpaired it is a master drag lock button. + + + 6. Mouse Gallery + + + In all of the examples below, it is assumed that /dev/mouse is a link + to the appropriate serial port or PS/2 mouse device. + + + 6.1. MS IntelliMouse (serial, PS/2) + + This mouse has a wheel which also acts as the button 2 (middle + button). The wheel movement is recognized as the Z axis motion. This + behavior is not compatible with XFree86 versions prior to 3.3.2, but + is more consistent with the support for other mice with wheels or + rollers. If you want to make the wheel behave like before, you can + use the "ZAxisMapping" option as described above. + + IntelliMouse supports the PnP COM device specification. + + To use this mouse as a serial device: + + Option "Protocol" "Auto" + + + or: + + Option "Protocol" "IntelliMouse" + + + + To use this mouse as the PS/2 device and the OS supports PS/2 mouse + initialization: + + Option "Protocol" "IMPS/2" + + + + To use this mouse as the PS/2 device but the OS does not support PS/2 + mouse initialization (the wheel won't work in this case): + + Option "Protocol" "PS/2" + + + + To use this mouse as the PS/2 device and the OS supports automatic + PS/2 mouse detection: + + + Option "Protocol" "Auto" + + + + 6.2. MS IntelliMouse Explorer (PS/2, USB) + + This mouse has a wheel which also acts as the button 2 (middle + button). There are two side buttons; they are recognized as the + buttons 4 and 5. The wheel movement is recognized as the Z axis + motion. + + To use this mouse as the PS/2 device and the OS supports PS/2 mouse + initialization: + + Option "Protocol" "ExplorerPS/2" + + + + To use this mouse as the PS/2 device but the OS does not support PS/2 + mouse initialization (the wheel and the side buttons won't work in + this case): + + Option "Protocol" "PS/2" + + + + To use this mouse as the PS/2 device and the OS supports automatic + PS/2 mouse detection: + + Option "Protocol" "Auto" + + + + To use this mouse as the USB device and the OS supports the generic + HID protocol: + + Option "Protocol" "usb" + + + + To use this mouse as the USB device and the OS supports automatic + mouse detection: + + Option "Protocol" "Auto" + + + + 6.3. Kensington Thinking Mouse and Kensington Expert Mouse (serial, + PS/2) + + These mice have four buttons. The Kensington Expert Mouse is really a + trackball. Both Thinking mice support the PnP COM device + specification. + + To use this mouse as a serial device: + + Option "Protocol" "Auto" + + + or: + + Option "Protocol" "ThinkingMouse" + + + To use this mouse as the PS/2 device and the OS supports PS/2 mouse + initialization: + + Option "Protocol" "ThinkingMousePS/2" + + + + To use this mouse as the PS/2 device but the OS does not support PS/2 + mouse initialization (the third and the fourth buttons act as though + they were the first and the second buttons): + + Option "Protocol" "PS/2" + + + + To use this mouse as the PS/2 device and the OS supports automatic + PS/2 mouse detection: + + Option "Protocol" "Auto" + + + + 6.4. Genius NetScroll (PS/2) + + This mouse has four buttons and a roller. The roller movement is + recognized as the Z axis motion. + + To use this mouse as the PS/2 device and the OS supports PS/2 mouse + initialization: + + Option "Protocol" "NetScrollPS/2" + + + + To use this mouse as the PS/2 device but the OS does not support PS/2 + mouse initialization (the roller and the fourth button won't work): + + Option "Protocol" "PS/2" + + + + To use this mouse as the PS/2 device and the OS supports automatic + PS/2 mouse detection: + + Option "Protocol" "Auto" + + + + 6.5. Genius NetMouse and NetMouse Pro (serial, PS/2) + + These mice have a "magic button" which is used like a wheel or a + roller. The "magic button" action is recognized as the Z axis motion. + NetMouse Pro is identical to NetMouse except that it has the third + button on the left hand side. + + NetMouse and NetMouse Pro support the PnP COM device specification. + When used as a serial mouse, they are compatible with MS IntelliMouse. + + To use these mice as a serial device: + + Option "Protocol" "Auto" + + + + or: + + Option "Protocol" "IntelliMouse" + + + + To use this mouse as the PS/2 device and the OS supports PS/2 mouse + initialization: + + Option "Protocol" "NetMousePS/2" + + + + To use this mouse as the PS/2 device but the OS does not support PS/2 + mouse initialization (the "magic button" and the third button won't + work): + + Option "Protocol" "PS/2" + + + + To use this mouse as the PS/2 device and the OS supports automatic + PS/2 mouse detection: + + Option "Protocol" "Auto" + + + + 6.6. Genius NetScroll Optical (PS/2, USB) + + This mouse has a wheel which also acts as the button 2 (middle + button), and two side buttons which are recognized as the buttons 4 + and 5. It is compatible with NetMouse and NetMouse Pro. + + To use this mouse as the PS/2 device and the OS supports PS/2 mouse + initialization: + + Option "Protocol" "NetMousePS/2" + + + + To use this mouse as the PS/2 device but the OS does not support PS/2 + mouse initialization (the wheel and the side buttons won't work): + + Option "Protocol" "PS/2" + + + + To use this mouse as the PS/2 device and the OS supports automatic + PS/2 mouse detection: + + Option "Protocol" "Auto" + + + + To use this mouse as the USB device and the OS supports the generic + HID protocol: + + Option "Protocol" "usb" + + + + To use this mouse as the USB device and the OS supports automatic + mouse detection: + + Option "Protocol" "Auto" + + + + 6.7. ALPS GlidePoint (serial, PS/2) + + The serial version of this pad device has been supported since XFree86 + 3.2. `Tapping' action is interpreted as the fourth button press. + (IMHO, the fourth button of GlidePoint should always be mapped to the + first button in order to make this pad behave like the other pad + products.) + + To use this pad as a serial device: + + Option "Protocol" "GlidePoint" + + + + To use this mouse as the PS/2 device and the OS supports PS/2 mouse + initialization: + + Option "Protocol" "GlidePointPS/2" + + + + To use this mouse as the PS/2 device but the OS does not support PS/2 + mouse initialization: + + Option "Protocol" "PS/2" + + + + To use this mouse as the PS/2 device and the OS supports automatic + PS/2 mouse detection: + + Option "Protocol" "Auto" + + + + 6.8. ASCII MieMouse (serial, PS/2) + + This mouse appears to be OEM from Genius. Although its shape is quite + different, it works like Genius NetMouse Pro. This mouse has a "knob" + which is used like a wheel or a roller. The "knob" action is + recognized as the Z axis motion. + + MieMouse supports the PnP COM device specification. When used as a + serial mouse, it is compatible with MS IntelliMouse. + + To use this mouse as a serial device: + + Option "Protocol" "Auto" + + + or: + + Option "Protocol" "IntelliMouse" + + + + To use this mouse as the PS/2 device and the OS supports PS/2 mouse + initialization: + + + Option "Protocol" "NetMousePS/2" + + + + To use this mouse as the PS/2 device but the OS does not support PS/2 + mouse initialization (the knob and the third button won't work): + + Option "Protocol" "PS/2" + + + + To use this mouse as the PS/2 device and the OS supports automatic + PS/2 mouse detection: + + Option "Protocol" "Auto" + + + + 6.9. Logitech MouseMan+ and FirstMouse+ (serial, PS/2) + + MouseMan+ has two buttons on top, one side button and a roller. + FirstMouse+ has two buttons and a roller. The roller movement is + recognized as the Z axis motion. The roller also acts as the third + button. The side button is recognized as the fourth button. + + MouseMan+ and FirstMouse+ support the PnP COM device specification. + They have MS IntelliMouse compatible mode when used as a serial mouse. + + To use these mice as a serial device: + + Option "Protocol" "Auto" + + + or: + + Option "Protocol" "IntelliMouse" + + + + To use this mouse as the PS/2 device and the OS supports PS/2 mouse + initialization: + + Option "Protocol" "MouseManPlusPS/2" + + + + To use this mouse as the PS/2 device but the OS does not support PS/2 + mouse initialization (the wheel and the fourth button won't work): + + Option "Protocol" "PS/2" + + + + To use this mouse as the PS/2 device and the OS supports automatic + PS/2 mouse detection: + + Option "Protocol" "Auto" + + + + 6.10. IBM ScrollPoint (PS/2) + + ScrollPoint has a "stick" in between the two buttons. This "stick" is + the same as the stick-shaped pointing device often found on notebook + computers, on which you move the mouse cursor by pushing the stick. + The stick movement is recognized as the Z axis motion. You can push + the stick to right and left, as well as forward and backward. Give + four numbers to ZAxisMapping option to map movement along all these + four directions to button actions. + + This mouse is compatible with Logitech MouseMan+. To use this mouse + as the PS/2 device and the OS supports PS/2 mouse initialization: + + Option "Protocol" "MouseManPlusPS/2" + + + + To use this mouse as the PS/2 device but the OS does not support PS/2 + mouse initialization (the stick won't work): + + Option "Protocol" "PS/2" + + + + To use this mouse as the PS/2 device and the OS supports automatic + PS/2 mouse detection: + + Option "Protocol" "Auto" + + + + 6.11. 8D ScrollMouse (serial, PS/2) + + ScrollMouse, also known as GyroMouse, has a "stick" similar to IBM + ScrollPoint. The stick movement is recognized as the Z axis motion. + You can push the stick to right and left, as well as forward and + backward. Give four numbers to ZAxisMapping option to map movement + along all these four directions to button actions. + + ScrollMouse supports the PnP COM device specification. When used as a + serial mouse, it is compatible with MS IntelliMouse. + + To use this mouse as a serial device: + + Option "Protocol" "Auto" + + + or: + + Option "Protocol" "IntelliMouse" + + + + To use this mouse as the PS/2 device and the OS supports PS/2 mouse + initialization: + + Option "Protocol" "IMPS/2" + + + + To use this mouse as the PS/2 device but the OS does not support PS/2 + mouse initialization (the stick won't work): + + Option "Protocol" "PS/2" + + + + To use this mouse as the PS/2 device and the OS supports automatic + PS/2 mouse detection: + Option "Protocol" "Auto" + + + + 6.12. A4 Tech 4D mice (serial, PS/2, USB) + + A4 Tech produces quit a number of mice with one or two wheels. Their + mice may have 2, 3, or 4 buttons. The wheels movement is recognized + as the Z axis motion. Give four numbers to ZAxisMapping option to map + movement of both wheels to button actions. + + 4D mice support the PnP COM device specification. When used as a + serial mouse, it is compatible with MS IntelliMouse. + + To use this mouse as a serial device: + + Option "Protocol" "Auto" + + + or: + + Option "Protocol" "IntelliMouse" + + + + To use this mouse as the PS/2 device and the OS supports PS/2 mouse + initialization: + + Option "Protocol" "IMPS/2" + + + + To use this mouse as the PS/2 device but the OS does not support PS/2 + mouse initialization (the wheels won't work): + + Option "Protocol" "PS/2" + + + + To use this mouse as the PS/2 device and the OS supports automatic + PS/2 mouse detection: + + Option "Protocol" "Auto" + + + + To use this mouse as the USB device and the OS supports the generic + HID protocol: + + Option "Protocol" "usb" + + + + To use this mouse as the USB device and the OS supports automatic + mouse detection: + + Option "Protocol" "Auto" + + + + 7. Configuration Examples + + + + This section shows some example InputDevice section for popular mice. + All the examples assume that the mouse is connected to the PS/2 mouse + port, and the OS supports the PS/2 mouse initialization. It is also + assumed that /dev/mouse is a link to the PS/2 mouse port. + + Logitech MouseMan+ has 4 buttons and a wheel. The following example + makes the wheel movement available as the button 5 and 6. + + + ______________________________________________________________________ + Section "InputDevice" + Identifier "MouseMan+" + Driver "mouse" + Option "Device" "/dev/mouse" + Option "Protocol" "MouseManPlusPS/2" + Option "Buttons" "6" + Option "ZAxisMapping" "5 6" + EndSection + ______________________________________________________________________ + + + + You can change button number assignment using the xmodmap command + AFTER you start the X server with the above configuration. You may + not like to use the wheel as the button 2 and rather want the side + button (button 4) act like the button 2. You may also want to map the + wheel movement to the button 4 and 5. This can be done by the + following command: + + + xmodmap -e "pointer = 1 6 3 2 4 5" + + + + After this command is run, the correspondence between the buttons and + button numbers will be as shown in the following table. + + + Physical Buttons Reported as: + ------------------------------------ + 1 Left Button Button 1 + 2 Wheel Button Button 6 + 3 Right Button Button 3 + 4 Side Button Button 2 + 5 Wheel Negative Move Button 4 + 6 Wheel Positive Move Button 5 + + + + For the MS IntelliMouse Explorer which as a wheel and 5 buttons, you + may have the following InputDevice section. + + + ______________________________________________________________________ + Section "InputDevice" + Identifier "IntelliMouse Explorer" + Driver "mouse" + Option "Device" "/dev/mouse" + Option "Protocol" "ExplorerPS/2" + Option "Buttons" "7" + Option "ZAxisMapping" "6 7" + EndSection + ______________________________________________________________________ + + + + The IntelliMouse Explorer has 5 buttons, thus, you should give "7" to + the Buttons option if you want to map the wheel movement to buttons (6 + and 7). With this configuration, the correspondence between the + buttons and button numbers will be as follows: + + + Physical Buttons Reported as: + ------------------------------------ + 1 Left Button Button 1 + 2 Wheel Button Button 2 + 3 Right Button Button 3 + 4 Side Button 1 Button 4 + 5 Side Button 2 Button 5 + 6 Wheel Negative Move Button 6 + 7 Wheel Positive Move Button 7 + + + + You can change button number assignment using xmodmap AFTER you + started the X server with the above configuration. + + + xmodmap -e "pointer = 1 2 3 4 7 5 6" + + + + The above command will moves the side button 2 to the button 7 and + make the wheel movement reported as the button 5 and 6. See the table + below. + + + Physical Buttons Reported as: + ------------------------------------ + 1 Left Button Button 1 + 2 Wheel Button Button 2 + 3 Right Button Button 3 + 4 Side Button 1 Button 4 + 5 Side Button 2 Button 7 + 6 Wheel Negative Move Button 5 + 7 Wheel Positive Move Button 6 + + + + For the A4 Tech WinEasy mouse which has two wheels and 3 buttons, you + may have the following InputDevice section. + + + ______________________________________________________________________ + Section "InputDevice" + Identifier "WinEasy" + Driver "mouse" + Option "Device" "/dev/mouse" + Option "Protocol" "IMPS/2" + Option "Buttons" "7" + Option "ZAxisMapping" "4 5 6 7" + EndSection + ______________________________________________________________________ + + + + The movement of the first wheel is mapped to the button 4 and 5. The + second wheel's movement will be reported as the buttons 6 and 7. + + The Kensington Expert mouse is really a trackball. It has 4 buttons + arranged in a rectangle around the ball. + + ______________________________________________________________________ + Section "InputDevice" + Identifier "DLB" + Driver "mouse" + Option "Protocol" "ThinkingMousePS/2" + Option "Buttons" "3" + Option "Emulate3Buttons" + Option "Device" "/dev/mouse" + Option "DragLockButtons" "2 1 4 3" + EndSection + ______________________________________________________________________ + + + In this example, button 2 is a drag lock button for button number 1, + and button 4 is a drag lock button for button 3. Since button 2 is + above button 1 and button 4 is above button 3 in the layout of this + trackball, this is reasonable. + + Because button 2 is being used as a drag lock, it can not be used as + an ordinary button. However, it can be activated by using the + "Emulate3Buttons" feature. However, some people my be unable to press + two buttons at the same time. They may prefer the following + InputDevice section which defines button 4 as a master drag lock + button, and leaves button 2 free for ordinary use. + + ______________________________________________________________________ + Section "InputDevice" + Identifier "MasterDLB" + Driver "mouse" + Option "Protocol" "ThinkingMousePS/2" + Option "Buttons" "3" + Option "Device" "/dev/mouse" + Option "DragLockButtons" "4" + EndSection + ______________________________________________________________________ + + + diff --git a/driver/xf86-input-mouse/README.sgml b/driver/xf86-input-mouse/README.sgml new file mode 100644 index 000000000..37ccc2964 --- /dev/null +++ b/driver/xf86-input-mouse/README.sgml @@ -0,0 +1,1125 @@ + %defs; +]> + +
+Mouse Support in X11R&relvers; +<author>Kazutaka Yokota +<date>17 December 2002 + +<ident> +</ident> + +<toc> + +<sect>Introduction <p> + +This document describes mouse support in X.Org Foundation's X11R&relvers; server. + +Mouse configuration has often been mysterious task for +novice users. +However, once you learn several basics, it is straightforward +to write the mouse <tt>"InputDevice"</tt> +section in the <tt>xorg.conf</tt> file by hand. + +<sect>Supported Hardware <p> + +The X.Org Foundation X server supports four classes of mice: +serial, bus and PS/2 mice, and additional mouse types supported by +specific operating systems, such as USB mice. + +<descrip> +<tag>Serial mouse</tag> +The serial mouse has been the most popular pointing device for +PCs. +There have been numerous serial mouse models from a number of +manufactures. +Despite the wide range of variations, there have been relatively +few protocols (data format) with which the serial mouse talks +to the host computer. + +The modern serial mouse conforms to the PnP COM device specification +so that the host computer can automatically detect the mouse +and load an appropriate driver. +The X server supports this specification and can detect +popular PnP serial mouse models on most platforms. + +<tag>Bus mouse</tag> +The bus mouse connects to a dedicated interface card in an expansion +slot. +Some video cards, notably those from ATI, and integrated I/O +cards may also have a bus mouse connector. +Some bus mice are known as `InPort mouse'. + +Note that some mouse manufactures have sold a package including a serial mouse +and a serial interface card. +Don't confuse this type of products with the genuine bus mouse. + +<tag>PS/2 mouse</tag> +They are sometimes called `Mouse-port mouse'. +The PS/2 mouse is becoming increasingly common and popular. + +The PS/2 mouse is an intelligent device and may have more than +three buttons and a wheel or a roller. +The PS/2 mouse is usually compatible with the original PS/2 mouse from IBM +immediately after power up. +The PS/2 mouse with additional features requires a specialized +initialization procedure to enable these features. +Without proper initialization, it behaves as though it were an ordinary +two or three button mouse. + +<tag>USB mouse </tag> +USB (Universal Serial Bus) ports are present on most modern +computers. Several devices can be plugged into this bus, including +mice and keyboards. + +The server includes support for USB mice on some systems. +</descrip> + +Many mice nowadays can be used both as a serial mouse and as a PS/2 mouse. +They has a logic to distinguish which interface it is connected to. +However, the mouse which is not marketed as compatible with both +serial and PS/2 mouse interface lacks this logic and cannot be +used in such a way, even if you can find an appropriate +adapter with which you can connect the PS/2 mouse to a serial port +or visa versa. + +X11R&relvers; supports the mouse with a wheel, a roller or a knob. +Its action is detected as the Z (third) axis motion of the mouse. +As the X server or clients normally do not use the Z axis movement of the +pointing device, a configuration option, <tt>"ZAxisMapping"</tt>, +is provided to assign the Z axis movement to another axis or a pair +of buttons (see below). + +<sect>OS Support for Mice <p> + +<sect1>Summary of Supported Mouse Protocol Types <p> +<verb> + Protocol Types + serial PnP BusMouse PS/2 Extended PS/2 +OS platforms protocols serial protocol protocol protocols + "Auto" "BusMouse" "PS/2" "xxxPS/2" USB +------------------------------------------------------------------------- +BSD/OS Ok ? ? ? ? ? +FreeBSD Ok Ok Ok Ok SP*1 SP*1 +FreeBSD(98) Ok ? Ok NA NA ? +Interactive Unix Ok NA ?*1 ?*1 NA ? +Linux Ok Ok Ok Ok Ok ? +Linux/98 Ok ? Ok NA NA ? +LynxOS Ok NA Ok Ok NA ? +NetBSD Ok Ok Ok SP*1 SP*1 SP*1 +NetBSD/pc98 Ok ? Ok NA NA NA +OpenBSD Ok Ok Ok Ok*1 Ok*1 Ok*1 +OS/2 SP*2 SP*2 SP*2 SP*2 SP*2 ? +SCO Ok ? SP*1 SP*1 NA ? +Solaris 2.x Ok NA*1 ?*1 Ok Ok SP*1 +SVR4 Ok NA*1 SP*1 SP*1 NA ? +PANIX Ok ? SP*1 SP*1 NA ? + +Ok: support is available, NA: not available, ?: untested or unknown. +SP: support is available in a different form + +*1 Refer to the following sections for details. +*2 X11R&relvers;/OS2 will support any type of mouse that the OS supports, + whether it is serial, bus mouse, or PnP type. + +</verb> + +<sect1>BSD/OS <p> +No testing has been done with BSD/OS. + +<sect1>FreeBSD <p> +FreeBSD supports the <tt>"SysMouse"</tt> protocol which must be +specified when the <tt>moused</tt> daemon is running in versions 2.2.1 +or later. + +When running the <tt>moused</tt>daemon, you must always specify the +<tt>/dev/sysmouse</tt> device and the <tt>"SysMouse"</tt> protocol +to the X server, regardless of the actual type of your mouse. + +FreeBSD versions 2.2.6 or later include the kernel-level +support for extended PS/2 mouse protocols and there is no need to specify +the exact protocol name to the X server. +Instead specify the <tt>"PS/2"</tt> or <tt>"Auto"</tt> protocol and +the X server will automatically make use of the kernel-level support. + +In fact, <tt>"Auto"</tt> protocol support is really efficient in these +versions. +You may always specify <tt>"Auto"</tt> to any mouse, serial, +bus or PS/2, unless the mouse is an old serial model which doesn't +support PnP. + +FreeBSD versions 2.2.5 or earlier do not support extended PS/2 +mouse protocols (<tt>"xxxPS/2"</tt>). +Always specify the <tt>"PS/2"</tt> protocol for any PS/2 mouse +in these versions regardless of the brand of the mouse. + +FreeBSD versions 3.1 or later have support for USB mice. +Specify the <tt>"Auto"</tt> protocol for the <tt>/dev/ums0</tt> device. +(If the <tt>moused</tt> daemon is running for the USB mouse, +you must use <tt>/dev/sysmouse</tt> instead of <tt>/dev/ums0</tt> +as explained above.) See the <em>ums(4)</em> manual page for details. + +<sect1>FreeBSD(98) <p> +The PS/2 mouse is not supported. + +<sect1>Interactive Unix <p> +The PnP serial mouse support (the <tt>"Auto"</tt> protocol) is not +supported for the moment. + +The bus mouse and PS/2 mouse should be supported by using the +appropriate device drivers. +Use <tt>/dev/mouse</tt> for the <tt>"BusMouse"</tt> protocol +and <tt>/dev/kdmouse</tt> for the <tt>"PS/2"</tt> protocol. +These protocols are untested but may work. +Please send success/failure reports to +<email>michael.rohleder@stadt-frankfurt.de</email>. + +<sect1>Linux <p> +All protocol types should work. + +<sect1>Linux/98 <p> +The PS/2 mouse is not supported. + +<sect1>LynxOS <p> +The PnP serial mouse support (the <tt>"Auto"</tt> protocol) is disabled in +LynxOS, because of limited TTY device driver functionality. + +<sect1>NetBSD <p> +NetBSD 1.3.x and former does not support extended PS/2 mouse protocols +(<tt>"xxxPS/2"</tt>). +The PS/2 mouse device driver <tt>/dev/pms</tt> emulates the bus mouse. +Therefore, you should always specify the <tt>"BusMouse"</tt> protocol for +any PS/2 mouse regardless of the brand of the mouse. +<p> +The <tt>"wsmouse"</tt> protocol introduced in NetBSD +1.4 along with the wscons console driver is supported. You need to run binaries +compiled on NetBSD 1.4 to have support +for it though. Use <tt>"/dev/wsmouse0"</tt> for the device. Refer to the +<em>wsmouse(4)</em> manual page for kernel configuration informations. +<p> +This driver also provides support for USB mice. See the +<em>ums(4)</em> manual page for details. + +<sect1>NetBSD/pc98 <p> +The PS/2 mouse is not supported. + +<sect1>OpenBSD <p> +The raw PS/2 mouse device driver <tt>/dev/psm0</tt> uses the raw PS/2 +mouse protocol. + +OpenBSD 2.2 and earlier does not support extended PS/2 mouse protocols +(<tt>"xxxPS/2"</tt>) . Therefore, you should specify the +<tt>"PS/2"</tt> protocol for any PS/2 mouse regardless of the brand of +the mouse. + +OpenBSD 2.3 and later support all extended PS/2 mouse protocols. +You can select the <tt>"Auto"</tt> protocol for PnP PS/2 +mice or any specific extended (<tt>"xxxPS/2"</tt>) protocol +for non PnP mice. + +There is also a cooked PS/2 mouse device driver <tt>/dev/pms0</tt> +which emulates the bus mouse. Specify the <tt>"BusMouse"</tt> +protocol for any PS/2 mouse regardless of the brand of the mouse when +using this device. +<p> +XFree86 3.3.6 support USB mice on OpenBSD 2.6 and later though the +generic Human Interface Device (hid) <tt>/dev/uhid*</tt>. Select the +<tt>"usb"</tt> protocol and the <tt>/dev/uhid*</tt> instance +corresponding to your mouse as the device name. + +<sect1>OS/2 <p> +X11R&relvers;/OS2 always uses the native mouse driver of the operating system +and will support any type of pointer that the OS supports, whether it is +serial, bus mouse, or PnP type. +If the mouse works under Presentation Manager, +it will also work under X11R&relvers;/OS2. + +Always specify <tt>"OSMouse"</tt> as the protocol type. + +<sect1>SCO <p> +The bus and PS/2 mouse are supported with the <tt>"OSMouse"</tt> +protocol type. + +The <tt>"OSMouse"</tt> may also be used with the serial mouse. + +<sect1>Solaris <p> +Testing has been done with Solaris 2.5.1, 2.6, 7, 8, 9 and 10. + +On Solaris 10 1/06 and later versions with "virtual mouse" support, +all PS/2 and USB mice connected to the system can be accessed via +the /dev/mouse device using the VUID protocol, including USB mice +plugged in after the X server is started. On older releases or +to address mice individually, specific devices and protocols may +be used. + +Logitech and Microsoft bus mice +have not been tested, but might work with the <tt>/dev/logi</tt> and +<tt>/dev/msm</tt> devices. +Standard 2 and 3 button PS/2 mice work with the <tt>"PS/2"</tt> protocol +type and the <tt>/dev/kdmouse</tt> device. +USB mice work with the <tt>"VUID"</tt> protocol type and the +<tt>/dev/mouse</tt> device. +The PnP serial mouse support via the <tt>"Auto"</tt> protocol has been tested +and does not work. The <tt>"Auto"</tt> protocol can however detect PS/2 and +USB mice correctly. + +Additional USB mice can be connected using the <tt>"VUID"</tt> protocol type +and the appropriate <tt>"/dev/usb/hid"</tt> device with the <tt>Option "StreamsModule" "usbms"</tt> line included in the associated <tt>"InputDevice"</tt> +section. + +<sect1>SVR4 <p> +The bus and PS/2 mouse may be supported with the <tt>"Xqueue"</tt> +protocol type. + +The <tt>"Xqueue"</tt> may also be used with the serial mouse. + +The PnP serial mouse support (the <tt>"Auto"</tt> protocol) is not +tested. + +<sect1>PANIX <p> +The PC/AT version of PANIX supports the bus and PS/2 mouse with the +<tt>"Xqueue"</tt> protocol type. +The PC-98 version of PANIX supports the bus mouse with the +<tt>"Xqueue"</tt> protocol type. + +<sect>Configuring Your Mouse <p> + +Before using the <tt>xorgconfig</tt> program +to set up mouse configuration, you must identify the interface type, +the device name and the protocol type of your mouse. +Blindly trying every possible combination of mouse settings +will lead you nowhere. + +The first thing you need to know is the interface type +of the mouse you are going to use. +It can be determined by looking at the connector of the mouse. +The serial mouse has a D-Sub female 9- or 25-pin connector. +The bus mice have either a D-Sub male 9-pin connector +or a round DIN 9-pin connector. +The PS/2 mouse is equipped with a small, round DIN 6-pin connector. +USB mice have a thin rectangular connector. +Some mice come with adapters with which the connector can +be converted to another. If you are to use such an adapter, +remember that the connector at the very end of the mouse/adapter pair is +what matters. + +The next thing to decide is a device node to use for the given interface. +For the bus and PS/2 mice, there is little choice; +your OS most possibly offers just one device node each +for the bus mouse and PS/2 mouse. +There may be more than one serial port to which the serial +mouse can be attached. + +The next step is to guess the appropriate protocol type for the mouse. +The X server may be able to select a protocol type for the given mouse +automatically in some cases. +Otherwise, the user has to choose one manually. +Follow the guidelines below. + +<descrip> +<tag>Bus mouse</tag> +The bus and InPort mice always use <tt>"BusMouse"</tt> +protocol regardless of the brand of the mouse. + +Some OSs may allow you to specify <tt>"Auto"</tt> as the +protocol type for the bus mouse. + +<tag>PS/2 mouse</tag> +The <tt>"PS/2"</tt> protocol should always be tried first for the PS/2 mouse +regardless of the brand of the mouse. +Any PS/2 mouse should work with this protocol type, although +wheels and other additional features are unavailable in the +X server. + +After verifying the mouse works with this protocol, +you may choose to specify one of <tt>"xxxPS/2"</tt> protocols so that +extra features are made available in the X server. +However, support for these PS/2 mice assumes certain behavior of +the underlying OS and may not always work as expected. +Support for some PS/2 mouse models may be disabled all together +for some OS platforms for this reason. + +Some OSs may allow you to specify <tt>"Auto"</tt> as the +protocol type for the PS/2 mouse and the X server will automatically +adjust itself. + +<tag>Serial mouse</tag> +The server supports a wide range of mice, both old and new. +If your mouse is of a relatively new model, it may conform to the +PnP COM device specification and the X server may be able to +detect an appropriate protocol type for the mouse automatically. + +Specify <tt>"Auto"</tt> as the protocol type and start the X server. +If the mouse is not a PnP mouse, or the X server cannot determine +a suitable protocol type, the server will print the following +error message and abort. + +<verb> +<mousename>: cannot determine the mouse protocol +</verb> + +If the X server generates the above error message, you need to +manually specify a protocol type for your mouse. +Choose one from the following list: + +<itemize> + <item><tt>GlidePoint</tt> + <item><tt>IntelliMouse</tt> + <item><tt>Logitech</tt> + <item><tt>Microsoft</tt> + <item><tt>MMHittab</tt> + <item><tt>MMSeries</tt> + <item><tt>MouseMan</tt> + <item><tt>MouseSystems</tt> + <item><tt>ThinkingMouse</tt> +</itemize> + +When you choose, keep in mind the following rule of thumb: + +<enum> +<item><tt>"Logitech"</tt> protocol is for old serial mouse models +from Logitech. +Modern Logitech mice use either <tt>"MouseMan"</tt> or <tt>"Microsoft"</tt> +protocol. +<item>Most 2-button serial mice support the <tt>"Microsoft"</tt> protocol. +<item>3-button serial mice may work with the <tt>"Mousesystems"</tt> +protocol. If it doesn't, it may work instead with the +<tt>"Microsoft"</tt> protocol although the third (middle) button won't +function. +3-button serial mice may also work with the <tt>"Mouseman"</tt> +protocol under which the third button may function as expected. +<item>3-button serial mice may have a small switch at the bottom +of the mouse to choose between ``MS'' and ``PC'', or ``2'' and ``3''. +``MS'' or ``2'' usually mean the <tt>"Microsoft"</tt> protocol. +``PC'' or ``3'' will choose the <tt>"MouseSystems"</tt> protocol. +<item>If the serial mouse has a roller or a wheel, it may be compatible +with the <tt>"IntelliMouse"</tt> protocol. +<item>If the serial mouse has a roller or a wheel and it doesn't work +with the <tt>"IntelliMouse"</tt> protocol, you have to use it +as a regular 2- or 3-button serial mouse. +</enum> + +If the <tt>"Auto"</tt> protocol is specified and the mouse seems to be working, +but you find that not all features of the mouse are available, that is +because the X server does not have native support for that model of mouse +and is using a ``compatible'' protocol according to PnP information. + +If you suspect this is the case with your mouse, please enter a +bug report at http://bugzilla.freedesktop.org, using the xorg product. + +<tag>USB mouse</tag> +If your mouse is connected to the USB port, it can either be supported +by the <tt>"Auto"</tt> protocol, or by an OS-specific protocol (see below), +or as a generic Human Interface Device by the <tt>"usb"</tt> protocol. + +<tag>Standardized protocols</tag> +Mouse device drivers in your OS may use the standardized protocol +regardless of the model or the class of the mouse. +For example, SVR4 systems may support <tt>"Xqueue"</tt> protocol. +In FreeBSD the system mouse device <tt>/dev/sysmouse</tt> +uses the <tt>"SysMouse"</tt> protocol. +Please refer to the OS support section of this file for more information. + +</descrip> + +<sect>xorg.conf Options <p> + +The old <tt>Pointer</tt> section has been replaced by a more general +<tt>InputDevice</tt> section. The following is a minimal example +of an <tt>InputDevice</tt> section for a mouse: + +<code> +Section "InputDevice" + Identifier "Mouse 1" + Driver "mouse" + Option "Device" "/dev/mouse" + Option "Protocol" "Auto" +EndSection +</code> + +The <tt>mouse</tt> driver supports the following config file options: + +<sect1>Buttons <p> +This option tells the X server the number of buttons on the mouse. +Currently there is no reliable way to automatically detect the correct +number. +This option is the only means for the X server to obtain it. +The default value is three. + +Note that if you intend to assign Z axis movement to button events +using the <tt>ZAxisMapping</tt> option below, you need to take account +of those buttons into <tt>N</tt> too. + +<verb> + Option "Buttons" "N" +</verb> + +<sect1>ZAxisMapping <p> +This option maps the Z axis (wheel) motion to buttons or to +another axis. + +<verb> + Option "ZAxisMapping" "X" + Option "ZAxisMapping" "Y" + Option "ZAxisMapping" "N1 N2" + Option "ZAxisMapping" "N1 N2 N3 N4" +</verb> + +The first example will map the Z axis motion to the X axis motion. +Whenever the user moves the wheel/roller, its movement is reported as +the X axis motion. When the wheel/roller stays still, the real X axis +motion is reported as is. The third example will map negative Z axis +motion to the button <tt>N1</tt> and positive Z axis motion to +the button <tt>N2</tt>. If this option is used and the buttons <tt>N1</tt> +or <tt>N2</tt> actually exists in the mouse, +their actions won't be detected by the X server. + +The last example is useful for the mouse with two wheels of which +the second wheel is used to generate horizontal scroll action, +and the mouse which has a knob or a stick which can detect the horizontal +force applied by the user. +The motion of the second wheel will be mapped to the buttons <tt>N3</tt>, +for the negative direction, and <tt>N4</tt>, for the positive direction. +If the buttons <tt>N3</tt> and <tt>N4</tt> actually exist in this mouse, +their actions won't be detected by the X server. + +NOTE #1: horizontal movement may not always be detected +by the current version of the X11R&relvers; X servers, +because there appears to be no accepted standard as to how the horizontal +direction is encoded in mouse data. + +NOTE #2: Some mice think left is the negative horizontal direction, +others may think otherwise. +Moreover, there are some mice whose two wheels are both mounted vertically, +and the direction of the second vertical wheel does not match the +first one's. + +You need to edit the <tt>xorg.conf</tt> file by hand to change this option if +the default value of "4 5 6 7" does not match the needs of your configuration. + +<sect1>Resolution <p> +The following option will set the mouse device resolution to <tt>N</tt> +counts per inch, if possible: + +<verb> + Option "Resolution" "N" +</verb> + +Not all mice and OSs can support this option. + +<sect1>Drag Lock Buttons <p> +Some people find it difficult or inconvenient to hold a trackball +button down, while at the same time moving the ball. Drag lock buttons +simulate the holding down of another button. When a drag lock button +is first pressed, its target buttons is "locked" down until the +second time the lock button is released, or until the button itself +is pressed and released. This allows the starting of a drag, the movement +of the trackball, and the ending of the drag to be separate operations. + +<verb> + Option "DragLockButtons" "W X Y Z" +</verb> + +This option consists of pairs of buttons. Each lock button number +is followed by the number of the button that it locks. In the above, +button number "W" is a drag lock button for button "X" and button number +"Y" is a drag lock button for button "Z". + +It may not be desirable to use multiple buttons as drag locks. +Instead, a "master drag lock button" may be defined. A master drag +lock button acts as a "META" key. After a master lock button is released, +the next button pressed is "locked" and not released until the +second time the real button is released. + +<verb> + Option "DragLockButtons" "M" +</verb> + +Since button "M" is unpaired it is a master drag lock button. + +<sect>Mouse Gallery <p> + +In all of the examples below, it is assumed that <tt>/dev/mouse</tt> is +a link to the appropriate serial port or PS/2 mouse device. + +<sect1>MS IntelliMouse (serial, PS/2) <p> +This mouse has a wheel which also acts as the button 2 (middle button). +The wheel movement is recognized as the Z axis motion. +This behavior is not compatible with XFree86 versions prior to 3.3.2, +but is more consistent with the support for other mice with +wheels or rollers. +If you want to make the wheel behave like before, +you can use the <tt>"ZAxisMapping"</tt> option as described above. +<p> +IntelliMouse supports the PnP COM device specification. +<p> +To use this mouse as a serial device: +<verb> + Option "Protocol" "Auto" +</verb> +or: +<verb> + Option "Protocol" "IntelliMouse" +</verb> + +To use this mouse as the PS/2 device and the OS supports PS/2 mouse +initialization: +<verb> + Option "Protocol" "IMPS/2" +</verb> + +To use this mouse as the PS/2 device but the OS does not support PS/2 mouse +initialization (the wheel won't work in this case): +<verb> + Option "Protocol" "PS/2" +</verb> + +To use this mouse as the PS/2 device and the OS supports automatic +PS/2 mouse detection: +<verb> + Option "Protocol" "Auto" +</verb> + +<sect1>MS IntelliMouse Explorer (PS/2, USB) <p> +This mouse has a wheel which also acts as the button 2 (middle button). +There are two side buttons; they are recognized as the buttons 4 and 5. +The wheel movement is recognized as the Z axis motion. +<p> +To use this mouse as the PS/2 device and the OS supports PS/2 mouse +initialization: +<verb> + Option "Protocol" "ExplorerPS/2" +</verb> + +To use this mouse as the PS/2 device but the OS does not support PS/2 mouse +initialization (the wheel and the side buttons won't work in this case): +<verb> + Option "Protocol" "PS/2" +</verb> + +To use this mouse as the PS/2 device and the OS supports automatic +PS/2 mouse detection: +<verb> + Option "Protocol" "Auto" +</verb> + +To use this mouse as the USB device and the OS supports the generic +HID protocol: +<verb> + Option "Protocol" "usb" +</verb> + +To use this mouse as the USB device and the OS supports automatic +mouse detection: +<verb> + Option "Protocol" "Auto" +</verb> + +<sect1>Kensington Thinking Mouse and Kensington Expert Mouse (serial, PS/2) <p> +These mice have four buttons. +The Kensington Expert Mouse is really a trackball. +Both Thinking mice support the PnP COM device specification. +<p> +To use this mouse as a serial device: +<verb> + Option "Protocol" "Auto" +</verb> +or: +<verb> + Option "Protocol" "ThinkingMouse" +</verb> + +To use this mouse as the PS/2 device and the OS supports PS/2 mouse +initialization: +<verb> + Option "Protocol" "ThinkingMousePS/2" +</verb> + +To use this mouse as the PS/2 device but the OS does not support PS/2 mouse +initialization (the third and the fourth buttons act as though they +were the first and the second buttons): +<verb> + Option "Protocol" "PS/2" +</verb> + +To use this mouse as the PS/2 device and the OS supports automatic +PS/2 mouse detection: +<verb> + Option "Protocol" "Auto" +</verb> + +<sect1>Genius NetScroll (PS/2) <p> +This mouse has four buttons and a roller. The roller movement is +recognized as the Z axis motion. +<p> +To use this mouse as the PS/2 device and the OS supports PS/2 mouse +initialization: +<verb> + Option "Protocol" "NetScrollPS/2" +</verb> + +To use this mouse as the PS/2 device but the OS does not support PS/2 mouse +initialization (the roller and the fourth button won't work): +<verb> + Option "Protocol" "PS/2" +</verb> + +To use this mouse as the PS/2 device and the OS supports automatic +PS/2 mouse detection: +<verb> + Option "Protocol" "Auto" +</verb> + +<sect1>Genius NetMouse and NetMouse Pro (serial, PS/2) <p> +These mice have a "magic button" which is used like a wheel or a +roller. The "magic button" action is recognized as the Z axis motion. +NetMouse Pro is identical to NetMouse except that it has the third +button on the left hand side. +<p> +NetMouse and NetMouse Pro support the PnP COM device specification. +When used as a serial mouse, they are compatible with MS IntelliMouse. +<p> +To use these mice as a serial device: +<verb> + Option "Protocol" "Auto" +</verb> +or: +<verb> + Option "Protocol" "IntelliMouse" +</verb> + +To use this mouse as the PS/2 device and the OS supports PS/2 mouse +initialization: +<verb> + Option "Protocol" "NetMousePS/2" +</verb> + +To use this mouse as the PS/2 device but the OS does not support PS/2 mouse +initialization (the "magic button" and the third button won't work): +<verb> + Option "Protocol" "PS/2" +</verb> + +To use this mouse as the PS/2 device and the OS supports automatic +PS/2 mouse detection: +<verb> + Option "Protocol" "Auto" +</verb> + +<sect1>Genius NetScroll Optical (PS/2, USB) <p> +This mouse has a wheel which also acts as the button 2 (middle button), +and two side buttons which are recognized as the buttons 4 and 5. +It is compatible with NetMouse and NetMouse Pro. +<p> +To use this mouse as the PS/2 device and the OS supports PS/2 mouse +initialization: +<verb> + Option "Protocol" "NetMousePS/2" +</verb> + +To use this mouse as the PS/2 device but the OS does not support PS/2 mouse +initialization (the wheel and the side buttons won't work): +<verb> + Option "Protocol" "PS/2" +</verb> + +To use this mouse as the PS/2 device and the OS supports automatic +PS/2 mouse detection: +<verb> + Option "Protocol" "Auto" +</verb> + +To use this mouse as the USB device and the OS supports the generic +HID protocol: +<verb> + Option "Protocol" "usb" +</verb> + +To use this mouse as the USB device and the OS supports automatic +mouse detection: +<verb> + Option "Protocol" "Auto" +</verb> + +<sect1>ALPS GlidePoint (serial, PS/2) <p> +The serial version of this pad device has been supported since XFree86 +3.2. `Tapping' action is interpreted as the fourth button press. +(IMHO, the fourth button of GlidePoint should always be mapped to the first +button in order to make this pad behave like the other pad products.) +<p> +To use this pad as a serial device: +<verb> + Option "Protocol" "GlidePoint" +</verb> + +To use this mouse as the PS/2 device and the OS supports PS/2 mouse +initialization: +<verb> + Option "Protocol" "GlidePointPS/2" +</verb> + +To use this mouse as the PS/2 device but the OS does not support PS/2 mouse +initialization: +<verb> + Option "Protocol" "PS/2" +</verb> + +To use this mouse as the PS/2 device and the OS supports automatic +PS/2 mouse detection: +<verb> + Option "Protocol" "Auto" +</verb> + +<sect1>ASCII MieMouse (serial, PS/2) <p> +This mouse appears to be OEM from Genius. Although its shape is +quite different, it works like Genius NetMouse Pro. This mouse has a +"knob" which is used like a wheel or a roller. The "knob" action is +recognized as the Z axis motion. +<p> +MieMouse supports the PnP COM device specification. When used as a +serial mouse, it is compatible with MS IntelliMouse. +<p> +To use this mouse as a serial device: +<verb> + Option "Protocol" "Auto" +</verb> +or: +<verb> + Option "Protocol" "IntelliMouse" +</verb> + +To use this mouse as the PS/2 device and the OS supports PS/2 mouse +initialization: +<verb> + Option "Protocol" "NetMousePS/2" +</verb> + +To use this mouse as the PS/2 device but the OS does not support PS/2 mouse +initialization (the knob and the third button won't work): +<verb> + Option "Protocol" "PS/2" +</verb> + +To use this mouse as the PS/2 device and the OS supports automatic +PS/2 mouse detection: +<verb> + Option "Protocol" "Auto" +</verb> + +<sect1>Logitech MouseMan+ and FirstMouse+ (serial, PS/2) <p> +MouseMan+ has two buttons on top, one side button and a roller. +FirstMouse+ has two buttons and a roller. The roller movement is +recognized as the Z axis motion. The roller also acts as the third +button. The side button is recognized as the fourth button. +<p> +MouseMan+ and FirstMouse+ support the PnP COM device specification. +They have MS IntelliMouse compatible mode when used as a serial mouse. +<p> +To use these mice as a serial device: +<verb> + Option "Protocol" "Auto" +</verb> +or: +<verb> + Option "Protocol" "IntelliMouse" +</verb> + +To use this mouse as the PS/2 device and the OS supports PS/2 mouse +initialization: +<verb> + Option "Protocol" "MouseManPlusPS/2" +</verb> + +To use this mouse as the PS/2 device but the OS does not support PS/2 mouse +initialization (the wheel and the fourth button won't work): +<verb> + Option "Protocol" "PS/2" +</verb> + +To use this mouse as the PS/2 device and the OS supports automatic +PS/2 mouse detection: +<verb> + Option "Protocol" "Auto" +</verb> + +<sect1>IBM ScrollPoint (PS/2) <p> +ScrollPoint has a "stick" in between the two buttons. +This "stick" is the same as the stick-shaped pointing device often +found on notebook computers, on which you move the mouse cursor by +pushing the stick. +The stick movement is recognized as the Z axis motion. +You can push the stick to right and left, as well as forward and +backward. Give four numbers to <tt>ZAxisMapping</tt> option +to map movement along all these four directions to button actions. +<p> +This mouse is compatible with Logitech MouseMan+. +To use this mouse as the PS/2 device and the OS supports PS/2 mouse +initialization: +<verb> + Option "Protocol" "MouseManPlusPS/2" +</verb> + +To use this mouse as the PS/2 device but the OS does not support PS/2 mouse +initialization (the stick won't work): +<verb> + Option "Protocol" "PS/2" +</verb> + +To use this mouse as the PS/2 device and the OS supports automatic +PS/2 mouse detection: +<verb> + Option "Protocol" "Auto" +</verb> + +<sect1>8D ScrollMouse (serial, PS/2) <p> +ScrollMouse, also known as GyroMouse, has a "stick" similar to +IBM ScrollPoint. +The stick movement is recognized as the Z axis motion. +You can push the stick to right and left, as well as forward and +backward. Give four numbers to <tt>ZAxisMapping</tt> option +to map movement along all these four directions to button actions. +<p> +ScrollMouse supports the PnP COM device specification. When used as a +serial mouse, it is compatible with MS IntelliMouse. +<p> +To use this mouse as a serial device: +<verb> + Option "Protocol" "Auto" +</verb> +or: +<verb> + Option "Protocol" "IntelliMouse" +</verb> + +To use this mouse as the PS/2 device and the OS supports PS/2 mouse +initialization: +<verb> + Option "Protocol" "IMPS/2" +</verb> + +To use this mouse as the PS/2 device but the OS does not support PS/2 mouse +initialization (the stick won't work): +<verb> + Option "Protocol" "PS/2" +</verb> + +To use this mouse as the PS/2 device and the OS supports automatic +PS/2 mouse detection: +<verb> + Option "Protocol" "Auto" +</verb> + +<sect1>A4 Tech 4D mice (serial, PS/2, USB) <p> +A4 Tech produces quit a number of mice with one or two wheels. +Their mice may have 2, 3, or 4 buttons. +The wheels movement is recognized as the Z axis motion. +Give four numbers to <tt>ZAxisMapping</tt> option +to map movement of both wheels to button actions. +<p> +4D mice support the PnP COM device specification. When used as a +serial mouse, it is compatible with MS IntelliMouse. +<p> +To use this mouse as a serial device: +<verb> + Option "Protocol" "Auto" +</verb> +or: +<verb> + Option "Protocol" "IntelliMouse" +</verb> + +To use this mouse as the PS/2 device and the OS supports PS/2 mouse +initialization: +<verb> + Option "Protocol" "IMPS/2" +</verb> + +To use this mouse as the PS/2 device but the OS does not support PS/2 mouse +initialization (the wheels won't work): +<verb> + Option "Protocol" "PS/2" +</verb> + +To use this mouse as the PS/2 device and the OS supports automatic +PS/2 mouse detection: +<verb> + Option "Protocol" "Auto" +</verb> + +To use this mouse as the USB device and the OS supports the generic +HID protocol: +<verb> + Option "Protocol" "usb" +</verb> + +To use this mouse as the USB device and the OS supports automatic +mouse detection: +<verb> + Option "Protocol" "Auto" +</verb> + +<sect>Configuration Examples <p> + +This section shows some example <tt>InputDevice</tt> section for +popular mice. All the examples assume that the mouse is connected to +the PS/2 mouse port, and the OS supports the PS/2 mouse initialization. +It is also assumed that <tt>/dev/mouse</tt> is +a link to the PS/2 mouse port. + +Logitech MouseMan+ has 4 buttons and a wheel. The following example +makes the wheel movement available as the button 5 and 6. + +<code> +Section "InputDevice" + Identifier "MouseMan+" + Driver "mouse" + Option "Device" "/dev/mouse" + Option "Protocol" "MouseManPlusPS/2" + Option "Buttons" "6" + Option "ZAxisMapping" "5 6" +EndSection +</code> + +You can change button number assignment using the <tt>xmodmap</tt> +command AFTER you start the X server with the above configuration. +You may not like to use the wheel as the button 2 and rather want +the side button (button 4) act like the button 2. You may also +want to map the wheel movement to the button 4 and 5. +This can be done by the following command: + +<verb> + xmodmap -e "pointer = 1 6 3 2 4 5" +</verb> + +After this command is run, the correspondence between the buttons and +button numbers will be as shown in the following table. + +<verb> +Physical Buttons Reported as: +------------------------------------ +1 Left Button Button 1 +2 Wheel Button Button 6 +3 Right Button Button 3 +4 Side Button Button 2 +5 Wheel Negative Move Button 4 +6 Wheel Positive Move Button 5 +</verb> + +Starting in the Xorg 6.9 release, you can also achieve this in your +configuration file by adding this to the "InputDevice" section in xorg.conf: +<verb> + Option "ButtonMapping" "1 6 3 2 4 5" +</verb> + + +For the MS IntelliMouse Explorer which as a wheel and 5 buttons, +you may have the following <tt>InputDevice</tt> section. + +<code> +Section "InputDevice" + Identifier "IntelliMouse Explorer" + Driver "mouse" + Option "Device" "/dev/mouse" + Option "Protocol" "ExplorerPS/2" + Option "Buttons" "7" + Option "ZAxisMapping" "6 7" +EndSection +</code> + +The IntelliMouse Explorer has 5 buttons, thus, you should give "7" +to the <tt>Buttons</tt> option if you want to map the wheel movement +to buttons (6 and 7). +With this configuration, the correspondence between the buttons and +button numbers will be as follows: + +<verb> +Physical Buttons Reported as: +------------------------------------ +1 Left Button Button 1 +2 Wheel Button Button 2 +3 Right Button Button 3 +4 Side Button 1 Button 4 +5 Side Button 2 Button 5 +6 Wheel Negative Move Button 6 +7 Wheel Positive Move Button 7 +</verb> + +You can change button number assignment using <tt>xmodmap</tt> +AFTER you started the X server with the above configuration. + +<verb> + xmodmap -e "pointer = 1 2 3 4 7 5 6" +</verb> + +The above command will moves the side button 2 to the button 7 and +make the wheel movement reported as the button 5 and 6. See +the table below. + +<verb> +Physical Buttons Reported as: +------------------------------------ +1 Left Button Button 1 +2 Wheel Button Button 2 +3 Right Button Button 3 +4 Side Button 1 Button 4 +5 Side Button 2 Button 7 +6 Wheel Negative Move Button 5 +7 Wheel Positive Move Button 6 +</verb> + +For the A4 Tech WinEasy mouse which has two wheels and 3 buttons, +you may have the following <tt>InputDevice</tt> section. + +<code> +Section "InputDevice" + Identifier "WinEasy" + Driver "mouse" + Option "Device" "/dev/mouse" + Option "Protocol" "IMPS/2" + Option "Buttons" "7" + Option "ZAxisMapping" "4 5 6 7" +EndSection +</code> + +The movement of the first wheel is mapped to the button 4 and 5. The +second wheel's movement will be reported as the buttons 6 and 7. + +The Kensington Expert mouse is really a trackball. It has 4 buttons +arranged in a rectangle around the ball. + +<code> +Section "InputDevice" + Identifier "DLB" + Driver "mouse" + Option "Protocol" "ThinkingMousePS/2" + Option "Buttons" "3" + Option "Emulate3Buttons" + Option "Device" "/dev/mouse" + Option "DragLockButtons" "2 1 4 3" +EndSection +</code> +In this example, button 2 is a drag lock button for button +number 1, and button 4 is a drag lock button for button 3. +Since button 2 is above button 1 and button 4 is above button 3 +in the layout of this trackball, this is reasonable. + +Because button 2 is being used as a drag lock, it can not be +used as an ordinary button. However, it can be activated by +using the "Emulate3Buttons" feature. However, some people my +be unable to press two buttons at the same time. They may +prefer the following <tt>InputDevice</tt> section which +defines button 4 as a master drag lock button, and leaves +button 2 free for ordinary use. +<code> +Section "InputDevice" + Identifier "MasterDLB" + Driver "mouse" + Option "Protocol" "ThinkingMousePS/2" + Option "Buttons" "3" + Option "Device" "/dev/mouse" + Option "DragLockButtons" "4" +EndSection +</code> + +</article> diff --git a/driver/xf86-input-mouse/aclocal.m4 b/driver/xf86-input-mouse/aclocal.m4 new file mode 100644 index 000000000..c578d51de --- /dev/null +++ b/driver/xf86-input-mouse/aclocal.m4 @@ -0,0 +1,7898 @@ +# generated automatically by aclocal 1.9.6 -*- Autoconf -*- + +# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2002, 2003, 2004, +# 2005 Free Software Foundation, Inc. +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + +# libtool.m4 - Configure libtool for the host system. -*-Autoconf-*- + +# serial 48 AC_PROG_LIBTOOL + + +# AC_PROVIDE_IFELSE(MACRO-NAME, IF-PROVIDED, IF-NOT-PROVIDED) +# ----------------------------------------------------------- +# If this macro is not defined by Autoconf, define it here. +m4_ifdef([AC_PROVIDE_IFELSE], + [], + [m4_define([AC_PROVIDE_IFELSE], + [m4_ifdef([AC_PROVIDE_$1], + [$2], [$3])])]) + + +# AC_PROG_LIBTOOL +# --------------- +AC_DEFUN([AC_PROG_LIBTOOL], +[AC_REQUIRE([_AC_PROG_LIBTOOL])dnl +dnl If AC_PROG_CXX has already been expanded, run AC_LIBTOOL_CXX +dnl immediately, otherwise, hook it in at the end of AC_PROG_CXX. + AC_PROVIDE_IFELSE([AC_PROG_CXX], + [AC_LIBTOOL_CXX], + [define([AC_PROG_CXX], defn([AC_PROG_CXX])[AC_LIBTOOL_CXX + ])]) +dnl And a similar setup for Fortran 77 support + AC_PROVIDE_IFELSE([AC_PROG_F77], + [AC_LIBTOOL_F77], + [define([AC_PROG_F77], defn([AC_PROG_F77])[AC_LIBTOOL_F77 +])]) + +dnl Quote A][M_PROG_GCJ so that aclocal doesn't bring it in needlessly. +dnl If either AC_PROG_GCJ or A][M_PROG_GCJ have already been expanded, run +dnl AC_LIBTOOL_GCJ immediately, otherwise, hook it in at the end of both. + AC_PROVIDE_IFELSE([AC_PROG_GCJ], + [AC_LIBTOOL_GCJ], + [AC_PROVIDE_IFELSE([A][M_PROG_GCJ], + [AC_LIBTOOL_GCJ], + [AC_PROVIDE_IFELSE([LT_AC_PROG_GCJ], + [AC_LIBTOOL_GCJ], + [ifdef([AC_PROG_GCJ], + [define([AC_PROG_GCJ], defn([AC_PROG_GCJ])[AC_LIBTOOL_GCJ])]) + ifdef([A][M_PROG_GCJ], + [define([A][M_PROG_GCJ], defn([A][M_PROG_GCJ])[AC_LIBTOOL_GCJ])]) + ifdef([LT_AC_PROG_GCJ], + [define([LT_AC_PROG_GCJ], + defn([LT_AC_PROG_GCJ])[AC_LIBTOOL_GCJ])])])]) +])])# AC_PROG_LIBTOOL + + +# _AC_PROG_LIBTOOL +# ---------------- +AC_DEFUN([_AC_PROG_LIBTOOL], +[AC_REQUIRE([AC_LIBTOOL_SETUP])dnl +AC_BEFORE([$0],[AC_LIBTOOL_CXX])dnl +AC_BEFORE([$0],[AC_LIBTOOL_F77])dnl +AC_BEFORE([$0],[AC_LIBTOOL_GCJ])dnl + +# This can be used to rebuild libtool when needed +LIBTOOL_DEPS="$ac_aux_dir/ltmain.sh" + +# Always use our own libtool. +LIBTOOL='$(SHELL) $(top_builddir)/libtool' +AC_SUBST(LIBTOOL)dnl + +# Prevent multiple expansion +define([AC_PROG_LIBTOOL], []) +])# _AC_PROG_LIBTOOL + + +# AC_LIBTOOL_SETUP +# ---------------- +AC_DEFUN([AC_LIBTOOL_SETUP], +[AC_PREREQ(2.50)dnl +AC_REQUIRE([AC_ENABLE_SHARED])dnl +AC_REQUIRE([AC_ENABLE_STATIC])dnl +AC_REQUIRE([AC_ENABLE_FAST_INSTALL])dnl +AC_REQUIRE([AC_CANONICAL_HOST])dnl +AC_REQUIRE([AC_CANONICAL_BUILD])dnl +AC_REQUIRE([AC_PROG_CC])dnl +AC_REQUIRE([AC_PROG_LD])dnl +AC_REQUIRE([AC_PROG_LD_RELOAD_FLAG])dnl +AC_REQUIRE([AC_PROG_NM])dnl + +AC_REQUIRE([AC_PROG_LN_S])dnl +AC_REQUIRE([AC_DEPLIBS_CHECK_METHOD])dnl +# Autoconf 2.13's AC_OBJEXT and AC_EXEEXT macros only works for C compilers! +AC_REQUIRE([AC_OBJEXT])dnl +AC_REQUIRE([AC_EXEEXT])dnl +dnl + +AC_LIBTOOL_SYS_MAX_CMD_LEN +AC_LIBTOOL_SYS_GLOBAL_SYMBOL_PIPE +AC_LIBTOOL_OBJDIR + +AC_REQUIRE([_LT_AC_SYS_COMPILER])dnl +_LT_AC_PROG_ECHO_BACKSLASH + +case $host_os in +aix3*) + # AIX sometimes has problems with the GCC collect2 program. For some + # reason, if we set the COLLECT_NAMES environment variable, the problems + # vanish in a puff of smoke. + if test "X${COLLECT_NAMES+set}" != Xset; then + COLLECT_NAMES= + export COLLECT_NAMES + fi + ;; +esac + +# Sed substitution that helps us do robust quoting. It backslashifies +# metacharacters that are still active within double-quoted strings. +Xsed='sed -e 1s/^X//' +[sed_quote_subst='s/\([\\"\\`$\\\\]\)/\\\1/g'] + +# Same as above, but do not quote variable references. +[double_quote_subst='s/\([\\"\\`\\\\]\)/\\\1/g'] + +# Sed substitution to delay expansion of an escaped shell variable in a +# double_quote_subst'ed string. +delay_variable_subst='s/\\\\\\\\\\\$/\\\\\\$/g' + +# Sed substitution to avoid accidental globbing in evaled expressions +no_glob_subst='s/\*/\\\*/g' + +# Constants: +rm="rm -f" + +# Global variables: +default_ofile=libtool +can_build_shared=yes + +# All known linkers require a `.a' archive for static linking (except MSVC, +# which needs '.lib'). +libext=a +ltmain="$ac_aux_dir/ltmain.sh" +ofile="$default_ofile" +with_gnu_ld="$lt_cv_prog_gnu_ld" + +AC_CHECK_TOOL(AR, ar, false) +AC_CHECK_TOOL(RANLIB, ranlib, :) +AC_CHECK_TOOL(STRIP, strip, :) + +old_CC="$CC" +old_CFLAGS="$CFLAGS" + +# Set sane defaults for various variables +test -z "$AR" && AR=ar +test -z "$AR_FLAGS" && AR_FLAGS=cru +test -z "$AS" && AS=as +test -z "$CC" && CC=cc +test -z "$LTCC" && LTCC=$CC +test -z "$LTCFLAGS" && LTCFLAGS=$CFLAGS +test -z "$DLLTOOL" && DLLTOOL=dlltool +test -z "$LD" && LD=ld +test -z "$LN_S" && LN_S="ln -s" +test -z "$MAGIC_CMD" && MAGIC_CMD=file +test -z "$NM" && NM=nm +test -z "$SED" && SED=sed +test -z "$OBJDUMP" && OBJDUMP=objdump +test -z "$RANLIB" && RANLIB=: +test -z "$STRIP" && STRIP=: +test -z "$ac_objext" && ac_objext=o + +# Determine commands to create old-style static archives. +old_archive_cmds='$AR $AR_FLAGS $oldlib$oldobjs$old_deplibs' +old_postinstall_cmds='chmod 644 $oldlib' +old_postuninstall_cmds= + +if test -n "$RANLIB"; then + case $host_os in + openbsd*) + old_postinstall_cmds="$old_postinstall_cmds~\$RANLIB -t \$oldlib" + ;; + *) + old_postinstall_cmds="$old_postinstall_cmds~\$RANLIB \$oldlib" + ;; + esac + old_archive_cmds="$old_archive_cmds~\$RANLIB \$oldlib" +fi + +_LT_CC_BASENAME([$compiler]) + +# Only perform the check for file, if the check method requires it +case $deplibs_check_method in +file_magic*) + if test "$file_magic_cmd" = '$MAGIC_CMD'; then + AC_PATH_MAGIC + fi + ;; +esac + +AC_PROVIDE_IFELSE([AC_LIBTOOL_DLOPEN], enable_dlopen=yes, enable_dlopen=no) +AC_PROVIDE_IFELSE([AC_LIBTOOL_WIN32_DLL], +enable_win32_dll=yes, enable_win32_dll=no) + +AC_ARG_ENABLE([libtool-lock], + [AC_HELP_STRING([--disable-libtool-lock], + [avoid locking (might break parallel builds)])]) +test "x$enable_libtool_lock" != xno && enable_libtool_lock=yes + +AC_ARG_WITH([pic], + [AC_HELP_STRING([--with-pic], + [try to use only PIC/non-PIC objects @<:@default=use both@:>@])], + [pic_mode="$withval"], + [pic_mode=default]) +test -z "$pic_mode" && pic_mode=default + +# Use C for the default configuration in the libtool script +tagname= +AC_LIBTOOL_LANG_C_CONFIG +_LT_AC_TAGCONFIG +])# AC_LIBTOOL_SETUP + + +# _LT_AC_SYS_COMPILER +# ------------------- +AC_DEFUN([_LT_AC_SYS_COMPILER], +[AC_REQUIRE([AC_PROG_CC])dnl + +# If no C compiler was specified, use CC. +LTCC=${LTCC-"$CC"} + +# If no C compiler flags were specified, use CFLAGS. +LTCFLAGS=${LTCFLAGS-"$CFLAGS"} + +# Allow CC to be a program name with arguments. +compiler=$CC +])# _LT_AC_SYS_COMPILER + + +# _LT_CC_BASENAME(CC) +# ------------------- +# Calculate cc_basename. Skip known compiler wrappers and cross-prefix. +AC_DEFUN([_LT_CC_BASENAME], +[for cc_temp in $1""; do + case $cc_temp in + compile | *[[\\/]]compile | ccache | *[[\\/]]ccache ) ;; + distcc | *[[\\/]]distcc | purify | *[[\\/]]purify ) ;; + \-*) ;; + *) break;; + esac +done +cc_basename=`$echo "X$cc_temp" | $Xsed -e 's%.*/%%' -e "s%^$host_alias-%%"` +]) + + +# _LT_COMPILER_BOILERPLATE +# ------------------------ +# Check for compiler boilerplate output or warnings with +# the simple compiler test code. +AC_DEFUN([_LT_COMPILER_BOILERPLATE], +[ac_outfile=conftest.$ac_objext +printf "$lt_simple_compile_test_code" >conftest.$ac_ext +eval "$ac_compile" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err +_lt_compiler_boilerplate=`cat conftest.err` +$rm conftest* +])# _LT_COMPILER_BOILERPLATE + + +# _LT_LINKER_BOILERPLATE +# ---------------------- +# Check for linker boilerplate output or warnings with +# the simple link test code. +AC_DEFUN([_LT_LINKER_BOILERPLATE], +[ac_outfile=conftest.$ac_objext +printf "$lt_simple_link_test_code" >conftest.$ac_ext +eval "$ac_link" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err +_lt_linker_boilerplate=`cat conftest.err` +$rm conftest* +])# _LT_LINKER_BOILERPLATE + + +# _LT_AC_SYS_LIBPATH_AIX +# ---------------------- +# Links a minimal program and checks the executable +# for the system default hardcoded library path. In most cases, +# this is /usr/lib:/lib, but when the MPI compilers are used +# the location of the communication and MPI libs are included too. +# If we don't find anything, use the default library path according +# to the aix ld manual. +AC_DEFUN([_LT_AC_SYS_LIBPATH_AIX], +[AC_LINK_IFELSE(AC_LANG_PROGRAM,[ +aix_libpath=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; } +}'` +# Check for a 64-bit object if we didn't find anything. +if test -z "$aix_libpath"; then aix_libpath=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; } +}'`; fi],[]) +if test -z "$aix_libpath"; then aix_libpath="/usr/lib:/lib"; fi +])# _LT_AC_SYS_LIBPATH_AIX + + +# _LT_AC_SHELL_INIT(ARG) +# ---------------------- +AC_DEFUN([_LT_AC_SHELL_INIT], +[ifdef([AC_DIVERSION_NOTICE], + [AC_DIVERT_PUSH(AC_DIVERSION_NOTICE)], + [AC_DIVERT_PUSH(NOTICE)]) +$1 +AC_DIVERT_POP +])# _LT_AC_SHELL_INIT + + +# _LT_AC_PROG_ECHO_BACKSLASH +# -------------------------- +# Add some code to the start of the generated configure script which +# will find an echo command which doesn't interpret backslashes. +AC_DEFUN([_LT_AC_PROG_ECHO_BACKSLASH], +[_LT_AC_SHELL_INIT([ +# Check that we are running under the correct shell. +SHELL=${CONFIG_SHELL-/bin/sh} + +case X$ECHO in +X*--fallback-echo) + # Remove one level of quotation (which was required for Make). + ECHO=`echo "$ECHO" | sed 's,\\\\\[$]\\[$]0,'[$]0','` + ;; +esac + +echo=${ECHO-echo} +if test "X[$]1" = X--no-reexec; then + # Discard the --no-reexec flag, and continue. + shift +elif test "X[$]1" = X--fallback-echo; then + # Avoid inline document here, it may be left over + : +elif test "X`($echo '\t') 2>/dev/null`" = 'X\t' ; then + # Yippee, $echo works! + : +else + # Restart under the correct shell. + exec $SHELL "[$]0" --no-reexec ${1+"[$]@"} +fi + +if test "X[$]1" = X--fallback-echo; then + # used as fallback echo + shift + cat <<EOF +[$]* +EOF + exit 0 +fi + +# The HP-UX ksh and POSIX shell print the target directory to stdout +# if CDPATH is set. +(unset CDPATH) >/dev/null 2>&1 && unset CDPATH + +if test -z "$ECHO"; then +if test "X${echo_test_string+set}" != Xset; then +# find a string as large as possible, as long as the shell can cope with it + for cmd in 'sed 50q "[$]0"' 'sed 20q "[$]0"' 'sed 10q "[$]0"' 'sed 2q "[$]0"' 'echo test'; do + # expected sizes: less than 2Kb, 1Kb, 512 bytes, 16 bytes, ... + if (echo_test_string=`eval $cmd`) 2>/dev/null && + echo_test_string=`eval $cmd` && + (test "X$echo_test_string" = "X$echo_test_string") 2>/dev/null + then + break + fi + done +fi + +if test "X`($echo '\t') 2>/dev/null`" = 'X\t' && + echo_testing_string=`($echo "$echo_test_string") 2>/dev/null` && + test "X$echo_testing_string" = "X$echo_test_string"; then + : +else + # The Solaris, AIX, and Digital Unix default echo programs unquote + # backslashes. This makes it impossible to quote backslashes using + # echo "$something" | sed 's/\\/\\\\/g' + # + # So, first we look for a working echo in the user's PATH. + + lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR + for dir in $PATH /usr/ucb; do + IFS="$lt_save_ifs" + if (test -f $dir/echo || test -f $dir/echo$ac_exeext) && + test "X`($dir/echo '\t') 2>/dev/null`" = 'X\t' && + echo_testing_string=`($dir/echo "$echo_test_string") 2>/dev/null` && + test "X$echo_testing_string" = "X$echo_test_string"; then + echo="$dir/echo" + break + fi + done + IFS="$lt_save_ifs" + + if test "X$echo" = Xecho; then + # We didn't find a better echo, so look for alternatives. + if test "X`(print -r '\t') 2>/dev/null`" = 'X\t' && + echo_testing_string=`(print -r "$echo_test_string") 2>/dev/null` && + test "X$echo_testing_string" = "X$echo_test_string"; then + # This shell has a builtin print -r that does the trick. + echo='print -r' + elif (test -f /bin/ksh || test -f /bin/ksh$ac_exeext) && + test "X$CONFIG_SHELL" != X/bin/ksh; then + # If we have ksh, try running configure again with it. + ORIGINAL_CONFIG_SHELL=${CONFIG_SHELL-/bin/sh} + export ORIGINAL_CONFIG_SHELL + CONFIG_SHELL=/bin/ksh + export CONFIG_SHELL + exec $CONFIG_SHELL "[$]0" --no-reexec ${1+"[$]@"} + else + # Try using printf. + echo='printf %s\n' + if test "X`($echo '\t') 2>/dev/null`" = 'X\t' && + echo_testing_string=`($echo "$echo_test_string") 2>/dev/null` && + test "X$echo_testing_string" = "X$echo_test_string"; then + # Cool, printf works + : + elif echo_testing_string=`($ORIGINAL_CONFIG_SHELL "[$]0" --fallback-echo '\t') 2>/dev/null` && + test "X$echo_testing_string" = 'X\t' && + echo_testing_string=`($ORIGINAL_CONFIG_SHELL "[$]0" --fallback-echo "$echo_test_string") 2>/dev/null` && + test "X$echo_testing_string" = "X$echo_test_string"; then + CONFIG_SHELL=$ORIGINAL_CONFIG_SHELL + export CONFIG_SHELL + SHELL="$CONFIG_SHELL" + export SHELL + echo="$CONFIG_SHELL [$]0 --fallback-echo" + elif echo_testing_string=`($CONFIG_SHELL "[$]0" --fallback-echo '\t') 2>/dev/null` && + test "X$echo_testing_string" = 'X\t' && + echo_testing_string=`($CONFIG_SHELL "[$]0" --fallback-echo "$echo_test_string") 2>/dev/null` && + test "X$echo_testing_string" = "X$echo_test_string"; then + echo="$CONFIG_SHELL [$]0 --fallback-echo" + else + # maybe with a smaller string... + prev=: + + for cmd in 'echo test' 'sed 2q "[$]0"' 'sed 10q "[$]0"' 'sed 20q "[$]0"' 'sed 50q "[$]0"'; do + if (test "X$echo_test_string" = "X`eval $cmd`") 2>/dev/null + then + break + fi + prev="$cmd" + done + + if test "$prev" != 'sed 50q "[$]0"'; then + echo_test_string=`eval $prev` + export echo_test_string + exec ${ORIGINAL_CONFIG_SHELL-${CONFIG_SHELL-/bin/sh}} "[$]0" ${1+"[$]@"} + else + # Oops. We lost completely, so just stick with echo. + echo=echo + fi + fi + fi + fi +fi +fi + +# Copy echo and quote the copy suitably for passing to libtool from +# the Makefile, instead of quoting the original, which is used later. +ECHO=$echo +if test "X$ECHO" = "X$CONFIG_SHELL [$]0 --fallback-echo"; then + ECHO="$CONFIG_SHELL \\\$\[$]0 --fallback-echo" +fi + +AC_SUBST(ECHO) +])])# _LT_AC_PROG_ECHO_BACKSLASH + + +# _LT_AC_LOCK +# ----------- +AC_DEFUN([_LT_AC_LOCK], +[AC_ARG_ENABLE([libtool-lock], + [AC_HELP_STRING([--disable-libtool-lock], + [avoid locking (might break parallel builds)])]) +test "x$enable_libtool_lock" != xno && enable_libtool_lock=yes + +# Some flags need to be propagated to the compiler or linker for good +# libtool support. +case $host in +ia64-*-hpux*) + # Find out which ABI we are using. + echo 'int i;' > conftest.$ac_ext + if AC_TRY_EVAL(ac_compile); then + case `/usr/bin/file conftest.$ac_objext` in + *ELF-32*) + HPUX_IA64_MODE="32" + ;; + *ELF-64*) + HPUX_IA64_MODE="64" + ;; + esac + fi + rm -rf conftest* + ;; +*-*-irix6*) + # Find out which ABI we are using. + echo '[#]line __oline__ "configure"' > conftest.$ac_ext + if AC_TRY_EVAL(ac_compile); then + if test "$lt_cv_prog_gnu_ld" = yes; then + case `/usr/bin/file conftest.$ac_objext` in + *32-bit*) + LD="${LD-ld} -melf32bsmip" + ;; + *N32*) + LD="${LD-ld} -melf32bmipn32" + ;; + *64-bit*) + LD="${LD-ld} -melf64bmip" + ;; + esac + else + case `/usr/bin/file conftest.$ac_objext` in + *32-bit*) + LD="${LD-ld} -32" + ;; + *N32*) + LD="${LD-ld} -n32" + ;; + *64-bit*) + LD="${LD-ld} -64" + ;; + esac + fi + fi + rm -rf conftest* + ;; + +x86_64-*linux*|ppc*-*linux*|powerpc*-*linux*|s390*-*linux*|sparc*-*linux*) + # Find out which ABI we are using. + echo 'int i;' > conftest.$ac_ext + if AC_TRY_EVAL(ac_compile); then + case `/usr/bin/file conftest.o` in + *32-bit*) + case $host in + x86_64-*linux*) + LD="${LD-ld} -m elf_i386" + ;; + ppc64-*linux*|powerpc64-*linux*) + LD="${LD-ld} -m elf32ppclinux" + ;; + s390x-*linux*) + LD="${LD-ld} -m elf_s390" + ;; + sparc64-*linux*) + LD="${LD-ld} -m elf32_sparc" + ;; + esac + ;; + *64-bit*) + case $host in + x86_64-*linux*) + LD="${LD-ld} -m elf_x86_64" + ;; + ppc*-*linux*|powerpc*-*linux*) + LD="${LD-ld} -m elf64ppc" + ;; + s390*-*linux*) + LD="${LD-ld} -m elf64_s390" + ;; + sparc*-*linux*) + LD="${LD-ld} -m elf64_sparc" + ;; + esac + ;; + esac + fi + rm -rf conftest* + ;; + +*-*-sco3.2v5*) + # On SCO OpenServer 5, we need -belf to get full-featured binaries. + SAVE_CFLAGS="$CFLAGS" + CFLAGS="$CFLAGS -belf" + AC_CACHE_CHECK([whether the C compiler needs -belf], lt_cv_cc_needs_belf, + [AC_LANG_PUSH(C) + AC_TRY_LINK([],[],[lt_cv_cc_needs_belf=yes],[lt_cv_cc_needs_belf=no]) + AC_LANG_POP]) + if test x"$lt_cv_cc_needs_belf" != x"yes"; then + # this is probably gcc 2.8.0, egcs 1.0 or newer; no need for -belf + CFLAGS="$SAVE_CFLAGS" + fi + ;; +sparc*-*solaris*) + # Find out which ABI we are using. + echo 'int i;' > conftest.$ac_ext + if AC_TRY_EVAL(ac_compile); then + case `/usr/bin/file conftest.o` in + *64-bit*) + case $lt_cv_prog_gnu_ld in + yes*) LD="${LD-ld} -m elf64_sparc" ;; + *) LD="${LD-ld} -64" ;; + esac + ;; + esac + fi + rm -rf conftest* + ;; + +AC_PROVIDE_IFELSE([AC_LIBTOOL_WIN32_DLL], +[*-*-cygwin* | *-*-mingw* | *-*-pw32*) + AC_CHECK_TOOL(DLLTOOL, dlltool, false) + AC_CHECK_TOOL(AS, as, false) + AC_CHECK_TOOL(OBJDUMP, objdump, false) + ;; + ]) +esac + +need_locks="$enable_libtool_lock" + +])# _LT_AC_LOCK + + +# AC_LIBTOOL_COMPILER_OPTION(MESSAGE, VARIABLE-NAME, FLAGS, +# [OUTPUT-FILE], [ACTION-SUCCESS], [ACTION-FAILURE]) +# ---------------------------------------------------------------- +# Check whether the given compiler option works +AC_DEFUN([AC_LIBTOOL_COMPILER_OPTION], +[AC_REQUIRE([LT_AC_PROG_SED]) +AC_CACHE_CHECK([$1], [$2], + [$2=no + ifelse([$4], , [ac_outfile=conftest.$ac_objext], [ac_outfile=$4]) + printf "$lt_simple_compile_test_code" > conftest.$ac_ext + lt_compiler_flag="$3" + # Insert the option either (1) after the last *FLAGS variable, or + # (2) before a word containing "conftest.", or (3) at the end. + # Note that $ac_compile itself does not contain backslashes and begins + # with a dollar sign (not a hyphen), so the echo should work correctly. + # The option is referenced via a variable to avoid confusing sed. + lt_compile=`echo "$ac_compile" | $SED \ + -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \ + -e 's: [[^ ]]*conftest\.: $lt_compiler_flag&:; t' \ + -e 's:$: $lt_compiler_flag:'` + (eval echo "\"\$as_me:__oline__: $lt_compile\"" >&AS_MESSAGE_LOG_FD) + (eval "$lt_compile" 2>conftest.err) + ac_status=$? + cat conftest.err >&AS_MESSAGE_LOG_FD + echo "$as_me:__oline__: \$? = $ac_status" >&AS_MESSAGE_LOG_FD + if (exit $ac_status) && test -s "$ac_outfile"; then + # The compiler can only warn and ignore the option if not recognized + # So say no if there are warnings other than the usual output. + $echo "X$_lt_compiler_boilerplate" | $Xsed -e '/^$/d' >conftest.exp + $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2 + if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then + $2=yes + fi + fi + $rm conftest* +]) + +if test x"[$]$2" = xyes; then + ifelse([$5], , :, [$5]) +else + ifelse([$6], , :, [$6]) +fi +])# AC_LIBTOOL_COMPILER_OPTION + + +# AC_LIBTOOL_LINKER_OPTION(MESSAGE, VARIABLE-NAME, FLAGS, +# [ACTION-SUCCESS], [ACTION-FAILURE]) +# ------------------------------------------------------------ +# Check whether the given compiler option works +AC_DEFUN([AC_LIBTOOL_LINKER_OPTION], +[AC_CACHE_CHECK([$1], [$2], + [$2=no + save_LDFLAGS="$LDFLAGS" + LDFLAGS="$LDFLAGS $3" + printf "$lt_simple_link_test_code" > conftest.$ac_ext + if (eval $ac_link 2>conftest.err) && test -s conftest$ac_exeext; then + # The linker can only warn and ignore the option if not recognized + # So say no if there are warnings + if test -s conftest.err; then + # Append any errors to the config.log. + cat conftest.err 1>&AS_MESSAGE_LOG_FD + $echo "X$_lt_linker_boilerplate" | $Xsed -e '/^$/d' > conftest.exp + $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2 + if diff conftest.exp conftest.er2 >/dev/null; then + $2=yes + fi + else + $2=yes + fi + fi + $rm conftest* + LDFLAGS="$save_LDFLAGS" +]) + +if test x"[$]$2" = xyes; then + ifelse([$4], , :, [$4]) +else + ifelse([$5], , :, [$5]) +fi +])# AC_LIBTOOL_LINKER_OPTION + + +# AC_LIBTOOL_SYS_MAX_CMD_LEN +# -------------------------- +AC_DEFUN([AC_LIBTOOL_SYS_MAX_CMD_LEN], +[# find the maximum length of command line arguments +AC_MSG_CHECKING([the maximum length of command line arguments]) +AC_CACHE_VAL([lt_cv_sys_max_cmd_len], [dnl + i=0 + teststring="ABCD" + + case $build_os in + msdosdjgpp*) + # On DJGPP, this test can blow up pretty badly due to problems in libc + # (any single argument exceeding 2000 bytes causes a buffer overrun + # during glob expansion). Even if it were fixed, the result of this + # check would be larger than it should be. + lt_cv_sys_max_cmd_len=12288; # 12K is about right + ;; + + gnu*) + # Under GNU Hurd, this test is not required because there is + # no limit to the length of command line arguments. + # Libtool will interpret -1 as no limit whatsoever + lt_cv_sys_max_cmd_len=-1; + ;; + + cygwin* | mingw*) + # On Win9x/ME, this test blows up -- it succeeds, but takes + # about 5 minutes as the teststring grows exponentially. + # Worse, since 9x/ME are not pre-emptively multitasking, + # you end up with a "frozen" computer, even though with patience + # the test eventually succeeds (with a max line length of 256k). + # Instead, let's just punt: use the minimum linelength reported by + # all of the supported platforms: 8192 (on NT/2K/XP). + lt_cv_sys_max_cmd_len=8192; + ;; + + amigaos*) + # On AmigaOS with pdksh, this test takes hours, literally. + # So we just punt and use a minimum line length of 8192. + lt_cv_sys_max_cmd_len=8192; + ;; + + netbsd* | freebsd* | openbsd* | darwin* | dragonfly*) + # This has been around since 386BSD, at least. Likely further. + if test -x /sbin/sysctl; then + lt_cv_sys_max_cmd_len=`/sbin/sysctl -n kern.argmax` + elif test -x /usr/sbin/sysctl; then + lt_cv_sys_max_cmd_len=`/usr/sbin/sysctl -n kern.argmax` + else + lt_cv_sys_max_cmd_len=65536 # usable default for all BSDs + fi + # And add a safety zone + lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 4` + lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \* 3` + ;; + + interix*) + # We know the value 262144 and hardcode it with a safety zone (like BSD) + lt_cv_sys_max_cmd_len=196608 + ;; + + osf*) + # Dr. Hans Ekkehard Plesser reports seeing a kernel panic running configure + # due to this test when exec_disable_arg_limit is 1 on Tru64. It is not + # nice to cause kernel panics so lets avoid the loop below. + # First set a reasonable default. + lt_cv_sys_max_cmd_len=16384 + # + if test -x /sbin/sysconfig; then + case `/sbin/sysconfig -q proc exec_disable_arg_limit` in + *1*) lt_cv_sys_max_cmd_len=-1 ;; + esac + fi + ;; + sco3.2v5*) + lt_cv_sys_max_cmd_len=102400 + ;; + sysv5* | sco5v6* | sysv4.2uw2*) + kargmax=`grep ARG_MAX /etc/conf/cf.d/stune 2>/dev/null` + if test -n "$kargmax"; then + lt_cv_sys_max_cmd_len=`echo $kargmax | sed 's/.*[[ ]]//'` + else + lt_cv_sys_max_cmd_len=32768 + fi + ;; + *) + # If test is not a shell built-in, we'll probably end up computing a + # maximum length that is only half of the actual maximum length, but + # we can't tell. + SHELL=${SHELL-${CONFIG_SHELL-/bin/sh}} + while (test "X"`$SHELL [$]0 --fallback-echo "X$teststring" 2>/dev/null` \ + = "XX$teststring") >/dev/null 2>&1 && + new_result=`expr "X$teststring" : ".*" 2>&1` && + lt_cv_sys_max_cmd_len=$new_result && + test $i != 17 # 1/2 MB should be enough + do + i=`expr $i + 1` + teststring=$teststring$teststring + done + teststring= + # Add a significant safety factor because C++ compilers can tack on massive + # amounts of additional arguments before passing them to the linker. + # It appears as though 1/2 is a usable value. + lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 2` + ;; + esac +]) +if test -n $lt_cv_sys_max_cmd_len ; then + AC_MSG_RESULT($lt_cv_sys_max_cmd_len) +else + AC_MSG_RESULT(none) +fi +])# AC_LIBTOOL_SYS_MAX_CMD_LEN + + +# _LT_AC_CHECK_DLFCN +# ------------------ +AC_DEFUN([_LT_AC_CHECK_DLFCN], +[AC_CHECK_HEADERS(dlfcn.h)dnl +])# _LT_AC_CHECK_DLFCN + + +# _LT_AC_TRY_DLOPEN_SELF (ACTION-IF-TRUE, ACTION-IF-TRUE-W-USCORE, +# ACTION-IF-FALSE, ACTION-IF-CROSS-COMPILING) +# --------------------------------------------------------------------- +AC_DEFUN([_LT_AC_TRY_DLOPEN_SELF], +[AC_REQUIRE([_LT_AC_CHECK_DLFCN])dnl +if test "$cross_compiling" = yes; then : + [$4] +else + lt_dlunknown=0; lt_dlno_uscore=1; lt_dlneed_uscore=2 + lt_status=$lt_dlunknown + cat > conftest.$ac_ext <<EOF +[#line __oline__ "configure" +#include "confdefs.h" + +#if HAVE_DLFCN_H +#include <dlfcn.h> +#endif + +#include <stdio.h> + +#ifdef RTLD_GLOBAL +# define LT_DLGLOBAL RTLD_GLOBAL +#else +# ifdef DL_GLOBAL +# define LT_DLGLOBAL DL_GLOBAL +# else +# define LT_DLGLOBAL 0 +# endif +#endif + +/* We may have to define LT_DLLAZY_OR_NOW in the command line if we + find out it does not work in some platform. */ +#ifndef LT_DLLAZY_OR_NOW +# ifdef RTLD_LAZY +# define LT_DLLAZY_OR_NOW RTLD_LAZY +# else +# ifdef DL_LAZY +# define LT_DLLAZY_OR_NOW DL_LAZY +# else +# ifdef RTLD_NOW +# define LT_DLLAZY_OR_NOW RTLD_NOW +# else +# ifdef DL_NOW +# define LT_DLLAZY_OR_NOW DL_NOW +# else +# define LT_DLLAZY_OR_NOW 0 +# endif +# endif +# endif +# endif +#endif + +#ifdef __cplusplus +extern "C" void exit (int); +#endif + +void fnord() { int i=42;} +int main () +{ + void *self = dlopen (0, LT_DLGLOBAL|LT_DLLAZY_OR_NOW); + int status = $lt_dlunknown; + + if (self) + { + if (dlsym (self,"fnord")) status = $lt_dlno_uscore; + else if (dlsym( self,"_fnord")) status = $lt_dlneed_uscore; + /* dlclose (self); */ + } + else + puts (dlerror ()); + + exit (status); +}] +EOF + if AC_TRY_EVAL(ac_link) && test -s conftest${ac_exeext} 2>/dev/null; then + (./conftest; exit; ) >&AS_MESSAGE_LOG_FD 2>/dev/null + lt_status=$? + case x$lt_status in + x$lt_dlno_uscore) $1 ;; + x$lt_dlneed_uscore) $2 ;; + x$lt_dlunknown|x*) $3 ;; + esac + else : + # compilation failed + $3 + fi +fi +rm -fr conftest* +])# _LT_AC_TRY_DLOPEN_SELF + + +# AC_LIBTOOL_DLOPEN_SELF +# ---------------------- +AC_DEFUN([AC_LIBTOOL_DLOPEN_SELF], +[AC_REQUIRE([_LT_AC_CHECK_DLFCN])dnl +if test "x$enable_dlopen" != xyes; then + enable_dlopen=unknown + enable_dlopen_self=unknown + enable_dlopen_self_static=unknown +else + lt_cv_dlopen=no + lt_cv_dlopen_libs= + + case $host_os in + beos*) + lt_cv_dlopen="load_add_on" + lt_cv_dlopen_libs= + lt_cv_dlopen_self=yes + ;; + + mingw* | pw32*) + lt_cv_dlopen="LoadLibrary" + lt_cv_dlopen_libs= + ;; + + cygwin*) + lt_cv_dlopen="dlopen" + lt_cv_dlopen_libs= + ;; + + darwin*) + # if libdl is installed we need to link against it + AC_CHECK_LIB([dl], [dlopen], + [lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-ldl"],[ + lt_cv_dlopen="dyld" + lt_cv_dlopen_libs= + lt_cv_dlopen_self=yes + ]) + ;; + + *) + AC_CHECK_FUNC([shl_load], + [lt_cv_dlopen="shl_load"], + [AC_CHECK_LIB([dld], [shl_load], + [lt_cv_dlopen="shl_load" lt_cv_dlopen_libs="-dld"], + [AC_CHECK_FUNC([dlopen], + [lt_cv_dlopen="dlopen"], + [AC_CHECK_LIB([dl], [dlopen], + [lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-ldl"], + [AC_CHECK_LIB([svld], [dlopen], + [lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-lsvld"], + [AC_CHECK_LIB([dld], [dld_link], + [lt_cv_dlopen="dld_link" lt_cv_dlopen_libs="-dld"]) + ]) + ]) + ]) + ]) + ]) + ;; + esac + + if test "x$lt_cv_dlopen" != xno; then + enable_dlopen=yes + else + enable_dlopen=no + fi + + case $lt_cv_dlopen in + dlopen) + save_CPPFLAGS="$CPPFLAGS" + test "x$ac_cv_header_dlfcn_h" = xyes && CPPFLAGS="$CPPFLAGS -DHAVE_DLFCN_H" + + save_LDFLAGS="$LDFLAGS" + wl=$lt_prog_compiler_wl eval LDFLAGS=\"\$LDFLAGS $export_dynamic_flag_spec\" + + save_LIBS="$LIBS" + LIBS="$lt_cv_dlopen_libs $LIBS" + + AC_CACHE_CHECK([whether a program can dlopen itself], + lt_cv_dlopen_self, [dnl + _LT_AC_TRY_DLOPEN_SELF( + lt_cv_dlopen_self=yes, lt_cv_dlopen_self=yes, + lt_cv_dlopen_self=no, lt_cv_dlopen_self=cross) + ]) + + if test "x$lt_cv_dlopen_self" = xyes; then + wl=$lt_prog_compiler_wl eval LDFLAGS=\"\$LDFLAGS $lt_prog_compiler_static\" + AC_CACHE_CHECK([whether a statically linked program can dlopen itself], + lt_cv_dlopen_self_static, [dnl + _LT_AC_TRY_DLOPEN_SELF( + lt_cv_dlopen_self_static=yes, lt_cv_dlopen_self_static=yes, + lt_cv_dlopen_self_static=no, lt_cv_dlopen_self_static=cross) + ]) + fi + + CPPFLAGS="$save_CPPFLAGS" + LDFLAGS="$save_LDFLAGS" + LIBS="$save_LIBS" + ;; + esac + + case $lt_cv_dlopen_self in + yes|no) enable_dlopen_self=$lt_cv_dlopen_self ;; + *) enable_dlopen_self=unknown ;; + esac + + case $lt_cv_dlopen_self_static in + yes|no) enable_dlopen_self_static=$lt_cv_dlopen_self_static ;; + *) enable_dlopen_self_static=unknown ;; + esac +fi +])# AC_LIBTOOL_DLOPEN_SELF + + +# AC_LIBTOOL_PROG_CC_C_O([TAGNAME]) +# --------------------------------- +# Check to see if options -c and -o are simultaneously supported by compiler +AC_DEFUN([AC_LIBTOOL_PROG_CC_C_O], +[AC_REQUIRE([_LT_AC_SYS_COMPILER])dnl +AC_CACHE_CHECK([if $compiler supports -c -o file.$ac_objext], + [_LT_AC_TAGVAR(lt_cv_prog_compiler_c_o, $1)], + [_LT_AC_TAGVAR(lt_cv_prog_compiler_c_o, $1)=no + $rm -r conftest 2>/dev/null + mkdir conftest + cd conftest + mkdir out + printf "$lt_simple_compile_test_code" > conftest.$ac_ext + + lt_compiler_flag="-o out/conftest2.$ac_objext" + # Insert the option either (1) after the last *FLAGS variable, or + # (2) before a word containing "conftest.", or (3) at the end. + # Note that $ac_compile itself does not contain backslashes and begins + # with a dollar sign (not a hyphen), so the echo should work correctly. + lt_compile=`echo "$ac_compile" | $SED \ + -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \ + -e 's: [[^ ]]*conftest\.: $lt_compiler_flag&:; t' \ + -e 's:$: $lt_compiler_flag:'` + (eval echo "\"\$as_me:__oline__: $lt_compile\"" >&AS_MESSAGE_LOG_FD) + (eval "$lt_compile" 2>out/conftest.err) + ac_status=$? + cat out/conftest.err >&AS_MESSAGE_LOG_FD + echo "$as_me:__oline__: \$? = $ac_status" >&AS_MESSAGE_LOG_FD + if (exit $ac_status) && test -s out/conftest2.$ac_objext + then + # The compiler can only warn and ignore the option if not recognized + # So say no if there are warnings + $echo "X$_lt_compiler_boilerplate" | $Xsed -e '/^$/d' > out/conftest.exp + $SED '/^$/d; /^ *+/d' out/conftest.err >out/conftest.er2 + if test ! -s out/conftest.er2 || diff out/conftest.exp out/conftest.er2 >/dev/null; then + _LT_AC_TAGVAR(lt_cv_prog_compiler_c_o, $1)=yes + fi + fi + chmod u+w . 2>&AS_MESSAGE_LOG_FD + $rm conftest* + # SGI C++ compiler will create directory out/ii_files/ for + # template instantiation + test -d out/ii_files && $rm out/ii_files/* && rmdir out/ii_files + $rm out/* && rmdir out + cd .. + rmdir conftest + $rm conftest* +]) +])# AC_LIBTOOL_PROG_CC_C_O + + +# AC_LIBTOOL_SYS_HARD_LINK_LOCKS([TAGNAME]) +# ----------------------------------------- +# Check to see if we can do hard links to lock some files if needed +AC_DEFUN([AC_LIBTOOL_SYS_HARD_LINK_LOCKS], +[AC_REQUIRE([_LT_AC_LOCK])dnl + +hard_links="nottested" +if test "$_LT_AC_TAGVAR(lt_cv_prog_compiler_c_o, $1)" = no && test "$need_locks" != no; then + # do not overwrite the value of need_locks provided by the user + AC_MSG_CHECKING([if we can lock with hard links]) + hard_links=yes + $rm conftest* + ln conftest.a conftest.b 2>/dev/null && hard_links=no + touch conftest.a + ln conftest.a conftest.b 2>&5 || hard_links=no + ln conftest.a conftest.b 2>/dev/null && hard_links=no + AC_MSG_RESULT([$hard_links]) + if test "$hard_links" = no; then + AC_MSG_WARN([`$CC' does not support `-c -o', so `make -j' may be unsafe]) + need_locks=warn + fi +else + need_locks=no +fi +])# AC_LIBTOOL_SYS_HARD_LINK_LOCKS + + +# AC_LIBTOOL_OBJDIR +# ----------------- +AC_DEFUN([AC_LIBTOOL_OBJDIR], +[AC_CACHE_CHECK([for objdir], [lt_cv_objdir], +[rm -f .libs 2>/dev/null +mkdir .libs 2>/dev/null +if test -d .libs; then + lt_cv_objdir=.libs +else + # MS-DOS does not allow filenames that begin with a dot. + lt_cv_objdir=_libs +fi +rmdir .libs 2>/dev/null]) +objdir=$lt_cv_objdir +])# AC_LIBTOOL_OBJDIR + + +# AC_LIBTOOL_PROG_LD_HARDCODE_LIBPATH([TAGNAME]) +# ---------------------------------------------- +# Check hardcoding attributes. +AC_DEFUN([AC_LIBTOOL_PROG_LD_HARDCODE_LIBPATH], +[AC_MSG_CHECKING([how to hardcode library paths into programs]) +_LT_AC_TAGVAR(hardcode_action, $1)= +if test -n "$_LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)" || \ + test -n "$_LT_AC_TAGVAR(runpath_var, $1)" || \ + test "X$_LT_AC_TAGVAR(hardcode_automatic, $1)" = "Xyes" ; then + + # We can hardcode non-existant directories. + if test "$_LT_AC_TAGVAR(hardcode_direct, $1)" != no && + # If the only mechanism to avoid hardcoding is shlibpath_var, we + # have to relink, otherwise we might link with an installed library + # when we should be linking with a yet-to-be-installed one + ## test "$_LT_AC_TAGVAR(hardcode_shlibpath_var, $1)" != no && + test "$_LT_AC_TAGVAR(hardcode_minus_L, $1)" != no; then + # Linking always hardcodes the temporary library directory. + _LT_AC_TAGVAR(hardcode_action, $1)=relink + else + # We can link without hardcoding, and we can hardcode nonexisting dirs. + _LT_AC_TAGVAR(hardcode_action, $1)=immediate + fi +else + # We cannot hardcode anything, or else we can only hardcode existing + # directories. + _LT_AC_TAGVAR(hardcode_action, $1)=unsupported +fi +AC_MSG_RESULT([$_LT_AC_TAGVAR(hardcode_action, $1)]) + +if test "$_LT_AC_TAGVAR(hardcode_action, $1)" = relink; then + # Fast installation is not supported + enable_fast_install=no +elif test "$shlibpath_overrides_runpath" = yes || + test "$enable_shared" = no; then + # Fast installation is not necessary + enable_fast_install=needless +fi +])# AC_LIBTOOL_PROG_LD_HARDCODE_LIBPATH + + +# AC_LIBTOOL_SYS_LIB_STRIP +# ------------------------ +AC_DEFUN([AC_LIBTOOL_SYS_LIB_STRIP], +[striplib= +old_striplib= +AC_MSG_CHECKING([whether stripping libraries is possible]) +if test -n "$STRIP" && $STRIP -V 2>&1 | grep "GNU strip" >/dev/null; then + test -z "$old_striplib" && old_striplib="$STRIP --strip-debug" + test -z "$striplib" && striplib="$STRIP --strip-unneeded" + AC_MSG_RESULT([yes]) +else +# FIXME - insert some real tests, host_os isn't really good enough + case $host_os in + darwin*) + if test -n "$STRIP" ; then + striplib="$STRIP -x" + AC_MSG_RESULT([yes]) + else + AC_MSG_RESULT([no]) +fi + ;; + *) + AC_MSG_RESULT([no]) + ;; + esac +fi +])# AC_LIBTOOL_SYS_LIB_STRIP + + +# AC_LIBTOOL_SYS_DYNAMIC_LINKER +# ----------------------------- +# PORTME Fill in your ld.so characteristics +AC_DEFUN([AC_LIBTOOL_SYS_DYNAMIC_LINKER], +[AC_MSG_CHECKING([dynamic linker characteristics]) +library_names_spec= +libname_spec='lib$name' +soname_spec= +shrext_cmds=".so" +postinstall_cmds= +postuninstall_cmds= +finish_cmds= +finish_eval= +shlibpath_var= +shlibpath_overrides_runpath=unknown +version_type=none +dynamic_linker="$host_os ld.so" +sys_lib_dlsearch_path_spec="/lib /usr/lib" +if test "$GCC" = yes; then + sys_lib_search_path_spec=`$CC -print-search-dirs | grep "^libraries:" | $SED -e "s/^libraries://" -e "s,=/,/,g"` + if echo "$sys_lib_search_path_spec" | grep ';' >/dev/null ; then + # if the path contains ";" then we assume it to be the separator + # otherwise default to the standard path separator (i.e. ":") - it is + # assumed that no part of a normal pathname contains ";" but that should + # okay in the real world where ";" in dirpaths is itself problematic. + sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'` + else + sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"` + fi +else + sys_lib_search_path_spec="/lib /usr/lib /usr/local/lib" +fi +need_lib_prefix=unknown +hardcode_into_libs=no + +# when you set need_version to no, make sure it does not cause -set_version +# flags to be left without arguments +need_version=unknown + +case $host_os in +aix3*) + version_type=linux + library_names_spec='${libname}${release}${shared_ext}$versuffix $libname.a' + shlibpath_var=LIBPATH + + # AIX 3 has no versioning support, so we append a major version to the name. + soname_spec='${libname}${release}${shared_ext}$major' + ;; + +aix4* | aix5*) + version_type=linux + need_lib_prefix=no + need_version=no + hardcode_into_libs=yes + if test "$host_cpu" = ia64; then + # AIX 5 supports IA64 + library_names_spec='${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext}$versuffix $libname${shared_ext}' + shlibpath_var=LD_LIBRARY_PATH + else + # With GCC up to 2.95.x, collect2 would create an import file + # for dependence libraries. The import file would start with + # the line `#! .'. This would cause the generated library to + # depend on `.', always an invalid library. This was fixed in + # development snapshots of GCC prior to 3.0. + case $host_os in + aix4 | aix4.[[01]] | aix4.[[01]].*) + if { echo '#if __GNUC__ > 2 || (__GNUC__ == 2 && __GNUC_MINOR__ >= 97)' + echo ' yes ' + echo '#endif'; } | ${CC} -E - | grep yes > /dev/null; then + : + else + can_build_shared=no + fi + ;; + esac + # AIX (on Power*) has no versioning support, so currently we can not hardcode correct + # soname into executable. Probably we can add versioning support to + # collect2, so additional links can be useful in future. + if test "$aix_use_runtimelinking" = yes; then + # If using run time linking (on AIX 4.2 or later) use lib<name>.so + # instead of lib<name>.a to let people know that these are not + # typical AIX shared libraries. + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + else + # We preserve .a as extension for shared libraries through AIX4.2 + # and later when we are not doing run time linking. + library_names_spec='${libname}${release}.a $libname.a' + soname_spec='${libname}${release}${shared_ext}$major' + fi + shlibpath_var=LIBPATH + fi + ;; + +amigaos*) + library_names_spec='$libname.ixlibrary $libname.a' + # Create ${libname}_ixlibrary.a entries in /sys/libs. + finish_eval='for lib in `ls $libdir/*.ixlibrary 2>/dev/null`; do libname=`$echo "X$lib" | $Xsed -e '\''s%^.*/\([[^/]]*\)\.ixlibrary$%\1%'\''`; test $rm /sys/libs/${libname}_ixlibrary.a; $show "cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a"; cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a || exit 1; done' + ;; + +beos*) + library_names_spec='${libname}${shared_ext}' + dynamic_linker="$host_os ld.so" + shlibpath_var=LIBRARY_PATH + ;; + +bsdi[[45]]*) + version_type=linux + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + finish_cmds='PATH="\$PATH:/sbin" ldconfig $libdir' + shlibpath_var=LD_LIBRARY_PATH + sys_lib_search_path_spec="/shlib /usr/lib /usr/X11/lib /usr/contrib/lib /lib /usr/local/lib" + sys_lib_dlsearch_path_spec="/shlib /usr/lib /usr/local/lib" + # the default ld.so.conf also contains /usr/contrib/lib and + # /usr/X11R6/lib (/usr/X11 is a link to /usr/X11R6), but let us allow + # libtool to hard-code these into programs + ;; + +cygwin* | mingw* | pw32*) + version_type=windows + shrext_cmds=".dll" + need_version=no + need_lib_prefix=no + + case $GCC,$host_os in + yes,cygwin* | yes,mingw* | yes,pw32*) + library_names_spec='$libname.dll.a' + # DLL is installed to $(libdir)/../bin by postinstall_cmds + postinstall_cmds='base_file=`basename \${file}`~ + dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\${base_file}'\''i;echo \$dlname'\''`~ + dldir=$destdir/`dirname \$dlpath`~ + test -d \$dldir || mkdir -p \$dldir~ + $install_prog $dir/$dlname \$dldir/$dlname~ + chmod a+x \$dldir/$dlname' + postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~ + dlpath=$dir/\$dldll~ + $rm \$dlpath' + shlibpath_overrides_runpath=yes + + case $host_os in + cygwin*) + # Cygwin DLLs use 'cyg' prefix rather than 'lib' + soname_spec='`echo ${libname} | sed -e 's/^lib/cyg/'``echo ${release} | $SED -e 's/[[.]]/-/g'`${versuffix}${shared_ext}' + sys_lib_search_path_spec="/usr/lib /lib/w32api /lib /usr/local/lib" + ;; + mingw*) + # MinGW DLLs use traditional 'lib' prefix + soname_spec='${libname}`echo ${release} | $SED -e 's/[[.]]/-/g'`${versuffix}${shared_ext}' + sys_lib_search_path_spec=`$CC -print-search-dirs | grep "^libraries:" | $SED -e "s/^libraries://" -e "s,=/,/,g"` + if echo "$sys_lib_search_path_spec" | [grep ';[c-zC-Z]:/' >/dev/null]; then + # It is most probably a Windows format PATH printed by + # mingw gcc, but we are running on Cygwin. Gcc prints its search + # path with ; separators, and with drive letters. We can handle the + # drive letters (cygwin fileutils understands them), so leave them, + # especially as we might pass files found there to a mingw objdump, + # which wouldn't understand a cygwinified path. Ahh. + sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'` + else + sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"` + fi + ;; + pw32*) + # pw32 DLLs use 'pw' prefix rather than 'lib' + library_names_spec='`echo ${libname} | sed -e 's/^lib/pw/'``echo ${release} | $SED -e 's/[[.]]/-/g'`${versuffix}${shared_ext}' + ;; + esac + ;; + + *) + library_names_spec='${libname}`echo ${release} | $SED -e 's/[[.]]/-/g'`${versuffix}${shared_ext} $libname.lib' + ;; + esac + dynamic_linker='Win32 ld.exe' + # FIXME: first we should search . and the directory the executable is in + shlibpath_var=PATH + ;; + +darwin* | rhapsody*) + dynamic_linker="$host_os dyld" + version_type=darwin + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${versuffix}$shared_ext ${libname}${release}${major}$shared_ext ${libname}$shared_ext' + soname_spec='${libname}${release}${major}$shared_ext' + shlibpath_overrides_runpath=yes + shlibpath_var=DYLD_LIBRARY_PATH + shrext_cmds='`test .$module = .yes && echo .so || echo .dylib`' + # Apple's gcc prints 'gcc -print-search-dirs' doesn't operate the same. + if test "$GCC" = yes; then + sys_lib_search_path_spec=`$CC -print-search-dirs | tr "\n" "$PATH_SEPARATOR" | sed -e 's/libraries:/@libraries:/' | tr "@" "\n" | grep "^libraries:" | sed -e "s/^libraries://" -e "s,=/,/,g" -e "s,$PATH_SEPARATOR, ,g" -e "s,.*,& /lib /usr/lib /usr/local/lib,g"` + else + sys_lib_search_path_spec='/lib /usr/lib /usr/local/lib' + fi + sys_lib_dlsearch_path_spec='/usr/local/lib /lib /usr/lib' + ;; + +dgux*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname$shared_ext' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + ;; + +freebsd1*) + dynamic_linker=no + ;; + +kfreebsd*-gnu) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + dynamic_linker='GNU ld.so' + ;; + +freebsd* | dragonfly*) + # DragonFly does not have aout. When/if they implement a new + # versioning mechanism, adjust this. + if test -x /usr/bin/objformat; then + objformat=`/usr/bin/objformat` + else + case $host_os in + freebsd[[123]]*) objformat=aout ;; + *) objformat=elf ;; + esac + fi + version_type=freebsd-$objformat + case $version_type in + freebsd-elf*) + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}' + need_version=no + need_lib_prefix=no + ;; + freebsd-*) + library_names_spec='${libname}${release}${shared_ext}$versuffix $libname${shared_ext}$versuffix' + need_version=yes + ;; + esac + shlibpath_var=LD_LIBRARY_PATH + case $host_os in + freebsd2*) + shlibpath_overrides_runpath=yes + ;; + freebsd3.[[01]]* | freebsdelf3.[[01]]*) + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + ;; + freebsd3.[[2-9]]* | freebsdelf3.[[2-9]]* | \ + freebsd4.[[0-5]] | freebsdelf4.[[0-5]] | freebsd4.1.1 | freebsdelf4.1.1) + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + ;; + freebsd*) # from 4.6 on + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + ;; + esac + ;; + +gnu*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}${major} ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + hardcode_into_libs=yes + ;; + +hpux9* | hpux10* | hpux11*) + # Give a soname corresponding to the major version so that dld.sl refuses to + # link against other versions. + version_type=sunos + need_lib_prefix=no + need_version=no + case $host_cpu in + ia64*) + shrext_cmds='.so' + hardcode_into_libs=yes + dynamic_linker="$host_os dld.so" + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes # Unless +noenvvar is specified. + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + if test "X$HPUX_IA64_MODE" = X32; then + sys_lib_search_path_spec="/usr/lib/hpux32 /usr/local/lib/hpux32 /usr/local/lib" + else + sys_lib_search_path_spec="/usr/lib/hpux64 /usr/local/lib/hpux64" + fi + sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec + ;; + hppa*64*) + shrext_cmds='.sl' + hardcode_into_libs=yes + dynamic_linker="$host_os dld.sl" + shlibpath_var=LD_LIBRARY_PATH # How should we handle SHLIB_PATH + shlibpath_overrides_runpath=yes # Unless +noenvvar is specified. + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + sys_lib_search_path_spec="/usr/lib/pa20_64 /usr/ccs/lib/pa20_64" + sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec + ;; + *) + shrext_cmds='.sl' + dynamic_linker="$host_os dld.sl" + shlibpath_var=SHLIB_PATH + shlibpath_overrides_runpath=no # +s is required to enable SHLIB_PATH + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + ;; + esac + # HP-UX runs *really* slowly unless shared libraries are mode 555. + postinstall_cmds='chmod 555 $lib' + ;; + +interix3*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + dynamic_linker='Interix 3.x ld.so.1 (PE, like ELF)' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + ;; + +irix5* | irix6* | nonstopux*) + case $host_os in + nonstopux*) version_type=nonstopux ;; + *) + if test "$lt_cv_prog_gnu_ld" = yes; then + version_type=linux + else + version_type=irix + fi ;; + esac + need_lib_prefix=no + need_version=no + soname_spec='${libname}${release}${shared_ext}$major' + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext} $libname${shared_ext}' + case $host_os in + irix5* | nonstopux*) + libsuff= shlibsuff= + ;; + *) + case $LD in # libtool.m4 will add one of these switches to LD + *-32|*"-32 "|*-melf32bsmip|*"-melf32bsmip ") + libsuff= shlibsuff= libmagic=32-bit;; + *-n32|*"-n32 "|*-melf32bmipn32|*"-melf32bmipn32 ") + libsuff=32 shlibsuff=N32 libmagic=N32;; + *-64|*"-64 "|*-melf64bmip|*"-melf64bmip ") + libsuff=64 shlibsuff=64 libmagic=64-bit;; + *) libsuff= shlibsuff= libmagic=never-match;; + esac + ;; + esac + shlibpath_var=LD_LIBRARY${shlibsuff}_PATH + shlibpath_overrides_runpath=no + sys_lib_search_path_spec="/usr/lib${libsuff} /lib${libsuff} /usr/local/lib${libsuff}" + sys_lib_dlsearch_path_spec="/usr/lib${libsuff} /lib${libsuff}" + hardcode_into_libs=yes + ;; + +# No shared lib support for Linux oldld, aout, or coff. +linux*oldld* | linux*aout* | linux*coff*) + dynamic_linker=no + ;; + +# This must be Linux ELF. +linux*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -n $libdir' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + # This implies no fast_install, which is unacceptable. + # Some rework will be needed to allow for fast_install + # before this can be enabled. + hardcode_into_libs=yes + + # find out which ABI we are using + libsuff= + case "$host_cpu" in + x86_64*|s390x*|powerpc64*) + echo '[#]line __oline__ "configure"' > conftest.$ac_ext + if AC_TRY_EVAL(ac_compile); then + case `/usr/bin/file conftest.$ac_objext` in + *64-bit*) + libsuff=64 + sys_lib_search_path_spec="/lib${libsuff} /usr/lib${libsuff} /usr/local/lib${libsuff}" + ;; + esac + fi + rm -rf conftest* + ;; + esac + + # Append ld.so.conf contents to the search path + if test -f /etc/ld.so.conf; then + lt_ld_extra=`awk '/^include / { system(sprintf("cd /etc; cat %s 2>/dev/null", \[$]2)); skip = 1; } { if (!skip) print \[$]0; skip = 0; }' < /etc/ld.so.conf | $SED -e 's/#.*//;s/[:, ]/ /g;s/=[^=]*$//;s/=[^= ]* / /g;/^$/d' | tr '\n' ' '` + sys_lib_dlsearch_path_spec="/lib${libsuff} /usr/lib${libsuff} $lt_ld_extra" + fi + + # We used to test for /lib/ld.so.1 and disable shared libraries on + # powerpc, because MkLinux only supported shared libraries with the + # GNU dynamic linker. Since this was broken with cross compilers, + # most powerpc-linux boxes support dynamic linking these days and + # people can always --disable-shared, the test was removed, and we + # assume the GNU/Linux dynamic linker is in use. + dynamic_linker='GNU/Linux ld.so' + ;; + +knetbsd*-gnu) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + dynamic_linker='GNU ld.so' + ;; + +netbsd*) + version_type=sunos + need_lib_prefix=no + need_version=no + if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir' + dynamic_linker='NetBSD (a.out) ld.so' + else + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + dynamic_linker='NetBSD ld.elf_so' + fi + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + ;; + +newsos6) + version_type=linux + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + ;; + +nto-qnx*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + ;; + +openbsd*) + version_type=sunos + sys_lib_dlsearch_path_spec="/usr/lib" + need_lib_prefix=no + # Some older versions of OpenBSD (3.3 at least) *do* need versioned libs. + case $host_os in + openbsd3.3 | openbsd3.3.*) need_version=yes ;; + *) need_version=no ;; + esac + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir' + shlibpath_var=LD_LIBRARY_PATH + if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then + case $host_os in + openbsd2.[[89]] | openbsd2.[[89]].*) + shlibpath_overrides_runpath=no + ;; + *) + shlibpath_overrides_runpath=yes + ;; + esac + else + shlibpath_overrides_runpath=yes + fi + ;; + +os2*) + libname_spec='$name' + shrext_cmds=".dll" + need_lib_prefix=no + library_names_spec='$libname${shared_ext} $libname.a' + dynamic_linker='OS/2 ld.exe' + shlibpath_var=LIBPATH + ;; + +osf3* | osf4* | osf5*) + version_type=osf + need_lib_prefix=no + need_version=no + soname_spec='${libname}${release}${shared_ext}$major' + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + shlibpath_var=LD_LIBRARY_PATH + sys_lib_search_path_spec="/usr/shlib /usr/ccs/lib /usr/lib/cmplrs/cc /usr/lib /usr/local/lib /var/shlib" + sys_lib_dlsearch_path_spec="$sys_lib_search_path_spec" + ;; + +solaris*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + # ldd complains unless libraries are executable + postinstall_cmds='chmod +x $lib' + ;; + +sunos4*) + version_type=sunos + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix' + finish_cmds='PATH="\$PATH:/usr/etc" ldconfig $libdir' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + if test "$with_gnu_ld" = yes; then + need_lib_prefix=no + fi + need_version=yes + ;; + +sysv4 | sysv4.3*) + version_type=linux + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + case $host_vendor in + sni) + shlibpath_overrides_runpath=no + need_lib_prefix=no + export_dynamic_flag_spec='${wl}-Blargedynsym' + runpath_var=LD_RUN_PATH + ;; + siemens) + need_lib_prefix=no + ;; + motorola) + need_lib_prefix=no + need_version=no + shlibpath_overrides_runpath=no + sys_lib_search_path_spec='/lib /usr/lib /usr/ccs/lib' + ;; + esac + ;; + +sysv4*MP*) + if test -d /usr/nec ;then + version_type=linux + library_names_spec='$libname${shared_ext}.$versuffix $libname${shared_ext}.$major $libname${shared_ext}' + soname_spec='$libname${shared_ext}.$major' + shlibpath_var=LD_LIBRARY_PATH + fi + ;; + +sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*) + version_type=freebsd-elf + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + hardcode_into_libs=yes + if test "$with_gnu_ld" = yes; then + sys_lib_search_path_spec='/usr/local/lib /usr/gnu/lib /usr/ccs/lib /usr/lib /lib' + shlibpath_overrides_runpath=no + else + sys_lib_search_path_spec='/usr/ccs/lib /usr/lib' + shlibpath_overrides_runpath=yes + case $host_os in + sco3.2v5*) + sys_lib_search_path_spec="$sys_lib_search_path_spec /lib" + ;; + esac + fi + sys_lib_dlsearch_path_spec='/usr/lib' + ;; + +uts4*) + version_type=linux + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + ;; + +*) + dynamic_linker=no + ;; +esac +AC_MSG_RESULT([$dynamic_linker]) +test "$dynamic_linker" = no && can_build_shared=no + +variables_saved_for_relink="PATH $shlibpath_var $runpath_var" +if test "$GCC" = yes; then + variables_saved_for_relink="$variables_saved_for_relink GCC_EXEC_PREFIX COMPILER_PATH LIBRARY_PATH" +fi +])# AC_LIBTOOL_SYS_DYNAMIC_LINKER + + +# _LT_AC_TAGCONFIG +# ---------------- +AC_DEFUN([_LT_AC_TAGCONFIG], +[AC_ARG_WITH([tags], + [AC_HELP_STRING([--with-tags@<:@=TAGS@:>@], + [include additional configurations @<:@automatic@:>@])], + [tagnames="$withval"]) + +if test -f "$ltmain" && test -n "$tagnames"; then + if test ! -f "${ofile}"; then + AC_MSG_WARN([output file `$ofile' does not exist]) + fi + + if test -z "$LTCC"; then + eval "`$SHELL ${ofile} --config | grep '^LTCC='`" + if test -z "$LTCC"; then + AC_MSG_WARN([output file `$ofile' does not look like a libtool script]) + else + AC_MSG_WARN([using `LTCC=$LTCC', extracted from `$ofile']) + fi + fi + if test -z "$LTCFLAGS"; then + eval "`$SHELL ${ofile} --config | grep '^LTCFLAGS='`" + fi + + # Extract list of available tagged configurations in $ofile. + # Note that this assumes the entire list is on one line. + available_tags=`grep "^available_tags=" "${ofile}" | $SED -e 's/available_tags=\(.*$\)/\1/' -e 's/\"//g'` + + lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR," + for tagname in $tagnames; do + IFS="$lt_save_ifs" + # Check whether tagname contains only valid characters + case `$echo "X$tagname" | $Xsed -e 's:[[-_ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz1234567890,/]]::g'` in + "") ;; + *) AC_MSG_ERROR([invalid tag name: $tagname]) + ;; + esac + + if grep "^# ### BEGIN LIBTOOL TAG CONFIG: $tagname$" < "${ofile}" > /dev/null + then + AC_MSG_ERROR([tag name \"$tagname\" already exists]) + fi + + # Update the list of available tags. + if test -n "$tagname"; then + echo appending configuration tag \"$tagname\" to $ofile + + case $tagname in + CXX) + if test -n "$CXX" && ( test "X$CXX" != "Xno" && + ( (test "X$CXX" = "Xg++" && `g++ -v >/dev/null 2>&1` ) || + (test "X$CXX" != "Xg++"))) ; then + AC_LIBTOOL_LANG_CXX_CONFIG + else + tagname="" + fi + ;; + + F77) + if test -n "$F77" && test "X$F77" != "Xno"; then + AC_LIBTOOL_LANG_F77_CONFIG + else + tagname="" + fi + ;; + + GCJ) + if test -n "$GCJ" && test "X$GCJ" != "Xno"; then + AC_LIBTOOL_LANG_GCJ_CONFIG + else + tagname="" + fi + ;; + + RC) + AC_LIBTOOL_LANG_RC_CONFIG + ;; + + *) + AC_MSG_ERROR([Unsupported tag name: $tagname]) + ;; + esac + + # Append the new tag name to the list of available tags. + if test -n "$tagname" ; then + available_tags="$available_tags $tagname" + fi + fi + done + IFS="$lt_save_ifs" + + # Now substitute the updated list of available tags. + if eval "sed -e 's/^available_tags=.*\$/available_tags=\"$available_tags\"/' \"$ofile\" > \"${ofile}T\""; then + mv "${ofile}T" "$ofile" + chmod +x "$ofile" + else + rm -f "${ofile}T" + AC_MSG_ERROR([unable to update list of available tagged configurations.]) + fi +fi +])# _LT_AC_TAGCONFIG + + +# AC_LIBTOOL_DLOPEN +# ----------------- +# enable checks for dlopen support +AC_DEFUN([AC_LIBTOOL_DLOPEN], + [AC_BEFORE([$0],[AC_LIBTOOL_SETUP]) +])# AC_LIBTOOL_DLOPEN + + +# AC_LIBTOOL_WIN32_DLL +# -------------------- +# declare package support for building win32 DLLs +AC_DEFUN([AC_LIBTOOL_WIN32_DLL], +[AC_BEFORE([$0], [AC_LIBTOOL_SETUP]) +])# AC_LIBTOOL_WIN32_DLL + + +# AC_ENABLE_SHARED([DEFAULT]) +# --------------------------- +# implement the --enable-shared flag +# DEFAULT is either `yes' or `no'. If omitted, it defaults to `yes'. +AC_DEFUN([AC_ENABLE_SHARED], +[define([AC_ENABLE_SHARED_DEFAULT], ifelse($1, no, no, yes))dnl +AC_ARG_ENABLE([shared], + [AC_HELP_STRING([--enable-shared@<:@=PKGS@:>@], + [build shared libraries @<:@default=]AC_ENABLE_SHARED_DEFAULT[@:>@])], + [p=${PACKAGE-default} + case $enableval in + yes) enable_shared=yes ;; + no) enable_shared=no ;; + *) + enable_shared=no + # Look at the argument we got. We use all the common list separators. + lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR," + for pkg in $enableval; do + IFS="$lt_save_ifs" + if test "X$pkg" = "X$p"; then + enable_shared=yes + fi + done + IFS="$lt_save_ifs" + ;; + esac], + [enable_shared=]AC_ENABLE_SHARED_DEFAULT) +])# AC_ENABLE_SHARED + + +# AC_DISABLE_SHARED +# ----------------- +# set the default shared flag to --disable-shared +AC_DEFUN([AC_DISABLE_SHARED], +[AC_BEFORE([$0],[AC_LIBTOOL_SETUP])dnl +AC_ENABLE_SHARED(no) +])# AC_DISABLE_SHARED + + +# AC_ENABLE_STATIC([DEFAULT]) +# --------------------------- +# implement the --enable-static flag +# DEFAULT is either `yes' or `no'. If omitted, it defaults to `yes'. +AC_DEFUN([AC_ENABLE_STATIC], +[define([AC_ENABLE_STATIC_DEFAULT], ifelse($1, no, no, yes))dnl +AC_ARG_ENABLE([static], + [AC_HELP_STRING([--enable-static@<:@=PKGS@:>@], + [build static libraries @<:@default=]AC_ENABLE_STATIC_DEFAULT[@:>@])], + [p=${PACKAGE-default} + case $enableval in + yes) enable_static=yes ;; + no) enable_static=no ;; + *) + enable_static=no + # Look at the argument we got. We use all the common list separators. + lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR," + for pkg in $enableval; do + IFS="$lt_save_ifs" + if test "X$pkg" = "X$p"; then + enable_static=yes + fi + done + IFS="$lt_save_ifs" + ;; + esac], + [enable_static=]AC_ENABLE_STATIC_DEFAULT) +])# AC_ENABLE_STATIC + + +# AC_DISABLE_STATIC +# ----------------- +# set the default static flag to --disable-static +AC_DEFUN([AC_DISABLE_STATIC], +[AC_BEFORE([$0],[AC_LIBTOOL_SETUP])dnl +AC_ENABLE_STATIC(no) +])# AC_DISABLE_STATIC + + +# AC_ENABLE_FAST_INSTALL([DEFAULT]) +# --------------------------------- +# implement the --enable-fast-install flag +# DEFAULT is either `yes' or `no'. If omitted, it defaults to `yes'. +AC_DEFUN([AC_ENABLE_FAST_INSTALL], +[define([AC_ENABLE_FAST_INSTALL_DEFAULT], ifelse($1, no, no, yes))dnl +AC_ARG_ENABLE([fast-install], + [AC_HELP_STRING([--enable-fast-install@<:@=PKGS@:>@], + [optimize for fast installation @<:@default=]AC_ENABLE_FAST_INSTALL_DEFAULT[@:>@])], + [p=${PACKAGE-default} + case $enableval in + yes) enable_fast_install=yes ;; + no) enable_fast_install=no ;; + *) + enable_fast_install=no + # Look at the argument we got. We use all the common list separators. + lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR," + for pkg in $enableval; do + IFS="$lt_save_ifs" + if test "X$pkg" = "X$p"; then + enable_fast_install=yes + fi + done + IFS="$lt_save_ifs" + ;; + esac], + [enable_fast_install=]AC_ENABLE_FAST_INSTALL_DEFAULT) +])# AC_ENABLE_FAST_INSTALL + + +# AC_DISABLE_FAST_INSTALL +# ----------------------- +# set the default to --disable-fast-install +AC_DEFUN([AC_DISABLE_FAST_INSTALL], +[AC_BEFORE([$0],[AC_LIBTOOL_SETUP])dnl +AC_ENABLE_FAST_INSTALL(no) +])# AC_DISABLE_FAST_INSTALL + + +# AC_LIBTOOL_PICMODE([MODE]) +# -------------------------- +# implement the --with-pic flag +# MODE is either `yes' or `no'. If omitted, it defaults to `both'. +AC_DEFUN([AC_LIBTOOL_PICMODE], +[AC_BEFORE([$0],[AC_LIBTOOL_SETUP])dnl +pic_mode=ifelse($#,1,$1,default) +])# AC_LIBTOOL_PICMODE + + +# AC_PROG_EGREP +# ------------- +# This is predefined starting with Autoconf 2.54, so this conditional +# definition can be removed once we require Autoconf 2.54 or later. +m4_ifndef([AC_PROG_EGREP], [AC_DEFUN([AC_PROG_EGREP], +[AC_CACHE_CHECK([for egrep], [ac_cv_prog_egrep], + [if echo a | (grep -E '(a|b)') >/dev/null 2>&1 + then ac_cv_prog_egrep='grep -E' + else ac_cv_prog_egrep='egrep' + fi]) + EGREP=$ac_cv_prog_egrep + AC_SUBST([EGREP]) +])]) + + +# AC_PATH_TOOL_PREFIX +# ------------------- +# find a file program which can recognise shared library +AC_DEFUN([AC_PATH_TOOL_PREFIX], +[AC_REQUIRE([AC_PROG_EGREP])dnl +AC_MSG_CHECKING([for $1]) +AC_CACHE_VAL(lt_cv_path_MAGIC_CMD, +[case $MAGIC_CMD in +[[\\/*] | ?:[\\/]*]) + lt_cv_path_MAGIC_CMD="$MAGIC_CMD" # Let the user override the test with a path. + ;; +*) + lt_save_MAGIC_CMD="$MAGIC_CMD" + lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR +dnl $ac_dummy forces splitting on constant user-supplied paths. +dnl POSIX.2 word splitting is done only on the output of word expansions, +dnl not every word. This closes a longstanding sh security hole. + ac_dummy="ifelse([$2], , $PATH, [$2])" + for ac_dir in $ac_dummy; do + IFS="$lt_save_ifs" + test -z "$ac_dir" && ac_dir=. + if test -f $ac_dir/$1; then + lt_cv_path_MAGIC_CMD="$ac_dir/$1" + if test -n "$file_magic_test_file"; then + case $deplibs_check_method in + "file_magic "*) + file_magic_regex=`expr "$deplibs_check_method" : "file_magic \(.*\)"` + MAGIC_CMD="$lt_cv_path_MAGIC_CMD" + if eval $file_magic_cmd \$file_magic_test_file 2> /dev/null | + $EGREP "$file_magic_regex" > /dev/null; then + : + else + cat <<EOF 1>&2 + +*** Warning: the command libtool uses to detect shared libraries, +*** $file_magic_cmd, produces output that libtool cannot recognize. +*** The result is that libtool may fail to recognize shared libraries +*** as such. This will affect the creation of libtool libraries that +*** depend on shared libraries, but programs linked with such libtool +*** libraries will work regardless of this problem. Nevertheless, you +*** may want to report the problem to your system manager and/or to +*** bug-libtool@gnu.org + +EOF + fi ;; + esac + fi + break + fi + done + IFS="$lt_save_ifs" + MAGIC_CMD="$lt_save_MAGIC_CMD" + ;; +esac]) +MAGIC_CMD="$lt_cv_path_MAGIC_CMD" +if test -n "$MAGIC_CMD"; then + AC_MSG_RESULT($MAGIC_CMD) +else + AC_MSG_RESULT(no) +fi +])# AC_PATH_TOOL_PREFIX + + +# AC_PATH_MAGIC +# ------------- +# find a file program which can recognise a shared library +AC_DEFUN([AC_PATH_MAGIC], +[AC_PATH_TOOL_PREFIX(${ac_tool_prefix}file, /usr/bin$PATH_SEPARATOR$PATH) +if test -z "$lt_cv_path_MAGIC_CMD"; then + if test -n "$ac_tool_prefix"; then + AC_PATH_TOOL_PREFIX(file, /usr/bin$PATH_SEPARATOR$PATH) + else + MAGIC_CMD=: + fi +fi +])# AC_PATH_MAGIC + + +# AC_PROG_LD +# ---------- +# find the pathname to the GNU or non-GNU linker +AC_DEFUN([AC_PROG_LD], +[AC_ARG_WITH([gnu-ld], + [AC_HELP_STRING([--with-gnu-ld], + [assume the C compiler uses GNU ld @<:@default=no@:>@])], + [test "$withval" = no || with_gnu_ld=yes], + [with_gnu_ld=no]) +AC_REQUIRE([LT_AC_PROG_SED])dnl +AC_REQUIRE([AC_PROG_CC])dnl +AC_REQUIRE([AC_CANONICAL_HOST])dnl +AC_REQUIRE([AC_CANONICAL_BUILD])dnl +ac_prog=ld +if test "$GCC" = yes; then + # Check if gcc -print-prog-name=ld gives a path. + AC_MSG_CHECKING([for ld used by $CC]) + case $host in + *-*-mingw*) + # gcc leaves a trailing carriage return which upsets mingw + ac_prog=`($CC -print-prog-name=ld) 2>&5 | tr -d '\015'` ;; + *) + ac_prog=`($CC -print-prog-name=ld) 2>&5` ;; + esac + case $ac_prog in + # Accept absolute paths. + [[\\/]]* | ?:[[\\/]]*) + re_direlt='/[[^/]][[^/]]*/\.\./' + # Canonicalize the pathname of ld + ac_prog=`echo $ac_prog| $SED 's%\\\\%/%g'` + while echo $ac_prog | grep "$re_direlt" > /dev/null 2>&1; do + ac_prog=`echo $ac_prog| $SED "s%$re_direlt%/%"` + done + test -z "$LD" && LD="$ac_prog" + ;; + "") + # If it fails, then pretend we aren't using GCC. + ac_prog=ld + ;; + *) + # If it is relative, then search for the first ld in PATH. + with_gnu_ld=unknown + ;; + esac +elif test "$with_gnu_ld" = yes; then + AC_MSG_CHECKING([for GNU ld]) +else + AC_MSG_CHECKING([for non-GNU ld]) +fi +AC_CACHE_VAL(lt_cv_path_LD, +[if test -z "$LD"; then + lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR + for ac_dir in $PATH; do + IFS="$lt_save_ifs" + test -z "$ac_dir" && ac_dir=. + if test -f "$ac_dir/$ac_prog" || test -f "$ac_dir/$ac_prog$ac_exeext"; then + lt_cv_path_LD="$ac_dir/$ac_prog" + # Check to see if the program is GNU ld. I'd rather use --version, + # but apparently some variants of GNU ld only accept -v. + # Break only if it was the GNU/non-GNU ld that we prefer. + case `"$lt_cv_path_LD" -v 2>&1 </dev/null` in + *GNU* | *'with BFD'*) + test "$with_gnu_ld" != no && break + ;; + *) + test "$with_gnu_ld" != yes && break + ;; + esac + fi + done + IFS="$lt_save_ifs" +else + lt_cv_path_LD="$LD" # Let the user override the test with a path. +fi]) +LD="$lt_cv_path_LD" +if test -n "$LD"; then + AC_MSG_RESULT($LD) +else + AC_MSG_RESULT(no) +fi +test -z "$LD" && AC_MSG_ERROR([no acceptable ld found in \$PATH]) +AC_PROG_LD_GNU +])# AC_PROG_LD + + +# AC_PROG_LD_GNU +# -------------- +AC_DEFUN([AC_PROG_LD_GNU], +[AC_REQUIRE([AC_PROG_EGREP])dnl +AC_CACHE_CHECK([if the linker ($LD) is GNU ld], lt_cv_prog_gnu_ld, +[# I'd rather use --version here, but apparently some GNU lds only accept -v. +case `$LD -v 2>&1 </dev/null` in +*GNU* | *'with BFD'*) + lt_cv_prog_gnu_ld=yes + ;; +*) + lt_cv_prog_gnu_ld=no + ;; +esac]) +with_gnu_ld=$lt_cv_prog_gnu_ld +])# AC_PROG_LD_GNU + + +# AC_PROG_LD_RELOAD_FLAG +# ---------------------- +# find reload flag for linker +# -- PORTME Some linkers may need a different reload flag. +AC_DEFUN([AC_PROG_LD_RELOAD_FLAG], +[AC_CACHE_CHECK([for $LD option to reload object files], + lt_cv_ld_reload_flag, + [lt_cv_ld_reload_flag='-r']) +reload_flag=$lt_cv_ld_reload_flag +case $reload_flag in +"" | " "*) ;; +*) reload_flag=" $reload_flag" ;; +esac +reload_cmds='$LD$reload_flag -o $output$reload_objs' +case $host_os in + darwin*) + if test "$GCC" = yes; then + reload_cmds='$LTCC $LTCFLAGS -nostdlib ${wl}-r -o $output$reload_objs' + else + reload_cmds='$LD$reload_flag -o $output$reload_objs' + fi + ;; +esac +])# AC_PROG_LD_RELOAD_FLAG + + +# AC_DEPLIBS_CHECK_METHOD +# ----------------------- +# how to check for library dependencies +# -- PORTME fill in with the dynamic library characteristics +AC_DEFUN([AC_DEPLIBS_CHECK_METHOD], +[AC_CACHE_CHECK([how to recognise dependent libraries], +lt_cv_deplibs_check_method, +[lt_cv_file_magic_cmd='$MAGIC_CMD' +lt_cv_file_magic_test_file= +lt_cv_deplibs_check_method='unknown' +# Need to set the preceding variable on all platforms that support +# interlibrary dependencies. +# 'none' -- dependencies not supported. +# `unknown' -- same as none, but documents that we really don't know. +# 'pass_all' -- all dependencies passed with no checks. +# 'test_compile' -- check by making test program. +# 'file_magic [[regex]]' -- check by looking for files in library path +# which responds to the $file_magic_cmd with a given extended regex. +# If you have `file' or equivalent on your system and you're not sure +# whether `pass_all' will *always* work, you probably want this one. + +case $host_os in +aix4* | aix5*) + lt_cv_deplibs_check_method=pass_all + ;; + +beos*) + lt_cv_deplibs_check_method=pass_all + ;; + +bsdi[[45]]*) + lt_cv_deplibs_check_method='file_magic ELF [[0-9]][[0-9]]*-bit [[ML]]SB (shared object|dynamic lib)' + lt_cv_file_magic_cmd='/usr/bin/file -L' + lt_cv_file_magic_test_file=/shlib/libc.so + ;; + +cygwin*) + # func_win32_libid is a shell function defined in ltmain.sh + lt_cv_deplibs_check_method='file_magic ^x86 archive import|^x86 DLL' + lt_cv_file_magic_cmd='func_win32_libid' + ;; + +mingw* | pw32*) + # Base MSYS/MinGW do not provide the 'file' command needed by + # func_win32_libid shell function, so use a weaker test based on 'objdump'. + lt_cv_deplibs_check_method='file_magic file format pei*-i386(.*architecture: i386)?' + lt_cv_file_magic_cmd='$OBJDUMP -f' + ;; + +darwin* | rhapsody*) + lt_cv_deplibs_check_method=pass_all + ;; + +freebsd* | kfreebsd*-gnu | dragonfly*) + if echo __ELF__ | $CC -E - | grep __ELF__ > /dev/null; then + case $host_cpu in + i*86 ) + # Not sure whether the presence of OpenBSD here was a mistake. + # Let's accept both of them until this is cleared up. + lt_cv_deplibs_check_method='file_magic (FreeBSD|OpenBSD|DragonFly)/i[[3-9]]86 (compact )?demand paged shared library' + lt_cv_file_magic_cmd=/usr/bin/file + lt_cv_file_magic_test_file=`echo /usr/lib/libc.so.*` + ;; + esac + else + lt_cv_deplibs_check_method=pass_all + fi + ;; + +gnu*) + lt_cv_deplibs_check_method=pass_all + ;; + +hpux10.20* | hpux11*) + lt_cv_file_magic_cmd=/usr/bin/file + case $host_cpu in + ia64*) + lt_cv_deplibs_check_method='file_magic (s[[0-9]][[0-9]][[0-9]]|ELF-[[0-9]][[0-9]]) shared object file - IA64' + lt_cv_file_magic_test_file=/usr/lib/hpux32/libc.so + ;; + hppa*64*) + [lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|ELF-[0-9][0-9]) shared object file - PA-RISC [0-9].[0-9]'] + lt_cv_file_magic_test_file=/usr/lib/pa20_64/libc.sl + ;; + *) + lt_cv_deplibs_check_method='file_magic (s[[0-9]][[0-9]][[0-9]]|PA-RISC[[0-9]].[[0-9]]) shared library' + lt_cv_file_magic_test_file=/usr/lib/libc.sl + ;; + esac + ;; + +interix3*) + # PIC code is broken on Interix 3.x, that's why |\.a not |_pic\.a here + lt_cv_deplibs_check_method='match_pattern /lib[[^/]]+(\.so|\.a)$' + ;; + +irix5* | irix6* | nonstopux*) + case $LD in + *-32|*"-32 ") libmagic=32-bit;; + *-n32|*"-n32 ") libmagic=N32;; + *-64|*"-64 ") libmagic=64-bit;; + *) libmagic=never-match;; + esac + lt_cv_deplibs_check_method=pass_all + ;; + +# This must be Linux ELF. +linux*) + lt_cv_deplibs_check_method=pass_all + ;; + +netbsd*) + if echo __ELF__ | $CC -E - | grep __ELF__ > /dev/null; then + lt_cv_deplibs_check_method='match_pattern /lib[[^/]]+(\.so\.[[0-9]]+\.[[0-9]]+|_pic\.a)$' + else + lt_cv_deplibs_check_method='match_pattern /lib[[^/]]+(\.so|_pic\.a)$' + fi + ;; + +newos6*) + lt_cv_deplibs_check_method='file_magic ELF [[0-9]][[0-9]]*-bit [[ML]]SB (executable|dynamic lib)' + lt_cv_file_magic_cmd=/usr/bin/file + lt_cv_file_magic_test_file=/usr/lib/libnls.so + ;; + +nto-qnx*) + lt_cv_deplibs_check_method=unknown + ;; + +openbsd*) + if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then + lt_cv_deplibs_check_method='match_pattern /lib[[^/]]+(\.so\.[[0-9]]+\.[[0-9]]+|\.so|_pic\.a)$' + else + lt_cv_deplibs_check_method='match_pattern /lib[[^/]]+(\.so\.[[0-9]]+\.[[0-9]]+|_pic\.a)$' + fi + ;; + +osf3* | osf4* | osf5*) + lt_cv_deplibs_check_method=pass_all + ;; + +solaris*) + lt_cv_deplibs_check_method=pass_all + ;; + +sysv4 | sysv4.3*) + case $host_vendor in + motorola) + lt_cv_deplibs_check_method='file_magic ELF [[0-9]][[0-9]]*-bit [[ML]]SB (shared object|dynamic lib) M[[0-9]][[0-9]]* Version [[0-9]]' + lt_cv_file_magic_test_file=`echo /usr/lib/libc.so*` + ;; + ncr) + lt_cv_deplibs_check_method=pass_all + ;; + sequent) + lt_cv_file_magic_cmd='/bin/file' + lt_cv_deplibs_check_method='file_magic ELF [[0-9]][[0-9]]*-bit [[LM]]SB (shared object|dynamic lib )' + ;; + sni) + lt_cv_file_magic_cmd='/bin/file' + lt_cv_deplibs_check_method="file_magic ELF [[0-9]][[0-9]]*-bit [[LM]]SB dynamic lib" + lt_cv_file_magic_test_file=/lib/libc.so + ;; + siemens) + lt_cv_deplibs_check_method=pass_all + ;; + pc) + lt_cv_deplibs_check_method=pass_all + ;; + esac + ;; + +sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*) + lt_cv_deplibs_check_method=pass_all + ;; +esac +]) +file_magic_cmd=$lt_cv_file_magic_cmd +deplibs_check_method=$lt_cv_deplibs_check_method +test -z "$deplibs_check_method" && deplibs_check_method=unknown +])# AC_DEPLIBS_CHECK_METHOD + + +# AC_PROG_NM +# ---------- +# find the pathname to a BSD-compatible name lister +AC_DEFUN([AC_PROG_NM], +[AC_CACHE_CHECK([for BSD-compatible nm], lt_cv_path_NM, +[if test -n "$NM"; then + # Let the user override the test. + lt_cv_path_NM="$NM" +else + lt_nm_to_check="${ac_tool_prefix}nm" + if test -n "$ac_tool_prefix" && test "$build" = "$host"; then + lt_nm_to_check="$lt_nm_to_check nm" + fi + for lt_tmp_nm in $lt_nm_to_check; do + lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR + for ac_dir in $PATH /usr/ccs/bin/elf /usr/ccs/bin /usr/ucb /bin; do + IFS="$lt_save_ifs" + test -z "$ac_dir" && ac_dir=. + tmp_nm="$ac_dir/$lt_tmp_nm" + if test -f "$tmp_nm" || test -f "$tmp_nm$ac_exeext" ; then + # Check to see if the nm accepts a BSD-compat flag. + # Adding the `sed 1q' prevents false positives on HP-UX, which says: + # nm: unknown option "B" ignored + # Tru64's nm complains that /dev/null is an invalid object file + case `"$tmp_nm" -B /dev/null 2>&1 | sed '1q'` in + */dev/null* | *'Invalid file or object type'*) + lt_cv_path_NM="$tmp_nm -B" + break + ;; + *) + case `"$tmp_nm" -p /dev/null 2>&1 | sed '1q'` in + */dev/null*) + lt_cv_path_NM="$tmp_nm -p" + break + ;; + *) + lt_cv_path_NM=${lt_cv_path_NM="$tmp_nm"} # keep the first match, but + continue # so that we can try to find one that supports BSD flags + ;; + esac + ;; + esac + fi + done + IFS="$lt_save_ifs" + done + test -z "$lt_cv_path_NM" && lt_cv_path_NM=nm +fi]) +NM="$lt_cv_path_NM" +])# AC_PROG_NM + + +# AC_CHECK_LIBM +# ------------- +# check for math library +AC_DEFUN([AC_CHECK_LIBM], +[AC_REQUIRE([AC_CANONICAL_HOST])dnl +LIBM= +case $host in +*-*-beos* | *-*-cygwin* | *-*-pw32* | *-*-darwin*) + # These system don't have libm, or don't need it + ;; +*-ncr-sysv4.3*) + AC_CHECK_LIB(mw, _mwvalidcheckl, LIBM="-lmw") + AC_CHECK_LIB(m, cos, LIBM="$LIBM -lm") + ;; +*) + AC_CHECK_LIB(m, cos, LIBM="-lm") + ;; +esac +])# AC_CHECK_LIBM + + +# AC_LIBLTDL_CONVENIENCE([DIRECTORY]) +# ----------------------------------- +# sets LIBLTDL to the link flags for the libltdl convenience library and +# LTDLINCL to the include flags for the libltdl header and adds +# --enable-ltdl-convenience to the configure arguments. Note that +# AC_CONFIG_SUBDIRS is not called here. If DIRECTORY is not provided, +# it is assumed to be `libltdl'. LIBLTDL will be prefixed with +# '${top_builddir}/' and LTDLINCL will be prefixed with '${top_srcdir}/' +# (note the single quotes!). If your package is not flat and you're not +# using automake, define top_builddir and top_srcdir appropriately in +# the Makefiles. +AC_DEFUN([AC_LIBLTDL_CONVENIENCE], +[AC_BEFORE([$0],[AC_LIBTOOL_SETUP])dnl + case $enable_ltdl_convenience in + no) AC_MSG_ERROR([this package needs a convenience libltdl]) ;; + "") enable_ltdl_convenience=yes + ac_configure_args="$ac_configure_args --enable-ltdl-convenience" ;; + esac + LIBLTDL='${top_builddir}/'ifelse($#,1,[$1],['libltdl'])/libltdlc.la + LTDLINCL='-I${top_srcdir}/'ifelse($#,1,[$1],['libltdl']) + # For backwards non-gettext consistent compatibility... + INCLTDL="$LTDLINCL" +])# AC_LIBLTDL_CONVENIENCE + + +# AC_LIBLTDL_INSTALLABLE([DIRECTORY]) +# ----------------------------------- +# sets LIBLTDL to the link flags for the libltdl installable library and +# LTDLINCL to the include flags for the libltdl header and adds +# --enable-ltdl-install to the configure arguments. Note that +# AC_CONFIG_SUBDIRS is not called here. If DIRECTORY is not provided, +# and an installed libltdl is not found, it is assumed to be `libltdl'. +# LIBLTDL will be prefixed with '${top_builddir}/'# and LTDLINCL with +# '${top_srcdir}/' (note the single quotes!). If your package is not +# flat and you're not using automake, define top_builddir and top_srcdir +# appropriately in the Makefiles. +# In the future, this macro may have to be called after AC_PROG_LIBTOOL. +AC_DEFUN([AC_LIBLTDL_INSTALLABLE], +[AC_BEFORE([$0],[AC_LIBTOOL_SETUP])dnl + AC_CHECK_LIB(ltdl, lt_dlinit, + [test x"$enable_ltdl_install" != xyes && enable_ltdl_install=no], + [if test x"$enable_ltdl_install" = xno; then + AC_MSG_WARN([libltdl not installed, but installation disabled]) + else + enable_ltdl_install=yes + fi + ]) + if test x"$enable_ltdl_install" = x"yes"; then + ac_configure_args="$ac_configure_args --enable-ltdl-install" + LIBLTDL='${top_builddir}/'ifelse($#,1,[$1],['libltdl'])/libltdl.la + LTDLINCL='-I${top_srcdir}/'ifelse($#,1,[$1],['libltdl']) + else + ac_configure_args="$ac_configure_args --enable-ltdl-install=no" + LIBLTDL="-lltdl" + LTDLINCL= + fi + # For backwards non-gettext consistent compatibility... + INCLTDL="$LTDLINCL" +])# AC_LIBLTDL_INSTALLABLE + + +# AC_LIBTOOL_CXX +# -------------- +# enable support for C++ libraries +AC_DEFUN([AC_LIBTOOL_CXX], +[AC_REQUIRE([_LT_AC_LANG_CXX]) +])# AC_LIBTOOL_CXX + + +# _LT_AC_LANG_CXX +# --------------- +AC_DEFUN([_LT_AC_LANG_CXX], +[AC_REQUIRE([AC_PROG_CXX]) +AC_REQUIRE([_LT_AC_PROG_CXXCPP]) +_LT_AC_SHELL_INIT([tagnames=${tagnames+${tagnames},}CXX]) +])# _LT_AC_LANG_CXX + +# _LT_AC_PROG_CXXCPP +# ------------------ +AC_DEFUN([_LT_AC_PROG_CXXCPP], +[ +AC_REQUIRE([AC_PROG_CXX]) +if test -n "$CXX" && ( test "X$CXX" != "Xno" && + ( (test "X$CXX" = "Xg++" && `g++ -v >/dev/null 2>&1` ) || + (test "X$CXX" != "Xg++"))) ; then + AC_PROG_CXXCPP +fi +])# _LT_AC_PROG_CXXCPP + +# AC_LIBTOOL_F77 +# -------------- +# enable support for Fortran 77 libraries +AC_DEFUN([AC_LIBTOOL_F77], +[AC_REQUIRE([_LT_AC_LANG_F77]) +])# AC_LIBTOOL_F77 + + +# _LT_AC_LANG_F77 +# --------------- +AC_DEFUN([_LT_AC_LANG_F77], +[AC_REQUIRE([AC_PROG_F77]) +_LT_AC_SHELL_INIT([tagnames=${tagnames+${tagnames},}F77]) +])# _LT_AC_LANG_F77 + + +# AC_LIBTOOL_GCJ +# -------------- +# enable support for GCJ libraries +AC_DEFUN([AC_LIBTOOL_GCJ], +[AC_REQUIRE([_LT_AC_LANG_GCJ]) +])# AC_LIBTOOL_GCJ + + +# _LT_AC_LANG_GCJ +# --------------- +AC_DEFUN([_LT_AC_LANG_GCJ], +[AC_PROVIDE_IFELSE([AC_PROG_GCJ],[], + [AC_PROVIDE_IFELSE([A][M_PROG_GCJ],[], + [AC_PROVIDE_IFELSE([LT_AC_PROG_GCJ],[], + [ifdef([AC_PROG_GCJ],[AC_REQUIRE([AC_PROG_GCJ])], + [ifdef([A][M_PROG_GCJ],[AC_REQUIRE([A][M_PROG_GCJ])], + [AC_REQUIRE([A][C_PROG_GCJ_OR_A][M_PROG_GCJ])])])])])]) +_LT_AC_SHELL_INIT([tagnames=${tagnames+${tagnames},}GCJ]) +])# _LT_AC_LANG_GCJ + + +# AC_LIBTOOL_RC +# ------------- +# enable support for Windows resource files +AC_DEFUN([AC_LIBTOOL_RC], +[AC_REQUIRE([LT_AC_PROG_RC]) +_LT_AC_SHELL_INIT([tagnames=${tagnames+${tagnames},}RC]) +])# AC_LIBTOOL_RC + + +# AC_LIBTOOL_LANG_C_CONFIG +# ------------------------ +# Ensure that the configuration vars for the C compiler are +# suitably defined. Those variables are subsequently used by +# AC_LIBTOOL_CONFIG to write the compiler configuration to `libtool'. +AC_DEFUN([AC_LIBTOOL_LANG_C_CONFIG], [_LT_AC_LANG_C_CONFIG]) +AC_DEFUN([_LT_AC_LANG_C_CONFIG], +[lt_save_CC="$CC" +AC_LANG_PUSH(C) + +# Source file extension for C test sources. +ac_ext=c + +# Object file extension for compiled C test sources. +objext=o +_LT_AC_TAGVAR(objext, $1)=$objext + +# Code to be used in simple compile tests +lt_simple_compile_test_code="int some_variable = 0;\n" + +# Code to be used in simple link tests +lt_simple_link_test_code='int main(){return(0);}\n' + +_LT_AC_SYS_COMPILER + +# save warnings/boilerplate of simple test code +_LT_COMPILER_BOILERPLATE +_LT_LINKER_BOILERPLATE + +AC_LIBTOOL_PROG_COMPILER_NO_RTTI($1) +AC_LIBTOOL_PROG_COMPILER_PIC($1) +AC_LIBTOOL_PROG_CC_C_O($1) +AC_LIBTOOL_SYS_HARD_LINK_LOCKS($1) +AC_LIBTOOL_PROG_LD_SHLIBS($1) +AC_LIBTOOL_SYS_DYNAMIC_LINKER($1) +AC_LIBTOOL_PROG_LD_HARDCODE_LIBPATH($1) +AC_LIBTOOL_SYS_LIB_STRIP +AC_LIBTOOL_DLOPEN_SELF + +# Report which library types will actually be built +AC_MSG_CHECKING([if libtool supports shared libraries]) +AC_MSG_RESULT([$can_build_shared]) + +AC_MSG_CHECKING([whether to build shared libraries]) +test "$can_build_shared" = "no" && enable_shared=no + +# On AIX, shared libraries and static libraries use the same namespace, and +# are all built from PIC. +case $host_os in +aix3*) + test "$enable_shared" = yes && enable_static=no + if test -n "$RANLIB"; then + archive_cmds="$archive_cmds~\$RANLIB \$lib" + postinstall_cmds='$RANLIB $lib' + fi + ;; + +aix4* | aix5*) + if test "$host_cpu" != ia64 && test "$aix_use_runtimelinking" = no ; then + test "$enable_shared" = yes && enable_static=no + fi + ;; +esac +AC_MSG_RESULT([$enable_shared]) + +AC_MSG_CHECKING([whether to build static libraries]) +# Make sure either enable_shared or enable_static is yes. +test "$enable_shared" = yes || enable_static=yes +AC_MSG_RESULT([$enable_static]) + +AC_LIBTOOL_CONFIG($1) + +AC_LANG_POP +CC="$lt_save_CC" +])# AC_LIBTOOL_LANG_C_CONFIG + + +# AC_LIBTOOL_LANG_CXX_CONFIG +# -------------------------- +# Ensure that the configuration vars for the C compiler are +# suitably defined. Those variables are subsequently used by +# AC_LIBTOOL_CONFIG to write the compiler configuration to `libtool'. +AC_DEFUN([AC_LIBTOOL_LANG_CXX_CONFIG], [_LT_AC_LANG_CXX_CONFIG(CXX)]) +AC_DEFUN([_LT_AC_LANG_CXX_CONFIG], +[AC_LANG_PUSH(C++) +AC_REQUIRE([AC_PROG_CXX]) +AC_REQUIRE([_LT_AC_PROG_CXXCPP]) + +_LT_AC_TAGVAR(archive_cmds_need_lc, $1)=no +_LT_AC_TAGVAR(allow_undefined_flag, $1)= +_LT_AC_TAGVAR(always_export_symbols, $1)=no +_LT_AC_TAGVAR(archive_expsym_cmds, $1)= +_LT_AC_TAGVAR(export_dynamic_flag_spec, $1)= +_LT_AC_TAGVAR(hardcode_direct, $1)=no +_LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)= +_LT_AC_TAGVAR(hardcode_libdir_flag_spec_ld, $1)= +_LT_AC_TAGVAR(hardcode_libdir_separator, $1)= +_LT_AC_TAGVAR(hardcode_minus_L, $1)=no +_LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=unsupported +_LT_AC_TAGVAR(hardcode_automatic, $1)=no +_LT_AC_TAGVAR(module_cmds, $1)= +_LT_AC_TAGVAR(module_expsym_cmds, $1)= +_LT_AC_TAGVAR(link_all_deplibs, $1)=unknown +_LT_AC_TAGVAR(old_archive_cmds, $1)=$old_archive_cmds +_LT_AC_TAGVAR(no_undefined_flag, $1)= +_LT_AC_TAGVAR(whole_archive_flag_spec, $1)= +_LT_AC_TAGVAR(enable_shared_with_static_runtimes, $1)=no + +# Dependencies to place before and after the object being linked: +_LT_AC_TAGVAR(predep_objects, $1)= +_LT_AC_TAGVAR(postdep_objects, $1)= +_LT_AC_TAGVAR(predeps, $1)= +_LT_AC_TAGVAR(postdeps, $1)= +_LT_AC_TAGVAR(compiler_lib_search_path, $1)= + +# Source file extension for C++ test sources. +ac_ext=cpp + +# Object file extension for compiled C++ test sources. +objext=o +_LT_AC_TAGVAR(objext, $1)=$objext + +# Code to be used in simple compile tests +lt_simple_compile_test_code="int some_variable = 0;\n" + +# Code to be used in simple link tests +lt_simple_link_test_code='int main(int, char *[[]]) { return(0); }\n' + +# ltmain only uses $CC for tagged configurations so make sure $CC is set. +_LT_AC_SYS_COMPILER + +# save warnings/boilerplate of simple test code +_LT_COMPILER_BOILERPLATE +_LT_LINKER_BOILERPLATE + +# Allow CC to be a program name with arguments. +lt_save_CC=$CC +lt_save_LD=$LD +lt_save_GCC=$GCC +GCC=$GXX +lt_save_with_gnu_ld=$with_gnu_ld +lt_save_path_LD=$lt_cv_path_LD +if test -n "${lt_cv_prog_gnu_ldcxx+set}"; then + lt_cv_prog_gnu_ld=$lt_cv_prog_gnu_ldcxx +else + $as_unset lt_cv_prog_gnu_ld +fi +if test -n "${lt_cv_path_LDCXX+set}"; then + lt_cv_path_LD=$lt_cv_path_LDCXX +else + $as_unset lt_cv_path_LD +fi +test -z "${LDCXX+set}" || LD=$LDCXX +CC=${CXX-"c++"} +compiler=$CC +_LT_AC_TAGVAR(compiler, $1)=$CC +_LT_CC_BASENAME([$compiler]) + +# We don't want -fno-exception wen compiling C++ code, so set the +# no_builtin_flag separately +if test "$GXX" = yes; then + _LT_AC_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)=' -fno-builtin' +else + _LT_AC_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)= +fi + +if test "$GXX" = yes; then + # Set up default GNU C++ configuration + + AC_PROG_LD + + # Check if GNU C++ uses GNU ld as the underlying linker, since the + # archiving commands below assume that GNU ld is being used. + if test "$with_gnu_ld" = yes; then + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}--rpath ${wl}$libdir' + _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic' + + # If archive_cmds runs LD, not CC, wlarc should be empty + # XXX I think wlarc can be eliminated in ltcf-cxx, but I need to + # investigate it a little bit more. (MM) + wlarc='${wl}' + + # ancient GNU ld didn't support --whole-archive et. al. + if eval "`$CC -print-prog-name=ld` --help 2>&1" | \ + grep 'no-whole-archive' > /dev/null; then + _LT_AC_TAGVAR(whole_archive_flag_spec, $1)="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive' + else + _LT_AC_TAGVAR(whole_archive_flag_spec, $1)= + fi + else + with_gnu_ld=no + wlarc= + + # A generic and very simple default shared library creation + # command for GNU C++ for the case where it uses the native + # linker, instead of GNU ld. If possible, this setting should + # overridden to take advantage of the native linker features on + # the platform it is being used on. + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $lib' + fi + + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep "\-L"' + +else + GXX=no + with_gnu_ld=no + wlarc= +fi + +# PORTME: fill in a description of your system's C++ link characteristics +AC_MSG_CHECKING([whether the $compiler linker ($LD) supports shared libraries]) +_LT_AC_TAGVAR(ld_shlibs, $1)=yes +case $host_os in + aix3*) + # FIXME: insert proper C++ library support + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + aix4* | aix5*) + if test "$host_cpu" = ia64; then + # On IA64, the linker does run time linking by default, so we don't + # have to do anything special. + aix_use_runtimelinking=no + exp_sym_flag='-Bexport' + no_entry_flag="" + else + aix_use_runtimelinking=no + + # Test if we are trying to use run time linking or normal + # AIX style linking. If -brtl is somewhere in LDFLAGS, we + # need to do runtime linking. + case $host_os in aix4.[[23]]|aix4.[[23]].*|aix5*) + for ld_flag in $LDFLAGS; do + case $ld_flag in + *-brtl*) + aix_use_runtimelinking=yes + break + ;; + esac + done + ;; + esac + + exp_sym_flag='-bexport' + no_entry_flag='-bnoentry' + fi + + # When large executables or shared objects are built, AIX ld can + # have problems creating the table of contents. If linking a library + # or program results in "error TOC overflow" add -mminimal-toc to + # CXXFLAGS/CFLAGS for g++/gcc. In the cases where that is not + # enough to fix the problem, add -Wl,-bbigtoc to LDFLAGS. + + _LT_AC_TAGVAR(archive_cmds, $1)='' + _LT_AC_TAGVAR(hardcode_direct, $1)=yes + _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=':' + _LT_AC_TAGVAR(link_all_deplibs, $1)=yes + + if test "$GXX" = yes; then + case $host_os in aix4.[[012]]|aix4.[[012]].*) + # We only want to do this on AIX 4.2 and lower, the check + # below for broken collect2 doesn't work under 4.3+ + collect2name=`${CC} -print-prog-name=collect2` + if test -f "$collect2name" && \ + strings "$collect2name" | grep resolve_lib_name >/dev/null + then + # We have reworked collect2 + _LT_AC_TAGVAR(hardcode_direct, $1)=yes + else + # We have old collect2 + _LT_AC_TAGVAR(hardcode_direct, $1)=unsupported + # It fails to find uninstalled libraries when the uninstalled + # path is not listed in the libpath. Setting hardcode_minus_L + # to unsupported forces relinking + _LT_AC_TAGVAR(hardcode_minus_L, $1)=yes + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir' + _LT_AC_TAGVAR(hardcode_libdir_separator, $1)= + fi + ;; + esac + shared_flag='-shared' + if test "$aix_use_runtimelinking" = yes; then + shared_flag="$shared_flag "'${wl}-G' + fi + else + # not using gcc + if test "$host_cpu" = ia64; then + # VisualAge C++, Version 5.5 for AIX 5L for IA-64, Beta 3 Release + # chokes on -Wl,-G. The following line is correct: + shared_flag='-G' + else + if test "$aix_use_runtimelinking" = yes; then + shared_flag='${wl}-G' + else + shared_flag='${wl}-bM:SRE' + fi + fi + fi + + # It seems that -bexpall does not export symbols beginning with + # underscore (_), so it is better to generate a list of symbols to export. + _LT_AC_TAGVAR(always_export_symbols, $1)=yes + if test "$aix_use_runtimelinking" = yes; then + # Warning - without using the other runtime loading flags (-brtl), + # -berok will link without error, but may produce a broken library. + _LT_AC_TAGVAR(allow_undefined_flag, $1)='-berok' + # Determine the default libpath from the value encoded in an empty executable. + _LT_AC_SYS_LIBPATH_AIX + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-blibpath:$libdir:'"$aix_libpath" + + _LT_AC_TAGVAR(archive_expsym_cmds, $1)="\$CC"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags `if test "x${allow_undefined_flag}" != "x"; then echo "${wl}${allow_undefined_flag}"; else :; fi` '"\${wl}$exp_sym_flag:\$export_symbols $shared_flag" + else + if test "$host_cpu" = ia64; then + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-R $libdir:/usr/lib:/lib' + _LT_AC_TAGVAR(allow_undefined_flag, $1)="-z nodefs" + _LT_AC_TAGVAR(archive_expsym_cmds, $1)="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags ${wl}${allow_undefined_flag} '"\${wl}$exp_sym_flag:\$export_symbols" + else + # Determine the default libpath from the value encoded in an empty executable. + _LT_AC_SYS_LIBPATH_AIX + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-blibpath:$libdir:'"$aix_libpath" + # Warning - without using the other run time loading flags, + # -berok will link without error, but may produce a broken library. + _LT_AC_TAGVAR(no_undefined_flag, $1)=' ${wl}-bernotok' + _LT_AC_TAGVAR(allow_undefined_flag, $1)=' ${wl}-berok' + # Exported symbols can be pulled into shared objects from archives + _LT_AC_TAGVAR(whole_archive_flag_spec, $1)='$convenience' + _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=yes + # This is similar to how AIX traditionally builds its shared libraries. + _LT_AC_TAGVAR(archive_expsym_cmds, $1)="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs ${wl}-bnoentry $compiler_flags ${wl}-bE:$export_symbols${allow_undefined_flag}~$AR $AR_FLAGS $output_objdir/$libname$release.a $output_objdir/$soname' + fi + fi + ;; + + beos*) + if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then + _LT_AC_TAGVAR(allow_undefined_flag, $1)=unsupported + # Joseph Beckenbach <jrb3@best.com> says some releases of gcc + # support --undefined. This deserves some investigation. FIXME + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -nostart $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + else + _LT_AC_TAGVAR(ld_shlibs, $1)=no + fi + ;; + + chorus*) + case $cc_basename in + *) + # FIXME: insert proper C++ library support + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + esac + ;; + + cygwin* | mingw* | pw32*) + # _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1) is actually meaningless, + # as there is no search path for DLLs. + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir' + _LT_AC_TAGVAR(allow_undefined_flag, $1)=unsupported + _LT_AC_TAGVAR(always_export_symbols, $1)=no + _LT_AC_TAGVAR(enable_shared_with_static_runtimes, $1)=yes + + if $LD --help 2>&1 | grep 'auto-import' > /dev/null; then + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib' + # If the export-symbols file already is a .def file (1st line + # is EXPORTS), use it as is; otherwise, prepend... + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then + cp $export_symbols $output_objdir/$soname.def; + else + echo EXPORTS > $output_objdir/$soname.def; + cat $export_symbols >> $output_objdir/$soname.def; + fi~ + $CC -shared -nostdlib $output_objdir/$soname.def $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib' + else + _LT_AC_TAGVAR(ld_shlibs, $1)=no + fi + ;; + darwin* | rhapsody*) + case $host_os in + rhapsody* | darwin1.[[012]]) + _LT_AC_TAGVAR(allow_undefined_flag, $1)='${wl}-undefined ${wl}suppress' + ;; + *) # Darwin 1.3 on + if test -z ${MACOSX_DEPLOYMENT_TARGET} ; then + _LT_AC_TAGVAR(allow_undefined_flag, $1)='${wl}-flat_namespace ${wl}-undefined ${wl}suppress' + else + case ${MACOSX_DEPLOYMENT_TARGET} in + 10.[[012]]) + _LT_AC_TAGVAR(allow_undefined_flag, $1)='${wl}-flat_namespace ${wl}-undefined ${wl}suppress' + ;; + 10.*) + _LT_AC_TAGVAR(allow_undefined_flag, $1)='${wl}-undefined ${wl}dynamic_lookup' + ;; + esac + fi + ;; + esac + _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=no + _LT_AC_TAGVAR(hardcode_direct, $1)=no + _LT_AC_TAGVAR(hardcode_automatic, $1)=yes + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=unsupported + _LT_AC_TAGVAR(whole_archive_flag_spec, $1)='' + _LT_AC_TAGVAR(link_all_deplibs, $1)=yes + + if test "$GXX" = yes ; then + lt_int_apple_cc_single_mod=no + output_verbose_link_cmd='echo' + if $CC -dumpspecs 2>&1 | $EGREP 'single_module' >/dev/null ; then + lt_int_apple_cc_single_mod=yes + fi + if test "X$lt_int_apple_cc_single_mod" = Xyes ; then + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -dynamiclib -single_module $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags -install_name $rpath/$soname $verstring' + else + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -r -keep_private_externs -nostdlib -o ${lib}-master.o $libobjs~$CC -dynamiclib $allow_undefined_flag -o $lib ${lib}-master.o $deplibs $compiler_flags -install_name $rpath/$soname $verstring' + fi + _LT_AC_TAGVAR(module_cmds, $1)='$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags' + # Don't fix this by using the ld -exported_symbols_list flag, it doesn't exist in older darwin lds + if test "X$lt_int_apple_cc_single_mod" = Xyes ; then + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -dynamiclib -single_module $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags -install_name $rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}' + else + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -r -keep_private_externs -nostdlib -o ${lib}-master.o $libobjs~$CC -dynamiclib $allow_undefined_flag -o $lib ${lib}-master.o $deplibs $compiler_flags -install_name $rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}' + fi + _LT_AC_TAGVAR(module_expsym_cmds, $1)='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}' + else + case $cc_basename in + xlc*) + output_verbose_link_cmd='echo' + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -qmkshrobj ${wl}-single_module $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-install_name ${wl}`echo $rpath/$soname` $verstring' + _LT_AC_TAGVAR(module_cmds, $1)='$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags' + # Don't fix this by using the ld -exported_symbols_list flag, it doesn't exist in older darwin lds + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -qmkshrobj ${wl}-single_module $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-install_name ${wl}$rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}' + _LT_AC_TAGVAR(module_expsym_cmds, $1)='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}' + ;; + *) + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + esac + fi + ;; + + dgux*) + case $cc_basename in + ec++*) + # FIXME: insert proper C++ library support + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + ghcx*) + # Green Hills C++ Compiler + # FIXME: insert proper C++ library support + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + *) + # FIXME: insert proper C++ library support + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + esac + ;; + freebsd[[12]]*) + # C++ shared libraries reported to be fairly broken before switch to ELF + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + freebsd-elf*) + _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=no + ;; + freebsd* | kfreebsd*-gnu | dragonfly*) + # FreeBSD 3 and later use GNU C++ and GNU ld with standard ELF + # conventions + _LT_AC_TAGVAR(ld_shlibs, $1)=yes + ;; + gnu*) + ;; + hpux9*) + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}+b ${wl}$libdir' + _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=: + _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E' + _LT_AC_TAGVAR(hardcode_direct, $1)=yes + _LT_AC_TAGVAR(hardcode_minus_L, $1)=yes # Not in the search PATH, + # but as the default + # location of the library. + + case $cc_basename in + CC*) + # FIXME: insert proper C++ library support + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + aCC*) + _LT_AC_TAGVAR(archive_cmds, $1)='$rm $output_objdir/$soname~$CC -b ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib' + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + # + # There doesn't appear to be a way to prevent this compiler from + # explicitly linking system object files so we need to strip them + # from the output so that they don't get included in the library + # dependencies. + output_verbose_link_cmd='templist=`($CC -b $CFLAGS -v conftest.$objext 2>&1) | grep "[[-]]L"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; echo $list' + ;; + *) + if test "$GXX" = yes; then + _LT_AC_TAGVAR(archive_cmds, $1)='$rm $output_objdir/$soname~$CC -shared -nostdlib -fPIC ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib' + else + # FIXME: insert proper C++ library support + _LT_AC_TAGVAR(ld_shlibs, $1)=no + fi + ;; + esac + ;; + hpux10*|hpux11*) + if test $with_gnu_ld = no; then + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}+b ${wl}$libdir' + _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=: + + case $host_cpu in + hppa*64*|ia64*) + _LT_AC_TAGVAR(hardcode_libdir_flag_spec_ld, $1)='+b $libdir' + ;; + *) + _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E' + ;; + esac + fi + case $host_cpu in + hppa*64*|ia64*) + _LT_AC_TAGVAR(hardcode_direct, $1)=no + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no + ;; + *) + _LT_AC_TAGVAR(hardcode_direct, $1)=yes + _LT_AC_TAGVAR(hardcode_minus_L, $1)=yes # Not in the search PATH, + # but as the default + # location of the library. + ;; + esac + + case $cc_basename in + CC*) + # FIXME: insert proper C++ library support + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + aCC*) + case $host_cpu in + hppa*64*) + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags' + ;; + ia64*) + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags' + ;; + *) + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags' + ;; + esac + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + # + # There doesn't appear to be a way to prevent this compiler from + # explicitly linking system object files so we need to strip them + # from the output so that they don't get included in the library + # dependencies. + output_verbose_link_cmd='templist=`($CC -b $CFLAGS -v conftest.$objext 2>&1) | grep "\-L"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; echo $list' + ;; + *) + if test "$GXX" = yes; then + if test $with_gnu_ld = no; then + case $host_cpu in + hppa*64*) + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib -fPIC ${wl}+h ${wl}$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags' + ;; + ia64*) + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib -fPIC ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags' + ;; + *) + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib -fPIC ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags' + ;; + esac + fi + else + # FIXME: insert proper C++ library support + _LT_AC_TAGVAR(ld_shlibs, $1)=no + fi + ;; + esac + ;; + interix3*) + _LT_AC_TAGVAR(hardcode_direct, $1)=no + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir' + _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E' + # Hack: On Interix 3.x, we cannot compile PIC because of a broken gcc. + # Instead, shared libraries are loaded at an image base (0x10000000 by + # default) and relocated if they conflict, which is a slow very memory + # consuming and fragmenting process. To avoid this, we pick a random, + # 256 KiB-aligned image base between 0x50000000 and 0x6FFC0000 at link + # time. Moving up from 0x10000000 also allows more sbrk(2) space. + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='sed "s,^,_," $export_symbols >$output_objdir/$soname.expsym~$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--retain-symbols-file,$output_objdir/$soname.expsym ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib' + ;; + irix5* | irix6*) + case $cc_basename in + CC*) + # SGI C++ + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -all -multigot $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib' + + # Archives containing C++ object files must be created using + # "CC -ar", where "CC" is the IRIX C++ compiler. This is + # necessary to make sure instantiated templates are included + # in the archive. + _LT_AC_TAGVAR(old_archive_cmds, $1)='$CC -ar -WR,-u -o $oldlib $oldobjs' + ;; + *) + if test "$GXX" = yes; then + if test "$with_gnu_ld" = no; then + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + else + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` -o $lib' + fi + fi + _LT_AC_TAGVAR(link_all_deplibs, $1)=yes + ;; + esac + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir' + _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=: + ;; + linux*) + case $cc_basename in + KCC*) + # Kuck and Associates, Inc. (KAI) C++ Compiler + + # KCC will only create a shared library if the output file + # ends with ".so" (or ".sl" for HP-UX), so rename the library + # to its proper name (with version) after linking. + _LT_AC_TAGVAR(archive_cmds, $1)='tempext=`echo $shared_ext | $SED -e '\''s/\([[^()0-9A-Za-z{}]]\)/\\\\\1/g'\''`; templib=`echo $lib | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib; mv \$templib $lib' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='tempext=`echo $shared_ext | $SED -e '\''s/\([[^()0-9A-Za-z{}]]\)/\\\\\1/g'\''`; templib=`echo $lib | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib ${wl}-retain-symbols-file,$export_symbols; mv \$templib $lib' + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + # + # There doesn't appear to be a way to prevent this compiler from + # explicitly linking system object files so we need to strip them + # from the output so that they don't get included in the library + # dependencies. + output_verbose_link_cmd='templist=`$CC $CFLAGS -v conftest.$objext -o libconftest$shared_ext 2>&1 | grep "ld"`; rm -f libconftest$shared_ext; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; echo $list' + + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}--rpath,$libdir' + _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic' + + # Archives containing C++ object files must be created using + # "CC -Bstatic", where "CC" is the KAI C++ compiler. + _LT_AC_TAGVAR(old_archive_cmds, $1)='$CC -Bstatic -o $oldlib $oldobjs' + ;; + icpc*) + # Intel C++ + with_gnu_ld=yes + # version 8.0 and above of icpc choke on multiply defined symbols + # if we add $predep_objects and $postdep_objects, however 7.1 and + # earlier do not add the objects themselves. + case `$CC -V 2>&1` in + *"Version 7."*) + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + ;; + *) # Version 8.0 or newer + tmp_idyn= + case $host_cpu in + ia64*) tmp_idyn=' -i_dynamic';; + esac + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared'"$tmp_idyn"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared'"$tmp_idyn"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + ;; + esac + _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=no + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir' + _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic' + _LT_AC_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive$convenience ${wl}--no-whole-archive' + ;; + pgCC*) + # Portland Group C++ compiler + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname -o $lib' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname ${wl}-retain-symbols-file ${wl}$export_symbols -o $lib' + + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}--rpath ${wl}$libdir' + _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic' + _LT_AC_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}--no-whole-archive' + ;; + cxx*) + # Compaq C++ + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib ${wl}-retain-symbols-file $wl$export_symbols' + + runpath_var=LD_RUN_PATH + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-rpath $libdir' + _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=: + + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + # + # There doesn't appear to be a way to prevent this compiler from + # explicitly linking system object files so we need to strip them + # from the output so that they don't get included in the library + # dependencies. + output_verbose_link_cmd='templist=`$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep "ld"`; templist=`echo $templist | $SED "s/\(^.*ld.*\)\( .*ld .*$\)/\1/"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; echo $list' + ;; + esac + ;; + lynxos*) + # FIXME: insert proper C++ library support + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + m88k*) + # FIXME: insert proper C++ library support + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + mvs*) + case $cc_basename in + cxx*) + # FIXME: insert proper C++ library support + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + *) + # FIXME: insert proper C++ library support + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + esac + ;; + netbsd*) + if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then + _LT_AC_TAGVAR(archive_cmds, $1)='$LD -Bshareable -o $lib $predep_objects $libobjs $deplibs $postdep_objects $linker_flags' + wlarc= + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir' + _LT_AC_TAGVAR(hardcode_direct, $1)=yes + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no + fi + # Workaround some broken pre-1.5 toolchains + output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep conftest.$objext | $SED -e "s:-lgcc -lc -lgcc::"' + ;; + openbsd2*) + # C++ shared libraries are fairly broken + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + openbsd*) + _LT_AC_TAGVAR(hardcode_direct, $1)=yes + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $lib' + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir' + if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-retain-symbols-file,$export_symbols -o $lib' + _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E' + _LT_AC_TAGVAR(whole_archive_flag_spec, $1)="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive' + fi + output_verbose_link_cmd='echo' + ;; + osf3*) + case $cc_basename in + KCC*) + # Kuck and Associates, Inc. (KAI) C++ Compiler + + # KCC will only create a shared library if the output file + # ends with ".so" (or ".sl" for HP-UX), so rename the library + # to its proper name (with version) after linking. + _LT_AC_TAGVAR(archive_cmds, $1)='tempext=`echo $shared_ext | $SED -e '\''s/\([[^()0-9A-Za-z{}]]\)/\\\\\1/g'\''`; templib=`echo $lib | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib; mv \$templib $lib' + + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir' + _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=: + + # Archives containing C++ object files must be created using + # "CC -Bstatic", where "CC" is the KAI C++ compiler. + _LT_AC_TAGVAR(old_archive_cmds, $1)='$CC -Bstatic -o $oldlib $oldobjs' + + ;; + RCC*) + # Rational C++ 2.4.1 + # FIXME: insert proper C++ library support + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + cxx*) + _LT_AC_TAGVAR(allow_undefined_flag, $1)=' ${wl}-expect_unresolved ${wl}\*' + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $soname `test -n "$verstring" && echo ${wl}-set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib' + + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir' + _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=: + + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + # + # There doesn't appear to be a way to prevent this compiler from + # explicitly linking system object files so we need to strip them + # from the output so that they don't get included in the library + # dependencies. + output_verbose_link_cmd='templist=`$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep "ld" | grep -v "ld:"`; templist=`echo $templist | $SED "s/\(^.*ld.*\)\( .*ld.*$\)/\1/"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; echo $list' + ;; + *) + if test "$GXX" = yes && test "$with_gnu_ld" = no; then + _LT_AC_TAGVAR(allow_undefined_flag, $1)=' ${wl}-expect_unresolved ${wl}\*' + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib ${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir' + _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=: + + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep "\-L"' + + else + # FIXME: insert proper C++ library support + _LT_AC_TAGVAR(ld_shlibs, $1)=no + fi + ;; + esac + ;; + osf4* | osf5*) + case $cc_basename in + KCC*) + # Kuck and Associates, Inc. (KAI) C++ Compiler + + # KCC will only create a shared library if the output file + # ends with ".so" (or ".sl" for HP-UX), so rename the library + # to its proper name (with version) after linking. + _LT_AC_TAGVAR(archive_cmds, $1)='tempext=`echo $shared_ext | $SED -e '\''s/\([[^()0-9A-Za-z{}]]\)/\\\\\1/g'\''`; templib=`echo $lib | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib; mv \$templib $lib' + + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir' + _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=: + + # Archives containing C++ object files must be created using + # the KAI C++ compiler. + _LT_AC_TAGVAR(old_archive_cmds, $1)='$CC -o $oldlib $oldobjs' + ;; + RCC*) + # Rational C++ 2.4.1 + # FIXME: insert proper C++ library support + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + cxx*) + _LT_AC_TAGVAR(allow_undefined_flag, $1)=' -expect_unresolved \*' + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -msym -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='for i in `cat $export_symbols`; do printf "%s %s\\n" -exported_symbol "\$i" >> $lib.exp; done~ + echo "-hidden">> $lib.exp~ + $CC -shared$allow_undefined_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -msym -soname $soname -Wl,-input -Wl,$lib.exp `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib~ + $rm $lib.exp' + + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-rpath $libdir' + _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=: + + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + # + # There doesn't appear to be a way to prevent this compiler from + # explicitly linking system object files so we need to strip them + # from the output so that they don't get included in the library + # dependencies. + output_verbose_link_cmd='templist=`$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep "ld" | grep -v "ld:"`; templist=`echo $templist | $SED "s/\(^.*ld.*\)\( .*ld.*$\)/\1/"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; echo $list' + ;; + *) + if test "$GXX" = yes && test "$with_gnu_ld" = no; then + _LT_AC_TAGVAR(allow_undefined_flag, $1)=' ${wl}-expect_unresolved ${wl}\*' + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib ${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-msym ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir' + _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=: + + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep "\-L"' + + else + # FIXME: insert proper C++ library support + _LT_AC_TAGVAR(ld_shlibs, $1)=no + fi + ;; + esac + ;; + psos*) + # FIXME: insert proper C++ library support + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + sunos4*) + case $cc_basename in + CC*) + # Sun C++ 4.x + # FIXME: insert proper C++ library support + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + lcc*) + # Lucid + # FIXME: insert proper C++ library support + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + *) + # FIXME: insert proper C++ library support + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + esac + ;; + solaris*) + case $cc_basename in + CC*) + # Sun C++ 4.2, 5.x and Centerline C++ + _LT_AC_TAGVAR(archive_cmds_need_lc,$1)=yes + _LT_AC_TAGVAR(no_undefined_flag, $1)=' -zdefs' + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -G${allow_undefined_flag} -h$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~ + $CC -G${allow_undefined_flag} ${wl}-M ${wl}$lib.exp -h$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~$rm $lib.exp' + + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir' + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no + case $host_os in + solaris2.[[0-5]] | solaris2.[[0-5]].*) ;; + *) + # The C++ compiler is used as linker so we must use $wl + # flag to pass the commands to the underlying system + # linker. We must also pass each convience library through + # to the system linker between allextract/defaultextract. + # The C++ compiler will combine linker options so we + # cannot just pass the convience library names through + # without $wl. + # Supported since Solaris 2.6 (maybe 2.5.1?) + _LT_AC_TAGVAR(whole_archive_flag_spec, $1)='${wl}-z ${wl}allextract`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}-z ${wl}defaultextract' + ;; + esac + _LT_AC_TAGVAR(link_all_deplibs, $1)=yes + + output_verbose_link_cmd='echo' + + # Archives containing C++ object files must be created using + # "CC -xar", where "CC" is the Sun C++ compiler. This is + # necessary to make sure instantiated templates are included + # in the archive. + _LT_AC_TAGVAR(old_archive_cmds, $1)='$CC -xar -o $oldlib $oldobjs' + ;; + gcx*) + # Green Hills C++ Compiler + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-h $wl$soname -o $lib' + + # The C++ compiler must be used to create the archive. + _LT_AC_TAGVAR(old_archive_cmds, $1)='$CC $LDFLAGS -archive -o $oldlib $oldobjs' + ;; + *) + # GNU C++ compiler with Solaris linker + if test "$GXX" = yes && test "$with_gnu_ld" = no; then + _LT_AC_TAGVAR(no_undefined_flag, $1)=' ${wl}-z ${wl}defs' + if $CC --version | grep -v '^2\.7' > /dev/null; then + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib $LDFLAGS $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-h $wl$soname -o $lib' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~ + $CC -shared -nostdlib ${wl}-M $wl$lib.exp -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~$rm $lib.exp' + + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + output_verbose_link_cmd="$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep \"\-L\"" + else + # g++ 2.7 appears to require `-G' NOT `-shared' on this + # platform. + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -G -nostdlib $LDFLAGS $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-h $wl$soname -o $lib' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~ + $CC -G -nostdlib ${wl}-M $wl$lib.exp -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~$rm $lib.exp' + + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + output_verbose_link_cmd="$CC -G $CFLAGS -v conftest.$objext 2>&1 | grep \"\-L\"" + fi + + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-R $wl$libdir' + fi + ;; + esac + ;; + sysv4*uw2* | sysv5OpenUNIX* | sysv5UnixWare7.[[01]].[[10]]* | unixware7* | sco3.2v5.0.[[024]]*) + _LT_AC_TAGVAR(no_undefined_flag, $1)='${wl}-z,text' + _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=no + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no + runpath_var='LD_RUN_PATH' + + case $cc_basename in + CC*) + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + ;; + *) + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + ;; + esac + ;; + sysv5* | sco3.2v5* | sco5v6*) + # Note: We can NOT use -z defs as we might desire, because we do not + # link with -lc, and that would cause any symbols used from libc to + # always be unresolved, which means just about no library would + # ever link correctly. If we're not using GNU ld we use -z text + # though, which does catch some bad symbols but isn't as heavy-handed + # as -z defs. + # For security reasons, it is highly recommended that you always + # use absolute paths for naming shared libraries, and exclude the + # DT_RUNPATH tag from executables and libraries. But doing so + # requires that you compile everything twice, which is a pain. + # So that behaviour is only enabled if SCOABSPATH is set to a + # non-empty value in the environment. Most likely only useful for + # creating official distributions of packages. + # This is a hack until libtool officially supports absolute path + # names for shared libraries. + _LT_AC_TAGVAR(no_undefined_flag, $1)='${wl}-z,text' + _LT_AC_TAGVAR(allow_undefined_flag, $1)='${wl}-z,nodefs' + _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=no + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='`test -z "$SCOABSPATH" && echo ${wl}-R,$libdir`' + _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=':' + _LT_AC_TAGVAR(link_all_deplibs, $1)=yes + _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-Bexport' + runpath_var='LD_RUN_PATH' + + case $cc_basename in + CC*) + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -G ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags' + ;; + *) + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags' + ;; + esac + ;; + tandem*) + case $cc_basename in + NCC*) + # NonStop-UX NCC 3.20 + # FIXME: insert proper C++ library support + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + *) + # FIXME: insert proper C++ library support + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + esac + ;; + vxworks*) + # FIXME: insert proper C++ library support + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + *) + # FIXME: insert proper C++ library support + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; +esac +AC_MSG_RESULT([$_LT_AC_TAGVAR(ld_shlibs, $1)]) +test "$_LT_AC_TAGVAR(ld_shlibs, $1)" = no && can_build_shared=no + +_LT_AC_TAGVAR(GCC, $1)="$GXX" +_LT_AC_TAGVAR(LD, $1)="$LD" + +AC_LIBTOOL_POSTDEP_PREDEP($1) +AC_LIBTOOL_PROG_COMPILER_PIC($1) +AC_LIBTOOL_PROG_CC_C_O($1) +AC_LIBTOOL_SYS_HARD_LINK_LOCKS($1) +AC_LIBTOOL_PROG_LD_SHLIBS($1) +AC_LIBTOOL_SYS_DYNAMIC_LINKER($1) +AC_LIBTOOL_PROG_LD_HARDCODE_LIBPATH($1) + +AC_LIBTOOL_CONFIG($1) + +AC_LANG_POP +CC=$lt_save_CC +LDCXX=$LD +LD=$lt_save_LD +GCC=$lt_save_GCC +with_gnu_ldcxx=$with_gnu_ld +with_gnu_ld=$lt_save_with_gnu_ld +lt_cv_path_LDCXX=$lt_cv_path_LD +lt_cv_path_LD=$lt_save_path_LD +lt_cv_prog_gnu_ldcxx=$lt_cv_prog_gnu_ld +lt_cv_prog_gnu_ld=$lt_save_with_gnu_ld +])# AC_LIBTOOL_LANG_CXX_CONFIG + +# AC_LIBTOOL_POSTDEP_PREDEP([TAGNAME]) +# ------------------------------------ +# Figure out "hidden" library dependencies from verbose +# compiler output when linking a shared library. +# Parse the compiler output and extract the necessary +# objects, libraries and library flags. +AC_DEFUN([AC_LIBTOOL_POSTDEP_PREDEP],[ +dnl we can't use the lt_simple_compile_test_code here, +dnl because it contains code intended for an executable, +dnl not a library. It's possible we should let each +dnl tag define a new lt_????_link_test_code variable, +dnl but it's only used here... +ifelse([$1],[],[cat > conftest.$ac_ext <<EOF +int a; +void foo (void) { a = 0; } +EOF +],[$1],[CXX],[cat > conftest.$ac_ext <<EOF +class Foo +{ +public: + Foo (void) { a = 0; } +private: + int a; +}; +EOF +],[$1],[F77],[cat > conftest.$ac_ext <<EOF + subroutine foo + implicit none + integer*4 a + a=0 + return + end +EOF +],[$1],[GCJ],[cat > conftest.$ac_ext <<EOF +public class foo { + private int a; + public void bar (void) { + a = 0; + } +}; +EOF +]) +dnl Parse the compiler output and extract the necessary +dnl objects, libraries and library flags. +if AC_TRY_EVAL(ac_compile); then + # Parse the compiler output and extract the necessary + # objects, libraries and library flags. + + # Sentinel used to keep track of whether or not we are before + # the conftest object file. + pre_test_object_deps_done=no + + # The `*' in the case matches for architectures that use `case' in + # $output_verbose_cmd can trigger glob expansion during the loop + # eval without this substitution. + output_verbose_link_cmd=`$echo "X$output_verbose_link_cmd" | $Xsed -e "$no_glob_subst"` + + for p in `eval $output_verbose_link_cmd`; do + case $p in + + -L* | -R* | -l*) + # Some compilers place space between "-{L,R}" and the path. + # Remove the space. + if test $p = "-L" \ + || test $p = "-R"; then + prev=$p + continue + else + prev= + fi + + if test "$pre_test_object_deps_done" = no; then + case $p in + -L* | -R*) + # Internal compiler library paths should come after those + # provided the user. The postdeps already come after the + # user supplied libs so there is no need to process them. + if test -z "$_LT_AC_TAGVAR(compiler_lib_search_path, $1)"; then + _LT_AC_TAGVAR(compiler_lib_search_path, $1)="${prev}${p}" + else + _LT_AC_TAGVAR(compiler_lib_search_path, $1)="${_LT_AC_TAGVAR(compiler_lib_search_path, $1)} ${prev}${p}" + fi + ;; + # The "-l" case would never come before the object being + # linked, so don't bother handling this case. + esac + else + if test -z "$_LT_AC_TAGVAR(postdeps, $1)"; then + _LT_AC_TAGVAR(postdeps, $1)="${prev}${p}" + else + _LT_AC_TAGVAR(postdeps, $1)="${_LT_AC_TAGVAR(postdeps, $1)} ${prev}${p}" + fi + fi + ;; + + *.$objext) + # This assumes that the test object file only shows up + # once in the compiler output. + if test "$p" = "conftest.$objext"; then + pre_test_object_deps_done=yes + continue + fi + + if test "$pre_test_object_deps_done" = no; then + if test -z "$_LT_AC_TAGVAR(predep_objects, $1)"; then + _LT_AC_TAGVAR(predep_objects, $1)="$p" + else + _LT_AC_TAGVAR(predep_objects, $1)="$_LT_AC_TAGVAR(predep_objects, $1) $p" + fi + else + if test -z "$_LT_AC_TAGVAR(postdep_objects, $1)"; then + _LT_AC_TAGVAR(postdep_objects, $1)="$p" + else + _LT_AC_TAGVAR(postdep_objects, $1)="$_LT_AC_TAGVAR(postdep_objects, $1) $p" + fi + fi + ;; + + *) ;; # Ignore the rest. + + esac + done + + # Clean up. + rm -f a.out a.exe +else + echo "libtool.m4: error: problem compiling $1 test program" +fi + +$rm -f confest.$objext + +# PORTME: override above test on systems where it is broken +ifelse([$1],[CXX], +[case $host_os in +interix3*) + # Interix 3.5 installs completely hosed .la files for C++, so rather than + # hack all around it, let's just trust "g++" to DTRT. + _LT_AC_TAGVAR(predep_objects,$1)= + _LT_AC_TAGVAR(postdep_objects,$1)= + _LT_AC_TAGVAR(postdeps,$1)= + ;; + +solaris*) + case $cc_basename in + CC*) + # Adding this requires a known-good setup of shared libraries for + # Sun compiler versions before 5.6, else PIC objects from an old + # archive will be linked into the output, leading to subtle bugs. + _LT_AC_TAGVAR(postdeps,$1)='-lCstd -lCrun' + ;; + esac + ;; +esac +]) + +case " $_LT_AC_TAGVAR(postdeps, $1) " in +*" -lc "*) _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=no ;; +esac +])# AC_LIBTOOL_POSTDEP_PREDEP + +# AC_LIBTOOL_LANG_F77_CONFIG +# -------------------------- +# Ensure that the configuration vars for the C compiler are +# suitably defined. Those variables are subsequently used by +# AC_LIBTOOL_CONFIG to write the compiler configuration to `libtool'. +AC_DEFUN([AC_LIBTOOL_LANG_F77_CONFIG], [_LT_AC_LANG_F77_CONFIG(F77)]) +AC_DEFUN([_LT_AC_LANG_F77_CONFIG], +[AC_REQUIRE([AC_PROG_F77]) +AC_LANG_PUSH(Fortran 77) + +_LT_AC_TAGVAR(archive_cmds_need_lc, $1)=no +_LT_AC_TAGVAR(allow_undefined_flag, $1)= +_LT_AC_TAGVAR(always_export_symbols, $1)=no +_LT_AC_TAGVAR(archive_expsym_cmds, $1)= +_LT_AC_TAGVAR(export_dynamic_flag_spec, $1)= +_LT_AC_TAGVAR(hardcode_direct, $1)=no +_LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)= +_LT_AC_TAGVAR(hardcode_libdir_flag_spec_ld, $1)= +_LT_AC_TAGVAR(hardcode_libdir_separator, $1)= +_LT_AC_TAGVAR(hardcode_minus_L, $1)=no +_LT_AC_TAGVAR(hardcode_automatic, $1)=no +_LT_AC_TAGVAR(module_cmds, $1)= +_LT_AC_TAGVAR(module_expsym_cmds, $1)= +_LT_AC_TAGVAR(link_all_deplibs, $1)=unknown +_LT_AC_TAGVAR(old_archive_cmds, $1)=$old_archive_cmds +_LT_AC_TAGVAR(no_undefined_flag, $1)= +_LT_AC_TAGVAR(whole_archive_flag_spec, $1)= +_LT_AC_TAGVAR(enable_shared_with_static_runtimes, $1)=no + +# Source file extension for f77 test sources. +ac_ext=f + +# Object file extension for compiled f77 test sources. +objext=o +_LT_AC_TAGVAR(objext, $1)=$objext + +# Code to be used in simple compile tests +lt_simple_compile_test_code=" subroutine t\n return\n end\n" + +# Code to be used in simple link tests +lt_simple_link_test_code=" program t\n end\n" + +# ltmain only uses $CC for tagged configurations so make sure $CC is set. +_LT_AC_SYS_COMPILER + +# save warnings/boilerplate of simple test code +_LT_COMPILER_BOILERPLATE +_LT_LINKER_BOILERPLATE + +# Allow CC to be a program name with arguments. +lt_save_CC="$CC" +CC=${F77-"f77"} +compiler=$CC +_LT_AC_TAGVAR(compiler, $1)=$CC +_LT_CC_BASENAME([$compiler]) + +AC_MSG_CHECKING([if libtool supports shared libraries]) +AC_MSG_RESULT([$can_build_shared]) + +AC_MSG_CHECKING([whether to build shared libraries]) +test "$can_build_shared" = "no" && enable_shared=no + +# On AIX, shared libraries and static libraries use the same namespace, and +# are all built from PIC. +case $host_os in +aix3*) + test "$enable_shared" = yes && enable_static=no + if test -n "$RANLIB"; then + archive_cmds="$archive_cmds~\$RANLIB \$lib" + postinstall_cmds='$RANLIB $lib' + fi + ;; +aix4* | aix5*) + if test "$host_cpu" != ia64 && test "$aix_use_runtimelinking" = no ; then + test "$enable_shared" = yes && enable_static=no + fi + ;; +esac +AC_MSG_RESULT([$enable_shared]) + +AC_MSG_CHECKING([whether to build static libraries]) +# Make sure either enable_shared or enable_static is yes. +test "$enable_shared" = yes || enable_static=yes +AC_MSG_RESULT([$enable_static]) + +_LT_AC_TAGVAR(GCC, $1)="$G77" +_LT_AC_TAGVAR(LD, $1)="$LD" + +AC_LIBTOOL_PROG_COMPILER_PIC($1) +AC_LIBTOOL_PROG_CC_C_O($1) +AC_LIBTOOL_SYS_HARD_LINK_LOCKS($1) +AC_LIBTOOL_PROG_LD_SHLIBS($1) +AC_LIBTOOL_SYS_DYNAMIC_LINKER($1) +AC_LIBTOOL_PROG_LD_HARDCODE_LIBPATH($1) + +AC_LIBTOOL_CONFIG($1) + +AC_LANG_POP +CC="$lt_save_CC" +])# AC_LIBTOOL_LANG_F77_CONFIG + + +# AC_LIBTOOL_LANG_GCJ_CONFIG +# -------------------------- +# Ensure that the configuration vars for the C compiler are +# suitably defined. Those variables are subsequently used by +# AC_LIBTOOL_CONFIG to write the compiler configuration to `libtool'. +AC_DEFUN([AC_LIBTOOL_LANG_GCJ_CONFIG], [_LT_AC_LANG_GCJ_CONFIG(GCJ)]) +AC_DEFUN([_LT_AC_LANG_GCJ_CONFIG], +[AC_LANG_SAVE + +# Source file extension for Java test sources. +ac_ext=java + +# Object file extension for compiled Java test sources. +objext=o +_LT_AC_TAGVAR(objext, $1)=$objext + +# Code to be used in simple compile tests +lt_simple_compile_test_code="class foo {}\n" + +# Code to be used in simple link tests +lt_simple_link_test_code='public class conftest { public static void main(String[[]] argv) {}; }\n' + +# ltmain only uses $CC for tagged configurations so make sure $CC is set. +_LT_AC_SYS_COMPILER + +# save warnings/boilerplate of simple test code +_LT_COMPILER_BOILERPLATE +_LT_LINKER_BOILERPLATE + +# Allow CC to be a program name with arguments. +lt_save_CC="$CC" +CC=${GCJ-"gcj"} +compiler=$CC +_LT_AC_TAGVAR(compiler, $1)=$CC +_LT_CC_BASENAME([$compiler]) + +# GCJ did not exist at the time GCC didn't implicitly link libc in. +_LT_AC_TAGVAR(archive_cmds_need_lc, $1)=no + +_LT_AC_TAGVAR(old_archive_cmds, $1)=$old_archive_cmds + +AC_LIBTOOL_PROG_COMPILER_NO_RTTI($1) +AC_LIBTOOL_PROG_COMPILER_PIC($1) +AC_LIBTOOL_PROG_CC_C_O($1) +AC_LIBTOOL_SYS_HARD_LINK_LOCKS($1) +AC_LIBTOOL_PROG_LD_SHLIBS($1) +AC_LIBTOOL_SYS_DYNAMIC_LINKER($1) +AC_LIBTOOL_PROG_LD_HARDCODE_LIBPATH($1) + +AC_LIBTOOL_CONFIG($1) + +AC_LANG_RESTORE +CC="$lt_save_CC" +])# AC_LIBTOOL_LANG_GCJ_CONFIG + + +# AC_LIBTOOL_LANG_RC_CONFIG +# ------------------------- +# Ensure that the configuration vars for the Windows resource compiler are +# suitably defined. Those variables are subsequently used by +# AC_LIBTOOL_CONFIG to write the compiler configuration to `libtool'. +AC_DEFUN([AC_LIBTOOL_LANG_RC_CONFIG], [_LT_AC_LANG_RC_CONFIG(RC)]) +AC_DEFUN([_LT_AC_LANG_RC_CONFIG], +[AC_LANG_SAVE + +# Source file extension for RC test sources. +ac_ext=rc + +# Object file extension for compiled RC test sources. +objext=o +_LT_AC_TAGVAR(objext, $1)=$objext + +# Code to be used in simple compile tests +lt_simple_compile_test_code='sample MENU { MENUITEM "&Soup", 100, CHECKED }\n' + +# Code to be used in simple link tests +lt_simple_link_test_code="$lt_simple_compile_test_code" + +# ltmain only uses $CC for tagged configurations so make sure $CC is set. +_LT_AC_SYS_COMPILER + +# save warnings/boilerplate of simple test code +_LT_COMPILER_BOILERPLATE +_LT_LINKER_BOILERPLATE + +# Allow CC to be a program name with arguments. +lt_save_CC="$CC" +CC=${RC-"windres"} +compiler=$CC +_LT_AC_TAGVAR(compiler, $1)=$CC +_LT_CC_BASENAME([$compiler]) +_LT_AC_TAGVAR(lt_cv_prog_compiler_c_o, $1)=yes + +AC_LIBTOOL_CONFIG($1) + +AC_LANG_RESTORE +CC="$lt_save_CC" +])# AC_LIBTOOL_LANG_RC_CONFIG + + +# AC_LIBTOOL_CONFIG([TAGNAME]) +# ---------------------------- +# If TAGNAME is not passed, then create an initial libtool script +# with a default configuration from the untagged config vars. Otherwise +# add code to config.status for appending the configuration named by +# TAGNAME from the matching tagged config vars. +AC_DEFUN([AC_LIBTOOL_CONFIG], +[# The else clause should only fire when bootstrapping the +# libtool distribution, otherwise you forgot to ship ltmain.sh +# with your package, and you will get complaints that there are +# no rules to generate ltmain.sh. +if test -f "$ltmain"; then + # See if we are running on zsh, and set the options which allow our commands through + # without removal of \ escapes. + if test -n "${ZSH_VERSION+set}" ; then + setopt NO_GLOB_SUBST + fi + # Now quote all the things that may contain metacharacters while being + # careful not to overquote the AC_SUBSTed values. We take copies of the + # variables and quote the copies for generation of the libtool script. + for var in echo old_CC old_CFLAGS AR AR_FLAGS EGREP RANLIB LN_S LTCC LTCFLAGS NM \ + SED SHELL STRIP \ + libname_spec library_names_spec soname_spec extract_expsyms_cmds \ + old_striplib striplib file_magic_cmd finish_cmds finish_eval \ + deplibs_check_method reload_flag reload_cmds need_locks \ + lt_cv_sys_global_symbol_pipe lt_cv_sys_global_symbol_to_cdecl \ + lt_cv_sys_global_symbol_to_c_name_address \ + sys_lib_search_path_spec sys_lib_dlsearch_path_spec \ + old_postinstall_cmds old_postuninstall_cmds \ + _LT_AC_TAGVAR(compiler, $1) \ + _LT_AC_TAGVAR(CC, $1) \ + _LT_AC_TAGVAR(LD, $1) \ + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1) \ + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1) \ + _LT_AC_TAGVAR(lt_prog_compiler_static, $1) \ + _LT_AC_TAGVAR(lt_prog_compiler_no_builtin_flag, $1) \ + _LT_AC_TAGVAR(export_dynamic_flag_spec, $1) \ + _LT_AC_TAGVAR(thread_safe_flag_spec, $1) \ + _LT_AC_TAGVAR(whole_archive_flag_spec, $1) \ + _LT_AC_TAGVAR(enable_shared_with_static_runtimes, $1) \ + _LT_AC_TAGVAR(old_archive_cmds, $1) \ + _LT_AC_TAGVAR(old_archive_from_new_cmds, $1) \ + _LT_AC_TAGVAR(predep_objects, $1) \ + _LT_AC_TAGVAR(postdep_objects, $1) \ + _LT_AC_TAGVAR(predeps, $1) \ + _LT_AC_TAGVAR(postdeps, $1) \ + _LT_AC_TAGVAR(compiler_lib_search_path, $1) \ + _LT_AC_TAGVAR(archive_cmds, $1) \ + _LT_AC_TAGVAR(archive_expsym_cmds, $1) \ + _LT_AC_TAGVAR(postinstall_cmds, $1) \ + _LT_AC_TAGVAR(postuninstall_cmds, $1) \ + _LT_AC_TAGVAR(old_archive_from_expsyms_cmds, $1) \ + _LT_AC_TAGVAR(allow_undefined_flag, $1) \ + _LT_AC_TAGVAR(no_undefined_flag, $1) \ + _LT_AC_TAGVAR(export_symbols_cmds, $1) \ + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1) \ + _LT_AC_TAGVAR(hardcode_libdir_flag_spec_ld, $1) \ + _LT_AC_TAGVAR(hardcode_libdir_separator, $1) \ + _LT_AC_TAGVAR(hardcode_automatic, $1) \ + _LT_AC_TAGVAR(module_cmds, $1) \ + _LT_AC_TAGVAR(module_expsym_cmds, $1) \ + _LT_AC_TAGVAR(lt_cv_prog_compiler_c_o, $1) \ + _LT_AC_TAGVAR(exclude_expsyms, $1) \ + _LT_AC_TAGVAR(include_expsyms, $1); do + + case $var in + _LT_AC_TAGVAR(old_archive_cmds, $1) | \ + _LT_AC_TAGVAR(old_archive_from_new_cmds, $1) | \ + _LT_AC_TAGVAR(archive_cmds, $1) | \ + _LT_AC_TAGVAR(archive_expsym_cmds, $1) | \ + _LT_AC_TAGVAR(module_cmds, $1) | \ + _LT_AC_TAGVAR(module_expsym_cmds, $1) | \ + _LT_AC_TAGVAR(old_archive_from_expsyms_cmds, $1) | \ + _LT_AC_TAGVAR(export_symbols_cmds, $1) | \ + extract_expsyms_cmds | reload_cmds | finish_cmds | \ + postinstall_cmds | postuninstall_cmds | \ + old_postinstall_cmds | old_postuninstall_cmds | \ + sys_lib_search_path_spec | sys_lib_dlsearch_path_spec) + # Double-quote double-evaled strings. + eval "lt_$var=\\\"\`\$echo \"X\$$var\" | \$Xsed -e \"\$double_quote_subst\" -e \"\$sed_quote_subst\" -e \"\$delay_variable_subst\"\`\\\"" + ;; + *) + eval "lt_$var=\\\"\`\$echo \"X\$$var\" | \$Xsed -e \"\$sed_quote_subst\"\`\\\"" + ;; + esac + done + + case $lt_echo in + *'\[$]0 --fallback-echo"') + lt_echo=`$echo "X$lt_echo" | $Xsed -e 's/\\\\\\\[$]0 --fallback-echo"[$]/[$]0 --fallback-echo"/'` + ;; + esac + +ifelse([$1], [], + [cfgfile="${ofile}T" + trap "$rm \"$cfgfile\"; exit 1" 1 2 15 + $rm -f "$cfgfile" + AC_MSG_NOTICE([creating $ofile])], + [cfgfile="$ofile"]) + + cat <<__EOF__ >> "$cfgfile" +ifelse([$1], [], +[#! $SHELL + +# `$echo "$cfgfile" | sed 's%^.*/%%'` - Provide generalized library-building support services. +# Generated automatically by $PROGRAM (GNU $PACKAGE $VERSION$TIMESTAMP) +# NOTE: Changes made to this file will be lost: look at ltmain.sh. +# +# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001 +# Free Software Foundation, Inc. +# +# This file is part of GNU Libtool: +# Originally by Gordon Matzigkeit <gord@gnu.ai.mit.edu>, 1996 +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, but +# WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +# General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +# As a special exception to the GNU General Public License, if you +# distribute this file as part of a program that contains a +# configuration script generated by Autoconf, you may include it under +# the same distribution terms that you use for the rest of that program. + +# A sed program that does not truncate output. +SED=$lt_SED + +# Sed that helps us avoid accidentally triggering echo(1) options like -n. +Xsed="$SED -e 1s/^X//" + +# The HP-UX ksh and POSIX shell print the target directory to stdout +# if CDPATH is set. +(unset CDPATH) >/dev/null 2>&1 && unset CDPATH + +# The names of the tagged configurations supported by this script. +available_tags= + +# ### BEGIN LIBTOOL CONFIG], +[# ### BEGIN LIBTOOL TAG CONFIG: $tagname]) + +# Libtool was configured on host `(hostname || uname -n) 2>/dev/null | sed 1q`: + +# Shell to use when invoking shell scripts. +SHELL=$lt_SHELL + +# Whether or not to build shared libraries. +build_libtool_libs=$enable_shared + +# Whether or not to build static libraries. +build_old_libs=$enable_static + +# Whether or not to add -lc for building shared libraries. +build_libtool_need_lc=$_LT_AC_TAGVAR(archive_cmds_need_lc, $1) + +# Whether or not to disallow shared libs when runtime libs are static +allow_libtool_libs_with_static_runtimes=$_LT_AC_TAGVAR(enable_shared_with_static_runtimes, $1) + +# Whether or not to optimize for fast installation. +fast_install=$enable_fast_install + +# The host system. +host_alias=$host_alias +host=$host +host_os=$host_os + +# The build system. +build_alias=$build_alias +build=$build +build_os=$build_os + +# An echo program that does not interpret backslashes. +echo=$lt_echo + +# The archiver. +AR=$lt_AR +AR_FLAGS=$lt_AR_FLAGS + +# A C compiler. +LTCC=$lt_LTCC + +# LTCC compiler flags. +LTCFLAGS=$lt_LTCFLAGS + +# A language-specific compiler. +CC=$lt_[]_LT_AC_TAGVAR(compiler, $1) + +# Is the compiler the GNU C compiler? +with_gcc=$_LT_AC_TAGVAR(GCC, $1) + +gcc_dir=\`gcc -print-file-name=. | $SED 's,/\.$,,'\` +gcc_ver=\`gcc -dumpversion\` + +# An ERE matcher. +EGREP=$lt_EGREP + +# The linker used to build libraries. +LD=$lt_[]_LT_AC_TAGVAR(LD, $1) + +# Whether we need hard or soft links. +LN_S=$lt_LN_S + +# A BSD-compatible nm program. +NM=$lt_NM + +# A symbol stripping program +STRIP=$lt_STRIP + +# Used to examine libraries when file_magic_cmd begins "file" +MAGIC_CMD=$MAGIC_CMD + +# Used on cygwin: DLL creation program. +DLLTOOL="$DLLTOOL" + +# Used on cygwin: object dumper. +OBJDUMP="$OBJDUMP" + +# Used on cygwin: assembler. +AS="$AS" + +# The name of the directory that contains temporary libtool files. +objdir=$objdir + +# How to create reloadable object files. +reload_flag=$lt_reload_flag +reload_cmds=$lt_reload_cmds + +# How to pass a linker flag through the compiler. +wl=$lt_[]_LT_AC_TAGVAR(lt_prog_compiler_wl, $1) + +# Object file suffix (normally "o"). +objext="$ac_objext" + +# Old archive suffix (normally "a"). +libext="$libext" + +# Shared library suffix (normally ".so"). +shrext_cmds='$shrext_cmds' + +# Executable file suffix (normally ""). +exeext="$exeext" + +# Additional compiler flags for building library objects. +pic_flag=$lt_[]_LT_AC_TAGVAR(lt_prog_compiler_pic, $1) +pic_mode=$pic_mode + +# What is the maximum length of a command? +max_cmd_len=$lt_cv_sys_max_cmd_len + +# Does compiler simultaneously support -c and -o options? +compiler_c_o=$lt_[]_LT_AC_TAGVAR(lt_cv_prog_compiler_c_o, $1) + +# Must we lock files when doing compilation? +need_locks=$lt_need_locks + +# Do we need the lib prefix for modules? +need_lib_prefix=$need_lib_prefix + +# Do we need a version for libraries? +need_version=$need_version + +# Whether dlopen is supported. +dlopen_support=$enable_dlopen + +# Whether dlopen of programs is supported. +dlopen_self=$enable_dlopen_self + +# Whether dlopen of statically linked programs is supported. +dlopen_self_static=$enable_dlopen_self_static + +# Compiler flag to prevent dynamic linking. +link_static_flag=$lt_[]_LT_AC_TAGVAR(lt_prog_compiler_static, $1) + +# Compiler flag to turn off builtin functions. +no_builtin_flag=$lt_[]_LT_AC_TAGVAR(lt_prog_compiler_no_builtin_flag, $1) + +# Compiler flag to allow reflexive dlopens. +export_dynamic_flag_spec=$lt_[]_LT_AC_TAGVAR(export_dynamic_flag_spec, $1) + +# Compiler flag to generate shared objects directly from archives. +whole_archive_flag_spec=$lt_[]_LT_AC_TAGVAR(whole_archive_flag_spec, $1) + +# Compiler flag to generate thread-safe objects. +thread_safe_flag_spec=$lt_[]_LT_AC_TAGVAR(thread_safe_flag_spec, $1) + +# Library versioning type. +version_type=$version_type + +# Format of library name prefix. +libname_spec=$lt_libname_spec + +# List of archive names. First name is the real one, the rest are links. +# The last name is the one that the linker finds with -lNAME. +library_names_spec=$lt_library_names_spec + +# The coded name of the library, if different from the real name. +soname_spec=$lt_soname_spec + +# Commands used to build and install an old-style archive. +RANLIB=$lt_RANLIB +old_archive_cmds=$lt_[]_LT_AC_TAGVAR(old_archive_cmds, $1) +old_postinstall_cmds=$lt_old_postinstall_cmds +old_postuninstall_cmds=$lt_old_postuninstall_cmds + +# Create an old-style archive from a shared archive. +old_archive_from_new_cmds=$lt_[]_LT_AC_TAGVAR(old_archive_from_new_cmds, $1) + +# Create a temporary old-style archive to link instead of a shared archive. +old_archive_from_expsyms_cmds=$lt_[]_LT_AC_TAGVAR(old_archive_from_expsyms_cmds, $1) + +# Commands used to build and install a shared archive. +archive_cmds=$lt_[]_LT_AC_TAGVAR(archive_cmds, $1) +archive_expsym_cmds=$lt_[]_LT_AC_TAGVAR(archive_expsym_cmds, $1) +postinstall_cmds=$lt_postinstall_cmds +postuninstall_cmds=$lt_postuninstall_cmds + +# Commands used to build a loadable module (assumed same as above if empty) +module_cmds=$lt_[]_LT_AC_TAGVAR(module_cmds, $1) +module_expsym_cmds=$lt_[]_LT_AC_TAGVAR(module_expsym_cmds, $1) + +# Commands to strip libraries. +old_striplib=$lt_old_striplib +striplib=$lt_striplib + +# Dependencies to place before the objects being linked to create a +# shared library. +predep_objects=\`echo $lt_[]_LT_AC_TAGVAR(predep_objects, $1) | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\` + +# Dependencies to place after the objects being linked to create a +# shared library. +postdep_objects=\`echo $lt_[]_LT_AC_TAGVAR(postdep_objects, $1) | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\` + +# Dependencies to place before the objects being linked to create a +# shared library. +predeps=$lt_[]_LT_AC_TAGVAR(predeps, $1) + +# Dependencies to place after the objects being linked to create a +# shared library. +postdeps=$lt_[]_LT_AC_TAGVAR(postdeps, $1) + +# The library search path used internally by the compiler when linking +# a shared library. +compiler_lib_search_path=\`echo $lt_[]_LT_AC_TAGVAR(compiler_lib_search_path, $1) | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\` + +# Method to check whether dependent libraries are shared objects. +deplibs_check_method=$lt_deplibs_check_method + +# Command to use when deplibs_check_method == file_magic. +file_magic_cmd=$lt_file_magic_cmd + +# Flag that allows shared libraries with undefined symbols to be built. +allow_undefined_flag=$lt_[]_LT_AC_TAGVAR(allow_undefined_flag, $1) + +# Flag that forces no undefined symbols. +no_undefined_flag=$lt_[]_LT_AC_TAGVAR(no_undefined_flag, $1) + +# Commands used to finish a libtool library installation in a directory. +finish_cmds=$lt_finish_cmds + +# Same as above, but a single script fragment to be evaled but not shown. +finish_eval=$lt_finish_eval + +# Take the output of nm and produce a listing of raw symbols and C names. +global_symbol_pipe=$lt_lt_cv_sys_global_symbol_pipe + +# Transform the output of nm in a proper C declaration +global_symbol_to_cdecl=$lt_lt_cv_sys_global_symbol_to_cdecl + +# Transform the output of nm in a C name address pair +global_symbol_to_c_name_address=$lt_lt_cv_sys_global_symbol_to_c_name_address + +# This is the shared library runtime path variable. +runpath_var=$runpath_var + +# This is the shared library path variable. +shlibpath_var=$shlibpath_var + +# Is shlibpath searched before the hard-coded library search path? +shlibpath_overrides_runpath=$shlibpath_overrides_runpath + +# How to hardcode a shared library path into an executable. +hardcode_action=$_LT_AC_TAGVAR(hardcode_action, $1) + +# Whether we should hardcode library paths into libraries. +hardcode_into_libs=$hardcode_into_libs + +# Flag to hardcode \$libdir into a binary during linking. +# This must work even if \$libdir does not exist. +hardcode_libdir_flag_spec=$lt_[]_LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1) + +# If ld is used when linking, flag to hardcode \$libdir into +# a binary during linking. This must work even if \$libdir does +# not exist. +hardcode_libdir_flag_spec_ld=$lt_[]_LT_AC_TAGVAR(hardcode_libdir_flag_spec_ld, $1) + +# Whether we need a single -rpath flag with a separated argument. +hardcode_libdir_separator=$lt_[]_LT_AC_TAGVAR(hardcode_libdir_separator, $1) + +# Set to yes if using DIR/libNAME${shared_ext} during linking hardcodes DIR into the +# resulting binary. +hardcode_direct=$_LT_AC_TAGVAR(hardcode_direct, $1) + +# Set to yes if using the -LDIR flag during linking hardcodes DIR into the +# resulting binary. +hardcode_minus_L=$_LT_AC_TAGVAR(hardcode_minus_L, $1) + +# Set to yes if using SHLIBPATH_VAR=DIR during linking hardcodes DIR into +# the resulting binary. +hardcode_shlibpath_var=$_LT_AC_TAGVAR(hardcode_shlibpath_var, $1) + +# Set to yes if building a shared library automatically hardcodes DIR into the library +# and all subsequent libraries and executables linked against it. +hardcode_automatic=$_LT_AC_TAGVAR(hardcode_automatic, $1) + +# Variables whose values should be saved in libtool wrapper scripts and +# restored at relink time. +variables_saved_for_relink="$variables_saved_for_relink" + +# Whether libtool must link a program against all its dependency libraries. +link_all_deplibs=$_LT_AC_TAGVAR(link_all_deplibs, $1) + +# Compile-time system search path for libraries +sys_lib_search_path_spec=\`echo $lt_sys_lib_search_path_spec | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\` + +# Run-time system search path for libraries +sys_lib_dlsearch_path_spec=$lt_sys_lib_dlsearch_path_spec + +# Fix the shell variable \$srcfile for the compiler. +fix_srcfile_path="$_LT_AC_TAGVAR(fix_srcfile_path, $1)" + +# Set to yes if exported symbols are required. +always_export_symbols=$_LT_AC_TAGVAR(always_export_symbols, $1) + +# The commands to list exported symbols. +export_symbols_cmds=$lt_[]_LT_AC_TAGVAR(export_symbols_cmds, $1) + +# The commands to extract the exported symbol list from a shared archive. +extract_expsyms_cmds=$lt_extract_expsyms_cmds + +# Symbols that should not be listed in the preloaded symbols. +exclude_expsyms=$lt_[]_LT_AC_TAGVAR(exclude_expsyms, $1) + +# Symbols that must always be exported. +include_expsyms=$lt_[]_LT_AC_TAGVAR(include_expsyms, $1) + +ifelse([$1],[], +[# ### END LIBTOOL CONFIG], +[# ### END LIBTOOL TAG CONFIG: $tagname]) + +__EOF__ + +ifelse([$1],[], [ + case $host_os in + aix3*) + cat <<\EOF >> "$cfgfile" + +# AIX sometimes has problems with the GCC collect2 program. For some +# reason, if we set the COLLECT_NAMES environment variable, the problems +# vanish in a puff of smoke. +if test "X${COLLECT_NAMES+set}" != Xset; then + COLLECT_NAMES= + export COLLECT_NAMES +fi +EOF + ;; + esac + + # We use sed instead of cat because bash on DJGPP gets confused if + # if finds mixed CR/LF and LF-only lines. Since sed operates in + # text mode, it properly converts lines to CR/LF. This bash problem + # is reportedly fixed, but why not run on old versions too? + sed '$q' "$ltmain" >> "$cfgfile" || (rm -f "$cfgfile"; exit 1) + + mv -f "$cfgfile" "$ofile" || \ + (rm -f "$ofile" && cp "$cfgfile" "$ofile" && rm -f "$cfgfile") + chmod +x "$ofile" +]) +else + # If there is no Makefile yet, we rely on a make rule to execute + # `config.status --recheck' to rerun these tests and create the + # libtool script then. + ltmain_in=`echo $ltmain | sed -e 's/\.sh$/.in/'` + if test -f "$ltmain_in"; then + test -f Makefile && make "$ltmain" + fi +fi +])# AC_LIBTOOL_CONFIG + + +# AC_LIBTOOL_PROG_COMPILER_NO_RTTI([TAGNAME]) +# ------------------------------------------- +AC_DEFUN([AC_LIBTOOL_PROG_COMPILER_NO_RTTI], +[AC_REQUIRE([_LT_AC_SYS_COMPILER])dnl + +_LT_AC_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)= + +if test "$GCC" = yes; then + _LT_AC_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)=' -fno-builtin' + + AC_LIBTOOL_COMPILER_OPTION([if $compiler supports -fno-rtti -fno-exceptions], + lt_cv_prog_compiler_rtti_exceptions, + [-fno-rtti -fno-exceptions], [], + [_LT_AC_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)="$_LT_AC_TAGVAR(lt_prog_compiler_no_builtin_flag, $1) -fno-rtti -fno-exceptions"]) +fi +])# AC_LIBTOOL_PROG_COMPILER_NO_RTTI + + +# AC_LIBTOOL_SYS_GLOBAL_SYMBOL_PIPE +# --------------------------------- +AC_DEFUN([AC_LIBTOOL_SYS_GLOBAL_SYMBOL_PIPE], +[AC_REQUIRE([AC_CANONICAL_HOST]) +AC_REQUIRE([AC_PROG_NM]) +AC_REQUIRE([AC_OBJEXT]) +# Check for command to grab the raw symbol name followed by C symbol from nm. +AC_MSG_CHECKING([command to parse $NM output from $compiler object]) +AC_CACHE_VAL([lt_cv_sys_global_symbol_pipe], +[ +# These are sane defaults that work on at least a few old systems. +# [They come from Ultrix. What could be older than Ultrix?!! ;)] + +# Character class describing NM global symbol codes. +symcode='[[BCDEGRST]]' + +# Regexp to match symbols that can be accessed directly from C. +sympat='\([[_A-Za-z]][[_A-Za-z0-9]]*\)' + +# Transform an extracted symbol line into a proper C declaration +lt_cv_sys_global_symbol_to_cdecl="sed -n -e 's/^. .* \(.*\)$/extern int \1;/p'" + +# Transform an extracted symbol line into symbol name and symbol address +lt_cv_sys_global_symbol_to_c_name_address="sed -n -e 's/^: \([[^ ]]*\) $/ {\\\"\1\\\", (lt_ptr) 0},/p' -e 's/^$symcode \([[^ ]]*\) \([[^ ]]*\)$/ {\"\2\", (lt_ptr) \&\2},/p'" + +# Define system-specific variables. +case $host_os in +aix*) + symcode='[[BCDT]]' + ;; +cygwin* | mingw* | pw32*) + symcode='[[ABCDGISTW]]' + ;; +hpux*) # Its linker distinguishes data from code symbols + if test "$host_cpu" = ia64; then + symcode='[[ABCDEGRST]]' + fi + lt_cv_sys_global_symbol_to_cdecl="sed -n -e 's/^T .* \(.*\)$/extern int \1();/p' -e 's/^$symcode* .* \(.*\)$/extern char \1;/p'" + lt_cv_sys_global_symbol_to_c_name_address="sed -n -e 's/^: \([[^ ]]*\) $/ {\\\"\1\\\", (lt_ptr) 0},/p' -e 's/^$symcode* \([[^ ]]*\) \([[^ ]]*\)$/ {\"\2\", (lt_ptr) \&\2},/p'" + ;; +linux*) + if test "$host_cpu" = ia64; then + symcode='[[ABCDGIRSTW]]' + lt_cv_sys_global_symbol_to_cdecl="sed -n -e 's/^T .* \(.*\)$/extern int \1();/p' -e 's/^$symcode* .* \(.*\)$/extern char \1;/p'" + lt_cv_sys_global_symbol_to_c_name_address="sed -n -e 's/^: \([[^ ]]*\) $/ {\\\"\1\\\", (lt_ptr) 0},/p' -e 's/^$symcode* \([[^ ]]*\) \([[^ ]]*\)$/ {\"\2\", (lt_ptr) \&\2},/p'" + fi + ;; +irix* | nonstopux*) + symcode='[[BCDEGRST]]' + ;; +osf*) + symcode='[[BCDEGQRST]]' + ;; +solaris*) + symcode='[[BDRT]]' + ;; +sco3.2v5*) + symcode='[[DT]]' + ;; +sysv4.2uw2*) + symcode='[[DT]]' + ;; +sysv5* | sco5v6* | unixware* | OpenUNIX*) + symcode='[[ABDT]]' + ;; +sysv4) + symcode='[[DFNSTU]]' + ;; +esac + +# Handle CRLF in mingw tool chain +opt_cr= +case $build_os in +mingw*) + opt_cr=`echo 'x\{0,1\}' | tr x '\015'` # option cr in regexp + ;; +esac + +# If we're using GNU nm, then use its standard symbol codes. +case `$NM -V 2>&1` in +*GNU* | *'with BFD'*) + symcode='[[ABCDGIRSTW]]' ;; +esac + +# Try without a prefix undercore, then with it. +for ac_symprfx in "" "_"; do + + # Transform symcode, sympat, and symprfx into a raw symbol and a C symbol. + symxfrm="\\1 $ac_symprfx\\2 \\2" + + # Write the raw and C identifiers. + lt_cv_sys_global_symbol_pipe="sed -n -e 's/^.*[[ ]]\($symcode$symcode*\)[[ ]][[ ]]*$ac_symprfx$sympat$opt_cr$/$symxfrm/p'" + + # Check to see that the pipe works correctly. + pipe_works=no + + rm -f conftest* + cat > conftest.$ac_ext <<EOF +#ifdef __cplusplus +extern "C" { +#endif +char nm_test_var; +void nm_test_func(){} +#ifdef __cplusplus +} +#endif +int main(){nm_test_var='a';nm_test_func();return(0);} +EOF + + if AC_TRY_EVAL(ac_compile); then + # Now try to grab the symbols. + nlist=conftest.nm + if AC_TRY_EVAL(NM conftest.$ac_objext \| $lt_cv_sys_global_symbol_pipe \> $nlist) && test -s "$nlist"; then + # Try sorting and uniquifying the output. + if sort "$nlist" | uniq > "$nlist"T; then + mv -f "$nlist"T "$nlist" + else + rm -f "$nlist"T + fi + + # Make sure that we snagged all the symbols we need. + if grep ' nm_test_var$' "$nlist" >/dev/null; then + if grep ' nm_test_func$' "$nlist" >/dev/null; then + cat <<EOF > conftest.$ac_ext +#ifdef __cplusplus +extern "C" { +#endif + +EOF + # Now generate the symbol file. + eval "$lt_cv_sys_global_symbol_to_cdecl"' < "$nlist" | grep -v main >> conftest.$ac_ext' + + cat <<EOF >> conftest.$ac_ext +#if defined (__STDC__) && __STDC__ +# define lt_ptr_t void * +#else +# define lt_ptr_t char * +# define const +#endif + +/* The mapping between symbol names and symbols. */ +const struct { + const char *name; + lt_ptr_t address; +} +lt_preloaded_symbols[[]] = +{ +EOF + $SED "s/^$symcode$symcode* \(.*\) \(.*\)$/ {\"\2\", (lt_ptr_t) \&\2},/" < "$nlist" | grep -v main >> conftest.$ac_ext + cat <<\EOF >> conftest.$ac_ext + {0, (lt_ptr_t) 0} +}; + +#ifdef __cplusplus +} +#endif +EOF + # Now try linking the two files. + mv conftest.$ac_objext conftstm.$ac_objext + lt_save_LIBS="$LIBS" + lt_save_CFLAGS="$CFLAGS" + LIBS="conftstm.$ac_objext" + CFLAGS="$CFLAGS$_LT_AC_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)" + if AC_TRY_EVAL(ac_link) && test -s conftest${ac_exeext}; then + pipe_works=yes + fi + LIBS="$lt_save_LIBS" + CFLAGS="$lt_save_CFLAGS" + else + echo "cannot find nm_test_func in $nlist" >&AS_MESSAGE_LOG_FD + fi + else + echo "cannot find nm_test_var in $nlist" >&AS_MESSAGE_LOG_FD + fi + else + echo "cannot run $lt_cv_sys_global_symbol_pipe" >&AS_MESSAGE_LOG_FD + fi + else + echo "$progname: failed program was:" >&AS_MESSAGE_LOG_FD + cat conftest.$ac_ext >&5 + fi + rm -f conftest* conftst* + + # Do not use the global_symbol_pipe unless it works. + if test "$pipe_works" = yes; then + break + else + lt_cv_sys_global_symbol_pipe= + fi +done +]) +if test -z "$lt_cv_sys_global_symbol_pipe"; then + lt_cv_sys_global_symbol_to_cdecl= +fi +if test -z "$lt_cv_sys_global_symbol_pipe$lt_cv_sys_global_symbol_to_cdecl"; then + AC_MSG_RESULT(failed) +else + AC_MSG_RESULT(ok) +fi +]) # AC_LIBTOOL_SYS_GLOBAL_SYMBOL_PIPE + + +# AC_LIBTOOL_PROG_COMPILER_PIC([TAGNAME]) +# --------------------------------------- +AC_DEFUN([AC_LIBTOOL_PROG_COMPILER_PIC], +[_LT_AC_TAGVAR(lt_prog_compiler_wl, $1)= +_LT_AC_TAGVAR(lt_prog_compiler_pic, $1)= +_LT_AC_TAGVAR(lt_prog_compiler_static, $1)= + +AC_MSG_CHECKING([for $compiler option to produce PIC]) + ifelse([$1],[CXX],[ + # C++ specific cases for pic, static, wl, etc. + if test "$GXX" = yes; then + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-static' + + case $host_os in + aix*) + # All AIX code is PIC. + if test "$host_cpu" = ia64; then + # AIX 5 now supports IA64 processor + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + fi + ;; + amigaos*) + # FIXME: we need at least 68020 code to build shared libraries, but + # adding the `-m68020' flag to GCC prevents building anything better, + # like `-m68040'. + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-m68020 -resident32 -malways-restore-a4' + ;; + beos* | cygwin* | irix5* | irix6* | nonstopux* | osf3* | osf4* | osf5*) + # PIC is the default for these OSes. + ;; + mingw* | os2* | pw32*) + # This hack is so that the source file can tell whether it is being + # built for inclusion in a dll (and should export symbols for example). + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-DDLL_EXPORT' + ;; + darwin* | rhapsody*) + # PIC is the default on this platform + # Common symbols not allowed in MH_DYLIB files + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-fno-common' + ;; + *djgpp*) + # DJGPP does not support shared libraries at all + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)= + ;; + interix3*) + # Interix 3.x gcc -fpic/-fPIC options generate broken code. + # Instead, we relocate shared libraries at runtime. + ;; + sysv4*MP*) + if test -d /usr/nec; then + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)=-Kconform_pic + fi + ;; + hpux*) + # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but + # not for PA HP-UX. + case $host_cpu in + hppa*64*|ia64*) + ;; + *) + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC' + ;; + esac + ;; + *) + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC' + ;; + esac + else + case $host_os in + aix4* | aix5*) + # All AIX code is PIC. + if test "$host_cpu" = ia64; then + # AIX 5 now supports IA64 processor + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + else + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-bnso -bI:/lib/syscalls.exp' + fi + ;; + chorus*) + case $cc_basename in + cxch68*) + # Green Hills C++ Compiler + # _LT_AC_TAGVAR(lt_prog_compiler_static, $1)="--no_auto_instantiation -u __main -u __premain -u _abort -r $COOL_DIR/lib/libOrb.a $MVME_DIR/lib/CC/libC.a $MVME_DIR/lib/classix/libcx.s.a" + ;; + esac + ;; + darwin*) + # PIC is the default on this platform + # Common symbols not allowed in MH_DYLIB files + case $cc_basename in + xlc*) + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-qnocommon' + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + ;; + esac + ;; + dgux*) + case $cc_basename in + ec++*) + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC' + ;; + ghcx*) + # Green Hills C++ Compiler + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-pic' + ;; + *) + ;; + esac + ;; + freebsd* | kfreebsd*-gnu | dragonfly*) + # FreeBSD uses GNU C++ + ;; + hpux9* | hpux10* | hpux11*) + case $cc_basename in + CC*) + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='${wl}-a ${wl}archive' + if test "$host_cpu" != ia64; then + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='+Z' + fi + ;; + aCC*) + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='${wl}-a ${wl}archive' + case $host_cpu in + hppa*64*|ia64*) + # +Z the default + ;; + *) + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='+Z' + ;; + esac + ;; + *) + ;; + esac + ;; + interix*) + # This is c89, which is MS Visual C++ (no shared libs) + # Anyone wants to do a port? + ;; + irix5* | irix6* | nonstopux*) + case $cc_basename in + CC*) + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-non_shared' + # CC pic flag -KPIC is the default. + ;; + *) + ;; + esac + ;; + linux*) + case $cc_basename in + KCC*) + # KAI C++ Compiler + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='--backend -Wl,' + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC' + ;; + icpc* | ecpc*) + # Intel C++ + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC' + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-static' + ;; + pgCC*) + # Portland Group C++ compiler. + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-fpic' + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + ;; + cxx*) + # Compaq C++ + # Make sure the PIC flag is empty. It appears that all Alpha + # Linux and Compaq Tru64 Unix objects are PIC. + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)= + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-non_shared' + ;; + *) + ;; + esac + ;; + lynxos*) + ;; + m88k*) + ;; + mvs*) + case $cc_basename in + cxx*) + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-W c,exportall' + ;; + *) + ;; + esac + ;; + netbsd*) + ;; + osf3* | osf4* | osf5*) + case $cc_basename in + KCC*) + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='--backend -Wl,' + ;; + RCC*) + # Rational C++ 2.4.1 + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-pic' + ;; + cxx*) + # Digital/Compaq C++ + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + # Make sure the PIC flag is empty. It appears that all Alpha + # Linux and Compaq Tru64 Unix objects are PIC. + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)= + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-non_shared' + ;; + *) + ;; + esac + ;; + psos*) + ;; + solaris*) + case $cc_basename in + CC*) + # Sun C++ 4.2, 5.x and Centerline C++ + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC' + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Qoption ld ' + ;; + gcx*) + # Green Hills C++ Compiler + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-PIC' + ;; + *) + ;; + esac + ;; + sunos4*) + case $cc_basename in + CC*) + # Sun C++ 4.x + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-pic' + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + ;; + lcc*) + # Lucid + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-pic' + ;; + *) + ;; + esac + ;; + tandem*) + case $cc_basename in + NCC*) + # NonStop-UX NCC 3.20 + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC' + ;; + *) + ;; + esac + ;; + sysv5* | unixware* | sco3.2v5* | sco5v6* | OpenUNIX*) + case $cc_basename in + CC*) + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC' + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + ;; + esac + ;; + vxworks*) + ;; + *) + _LT_AC_TAGVAR(lt_prog_compiler_can_build_shared, $1)=no + ;; + esac + fi +], +[ + if test "$GCC" = yes; then + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-static' + + case $host_os in + aix*) + # All AIX code is PIC. + if test "$host_cpu" = ia64; then + # AIX 5 now supports IA64 processor + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + fi + ;; + + amigaos*) + # FIXME: we need at least 68020 code to build shared libraries, but + # adding the `-m68020' flag to GCC prevents building anything better, + # like `-m68040'. + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-m68020 -resident32 -malways-restore-a4' + ;; + + beos* | cygwin* | irix5* | irix6* | nonstopux* | osf3* | osf4* | osf5*) + # PIC is the default for these OSes. + ;; + + mingw* | pw32* | os2*) + # This hack is so that the source file can tell whether it is being + # built for inclusion in a dll (and should export symbols for example). + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-DDLL_EXPORT' + ;; + + darwin* | rhapsody*) + # PIC is the default on this platform + # Common symbols not allowed in MH_DYLIB files + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-fno-common' + ;; + + interix3*) + # Interix 3.x gcc -fpic/-fPIC options generate broken code. + # Instead, we relocate shared libraries at runtime. + ;; + + msdosdjgpp*) + # Just because we use GCC doesn't mean we suddenly get shared libraries + # on systems that don't support them. + _LT_AC_TAGVAR(lt_prog_compiler_can_build_shared, $1)=no + enable_shared=no + ;; + + sysv4*MP*) + if test -d /usr/nec; then + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)=-Kconform_pic + fi + ;; + + hpux*) + # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but + # not for PA HP-UX. + case $host_cpu in + hppa*64*|ia64*) + # +Z the default + ;; + *) + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC' + ;; + esac + ;; + + *) + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC' + ;; + esac + else + # PORTME Check for flag to pass linker flags through the system compiler. + case $host_os in + aix*) + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + if test "$host_cpu" = ia64; then + # AIX 5 now supports IA64 processor + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + else + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-bnso -bI:/lib/syscalls.exp' + fi + ;; + darwin*) + # PIC is the default on this platform + # Common symbols not allowed in MH_DYLIB files + case $cc_basename in + xlc*) + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-qnocommon' + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + ;; + esac + ;; + + mingw* | pw32* | os2*) + # This hack is so that the source file can tell whether it is being + # built for inclusion in a dll (and should export symbols for example). + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-DDLL_EXPORT' + ;; + + hpux9* | hpux10* | hpux11*) + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but + # not for PA HP-UX. + case $host_cpu in + hppa*64*|ia64*) + # +Z the default + ;; + *) + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='+Z' + ;; + esac + # Is there a better lt_prog_compiler_static that works with the bundled CC? + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='${wl}-a ${wl}archive' + ;; + + irix5* | irix6* | nonstopux*) + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + # PIC (with -KPIC) is the default. + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-non_shared' + ;; + + newsos6) + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC' + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + ;; + + linux*) + case $cc_basename in + icc* | ecc*) + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC' + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-static' + ;; + pgcc* | pgf77* | pgf90* | pgf95*) + # Portland Group compilers (*not* the Pentium gcc compiler, + # which looks to be a dead project) + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-fpic' + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + ;; + ccc*) + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + # All Alpha code is PIC. + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-non_shared' + ;; + esac + ;; + + osf3* | osf4* | osf5*) + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + # All OSF/1 code is PIC. + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-non_shared' + ;; + + solaris*) + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC' + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + case $cc_basename in + f77* | f90* | f95*) + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Qoption ld ';; + *) + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,';; + esac + ;; + + sunos4*) + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Qoption ld ' + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-PIC' + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + ;; + + sysv4 | sysv4.2uw2* | sysv4.3*) + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC' + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + ;; + + sysv4*MP*) + if test -d /usr/nec ;then + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-Kconform_pic' + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + fi + ;; + + sysv5* | unixware* | sco3.2v5* | sco5v6* | OpenUNIX*) + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC' + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + ;; + + unicos*) + _LT_AC_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,' + _LT_AC_TAGVAR(lt_prog_compiler_can_build_shared, $1)=no + ;; + + uts4*) + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)='-pic' + _LT_AC_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic' + ;; + + *) + _LT_AC_TAGVAR(lt_prog_compiler_can_build_shared, $1)=no + ;; + esac + fi +]) +AC_MSG_RESULT([$_LT_AC_TAGVAR(lt_prog_compiler_pic, $1)]) + +# +# Check to make sure the PIC flag actually works. +# +if test -n "$_LT_AC_TAGVAR(lt_prog_compiler_pic, $1)"; then + AC_LIBTOOL_COMPILER_OPTION([if $compiler PIC flag $_LT_AC_TAGVAR(lt_prog_compiler_pic, $1) works], + _LT_AC_TAGVAR(lt_prog_compiler_pic_works, $1), + [$_LT_AC_TAGVAR(lt_prog_compiler_pic, $1)ifelse([$1],[],[ -DPIC],[ifelse([$1],[CXX],[ -DPIC],[])])], [], + [case $_LT_AC_TAGVAR(lt_prog_compiler_pic, $1) in + "" | " "*) ;; + *) _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)=" $_LT_AC_TAGVAR(lt_prog_compiler_pic, $1)" ;; + esac], + [_LT_AC_TAGVAR(lt_prog_compiler_pic, $1)= + _LT_AC_TAGVAR(lt_prog_compiler_can_build_shared, $1)=no]) +fi +case $host_os in + # For platforms which do not support PIC, -DPIC is meaningless: + *djgpp*) + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)= + ;; + *) + _LT_AC_TAGVAR(lt_prog_compiler_pic, $1)="$_LT_AC_TAGVAR(lt_prog_compiler_pic, $1)ifelse([$1],[],[ -DPIC],[ifelse([$1],[CXX],[ -DPIC],[])])" + ;; +esac + +# +# Check to make sure the static flag actually works. +# +wl=$_LT_AC_TAGVAR(lt_prog_compiler_wl, $1) eval lt_tmp_static_flag=\"$_LT_AC_TAGVAR(lt_prog_compiler_static, $1)\" +AC_LIBTOOL_LINKER_OPTION([if $compiler static flag $lt_tmp_static_flag works], + _LT_AC_TAGVAR(lt_prog_compiler_static_works, $1), + $lt_tmp_static_flag, + [], + [_LT_AC_TAGVAR(lt_prog_compiler_static, $1)=]) +]) + + +# AC_LIBTOOL_PROG_LD_SHLIBS([TAGNAME]) +# ------------------------------------ +# See if the linker supports building shared libraries. +AC_DEFUN([AC_LIBTOOL_PROG_LD_SHLIBS], +[AC_MSG_CHECKING([whether the $compiler linker ($LD) supports shared libraries]) +ifelse([$1],[CXX],[ + _LT_AC_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols' + case $host_os in + aix4* | aix5*) + # If we're using GNU nm, then we don't want the "-C" option. + # -C means demangle to AIX nm, but means don't demangle with GNU nm + if $NM -V 2>&1 | grep 'GNU' > /dev/null; then + _LT_AC_TAGVAR(export_symbols_cmds, $1)='$NM -Bpg $libobjs $convenience | awk '\''{ if (((\[$]2 == "T") || (\[$]2 == "D") || (\[$]2 == "B")) && ([substr](\[$]3,1,1) != ".")) { print \[$]3 } }'\'' | sort -u > $export_symbols' + else + _LT_AC_TAGVAR(export_symbols_cmds, $1)='$NM -BCpg $libobjs $convenience | awk '\''{ if (((\[$]2 == "T") || (\[$]2 == "D") || (\[$]2 == "B")) && ([substr](\[$]3,1,1) != ".")) { print \[$]3 } }'\'' | sort -u > $export_symbols' + fi + ;; + pw32*) + _LT_AC_TAGVAR(export_symbols_cmds, $1)="$ltdll_cmds" + ;; + cygwin* | mingw*) + _LT_AC_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[[BCDGRS]] /s/.* \([[^ ]]*\)/\1 DATA/;/^.* __nm__/s/^.* __nm__\([[^ ]]*\) [[^ ]]*/\1 DATA/;/^I /d;/^[[AITW]] /s/.* //'\'' | sort | uniq > $export_symbols' + ;; + *) + _LT_AC_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols' + ;; + esac +],[ + runpath_var= + _LT_AC_TAGVAR(allow_undefined_flag, $1)= + _LT_AC_TAGVAR(enable_shared_with_static_runtimes, $1)=no + _LT_AC_TAGVAR(archive_cmds, $1)= + _LT_AC_TAGVAR(archive_expsym_cmds, $1)= + _LT_AC_TAGVAR(old_archive_From_new_cmds, $1)= + _LT_AC_TAGVAR(old_archive_from_expsyms_cmds, $1)= + _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)= + _LT_AC_TAGVAR(whole_archive_flag_spec, $1)= + _LT_AC_TAGVAR(thread_safe_flag_spec, $1)= + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)= + _LT_AC_TAGVAR(hardcode_libdir_flag_spec_ld, $1)= + _LT_AC_TAGVAR(hardcode_libdir_separator, $1)= + _LT_AC_TAGVAR(hardcode_direct, $1)=no + _LT_AC_TAGVAR(hardcode_minus_L, $1)=no + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=unsupported + _LT_AC_TAGVAR(link_all_deplibs, $1)=unknown + _LT_AC_TAGVAR(hardcode_automatic, $1)=no + _LT_AC_TAGVAR(module_cmds, $1)= + _LT_AC_TAGVAR(module_expsym_cmds, $1)= + _LT_AC_TAGVAR(always_export_symbols, $1)=no + _LT_AC_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols' + # include_expsyms should be a list of space-separated symbols to be *always* + # included in the symbol list + _LT_AC_TAGVAR(include_expsyms, $1)= + # exclude_expsyms can be an extended regexp of symbols to exclude + # it will be wrapped by ` (' and `)$', so one must not match beginning or + # end of line. Example: `a|bc|.*d.*' will exclude the symbols `a' and `bc', + # as well as any symbol that contains `d'. + _LT_AC_TAGVAR(exclude_expsyms, $1)="_GLOBAL_OFFSET_TABLE_" + # Although _GLOBAL_OFFSET_TABLE_ is a valid symbol C name, most a.out + # platforms (ab)use it in PIC code, but their linkers get confused if + # the symbol is explicitly referenced. Since portable code cannot + # rely on this symbol name, it's probably fine to never include it in + # preloaded symbol tables. + extract_expsyms_cmds= + # Just being paranoid about ensuring that cc_basename is set. + _LT_CC_BASENAME([$compiler]) + case $host_os in + cygwin* | mingw* | pw32*) + # FIXME: the MSVC++ port hasn't been tested in a loooong time + # When not using gcc, we currently assume that we are using + # Microsoft Visual C++. + if test "$GCC" != yes; then + with_gnu_ld=no + fi + ;; + interix*) + # we just hope/assume this is gcc and not c89 (= MSVC++) + with_gnu_ld=yes + ;; + openbsd*) + with_gnu_ld=no + ;; + esac + + _LT_AC_TAGVAR(ld_shlibs, $1)=yes + if test "$with_gnu_ld" = yes; then + # If archive_cmds runs LD, not CC, wlarc should be empty + wlarc='${wl}' + + # Set some defaults for GNU ld with shared library support. These + # are reset later if shared libraries are not supported. Putting them + # here allows them to be overridden if necessary. + runpath_var=LD_RUN_PATH + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}--rpath ${wl}$libdir' + _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic' + # ancient GNU ld didn't support --whole-archive et. al. + if $LD --help 2>&1 | grep 'no-whole-archive' > /dev/null; then + _LT_AC_TAGVAR(whole_archive_flag_spec, $1)="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive' + else + _LT_AC_TAGVAR(whole_archive_flag_spec, $1)= + fi + supports_anon_versioning=no + case `$LD -v 2>/dev/null` in + *\ [[01]].* | *\ 2.[[0-9]].* | *\ 2.10.*) ;; # catch versions < 2.11 + *\ 2.11.93.0.2\ *) supports_anon_versioning=yes ;; # RH7.3 ... + *\ 2.11.92.0.12\ *) supports_anon_versioning=yes ;; # Mandrake 8.2 ... + *\ 2.11.*) ;; # other 2.11 versions + *) supports_anon_versioning=yes ;; + esac + + # See if GNU ld supports shared libraries. + case $host_os in + aix3* | aix4* | aix5*) + # On AIX/PPC, the GNU linker is very broken + if test "$host_cpu" != ia64; then + _LT_AC_TAGVAR(ld_shlibs, $1)=no + cat <<EOF 1>&2 + +*** Warning: the GNU linker, at least up to release 2.9.1, is reported +*** to be unable to reliably create shared libraries on AIX. +*** Therefore, libtool is disabling shared libraries support. If you +*** really care for shared libraries, you may want to modify your PATH +*** so that a non-GNU linker is found, and then restart. + +EOF + fi + ;; + + amigaos*) + _LT_AC_TAGVAR(archive_cmds, $1)='$rm $output_objdir/a2ixlibrary.data~$echo "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$echo "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$echo "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$echo "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)' + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir' + _LT_AC_TAGVAR(hardcode_minus_L, $1)=yes + + # Samuel A. Falvo II <kc5tja@dolphin.openprojects.net> reports + # that the semantics of dynamic libraries on AmigaOS, at least up + # to version 4, is to share data among multiple programs linked + # with the same dynamic library. Since this doesn't match the + # behavior of shared libraries on other platforms, we can't use + # them. + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + + beos*) + if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then + _LT_AC_TAGVAR(allow_undefined_flag, $1)=unsupported + # Joseph Beckenbach <jrb3@best.com> says some releases of gcc + # support --undefined. This deserves some investigation. FIXME + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -nostart $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + else + _LT_AC_TAGVAR(ld_shlibs, $1)=no + fi + ;; + + cygwin* | mingw* | pw32*) + # _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1) is actually meaningless, + # as there is no search path for DLLs. + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir' + _LT_AC_TAGVAR(allow_undefined_flag, $1)=unsupported + _LT_AC_TAGVAR(always_export_symbols, $1)=no + _LT_AC_TAGVAR(enable_shared_with_static_runtimes, $1)=yes + _LT_AC_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[[BCDGRS]] /s/.* \([[^ ]]*\)/\1 DATA/'\'' | $SED -e '\''/^[[AITW]] /s/.* //'\'' | sort | uniq > $export_symbols' + + if $LD --help 2>&1 | grep 'auto-import' > /dev/null; then + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib' + # If the export-symbols file already is a .def file (1st line + # is EXPORTS), use it as is; otherwise, prepend... + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then + cp $export_symbols $output_objdir/$soname.def; + else + echo EXPORTS > $output_objdir/$soname.def; + cat $export_symbols >> $output_objdir/$soname.def; + fi~ + $CC -shared $output_objdir/$soname.def $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib' + else + _LT_AC_TAGVAR(ld_shlibs, $1)=no + fi + ;; + + interix3*) + _LT_AC_TAGVAR(hardcode_direct, $1)=no + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir' + _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E' + # Hack: On Interix 3.x, we cannot compile PIC because of a broken gcc. + # Instead, shared libraries are loaded at an image base (0x10000000 by + # default) and relocated if they conflict, which is a slow very memory + # consuming and fragmenting process. To avoid this, we pick a random, + # 256 KiB-aligned image base between 0x50000000 and 0x6FFC0000 at link + # time. Moving up from 0x10000000 also allows more sbrk(2) space. + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='sed "s,^,_," $export_symbols >$output_objdir/$soname.expsym~$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--retain-symbols-file,$output_objdir/$soname.expsym ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib' + ;; + + linux*) + if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then + tmp_addflag= + case $cc_basename,$host_cpu in + pgcc*) # Portland Group C compiler + _LT_AC_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}--no-whole-archive' + tmp_addflag=' $pic_flag' + ;; + pgf77* | pgf90* | pgf95*) # Portland Group f77 and f90 compilers + _LT_AC_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}--no-whole-archive' + tmp_addflag=' $pic_flag -Mnomain' ;; + ecc*,ia64* | icc*,ia64*) # Intel C compiler on ia64 + tmp_addflag=' -i_dynamic' ;; + efc*,ia64* | ifort*,ia64*) # Intel Fortran compiler on ia64 + tmp_addflag=' -i_dynamic -nofor_main' ;; + ifc* | ifort*) # Intel Fortran compiler + tmp_addflag=' -nofor_main' ;; + esac + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared'"$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + + if test $supports_anon_versioning = yes; then + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$echo "{ global:" > $output_objdir/$libname.ver~ + cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~ + $echo "local: *; };" >> $output_objdir/$libname.ver~ + $CC -shared'"$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-version-script ${wl}$output_objdir/$libname.ver -o $lib' + fi + else + _LT_AC_TAGVAR(ld_shlibs, $1)=no + fi + ;; + + netbsd*) + if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then + _LT_AC_TAGVAR(archive_cmds, $1)='$LD -Bshareable $libobjs $deplibs $linker_flags -o $lib' + wlarc= + else + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + fi + ;; + + solaris*) + if $LD -v 2>&1 | grep 'BFD 2\.8' > /dev/null; then + _LT_AC_TAGVAR(ld_shlibs, $1)=no + cat <<EOF 1>&2 + +*** Warning: The releases 2.8.* of the GNU linker cannot reliably +*** create shared libraries on Solaris systems. Therefore, libtool +*** is disabling shared libraries support. We urge you to upgrade GNU +*** binutils to release 2.9.1 or newer. Another option is to modify +*** your PATH or compiler configuration so that the native linker is +*** used, and then restart. + +EOF + elif $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + else + _LT_AC_TAGVAR(ld_shlibs, $1)=no + fi + ;; + + sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX*) + case `$LD -v 2>&1` in + *\ [[01]].* | *\ 2.[[0-9]].* | *\ 2.1[[0-5]].*) + _LT_AC_TAGVAR(ld_shlibs, $1)=no + cat <<_LT_EOF 1>&2 + +*** Warning: Releases of the GNU linker prior to 2.16.91.0.3 can not +*** reliably create shared libraries on SCO systems. Therefore, libtool +*** is disabling shared libraries support. We urge you to upgrade GNU +*** binutils to release 2.16.91.0.3 or newer. Another option is to modify +*** your PATH or compiler configuration so that the native linker is +*** used, and then restart. + +_LT_EOF + ;; + *) + if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='`test -z "$SCOABSPATH" && echo ${wl}-rpath,$libdir`' + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname,\${SCOABSPATH:+${install_libdir}/}$soname,-retain-symbols-file,$export_symbols -o $lib' + else + _LT_AC_TAGVAR(ld_shlibs, $1)=no + fi + ;; + esac + ;; + + sunos4*) + _LT_AC_TAGVAR(archive_cmds, $1)='$LD -assert pure-text -Bshareable -o $lib $libobjs $deplibs $linker_flags' + wlarc= + _LT_AC_TAGVAR(hardcode_direct, $1)=yes + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no + ;; + + *) + if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + else + _LT_AC_TAGVAR(ld_shlibs, $1)=no + fi + ;; + esac + + if test "$_LT_AC_TAGVAR(ld_shlibs, $1)" = no; then + runpath_var= + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)= + _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)= + _LT_AC_TAGVAR(whole_archive_flag_spec, $1)= + fi + else + # PORTME fill in a description of your system's linker (not GNU ld) + case $host_os in + aix3*) + _LT_AC_TAGVAR(allow_undefined_flag, $1)=unsupported + _LT_AC_TAGVAR(always_export_symbols, $1)=yes + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$LD -o $output_objdir/$soname $libobjs $deplibs $linker_flags -bE:$export_symbols -T512 -H512 -bM:SRE~$AR $AR_FLAGS $lib $output_objdir/$soname' + # Note: this linker hardcodes the directories in LIBPATH if there + # are no directories specified by -L. + _LT_AC_TAGVAR(hardcode_minus_L, $1)=yes + if test "$GCC" = yes && test -z "$lt_prog_compiler_static"; then + # Neither direct hardcoding nor static linking is supported with a + # broken collect2. + _LT_AC_TAGVAR(hardcode_direct, $1)=unsupported + fi + ;; + + aix4* | aix5*) + if test "$host_cpu" = ia64; then + # On IA64, the linker does run time linking by default, so we don't + # have to do anything special. + aix_use_runtimelinking=no + exp_sym_flag='-Bexport' + no_entry_flag="" + else + # If we're using GNU nm, then we don't want the "-C" option. + # -C means demangle to AIX nm, but means don't demangle with GNU nm + if $NM -V 2>&1 | grep 'GNU' > /dev/null; then + _LT_AC_TAGVAR(export_symbols_cmds, $1)='$NM -Bpg $libobjs $convenience | awk '\''{ if (((\[$]2 == "T") || (\[$]2 == "D") || (\[$]2 == "B")) && ([substr](\[$]3,1,1) != ".")) { print \[$]3 } }'\'' | sort -u > $export_symbols' + else + _LT_AC_TAGVAR(export_symbols_cmds, $1)='$NM -BCpg $libobjs $convenience | awk '\''{ if (((\[$]2 == "T") || (\[$]2 == "D") || (\[$]2 == "B")) && ([substr](\[$]3,1,1) != ".")) { print \[$]3 } }'\'' | sort -u > $export_symbols' + fi + aix_use_runtimelinking=no + + # Test if we are trying to use run time linking or normal + # AIX style linking. If -brtl is somewhere in LDFLAGS, we + # need to do runtime linking. + case $host_os in aix4.[[23]]|aix4.[[23]].*|aix5*) + for ld_flag in $LDFLAGS; do + if (test $ld_flag = "-brtl" || test $ld_flag = "-Wl,-brtl"); then + aix_use_runtimelinking=yes + break + fi + done + ;; + esac + + exp_sym_flag='-bexport' + no_entry_flag='-bnoentry' + fi + + # When large executables or shared objects are built, AIX ld can + # have problems creating the table of contents. If linking a library + # or program results in "error TOC overflow" add -mminimal-toc to + # CXXFLAGS/CFLAGS for g++/gcc. In the cases where that is not + # enough to fix the problem, add -Wl,-bbigtoc to LDFLAGS. + + _LT_AC_TAGVAR(archive_cmds, $1)='' + _LT_AC_TAGVAR(hardcode_direct, $1)=yes + _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=':' + _LT_AC_TAGVAR(link_all_deplibs, $1)=yes + + if test "$GCC" = yes; then + case $host_os in aix4.[[012]]|aix4.[[012]].*) + # We only want to do this on AIX 4.2 and lower, the check + # below for broken collect2 doesn't work under 4.3+ + collect2name=`${CC} -print-prog-name=collect2` + if test -f "$collect2name" && \ + strings "$collect2name" | grep resolve_lib_name >/dev/null + then + # We have reworked collect2 + _LT_AC_TAGVAR(hardcode_direct, $1)=yes + else + # We have old collect2 + _LT_AC_TAGVAR(hardcode_direct, $1)=unsupported + # It fails to find uninstalled libraries when the uninstalled + # path is not listed in the libpath. Setting hardcode_minus_L + # to unsupported forces relinking + _LT_AC_TAGVAR(hardcode_minus_L, $1)=yes + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir' + _LT_AC_TAGVAR(hardcode_libdir_separator, $1)= + fi + ;; + esac + shared_flag='-shared' + if test "$aix_use_runtimelinking" = yes; then + shared_flag="$shared_flag "'${wl}-G' + fi + else + # not using gcc + if test "$host_cpu" = ia64; then + # VisualAge C++, Version 5.5 for AIX 5L for IA-64, Beta 3 Release + # chokes on -Wl,-G. The following line is correct: + shared_flag='-G' + else + if test "$aix_use_runtimelinking" = yes; then + shared_flag='${wl}-G' + else + shared_flag='${wl}-bM:SRE' + fi + fi + fi + + # It seems that -bexpall does not export symbols beginning with + # underscore (_), so it is better to generate a list of symbols to export. + _LT_AC_TAGVAR(always_export_symbols, $1)=yes + if test "$aix_use_runtimelinking" = yes; then + # Warning - without using the other runtime loading flags (-brtl), + # -berok will link without error, but may produce a broken library. + _LT_AC_TAGVAR(allow_undefined_flag, $1)='-berok' + # Determine the default libpath from the value encoded in an empty executable. + _LT_AC_SYS_LIBPATH_AIX + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-blibpath:$libdir:'"$aix_libpath" + _LT_AC_TAGVAR(archive_expsym_cmds, $1)="\$CC"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags `if test "x${allow_undefined_flag}" != "x"; then echo "${wl}${allow_undefined_flag}"; else :; fi` '"\${wl}$exp_sym_flag:\$export_symbols $shared_flag" + else + if test "$host_cpu" = ia64; then + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-R $libdir:/usr/lib:/lib' + _LT_AC_TAGVAR(allow_undefined_flag, $1)="-z nodefs" + _LT_AC_TAGVAR(archive_expsym_cmds, $1)="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags ${wl}${allow_undefined_flag} '"\${wl}$exp_sym_flag:\$export_symbols" + else + # Determine the default libpath from the value encoded in an empty executable. + _LT_AC_SYS_LIBPATH_AIX + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-blibpath:$libdir:'"$aix_libpath" + # Warning - without using the other run time loading flags, + # -berok will link without error, but may produce a broken library. + _LT_AC_TAGVAR(no_undefined_flag, $1)=' ${wl}-bernotok' + _LT_AC_TAGVAR(allow_undefined_flag, $1)=' ${wl}-berok' + # Exported symbols can be pulled into shared objects from archives + _LT_AC_TAGVAR(whole_archive_flag_spec, $1)='$convenience' + _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=yes + # This is similar to how AIX traditionally builds its shared libraries. + _LT_AC_TAGVAR(archive_expsym_cmds, $1)="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs ${wl}-bnoentry $compiler_flags ${wl}-bE:$export_symbols${allow_undefined_flag}~$AR $AR_FLAGS $output_objdir/$libname$release.a $output_objdir/$soname' + fi + fi + ;; + + amigaos*) + _LT_AC_TAGVAR(archive_cmds, $1)='$rm $output_objdir/a2ixlibrary.data~$echo "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$echo "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$echo "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$echo "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)' + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir' + _LT_AC_TAGVAR(hardcode_minus_L, $1)=yes + # see comment about different semantics on the GNU ld section + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + + bsdi[[45]]*) + _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)=-rdynamic + ;; + + cygwin* | mingw* | pw32*) + # When not using gcc, we currently assume that we are using + # Microsoft Visual C++. + # hardcode_libdir_flag_spec is actually meaningless, as there is + # no search path for DLLs. + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)=' ' + _LT_AC_TAGVAR(allow_undefined_flag, $1)=unsupported + # Tell ltmain to make .lib files, not .a files. + libext=lib + # Tell ltmain to make .dll files, not .so files. + shrext_cmds=".dll" + # FIXME: Setting linknames here is a bad hack. + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -o $lib $libobjs $compiler_flags `echo "$deplibs" | $SED -e '\''s/ -lc$//'\''` -link -dll~linknames=' + # The linker will automatically build a .lib file if we build a DLL. + _LT_AC_TAGVAR(old_archive_From_new_cmds, $1)='true' + # FIXME: Should let the user specify the lib program. + _LT_AC_TAGVAR(old_archive_cmds, $1)='lib /OUT:$oldlib$oldobjs$old_deplibs' + _LT_AC_TAGVAR(fix_srcfile_path, $1)='`cygpath -w "$srcfile"`' + _LT_AC_TAGVAR(enable_shared_with_static_runtimes, $1)=yes + ;; + + darwin* | rhapsody*) + case $host_os in + rhapsody* | darwin1.[[012]]) + _LT_AC_TAGVAR(allow_undefined_flag, $1)='${wl}-undefined ${wl}suppress' + ;; + *) # Darwin 1.3 on + if test -z ${MACOSX_DEPLOYMENT_TARGET} ; then + _LT_AC_TAGVAR(allow_undefined_flag, $1)='${wl}-flat_namespace ${wl}-undefined ${wl}suppress' + else + case ${MACOSX_DEPLOYMENT_TARGET} in + 10.[[012]]) + _LT_AC_TAGVAR(allow_undefined_flag, $1)='${wl}-flat_namespace ${wl}-undefined ${wl}suppress' + ;; + 10.*) + _LT_AC_TAGVAR(allow_undefined_flag, $1)='${wl}-undefined ${wl}dynamic_lookup' + ;; + esac + fi + ;; + esac + _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=no + _LT_AC_TAGVAR(hardcode_direct, $1)=no + _LT_AC_TAGVAR(hardcode_automatic, $1)=yes + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=unsupported + _LT_AC_TAGVAR(whole_archive_flag_spec, $1)='' + _LT_AC_TAGVAR(link_all_deplibs, $1)=yes + if test "$GCC" = yes ; then + output_verbose_link_cmd='echo' + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -dynamiclib $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags -install_name $rpath/$soname $verstring' + _LT_AC_TAGVAR(module_cmds, $1)='$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags' + # Don't fix this by using the ld -exported_symbols_list flag, it doesn't exist in older darwin lds + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -dynamiclib $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags -install_name $rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}' + _LT_AC_TAGVAR(module_expsym_cmds, $1)='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}' + else + case $cc_basename in + xlc*) + output_verbose_link_cmd='echo' + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -qmkshrobj $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-install_name ${wl}`echo $rpath/$soname` $verstring' + _LT_AC_TAGVAR(module_cmds, $1)='$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags' + # Don't fix this by using the ld -exported_symbols_list flag, it doesn't exist in older darwin lds + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -qmkshrobj $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-install_name ${wl}$rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}' + _LT_AC_TAGVAR(module_expsym_cmds, $1)='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}' + ;; + *) + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + esac + fi + ;; + + dgux*) + _LT_AC_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir' + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no + ;; + + freebsd1*) + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + + # FreeBSD 2.2.[012] allows us to include c++rt0.o to get C++ constructor + # support. Future versions do this automatically, but an explicit c++rt0.o + # does not break anything, and helps significantly (at the cost of a little + # extra space). + freebsd2.2*) + _LT_AC_TAGVAR(archive_cmds, $1)='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags /usr/lib/c++rt0.o' + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir' + _LT_AC_TAGVAR(hardcode_direct, $1)=yes + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no + ;; + + # Unfortunately, older versions of FreeBSD 2 do not have this feature. + freebsd2*) + _LT_AC_TAGVAR(archive_cmds, $1)='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' + _LT_AC_TAGVAR(hardcode_direct, $1)=yes + _LT_AC_TAGVAR(hardcode_minus_L, $1)=yes + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no + ;; + + # FreeBSD 3 and greater uses gcc -shared to do shared libraries. + freebsd* | kfreebsd*-gnu | dragonfly*) + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -o $lib $libobjs $deplibs $compiler_flags' + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir' + _LT_AC_TAGVAR(hardcode_direct, $1)=yes + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no + ;; + + hpux9*) + if test "$GCC" = yes; then + _LT_AC_TAGVAR(archive_cmds, $1)='$rm $output_objdir/$soname~$CC -shared -fPIC ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $libobjs $deplibs $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib' + else + _LT_AC_TAGVAR(archive_cmds, $1)='$rm $output_objdir/$soname~$LD -b +b $install_libdir -o $output_objdir/$soname $libobjs $deplibs $linker_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib' + fi + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}+b ${wl}$libdir' + _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=: + _LT_AC_TAGVAR(hardcode_direct, $1)=yes + + # hardcode_minus_L: Not really in the search PATH, + # but as the default location of the library. + _LT_AC_TAGVAR(hardcode_minus_L, $1)=yes + _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E' + ;; + + hpux10*) + if test "$GCC" = yes -a "$with_gnu_ld" = no; then + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -fPIC ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags' + else + _LT_AC_TAGVAR(archive_cmds, $1)='$LD -b +h $soname +b $install_libdir -o $lib $libobjs $deplibs $linker_flags' + fi + if test "$with_gnu_ld" = no; then + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}+b ${wl}$libdir' + _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=: + + _LT_AC_TAGVAR(hardcode_direct, $1)=yes + _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E' + + # hardcode_minus_L: Not really in the search PATH, + # but as the default location of the library. + _LT_AC_TAGVAR(hardcode_minus_L, $1)=yes + fi + ;; + + hpux11*) + if test "$GCC" = yes -a "$with_gnu_ld" = no; then + case $host_cpu in + hppa*64*) + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags' + ;; + ia64*) + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags' + ;; + *) + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared -fPIC ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags' + ;; + esac + else + case $host_cpu in + hppa*64*) + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags' + ;; + ia64*) + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags' + ;; + *) + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags' + ;; + esac + fi + if test "$with_gnu_ld" = no; then + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}+b ${wl}$libdir' + _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=: + + case $host_cpu in + hppa*64*|ia64*) + _LT_AC_TAGVAR(hardcode_libdir_flag_spec_ld, $1)='+b $libdir' + _LT_AC_TAGVAR(hardcode_direct, $1)=no + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no + ;; + *) + _LT_AC_TAGVAR(hardcode_direct, $1)=yes + _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E' + + # hardcode_minus_L: Not really in the search PATH, + # but as the default location of the library. + _LT_AC_TAGVAR(hardcode_minus_L, $1)=yes + ;; + esac + fi + ;; + + irix5* | irix6* | nonstopux*) + if test "$GCC" = yes; then + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + else + _LT_AC_TAGVAR(archive_cmds, $1)='$LD -shared $libobjs $deplibs $linker_flags -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib' + _LT_AC_TAGVAR(hardcode_libdir_flag_spec_ld, $1)='-rpath $libdir' + fi + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir' + _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=: + _LT_AC_TAGVAR(link_all_deplibs, $1)=yes + ;; + + netbsd*) + if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then + _LT_AC_TAGVAR(archive_cmds, $1)='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' # a.out + else + _LT_AC_TAGVAR(archive_cmds, $1)='$LD -shared -o $lib $libobjs $deplibs $linker_flags' # ELF + fi + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir' + _LT_AC_TAGVAR(hardcode_direct, $1)=yes + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no + ;; + + newsos6) + _LT_AC_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + _LT_AC_TAGVAR(hardcode_direct, $1)=yes + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir' + _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=: + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no + ;; + + openbsd*) + _LT_AC_TAGVAR(hardcode_direct, $1)=yes + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no + if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-retain-symbols-file,$export_symbols' + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir' + _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E' + else + case $host_os in + openbsd[[01]].* | openbsd2.[[0-7]] | openbsd2.[[0-7]].*) + _LT_AC_TAGVAR(archive_cmds, $1)='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir' + ;; + *) + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags' + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir' + ;; + esac + fi + ;; + + os2*) + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir' + _LT_AC_TAGVAR(hardcode_minus_L, $1)=yes + _LT_AC_TAGVAR(allow_undefined_flag, $1)=unsupported + _LT_AC_TAGVAR(archive_cmds, $1)='$echo "LIBRARY $libname INITINSTANCE" > $output_objdir/$libname.def~$echo "DESCRIPTION \"$libname\"" >> $output_objdir/$libname.def~$echo DATA >> $output_objdir/$libname.def~$echo " SINGLE NONSHARED" >> $output_objdir/$libname.def~$echo EXPORTS >> $output_objdir/$libname.def~emxexp $libobjs >> $output_objdir/$libname.def~$CC -Zdll -Zcrtdll -o $lib $libobjs $deplibs $compiler_flags $output_objdir/$libname.def' + _LT_AC_TAGVAR(old_archive_From_new_cmds, $1)='emximp -o $output_objdir/$libname.a $output_objdir/$libname.def' + ;; + + osf3*) + if test "$GCC" = yes; then + _LT_AC_TAGVAR(allow_undefined_flag, $1)=' ${wl}-expect_unresolved ${wl}\*' + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + else + _LT_AC_TAGVAR(allow_undefined_flag, $1)=' -expect_unresolved \*' + _LT_AC_TAGVAR(archive_cmds, $1)='$LD -shared${allow_undefined_flag} $libobjs $deplibs $linker_flags -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib' + fi + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir' + _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=: + ;; + + osf4* | osf5*) # as osf3* with the addition of -msym flag + if test "$GCC" = yes; then + _LT_AC_TAGVAR(allow_undefined_flag, $1)=' ${wl}-expect_unresolved ${wl}\*' + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags ${wl}-msym ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir' + else + _LT_AC_TAGVAR(allow_undefined_flag, $1)=' -expect_unresolved \*' + _LT_AC_TAGVAR(archive_cmds, $1)='$LD -shared${allow_undefined_flag} $libobjs $deplibs $linker_flags -msym -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='for i in `cat $export_symbols`; do printf "%s %s\\n" -exported_symbol "\$i" >> $lib.exp; done; echo "-hidden">> $lib.exp~ + $LD -shared${allow_undefined_flag} -input $lib.exp $linker_flags $libobjs $deplibs -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib~$rm $lib.exp' + + # Both c and cxx compiler support -rpath directly + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-rpath $libdir' + fi + _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=: + ;; + + solaris*) + _LT_AC_TAGVAR(no_undefined_flag, $1)=' -z text' + if test "$GCC" = yes; then + wlarc='${wl}' + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~ + $CC -shared ${wl}-M ${wl}$lib.exp ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags~$rm $lib.exp' + else + wlarc='' + _LT_AC_TAGVAR(archive_cmds, $1)='$LD -G${allow_undefined_flag} -h $soname -o $lib $libobjs $deplibs $linker_flags' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~ + $LD -G${allow_undefined_flag} -M $lib.exp -h $soname -o $lib $libobjs $deplibs $linker_flags~$rm $lib.exp' + fi + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir' + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no + case $host_os in + solaris2.[[0-5]] | solaris2.[[0-5]].*) ;; + *) + # The compiler driver will combine linker options so we + # cannot just pass the convience library names through + # without $wl, iff we do not link with $LD. + # Luckily, gcc supports the same syntax we need for Sun Studio. + # Supported since Solaris 2.6 (maybe 2.5.1?) + case $wlarc in + '') + _LT_AC_TAGVAR(whole_archive_flag_spec, $1)='-z allextract$convenience -z defaultextract' ;; + *) + _LT_AC_TAGVAR(whole_archive_flag_spec, $1)='${wl}-z ${wl}allextract`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}-z ${wl}defaultextract' ;; + esac ;; + esac + _LT_AC_TAGVAR(link_all_deplibs, $1)=yes + ;; + + sunos4*) + if test "x$host_vendor" = xsequent; then + # Use $CC to link under sequent, because it throws in some extra .o + # files that make .init and .fini sections work. + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -G ${wl}-h $soname -o $lib $libobjs $deplibs $compiler_flags' + else + _LT_AC_TAGVAR(archive_cmds, $1)='$LD -assert pure-text -Bstatic -o $lib $libobjs $deplibs $linker_flags' + fi + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir' + _LT_AC_TAGVAR(hardcode_direct, $1)=yes + _LT_AC_TAGVAR(hardcode_minus_L, $1)=yes + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no + ;; + + sysv4) + case $host_vendor in + sni) + _LT_AC_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + _LT_AC_TAGVAR(hardcode_direct, $1)=yes # is this really true??? + ;; + siemens) + ## LD is ld it makes a PLAMLIB + ## CC just makes a GrossModule. + _LT_AC_TAGVAR(archive_cmds, $1)='$LD -G -o $lib $libobjs $deplibs $linker_flags' + _LT_AC_TAGVAR(reload_cmds, $1)='$CC -r -o $output$reload_objs' + _LT_AC_TAGVAR(hardcode_direct, $1)=no + ;; + motorola) + _LT_AC_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + _LT_AC_TAGVAR(hardcode_direct, $1)=no #Motorola manual says yes, but my tests say they lie + ;; + esac + runpath_var='LD_RUN_PATH' + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no + ;; + + sysv4.3*) + _LT_AC_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no + _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='-Bexport' + ;; + + sysv4*MP*) + if test -d /usr/nec; then + _LT_AC_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no + runpath_var=LD_RUN_PATH + hardcode_runpath_var=yes + _LT_AC_TAGVAR(ld_shlibs, $1)=yes + fi + ;; + + sysv4*uw2* | sysv5OpenUNIX* | sysv5UnixWare7.[[01]].[[10]]* | unixware7*) + _LT_AC_TAGVAR(no_undefined_flag, $1)='${wl}-z,text' + _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=no + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no + runpath_var='LD_RUN_PATH' + + if test "$GCC" = yes; then + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + else + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + fi + ;; + + sysv5* | sco3.2v5* | sco5v6*) + # Note: We can NOT use -z defs as we might desire, because we do not + # link with -lc, and that would cause any symbols used from libc to + # always be unresolved, which means just about no library would + # ever link correctly. If we're not using GNU ld we use -z text + # though, which does catch some bad symbols but isn't as heavy-handed + # as -z defs. + _LT_AC_TAGVAR(no_undefined_flag, $1)='${wl}-z,text' + _LT_AC_TAGVAR(allow_undefined_flag, $1)='${wl}-z,nodefs' + _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=no + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='`test -z "$SCOABSPATH" && echo ${wl}-R,$libdir`' + _LT_AC_TAGVAR(hardcode_libdir_separator, $1)=':' + _LT_AC_TAGVAR(link_all_deplibs, $1)=yes + _LT_AC_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-Bexport' + runpath_var='LD_RUN_PATH' + + if test "$GCC" = yes; then + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags' + else + _LT_AC_TAGVAR(archive_cmds, $1)='$CC -G ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags' + _LT_AC_TAGVAR(archive_expsym_cmds, $1)='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags' + fi + ;; + + uts4*) + _LT_AC_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + _LT_AC_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir' + _LT_AC_TAGVAR(hardcode_shlibpath_var, $1)=no + ;; + + *) + _LT_AC_TAGVAR(ld_shlibs, $1)=no + ;; + esac + fi +]) +AC_MSG_RESULT([$_LT_AC_TAGVAR(ld_shlibs, $1)]) +test "$_LT_AC_TAGVAR(ld_shlibs, $1)" = no && can_build_shared=no + +# +# Do we need to explicitly link libc? +# +case "x$_LT_AC_TAGVAR(archive_cmds_need_lc, $1)" in +x|xyes) + # Assume -lc should be added + _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=yes + + if test "$enable_shared" = yes && test "$GCC" = yes; then + case $_LT_AC_TAGVAR(archive_cmds, $1) in + *'~'*) + # FIXME: we may have to deal with multi-command sequences. + ;; + '$CC '*) + # Test whether the compiler implicitly links with -lc since on some + # systems, -lgcc has to come before -lc. If gcc already passes -lc + # to ld, don't add -lc before -lgcc. + AC_MSG_CHECKING([whether -lc should be explicitly linked in]) + $rm conftest* + printf "$lt_simple_compile_test_code" > conftest.$ac_ext + + if AC_TRY_EVAL(ac_compile) 2>conftest.err; then + soname=conftest + lib=conftest + libobjs=conftest.$ac_objext + deplibs= + wl=$_LT_AC_TAGVAR(lt_prog_compiler_wl, $1) + pic_flag=$_LT_AC_TAGVAR(lt_prog_compiler_pic, $1) + compiler_flags=-v + linker_flags=-v + verstring= + output_objdir=. + libname=conftest + lt_save_allow_undefined_flag=$_LT_AC_TAGVAR(allow_undefined_flag, $1) + _LT_AC_TAGVAR(allow_undefined_flag, $1)= + if AC_TRY_EVAL(_LT_AC_TAGVAR(archive_cmds, $1) 2\>\&1 \| grep \" -lc \" \>/dev/null 2\>\&1) + then + _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=no + else + _LT_AC_TAGVAR(archive_cmds_need_lc, $1)=yes + fi + _LT_AC_TAGVAR(allow_undefined_flag, $1)=$lt_save_allow_undefined_flag + else + cat conftest.err 1>&5 + fi + $rm conftest* + AC_MSG_RESULT([$_LT_AC_TAGVAR(archive_cmds_need_lc, $1)]) + ;; + esac + fi + ;; +esac +])# AC_LIBTOOL_PROG_LD_SHLIBS + + +# _LT_AC_FILE_LTDLL_C +# ------------------- +# Be careful that the start marker always follows a newline. +AC_DEFUN([_LT_AC_FILE_LTDLL_C], [ +# /* ltdll.c starts here */ +# #define WIN32_LEAN_AND_MEAN +# #include <windows.h> +# #undef WIN32_LEAN_AND_MEAN +# #include <stdio.h> +# +# #ifndef __CYGWIN__ +# # ifdef __CYGWIN32__ +# # define __CYGWIN__ __CYGWIN32__ +# # endif +# #endif +# +# #ifdef __cplusplus +# extern "C" { +# #endif +# BOOL APIENTRY DllMain (HINSTANCE hInst, DWORD reason, LPVOID reserved); +# #ifdef __cplusplus +# } +# #endif +# +# #ifdef __CYGWIN__ +# #include <cygwin/cygwin_dll.h> +# DECLARE_CYGWIN_DLL( DllMain ); +# #endif +# HINSTANCE __hDllInstance_base; +# +# BOOL APIENTRY +# DllMain (HINSTANCE hInst, DWORD reason, LPVOID reserved) +# { +# __hDllInstance_base = hInst; +# return TRUE; +# } +# /* ltdll.c ends here */ +])# _LT_AC_FILE_LTDLL_C + + +# _LT_AC_TAGVAR(VARNAME, [TAGNAME]) +# --------------------------------- +AC_DEFUN([_LT_AC_TAGVAR], [ifelse([$2], [], [$1], [$1_$2])]) + + +# old names +AC_DEFUN([AM_PROG_LIBTOOL], [AC_PROG_LIBTOOL]) +AC_DEFUN([AM_ENABLE_SHARED], [AC_ENABLE_SHARED($@)]) +AC_DEFUN([AM_ENABLE_STATIC], [AC_ENABLE_STATIC($@)]) +AC_DEFUN([AM_DISABLE_SHARED], [AC_DISABLE_SHARED($@)]) +AC_DEFUN([AM_DISABLE_STATIC], [AC_DISABLE_STATIC($@)]) +AC_DEFUN([AM_PROG_LD], [AC_PROG_LD]) +AC_DEFUN([AM_PROG_NM], [AC_PROG_NM]) + +# This is just to silence aclocal about the macro not being used +ifelse([AC_DISABLE_FAST_INSTALL]) + +AC_DEFUN([LT_AC_PROG_GCJ], +[AC_CHECK_TOOL(GCJ, gcj, no) + test "x${GCJFLAGS+set}" = xset || GCJFLAGS="-g -O2" + AC_SUBST(GCJFLAGS) +]) + +AC_DEFUN([LT_AC_PROG_RC], +[AC_CHECK_TOOL(RC, windres, no) +]) + +# NOTE: This macro has been submitted for inclusion into # +# GNU Autoconf as AC_PROG_SED. When it is available in # +# a released version of Autoconf we should remove this # +# macro and use it instead. # +# LT_AC_PROG_SED +# -------------- +# Check for a fully-functional sed program, that truncates +# as few characters as possible. Prefer GNU sed if found. +AC_DEFUN([LT_AC_PROG_SED], +[AC_MSG_CHECKING([for a sed that does not truncate output]) +AC_CACHE_VAL(lt_cv_path_SED, +[# Loop through the user's path and test for sed and gsed. +# Then use that list of sed's as ones to test for truncation. +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for lt_ac_prog in sed gsed; do + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$lt_ac_prog$ac_exec_ext"; then + lt_ac_sed_list="$lt_ac_sed_list $as_dir/$lt_ac_prog$ac_exec_ext" + fi + done + done +done +IFS=$as_save_IFS +lt_ac_max=0 +lt_ac_count=0 +# Add /usr/xpg4/bin/sed as it is typically found on Solaris +# along with /bin/sed that truncates output. +for lt_ac_sed in $lt_ac_sed_list /usr/xpg4/bin/sed; do + test ! -f $lt_ac_sed && continue + cat /dev/null > conftest.in + lt_ac_count=0 + echo $ECHO_N "0123456789$ECHO_C" >conftest.in + # Check for GNU sed and select it if it is found. + if "$lt_ac_sed" --version 2>&1 < /dev/null | grep 'GNU' > /dev/null; then + lt_cv_path_SED=$lt_ac_sed + break + fi + while true; do + cat conftest.in conftest.in >conftest.tmp + mv conftest.tmp conftest.in + cp conftest.in conftest.nl + echo >>conftest.nl + $lt_ac_sed -e 's/a$//' < conftest.nl >conftest.out || break + cmp -s conftest.out conftest.nl || break + # 10000 chars as input seems more than enough + test $lt_ac_count -gt 10 && break + lt_ac_count=`expr $lt_ac_count + 1` + if test $lt_ac_count -gt $lt_ac_max; then + lt_ac_max=$lt_ac_count + lt_cv_path_SED=$lt_ac_sed + fi + done +done +]) +SED=$lt_cv_path_SED +AC_SUBST([SED]) +AC_MSG_RESULT([$SED]) +]) + +# pkg.m4 - Macros to locate and utilise pkg-config. -*- Autoconf -*- +# +# Copyright © 2004 Scott James Remnant <scott@netsplit.com>. +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, but +# WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +# General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. +# +# As a special exception to the GNU General Public License, if you +# distribute this file as part of a program that contains a +# configuration script generated by Autoconf, you may include it under +# the same distribution terms that you use for the rest of that program. + +# PKG_PROG_PKG_CONFIG([MIN-VERSION]) +# ---------------------------------- +AC_DEFUN([PKG_PROG_PKG_CONFIG], +[m4_pattern_forbid([^_?PKG_[A-Z_]+$]) +m4_pattern_allow([^PKG_CONFIG(_PATH)?$]) +AC_ARG_VAR([PKG_CONFIG], [path to pkg-config utility])dnl +if test "x$ac_cv_env_PKG_CONFIG_set" != "xset"; then + AC_PATH_TOOL([PKG_CONFIG], [pkg-config]) +fi +if test -n "$PKG_CONFIG"; then + _pkg_min_version=m4_default([$1], [0.9.0]) + AC_MSG_CHECKING([pkg-config is at least version $_pkg_min_version]) + if $PKG_CONFIG --atleast-pkgconfig-version $_pkg_min_version; then + AC_MSG_RESULT([yes]) + else + AC_MSG_RESULT([no]) + PKG_CONFIG="" + fi + +fi[]dnl +])# PKG_PROG_PKG_CONFIG + +# PKG_CHECK_EXISTS(MODULES, [ACTION-IF-FOUND], [ACTION-IF-NOT-FOUND]) +# +# Check to see whether a particular set of modules exists. Similar +# to PKG_CHECK_MODULES(), but does not set variables or print errors. +# +# +# Similar to PKG_CHECK_MODULES, make sure that the first instance of +# this or PKG_CHECK_MODULES is called, or make sure to call +# PKG_CHECK_EXISTS manually +# -------------------------------------------------------------- +AC_DEFUN([PKG_CHECK_EXISTS], +[AC_REQUIRE([PKG_PROG_PKG_CONFIG])dnl +if test -n "$PKG_CONFIG" && \ + AC_RUN_LOG([$PKG_CONFIG --exists --print-errors "$1"]); then + m4_ifval([$2], [$2], [:]) +m4_ifvaln([$3], [else + $3])dnl +fi]) + + +# _PKG_CONFIG([VARIABLE], [COMMAND], [MODULES]) +# --------------------------------------------- +m4_define([_PKG_CONFIG], +[if test -n "$PKG_CONFIG"; then + if test -n "$$1"; then + pkg_cv_[]$1="$$1" + else + PKG_CHECK_EXISTS([$3], + [pkg_cv_[]$1=`$PKG_CONFIG --[]$2 "$3" 2>/dev/null`], + [pkg_failed=yes]) + fi +else + pkg_failed=untried +fi[]dnl +])# _PKG_CONFIG + +# _PKG_SHORT_ERRORS_SUPPORTED +# ----------------------------- +AC_DEFUN([_PKG_SHORT_ERRORS_SUPPORTED], +[AC_REQUIRE([PKG_PROG_PKG_CONFIG]) +if $PKG_CONFIG --atleast-pkgconfig-version 0.20; then + _pkg_short_errors_supported=yes +else + _pkg_short_errors_supported=no +fi[]dnl +])# _PKG_SHORT_ERRORS_SUPPORTED + + +# PKG_CHECK_MODULES(VARIABLE-PREFIX, MODULES, [ACTION-IF-FOUND], +# [ACTION-IF-NOT-FOUND]) +# +# +# Note that if there is a possibility the first call to +# PKG_CHECK_MODULES might not happen, you should be sure to include an +# explicit call to PKG_PROG_PKG_CONFIG in your configure.ac +# +# +# -------------------------------------------------------------- +AC_DEFUN([PKG_CHECK_MODULES], +[AC_REQUIRE([PKG_PROG_PKG_CONFIG])dnl +AC_ARG_VAR([$1][_CFLAGS], [C compiler flags for $1, overriding pkg-config])dnl +AC_ARG_VAR([$1][_LIBS], [linker flags for $1, overriding pkg-config])dnl + +pkg_failed=no +AC_MSG_CHECKING([for $1]) + +_PKG_CONFIG([$1][_CFLAGS], [cflags], [$2]) +_PKG_CONFIG([$1][_LIBS], [libs], [$2]) + +m4_define([_PKG_TEXT], [Alternatively, you may set the environment variables $1[]_CFLAGS +and $1[]_LIBS to avoid the need to call pkg-config. +See the pkg-config man page for more details.]) + +if test $pkg_failed = yes; then + _PKG_SHORT_ERRORS_SUPPORTED + if test $_pkg_short_errors_supported = yes; then + $1[]_PKG_ERRORS=`$PKG_CONFIG --short-errors --errors-to-stdout --print-errors "$2"` + else + $1[]_PKG_ERRORS=`$PKG_CONFIG --errors-to-stdout --print-errors "$2"` + fi + # Put the nasty error message in config.log where it belongs + echo "$$1[]_PKG_ERRORS" >&AS_MESSAGE_LOG_FD + + ifelse([$4], , [AC_MSG_ERROR(dnl +[Package requirements ($2) were not met: + +$$1_PKG_ERRORS + +Consider adjusting the PKG_CONFIG_PATH environment variable if you +installed software in a non-standard prefix. + +_PKG_TEXT +])], + [AC_MSG_RESULT([no]) + $4]) +elif test $pkg_failed = untried; then + ifelse([$4], , [AC_MSG_FAILURE(dnl +[The pkg-config script could not be found or is too old. Make sure it +is in your PATH or set the PKG_CONFIG environment variable to the full +path to pkg-config. + +_PKG_TEXT + +To get pkg-config, see <http://www.freedesktop.org/software/pkgconfig>.])], + [$4]) +else + $1[]_CFLAGS=$pkg_cv_[]$1[]_CFLAGS + $1[]_LIBS=$pkg_cv_[]$1[]_LIBS + AC_MSG_RESULT([yes]) + ifelse([$3], , :, [$3]) +fi[]dnl +])# PKG_CHECK_MODULES + +dnl +dnl Copyright 2005-2006 Sun Microsystems, Inc. All rights reserved. +dnl +dnl Permission is hereby granted, free of charge, to any person obtaining a +dnl copy of this software and associated documentation files (the +dnl "Software"), to deal in the Software without restriction, including +dnl without limitation the rights to use, copy, modify, merge, publish, +dnl distribute, and/or sell copies of the Software, and to permit persons +dnl to whom the Software is furnished to do so, provided that the above +dnl copyright notice(s) and this permission notice appear in all copies of +dnl the Software and that both the above copyright notice(s) and this +dnl permission notice appear in supporting documentation. +dnl +dnl THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +dnl OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +dnl MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT +dnl OF THIRD PARTY RIGHTS. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR +dnl HOLDERS INCLUDED IN THIS NOTICE BE LIABLE FOR ANY CLAIM, OR ANY SPECIAL +dnl INDIRECT OR CONSEQUENTIAL DAMAGES, OR ANY DAMAGES WHATSOEVER RESULTING +dnl FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, +dnl NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION +dnl WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. +dnl +dnl Except as contained in this notice, the name of a copyright holder +dnl shall not be used in advertising or otherwise to promote the sale, use +dnl or other dealings in this Software without prior written authorization +dnl of the copyright holder. + +# XORG_MACROS_VERSION(required-version) +# ------------------------------------- +# Minimum version: 1.1.0 +# +# If you're using a macro added in Version 1.1 or newer, include this in +# your configure.ac with the minimum required version, such as: +# XORG_MACROS_VERSION(1.1) +# +# To force at least a version with this macro defined, also add: +# m4_ifndef([XORG_MACROS_VERSION], [AC_FATAL([must install xorg-macros 1.1 or later before running autoconf/autogen])]) +# +# +# See the "minimum version" comment for each macro you use to see what +# version you require. +AC_DEFUN([XORG_MACROS_VERSION],[ + [XORG_MACROS_needed_version=$1 + XORG_MACROS_needed_major=`echo $XORG_MACROS_needed_version | sed 's/\..*$//'` + XORG_MACROS_needed_minor=`echo $XORG_MACROS_needed_version | sed -e 's/^[0-9]*\.//' -e 's/\..*$//'`] + AC_MSG_CHECKING([if xorg-macros used to generate configure is at least ${XORG_MACROS_needed_major}.${XORG_MACROS_needed_minor}]) + [XORG_MACROS_version=1.1.1 + XORG_MACROS_major=`echo $XORG_MACROS_version | sed 's/\..*$//'` + XORG_MACROS_minor=`echo $XORG_MACROS_version | sed -e 's/^[0-9]*\.//' -e 's/\..*$//'`] + if test $XORG_MACROS_major -ne $XORG_MACROS_needed_major ; then + AC_MSG_ERROR([configure built with incompatible version of xorg-macros.m4 - requires version ${XORG_MACROS_major}.x]) + fi + if test $XORG_MACROS_minor -lt $XORG_MACROS_needed_minor ; then + AC_MSG_ERROR([configure built with too old of a version of xorg-macros.m4 - requires version ${XORG_MACROS_major}.${XORG_MACROS_minor}.0 or newer]) + fi + AC_MSG_RESULT([yes, $XORG_MACROS_version]) +]) # XORG_MACROS_VERSION + +# XORG_PROG_RAWCPP() +# ------------------ +# Minimum version: 1.0.0 +# +# Find cpp program and necessary flags for use in pre-processing text files +# such as man pages and config files +AC_DEFUN([XORG_PROG_RAWCPP],[ +AC_REQUIRE([AC_PROG_CPP]) +AC_PATH_PROGS(RAWCPP, [cpp], [${CPP}], + [$PATH:/bin:/usr/bin:/usr/lib:/usr/libexec:/usr/ccs/lib:/usr/ccs/lbin:/lib]) + +# Check for flag to avoid builtin definitions - assumes unix is predefined, +# which is not the best choice for supporting other OS'es, but covers most +# of the ones we need for now. +AC_MSG_CHECKING([if $RAWCPP requires -undef]) +AC_LANG_CONFTEST([Does cpp redefine unix ?]) +if test `${RAWCPP} < conftest.$ac_ext | grep -c 'unix'` -eq 1 ; then + AC_MSG_RESULT([no]) +else + if test `${RAWCPP} -undef < conftest.$ac_ext | grep -c 'unix'` -eq 1 ; then + RAWCPPFLAGS=-undef + AC_MSG_RESULT([yes]) + else + AC_MSG_ERROR([${RAWCPP} defines unix with or without -undef. I don't know what to do.]) + fi +fi +rm -f conftest.$ac_ext + +AC_MSG_CHECKING([if $RAWCPP requires -traditional]) +AC_LANG_CONFTEST([Does cpp preserve "whitespace"?]) +if test `${RAWCPP} < conftest.$ac_ext | grep -c 'preserve \"'` -eq 1 ; then + AC_MSG_RESULT([no]) +else + if test `${RAWCPP} -traditional < conftest.$ac_ext | grep -c 'preserve \"'` -eq 1 ; then + RAWCPPFLAGS="${RAWCPPFLAGS} -traditional" + AC_MSG_RESULT([yes]) + else + AC_MSG_ERROR([${RAWCPP} does not preserve whitespace with or without -traditional. I don't know what to do.]) + fi +fi +rm -f conftest.$ac_ext +AC_SUBST(RAWCPPFLAGS) +]) # XORG_PROG_RAWCPP + +# XORG_MANPAGE_SECTIONS() +# ----------------------- +# Minimum version: 1.0.0 +# +# Determine which sections man pages go in for the different man page types +# on this OS - replaces *ManSuffix settings in old Imake *.cf per-os files. +# Not sure if there's any better way than just hardcoding by OS name. +# Override default settings by setting environment variables + +AC_DEFUN([XORG_MANPAGE_SECTIONS],[ +AC_REQUIRE([AC_CANONICAL_HOST]) + +if test x$APP_MAN_SUFFIX = x ; then + APP_MAN_SUFFIX=1 +fi +if test x$APP_MAN_DIR = x ; then + APP_MAN_DIR='$(mandir)/man$(APP_MAN_SUFFIX)' +fi + +if test x$LIB_MAN_SUFFIX = x ; then + LIB_MAN_SUFFIX=3 +fi +if test x$LIB_MAN_DIR = x ; then + LIB_MAN_DIR='$(mandir)/man$(LIB_MAN_SUFFIX)' +fi + +if test x$FILE_MAN_SUFFIX = x ; then + case $host_os in + solaris*) FILE_MAN_SUFFIX=4 ;; + *) FILE_MAN_SUFFIX=5 ;; + esac +fi +if test x$FILE_MAN_DIR = x ; then + FILE_MAN_DIR='$(mandir)/man$(FILE_MAN_SUFFIX)' +fi + +if test x$MISC_MAN_SUFFIX = x ; then + case $host_os in + solaris*) MISC_MAN_SUFFIX=5 ;; + *) MISC_MAN_SUFFIX=7 ;; + esac +fi +if test x$MISC_MAN_DIR = x ; then + MISC_MAN_DIR='$(mandir)/man$(MISC_MAN_SUFFIX)' +fi + +if test x$DRIVER_MAN_SUFFIX = x ; then + case $host_os in + solaris*) DRIVER_MAN_SUFFIX=7 ;; + *) DRIVER_MAN_SUFFIX=4 ;; + esac +fi +if test x$DRIVER_MAN_DIR = x ; then + DRIVER_MAN_DIR='$(mandir)/man$(DRIVER_MAN_SUFFIX)' +fi + +if test x$ADMIN_MAN_SUFFIX = x ; then + case $host_os in + solaris*) ADMIN_MAN_SUFFIX=1m ;; + *) ADMIN_MAN_SUFFIX=8 ;; + esac +fi +if test x$ADMIN_MAN_DIR = x ; then + ADMIN_MAN_DIR='$(mandir)/man$(ADMIN_MAN_SUFFIX)' +fi + + +AC_SUBST([APP_MAN_SUFFIX]) +AC_SUBST([LIB_MAN_SUFFIX]) +AC_SUBST([FILE_MAN_SUFFIX]) +AC_SUBST([MISC_MAN_SUFFIX]) +AC_SUBST([DRIVER_MAN_SUFFIX]) +AC_SUBST([ADMIN_MAN_SUFFIX]) +AC_SUBST([APP_MAN_DIR]) +AC_SUBST([LIB_MAN_DIR]) +AC_SUBST([FILE_MAN_DIR]) +AC_SUBST([MISC_MAN_DIR]) +AC_SUBST([DRIVER_MAN_DIR]) +AC_SUBST([ADMIN_MAN_DIR]) +]) # XORG_MANPAGE_SECTIONS + +# XORG_CHECK_LINUXDOC +# ------------------- +# Minimum version: 1.0.0 +# +# Defines the variable MAKE_TEXT if the necessary tools and +# files are found. $(MAKE_TEXT) blah.sgml will then produce blah.txt. +# Whether or not the necessary tools and files are found can be checked +# with the AM_CONDITIONAL "BUILD_LINUXDOC" +AC_DEFUN([XORG_CHECK_LINUXDOC],[ +AC_CHECK_FILE( + [$prefix/share/X11/sgml/defs.ent], + [DEFS_ENT_PATH=$prefix/share/X11/sgml], + [DEFS_ENT_PATH=] +) + +AC_PATH_PROG(LINUXDOC, linuxdoc) +AC_PATH_PROG(PS2PDF, ps2pdf) + +AC_MSG_CHECKING([Whether to build documentation]) + +if test x$DEFS_ENT_PATH != x && test x$LINUXDOC != x ; then + BUILDDOC=yes +else + BUILDDOC=no +fi + +AM_CONDITIONAL(BUILD_LINUXDOC, [test x$BUILDDOC = xyes]) + +AC_MSG_RESULT([$BUILDDOC]) + +AC_MSG_CHECKING([Whether to build pdf documentation]) + +if test x$PS2PDF != x ; then + BUILDPDFDOC=yes +else + BUILDPDFDOC=no +fi + +AM_CONDITIONAL(BUILD_PDFDOC, [test x$BUILDPDFDOC = xyes]) + +AC_MSG_RESULT([$BUILDPDFDOC]) + +MAKE_TEXT="SGML_SEARCH_PATH=$DEFS_ENT_PATH GROFF_NO_SGR=y $LINUXDOC -B txt" +MAKE_PS="SGML_SEARCH_PATH=$DEFS_ENT_PATH $LINUXDOC -B latex --papersize=letter --output=ps" +MAKE_PDF="$PS2PDF" +MAKE_HTML="SGML_SEARCH_PATH=$DEFS_ENT_PATH $LINUXDOC -B html --split=0" + +AC_SUBST(MAKE_TEXT) +AC_SUBST(MAKE_PS) +AC_SUBST(MAKE_PDF) +AC_SUBST(MAKE_HTML) +]) # XORG_CHECK_LINUXDOC + +# XORG_CHECK_MALLOC_ZERO +# ---------------------- +# Minimum version: 1.0.0 +# +# Defines {MALLOC,XMALLOC,XTMALLOC}_ZERO_CFLAGS appropriately if +# malloc(0) returns NULL. Packages should add one of these cflags to +# their AM_CFLAGS (or other appropriate *_CFLAGS) to use them. +AC_DEFUN([XORG_CHECK_MALLOC_ZERO],[ +AC_ARG_ENABLE(malloc0returnsnull, + AC_HELP_STRING([--enable-malloc0returnsnull], + [malloc(0) returns NULL (default: auto)]), + [MALLOC_ZERO_RETURNS_NULL=$enableval], + [MALLOC_ZERO_RETURNS_NULL=auto]) + +AC_MSG_CHECKING([whether malloc(0) returns NULL]) +if test "x$MALLOC_ZERO_RETURNS_NULL" = xauto; then + AC_RUN_IFELSE([ +char *malloc(); +char *realloc(); +char *calloc(); +main() { + char *m0, *r0, *c0, *p; + m0 = malloc(0); + p = malloc(10); + r0 = realloc(p,0); + c0 = calloc(0); + exit(m0 == 0 || r0 == 0 || c0 == 0 ? 0 : 1); +}], + [MALLOC_ZERO_RETURNS_NULL=yes], + [MALLOC_ZERO_RETURNS_NULL=no]) +fi +AC_MSG_RESULT([$MALLOC_ZERO_RETURNS_NULL]) + +if test "x$MALLOC_ZERO_RETURNS_NULL" = xyes; then + MALLOC_ZERO_CFLAGS="-DMALLOC_0_RETURNS_NULL" + XMALLOC_ZERO_CFLAGS=$MALLOC_ZERO_CFLAGS + XTMALLOC_ZERO_CFLAGS="$MALLOC_ZERO_CFLAGS -DXTMALLOC_BC" +else + MALLOC_ZERO_CFLAGS="" + XMALLOC_ZERO_CFLAGS="" + XTMALLOC_ZERO_CFLAGS="" +fi + +AC_SUBST([MALLOC_ZERO_CFLAGS]) +AC_SUBST([XMALLOC_ZERO_CFLAGS]) +AC_SUBST([XTMALLOC_ZERO_CFLAGS]) +]) # XORG_CHECK_MALLOC_ZERO + +# XORG_WITH_LINT() +# ---------------- +# Minimum version: 1.1.0 +# +# Sets up flags for source checkers such as lint and sparse if --with-lint +# is specified. (Use --with-lint=sparse for sparse.) +# Sets $LINT to name of source checker passed with --with-lint (default: lint) +# Sets $LINT_FLAGS to flags to pass to source checker +# Sets LINT automake conditional if enabled (default: disabled) +# +AC_DEFUN([XORG_WITH_LINT],[ + +# Allow checking code with lint, sparse, etc. +AC_ARG_WITH(lint, [AC_HELP_STRING([--with-lint], + [Use a lint-style source code checker (default: disabled)])], + [use_lint=$withval], [use_lint=no]) +if test "x$use_lint" = "xyes" ; then + LINT="lint" +else + LINT="$use_lint" +fi +if test "x$LINT_FLAGS" = "x" -a "x$LINT" != "xno" ; then + case $LINT in + lint|*/lint) + case $host_os in + solaris*) + LINT_FLAGS="-u -b -h -erroff=E_INDISTING_FROM_TRUNC2" + ;; + esac + ;; + esac +fi + +AC_SUBST(LINT) +AC_SUBST(LINT_FLAGS) +AM_CONDITIONAL(LINT, [test x$LINT != xno]) + +]) # XORG_WITH_LINT + +# XORG_LINT_LIBRARY(LIBNAME) +# -------------------------- +# Minimum version: 1.1.0 +# +# Sets up flags for building lint libraries for checking programs that call +# functions in the library. +# Disabled by default, enable with --enable-lint-library +# Sets: +# @LINTLIB@ - name of lint library file to make +# MAKE_LINT_LIB - automake conditional +# + +AC_DEFUN([XORG_LINT_LIBRARY],[ +AC_REQUIRE([XORG_WITH_LINT]) +# Build lint "library" for more indepth checks of programs calling this library +AC_ARG_ENABLE(lint-library, [AC_HELP_STRING([--enable-lint-library], + [Create lint library (default: disabled)])], + [make_lint_lib=$enableval], [make_lint_lib=no]) +if test "x$make_lint_lib" != "xno" ; then + if test "x$LINT" = "xno" ; then + AC_MSG_ERROR([Cannot make lint library without --with-lint]) + fi + if test "x$make_lint_lib" = "xyes" ; then + LINTLIB=llib-l$1.ln + else + LINTLIB=$make_lint_lib + fi +fi +AC_SUBST(LINTLIB) +AM_CONDITIONAL(MAKE_LINT_LIB, [test x$make_lint_lib != xno]) + +]) # XORG_LINT_LIBRARY + +dnl Copyright 2005 Red Hat, Inc +dnl +dnl Permission to use, copy, modify, distribute, and sell this software and its +dnl documentation for any purpose is hereby granted without fee, provided that +dnl the above copyright notice appear in all copies and that both that +dnl copyright notice and this permission notice appear in supporting +dnl documentation. +dnl +dnl The above copyright notice and this permission notice shall be included +dnl in all copies or substantial portions of the Software. +dnl +dnl THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +dnl OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +dnl MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +dnl IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +dnl OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +dnl ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +dnl OTHER DEALINGS IN THE SOFTWARE. +dnl +dnl Except as contained in this notice, the name of the copyright holders shall +dnl not be used in advertising or otherwise to promote the sale, use or +dnl other dealings in this Software without prior written authorization +dnl from the copyright holders. +dnl + +# XORG_DRIVER_CHECK_EXT() +# -------------------------- +# Checks for the $1 define in xorg-server.h (from the sdk). If it +# is defined, then add $1 to $REQUIRED_MODULES. + +AC_DEFUN([XORG_DRIVER_CHECK_EXT],[ + SAVE_CFLAGS="$CFLAGS" + CFLAGS="$CFLAGS -I`pkg-config --variable=sdkdir xorg-server`" + AC_COMPILE_IFELSE([AC_LANG_PROGRAM([[ +#include "xorg-server.h" +#if !defined $1 +#error $1 not defined +#endif + ]])], + [_EXT_CHECK=yes], + [_EXT_CHECK=no]) + CFLAGS="$SAVE_CFLAGS" + AC_MSG_CHECKING([if $1 is defined]) + AC_MSG_RESULT([$_EXT_CHECK]) + if test "$_EXT_CHECK" != no; then + REQUIRED_MODULES="$REQUIRED_MODULES $2" + fi +]) + +dnl Copyright 2005 Red Hat, Inc +dnl +dnl Permission to use, copy, modify, distribute, and sell this software and its +dnl documentation for any purpose is hereby granted without fee, provided that +dnl the above copyright notice appear in all copies and that both that +dnl copyright notice and this permission notice appear in supporting +dnl documentation. +dnl +dnl The above copyright notice and this permission notice shall be included +dnl in all copies or substantial portions of the Software. +dnl +dnl THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +dnl OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +dnl MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +dnl IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +dnl OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +dnl ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +dnl OTHER DEALINGS IN THE SOFTWARE. +dnl +dnl Except as contained in this notice, the name of the copyright holders shall +dnl not be used in advertising or otherwise to promote the sale, use or +dnl other dealings in this Software without prior written authorization +dnl from the copyright holders. +dnl + +# XORG_RELEASE_VERSION +# -------------------- +# Adds --with/without-release-string and changes the PACKAGE and +# PACKAGE_TARNAME to use "$PACKAGE{_TARNAME}-$RELEASE_VERSION". If +# no option is given, PACKAGE and PACKAGE_TARNAME are unchanged. + +AC_DEFUN([XORG_RELEASE_VERSION],[ + AC_ARG_WITH(release-version, + AC_HELP_STRING([--with-release-version=STRING], + [Use release version string in package name]), + [RELEASE_VERSION="$withval"], + [RELEASE_VERSION=""]) + if test "x$RELEASE_VERSION" != "x"; then + PACKAGE="$PACKAGE-$RELEASE_VERSION" + PACKAGE_TARNAME="$PACKAGE_TARNAME-$RELEASE_VERSION" + AC_MSG_NOTICE([Building with package name set to $PACKAGE]) + fi +]) + +# Copyright (C) 2002, 2003, 2005 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# AM_AUTOMAKE_VERSION(VERSION) +# ---------------------------- +# Automake X.Y traces this macro to ensure aclocal.m4 has been +# generated from the m4 files accompanying Automake X.Y. +AC_DEFUN([AM_AUTOMAKE_VERSION], [am__api_version="1.9"]) + +# AM_SET_CURRENT_AUTOMAKE_VERSION +# ------------------------------- +# Call AM_AUTOMAKE_VERSION so it can be traced. +# This function is AC_REQUIREd by AC_INIT_AUTOMAKE. +AC_DEFUN([AM_SET_CURRENT_AUTOMAKE_VERSION], + [AM_AUTOMAKE_VERSION([1.9.6])]) + +# AM_AUX_DIR_EXPAND -*- Autoconf -*- + +# Copyright (C) 2001, 2003, 2005 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# For projects using AC_CONFIG_AUX_DIR([foo]), Autoconf sets +# $ac_aux_dir to `$srcdir/foo'. In other projects, it is set to +# `$srcdir', `$srcdir/..', or `$srcdir/../..'. +# +# Of course, Automake must honor this variable whenever it calls a +# tool from the auxiliary directory. The problem is that $srcdir (and +# therefore $ac_aux_dir as well) can be either absolute or relative, +# depending on how configure is run. This is pretty annoying, since +# it makes $ac_aux_dir quite unusable in subdirectories: in the top +# source directory, any form will work fine, but in subdirectories a +# relative path needs to be adjusted first. +# +# $ac_aux_dir/missing +# fails when called from a subdirectory if $ac_aux_dir is relative +# $top_srcdir/$ac_aux_dir/missing +# fails if $ac_aux_dir is absolute, +# fails when called from a subdirectory in a VPATH build with +# a relative $ac_aux_dir +# +# The reason of the latter failure is that $top_srcdir and $ac_aux_dir +# are both prefixed by $srcdir. In an in-source build this is usually +# harmless because $srcdir is `.', but things will broke when you +# start a VPATH build or use an absolute $srcdir. +# +# So we could use something similar to $top_srcdir/$ac_aux_dir/missing, +# iff we strip the leading $srcdir from $ac_aux_dir. That would be: +# am_aux_dir='\$(top_srcdir)/'`expr "$ac_aux_dir" : "$srcdir//*\(.*\)"` +# and then we would define $MISSING as +# MISSING="\${SHELL} $am_aux_dir/missing" +# This will work as long as MISSING is not called from configure, because +# unfortunately $(top_srcdir) has no meaning in configure. +# However there are other variables, like CC, which are often used in +# configure, and could therefore not use this "fixed" $ac_aux_dir. +# +# Another solution, used here, is to always expand $ac_aux_dir to an +# absolute PATH. The drawback is that using absolute paths prevent a +# configured tree to be moved without reconfiguration. + +AC_DEFUN([AM_AUX_DIR_EXPAND], +[dnl Rely on autoconf to set up CDPATH properly. +AC_PREREQ([2.50])dnl +# expand $ac_aux_dir to an absolute path +am_aux_dir=`cd $ac_aux_dir && pwd` +]) + +# AM_CONDITIONAL -*- Autoconf -*- + +# Copyright (C) 1997, 2000, 2001, 2003, 2004, 2005 +# Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# serial 7 + +# AM_CONDITIONAL(NAME, SHELL-CONDITION) +# ------------------------------------- +# Define a conditional. +AC_DEFUN([AM_CONDITIONAL], +[AC_PREREQ(2.52)dnl + ifelse([$1], [TRUE], [AC_FATAL([$0: invalid condition: $1])], + [$1], [FALSE], [AC_FATAL([$0: invalid condition: $1])])dnl +AC_SUBST([$1_TRUE]) +AC_SUBST([$1_FALSE]) +if $2; then + $1_TRUE= + $1_FALSE='#' +else + $1_TRUE='#' + $1_FALSE= +fi +AC_CONFIG_COMMANDS_PRE( +[if test -z "${$1_TRUE}" && test -z "${$1_FALSE}"; then + AC_MSG_ERROR([[conditional "$1" was never defined. +Usually this means the macro was only invoked conditionally.]]) +fi])]) + + +# Copyright (C) 1999, 2000, 2001, 2002, 2003, 2004, 2005 +# Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# serial 8 + +# There are a few dirty hacks below to avoid letting `AC_PROG_CC' be +# written in clear, in which case automake, when reading aclocal.m4, +# will think it sees a *use*, and therefore will trigger all it's +# C support machinery. Also note that it means that autoscan, seeing +# CC etc. in the Makefile, will ask for an AC_PROG_CC use... + + +# _AM_DEPENDENCIES(NAME) +# ---------------------- +# See how the compiler implements dependency checking. +# NAME is "CC", "CXX", "GCJ", or "OBJC". +# We try a few techniques and use that to set a single cache variable. +# +# We don't AC_REQUIRE the corresponding AC_PROG_CC since the latter was +# modified to invoke _AM_DEPENDENCIES(CC); we would have a circular +# dependency, and given that the user is not expected to run this macro, +# just rely on AC_PROG_CC. +AC_DEFUN([_AM_DEPENDENCIES], +[AC_REQUIRE([AM_SET_DEPDIR])dnl +AC_REQUIRE([AM_OUTPUT_DEPENDENCY_COMMANDS])dnl +AC_REQUIRE([AM_MAKE_INCLUDE])dnl +AC_REQUIRE([AM_DEP_TRACK])dnl + +ifelse([$1], CC, [depcc="$CC" am_compiler_list=], + [$1], CXX, [depcc="$CXX" am_compiler_list=], + [$1], OBJC, [depcc="$OBJC" am_compiler_list='gcc3 gcc'], + [$1], GCJ, [depcc="$GCJ" am_compiler_list='gcc3 gcc'], + [depcc="$$1" am_compiler_list=]) + +AC_CACHE_CHECK([dependency style of $depcc], + [am_cv_$1_dependencies_compiler_type], +[if test -z "$AMDEP_TRUE" && test -f "$am_depcomp"; then + # We make a subdir and do the tests there. Otherwise we can end up + # making bogus files that we don't know about and never remove. For + # instance it was reported that on HP-UX the gcc test will end up + # making a dummy file named `D' -- because `-MD' means `put the output + # in D'. + mkdir conftest.dir + # Copy depcomp to subdir because otherwise we won't find it if we're + # using a relative directory. + cp "$am_depcomp" conftest.dir + cd conftest.dir + # We will build objects and dependencies in a subdirectory because + # it helps to detect inapplicable dependency modes. For instance + # both Tru64's cc and ICC support -MD to output dependencies as a + # side effect of compilation, but ICC will put the dependencies in + # the current directory while Tru64 will put them in the object + # directory. + mkdir sub + + am_cv_$1_dependencies_compiler_type=none + if test "$am_compiler_list" = ""; then + am_compiler_list=`sed -n ['s/^#*\([a-zA-Z0-9]*\))$/\1/p'] < ./depcomp` + fi + for depmode in $am_compiler_list; do + # Setup a source with many dependencies, because some compilers + # like to wrap large dependency lists on column 80 (with \), and + # we should not choose a depcomp mode which is confused by this. + # + # We need to recreate these files for each test, as the compiler may + # overwrite some of them when testing with obscure command lines. + # This happens at least with the AIX C compiler. + : > sub/conftest.c + for i in 1 2 3 4 5 6; do + echo '#include "conftst'$i'.h"' >> sub/conftest.c + # Using `: > sub/conftst$i.h' creates only sub/conftst1.h with + # Solaris 8's {/usr,}/bin/sh. + touch sub/conftst$i.h + done + echo "${am__include} ${am__quote}sub/conftest.Po${am__quote}" > confmf + + case $depmode in + nosideeffect) + # after this tag, mechanisms are not by side-effect, so they'll + # only be used when explicitly requested + if test "x$enable_dependency_tracking" = xyes; then + continue + else + break + fi + ;; + none) break ;; + esac + # We check with `-c' and `-o' for the sake of the "dashmstdout" + # mode. It turns out that the SunPro C++ compiler does not properly + # handle `-M -o', and we need to detect this. + if depmode=$depmode \ + source=sub/conftest.c object=sub/conftest.${OBJEXT-o} \ + depfile=sub/conftest.Po tmpdepfile=sub/conftest.TPo \ + $SHELL ./depcomp $depcc -c -o sub/conftest.${OBJEXT-o} sub/conftest.c \ + >/dev/null 2>conftest.err && + grep sub/conftst6.h sub/conftest.Po > /dev/null 2>&1 && + grep sub/conftest.${OBJEXT-o} sub/conftest.Po > /dev/null 2>&1 && + ${MAKE-make} -s -f confmf > /dev/null 2>&1; then + # icc doesn't choke on unknown options, it will just issue warnings + # or remarks (even with -Werror). So we grep stderr for any message + # that says an option was ignored or not supported. + # When given -MP, icc 7.0 and 7.1 complain thusly: + # icc: Command line warning: ignoring option '-M'; no argument required + # The diagnosis changed in icc 8.0: + # icc: Command line remark: option '-MP' not supported + if (grep 'ignoring option' conftest.err || + grep 'not supported' conftest.err) >/dev/null 2>&1; then :; else + am_cv_$1_dependencies_compiler_type=$depmode + break + fi + fi + done + + cd .. + rm -rf conftest.dir +else + am_cv_$1_dependencies_compiler_type=none +fi +]) +AC_SUBST([$1DEPMODE], [depmode=$am_cv_$1_dependencies_compiler_type]) +AM_CONDITIONAL([am__fastdep$1], [ + test "x$enable_dependency_tracking" != xno \ + && test "$am_cv_$1_dependencies_compiler_type" = gcc3]) +]) + + +# AM_SET_DEPDIR +# ------------- +# Choose a directory name for dependency files. +# This macro is AC_REQUIREd in _AM_DEPENDENCIES +AC_DEFUN([AM_SET_DEPDIR], +[AC_REQUIRE([AM_SET_LEADING_DOT])dnl +AC_SUBST([DEPDIR], ["${am__leading_dot}deps"])dnl +]) + + +# AM_DEP_TRACK +# ------------ +AC_DEFUN([AM_DEP_TRACK], +[AC_ARG_ENABLE(dependency-tracking, +[ --disable-dependency-tracking speeds up one-time build + --enable-dependency-tracking do not reject slow dependency extractors]) +if test "x$enable_dependency_tracking" != xno; then + am_depcomp="$ac_aux_dir/depcomp" + AMDEPBACKSLASH='\' +fi +AM_CONDITIONAL([AMDEP], [test "x$enable_dependency_tracking" != xno]) +AC_SUBST([AMDEPBACKSLASH]) +]) + +# Generate code to set up dependency tracking. -*- Autoconf -*- + +# Copyright (C) 1999, 2000, 2001, 2002, 2003, 2004, 2005 +# Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +#serial 3 + +# _AM_OUTPUT_DEPENDENCY_COMMANDS +# ------------------------------ +AC_DEFUN([_AM_OUTPUT_DEPENDENCY_COMMANDS], +[for mf in $CONFIG_FILES; do + # Strip MF so we end up with the name of the file. + mf=`echo "$mf" | sed -e 's/:.*$//'` + # Check whether this is an Automake generated Makefile or not. + # We used to match only the files named `Makefile.in', but + # some people rename them; so instead we look at the file content. + # Grep'ing the first line is not enough: some people post-process + # each Makefile.in and add a new line on top of each file to say so. + # So let's grep whole file. + if grep '^#.*generated by automake' $mf > /dev/null 2>&1; then + dirpart=`AS_DIRNAME("$mf")` + else + continue + fi + # Extract the definition of DEPDIR, am__include, and am__quote + # from the Makefile without running `make'. + DEPDIR=`sed -n 's/^DEPDIR = //p' < "$mf"` + test -z "$DEPDIR" && continue + am__include=`sed -n 's/^am__include = //p' < "$mf"` + test -z "am__include" && continue + am__quote=`sed -n 's/^am__quote = //p' < "$mf"` + # When using ansi2knr, U may be empty or an underscore; expand it + U=`sed -n 's/^U = //p' < "$mf"` + # Find all dependency output files, they are included files with + # $(DEPDIR) in their names. We invoke sed twice because it is the + # simplest approach to changing $(DEPDIR) to its actual value in the + # expansion. + for file in `sed -n " + s/^$am__include $am__quote\(.*(DEPDIR).*\)$am__quote"'$/\1/p' <"$mf" | \ + sed -e 's/\$(DEPDIR)/'"$DEPDIR"'/g' -e 's/\$U/'"$U"'/g'`; do + # Make sure the directory exists. + test -f "$dirpart/$file" && continue + fdir=`AS_DIRNAME(["$file"])` + AS_MKDIR_P([$dirpart/$fdir]) + # echo "creating $dirpart/$file" + echo '# dummy' > "$dirpart/$file" + done +done +])# _AM_OUTPUT_DEPENDENCY_COMMANDS + + +# AM_OUTPUT_DEPENDENCY_COMMANDS +# ----------------------------- +# This macro should only be invoked once -- use via AC_REQUIRE. +# +# This code is only required when automatic dependency tracking +# is enabled. FIXME. This creates each `.P' file that we will +# need in order to bootstrap the dependency handling code. +AC_DEFUN([AM_OUTPUT_DEPENDENCY_COMMANDS], +[AC_CONFIG_COMMANDS([depfiles], + [test x"$AMDEP_TRUE" != x"" || _AM_OUTPUT_DEPENDENCY_COMMANDS], + [AMDEP_TRUE="$AMDEP_TRUE" ac_aux_dir="$ac_aux_dir"]) +]) + +# Copyright (C) 1996, 1997, 2000, 2001, 2003, 2005 +# Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# serial 8 + +# AM_CONFIG_HEADER is obsolete. It has been replaced by AC_CONFIG_HEADERS. +AU_DEFUN([AM_CONFIG_HEADER], [AC_CONFIG_HEADERS($@)]) + +# Do all the work for Automake. -*- Autoconf -*- + +# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2002, 2003, 2004, 2005 +# Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# serial 12 + +# This macro actually does too much. Some checks are only needed if +# your package does certain things. But this isn't really a big deal. + +# AM_INIT_AUTOMAKE(PACKAGE, VERSION, [NO-DEFINE]) +# AM_INIT_AUTOMAKE([OPTIONS]) +# ----------------------------------------------- +# The call with PACKAGE and VERSION arguments is the old style +# call (pre autoconf-2.50), which is being phased out. PACKAGE +# and VERSION should now be passed to AC_INIT and removed from +# the call to AM_INIT_AUTOMAKE. +# We support both call styles for the transition. After +# the next Automake release, Autoconf can make the AC_INIT +# arguments mandatory, and then we can depend on a new Autoconf +# release and drop the old call support. +AC_DEFUN([AM_INIT_AUTOMAKE], +[AC_PREREQ([2.58])dnl +dnl Autoconf wants to disallow AM_ names. We explicitly allow +dnl the ones we care about. +m4_pattern_allow([^AM_[A-Z]+FLAGS$])dnl +AC_REQUIRE([AM_SET_CURRENT_AUTOMAKE_VERSION])dnl +AC_REQUIRE([AC_PROG_INSTALL])dnl +# test to see if srcdir already configured +if test "`cd $srcdir && pwd`" != "`pwd`" && + test -f $srcdir/config.status; then + AC_MSG_ERROR([source directory already configured; run "make distclean" there first]) +fi + +# test whether we have cygpath +if test -z "$CYGPATH_W"; then + if (cygpath --version) >/dev/null 2>/dev/null; then + CYGPATH_W='cygpath -w' + else + CYGPATH_W=echo + fi +fi +AC_SUBST([CYGPATH_W]) + +# Define the identity of the package. +dnl Distinguish between old-style and new-style calls. +m4_ifval([$2], +[m4_ifval([$3], [_AM_SET_OPTION([no-define])])dnl + AC_SUBST([PACKAGE], [$1])dnl + AC_SUBST([VERSION], [$2])], +[_AM_SET_OPTIONS([$1])dnl + AC_SUBST([PACKAGE], ['AC_PACKAGE_TARNAME'])dnl + AC_SUBST([VERSION], ['AC_PACKAGE_VERSION'])])dnl + +_AM_IF_OPTION([no-define],, +[AC_DEFINE_UNQUOTED(PACKAGE, "$PACKAGE", [Name of package]) + AC_DEFINE_UNQUOTED(VERSION, "$VERSION", [Version number of package])])dnl + +# Some tools Automake needs. +AC_REQUIRE([AM_SANITY_CHECK])dnl +AC_REQUIRE([AC_ARG_PROGRAM])dnl +AM_MISSING_PROG(ACLOCAL, aclocal-${am__api_version}) +AM_MISSING_PROG(AUTOCONF, autoconf) +AM_MISSING_PROG(AUTOMAKE, automake-${am__api_version}) +AM_MISSING_PROG(AUTOHEADER, autoheader) +AM_MISSING_PROG(MAKEINFO, makeinfo) +AM_PROG_INSTALL_SH +AM_PROG_INSTALL_STRIP +AC_REQUIRE([AM_PROG_MKDIR_P])dnl +# We need awk for the "check" target. The system "awk" is bad on +# some platforms. +AC_REQUIRE([AC_PROG_AWK])dnl +AC_REQUIRE([AC_PROG_MAKE_SET])dnl +AC_REQUIRE([AM_SET_LEADING_DOT])dnl +_AM_IF_OPTION([tar-ustar], [_AM_PROG_TAR([ustar])], + [_AM_IF_OPTION([tar-pax], [_AM_PROG_TAR([pax])], + [_AM_PROG_TAR([v7])])]) +_AM_IF_OPTION([no-dependencies],, +[AC_PROVIDE_IFELSE([AC_PROG_CC], + [_AM_DEPENDENCIES(CC)], + [define([AC_PROG_CC], + defn([AC_PROG_CC])[_AM_DEPENDENCIES(CC)])])dnl +AC_PROVIDE_IFELSE([AC_PROG_CXX], + [_AM_DEPENDENCIES(CXX)], + [define([AC_PROG_CXX], + defn([AC_PROG_CXX])[_AM_DEPENDENCIES(CXX)])])dnl +]) +]) + + +# When config.status generates a header, we must update the stamp-h file. +# This file resides in the same directory as the config header +# that is generated. The stamp files are numbered to have different names. + +# Autoconf calls _AC_AM_CONFIG_HEADER_HOOK (when defined) in the +# loop where config.status creates the headers, so we can generate +# our stamp files there. +AC_DEFUN([_AC_AM_CONFIG_HEADER_HOOK], +[# Compute $1's index in $config_headers. +_am_stamp_count=1 +for _am_header in $config_headers :; do + case $_am_header in + $1 | $1:* ) + break ;; + * ) + _am_stamp_count=`expr $_am_stamp_count + 1` ;; + esac +done +echo "timestamp for $1" >`AS_DIRNAME([$1])`/stamp-h[]$_am_stamp_count]) + +# Copyright (C) 2001, 2003, 2005 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# AM_PROG_INSTALL_SH +# ------------------ +# Define $install_sh. +AC_DEFUN([AM_PROG_INSTALL_SH], +[AC_REQUIRE([AM_AUX_DIR_EXPAND])dnl +install_sh=${install_sh-"$am_aux_dir/install-sh"} +AC_SUBST(install_sh)]) + +# Copyright (C) 2003, 2005 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# serial 2 + +# Check whether the underlying file-system supports filenames +# with a leading dot. For instance MS-DOS doesn't. +AC_DEFUN([AM_SET_LEADING_DOT], +[rm -rf .tst 2>/dev/null +mkdir .tst 2>/dev/null +if test -d .tst; then + am__leading_dot=. +else + am__leading_dot=_ +fi +rmdir .tst 2>/dev/null +AC_SUBST([am__leading_dot])]) + +# Add --enable-maintainer-mode option to configure. -*- Autoconf -*- +# From Jim Meyering + +# Copyright (C) 1996, 1998, 2000, 2001, 2002, 2003, 2004, 2005 +# Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# serial 4 + +AC_DEFUN([AM_MAINTAINER_MODE], +[AC_MSG_CHECKING([whether to enable maintainer-specific portions of Makefiles]) + dnl maintainer-mode is disabled by default + AC_ARG_ENABLE(maintainer-mode, +[ --enable-maintainer-mode enable make rules and dependencies not useful + (and sometimes confusing) to the casual installer], + USE_MAINTAINER_MODE=$enableval, + USE_MAINTAINER_MODE=no) + AC_MSG_RESULT([$USE_MAINTAINER_MODE]) + AM_CONDITIONAL(MAINTAINER_MODE, [test $USE_MAINTAINER_MODE = yes]) + MAINT=$MAINTAINER_MODE_TRUE + AC_SUBST(MAINT)dnl +] +) + +AU_DEFUN([jm_MAINTAINER_MODE], [AM_MAINTAINER_MODE]) + +# Check to see how 'make' treats includes. -*- Autoconf -*- + +# Copyright (C) 2001, 2002, 2003, 2005 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# serial 3 + +# AM_MAKE_INCLUDE() +# ----------------- +# Check to see how make treats includes. +AC_DEFUN([AM_MAKE_INCLUDE], +[am_make=${MAKE-make} +cat > confinc << 'END' +am__doit: + @echo done +.PHONY: am__doit +END +# If we don't find an include directive, just comment out the code. +AC_MSG_CHECKING([for style of include used by $am_make]) +am__include="#" +am__quote= +_am_result=none +# First try GNU make style include. +echo "include confinc" > confmf +# We grep out `Entering directory' and `Leaving directory' +# messages which can occur if `w' ends up in MAKEFLAGS. +# In particular we don't look at `^make:' because GNU make might +# be invoked under some other name (usually "gmake"), in which +# case it prints its new name instead of `make'. +if test "`$am_make -s -f confmf 2> /dev/null | grep -v 'ing directory'`" = "done"; then + am__include=include + am__quote= + _am_result=GNU +fi +# Now try BSD make style include. +if test "$am__include" = "#"; then + echo '.include "confinc"' > confmf + if test "`$am_make -s -f confmf 2> /dev/null`" = "done"; then + am__include=.include + am__quote="\"" + _am_result=BSD + fi +fi +AC_SUBST([am__include]) +AC_SUBST([am__quote]) +AC_MSG_RESULT([$_am_result]) +rm -f confinc confmf +]) + +# Fake the existence of programs that GNU maintainers use. -*- Autoconf -*- + +# Copyright (C) 1997, 1999, 2000, 2001, 2003, 2005 +# Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# serial 4 + +# AM_MISSING_PROG(NAME, PROGRAM) +# ------------------------------ +AC_DEFUN([AM_MISSING_PROG], +[AC_REQUIRE([AM_MISSING_HAS_RUN]) +$1=${$1-"${am_missing_run}$2"} +AC_SUBST($1)]) + + +# AM_MISSING_HAS_RUN +# ------------------ +# Define MISSING if not defined so far and test if it supports --run. +# If it does, set am_missing_run to use it, otherwise, to nothing. +AC_DEFUN([AM_MISSING_HAS_RUN], +[AC_REQUIRE([AM_AUX_DIR_EXPAND])dnl +test x"${MISSING+set}" = xset || MISSING="\${SHELL} $am_aux_dir/missing" +# Use eval to expand $SHELL +if eval "$MISSING --run true"; then + am_missing_run="$MISSING --run " +else + am_missing_run= + AC_MSG_WARN([`missing' script is too old or missing]) +fi +]) + +# Copyright (C) 2003, 2004, 2005 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# AM_PROG_MKDIR_P +# --------------- +# Check whether `mkdir -p' is supported, fallback to mkinstalldirs otherwise. +# +# Automake 1.8 used `mkdir -m 0755 -p --' to ensure that directories +# created by `make install' are always world readable, even if the +# installer happens to have an overly restrictive umask (e.g. 077). +# This was a mistake. There are at least two reasons why we must not +# use `-m 0755': +# - it causes special bits like SGID to be ignored, +# - it may be too restrictive (some setups expect 775 directories). +# +# Do not use -m 0755 and let people choose whatever they expect by +# setting umask. +# +# We cannot accept any implementation of `mkdir' that recognizes `-p'. +# Some implementations (such as Solaris 8's) are not thread-safe: if a +# parallel make tries to run `mkdir -p a/b' and `mkdir -p a/c' +# concurrently, both version can detect that a/ is missing, but only +# one can create it and the other will error out. Consequently we +# restrict ourselves to GNU make (using the --version option ensures +# this.) +AC_DEFUN([AM_PROG_MKDIR_P], +[if mkdir -p --version . >/dev/null 2>&1 && test ! -d ./--version; then + # We used to keeping the `.' as first argument, in order to + # allow $(mkdir_p) to be used without argument. As in + # $(mkdir_p) $(somedir) + # where $(somedir) is conditionally defined. However this is wrong + # for two reasons: + # 1. if the package is installed by a user who cannot write `.' + # make install will fail, + # 2. the above comment should most certainly read + # $(mkdir_p) $(DESTDIR)$(somedir) + # so it does not work when $(somedir) is undefined and + # $(DESTDIR) is not. + # To support the latter case, we have to write + # test -z "$(somedir)" || $(mkdir_p) $(DESTDIR)$(somedir), + # so the `.' trick is pointless. + mkdir_p='mkdir -p --' +else + # On NextStep and OpenStep, the `mkdir' command does not + # recognize any option. It will interpret all options as + # directories to create, and then abort because `.' already + # exists. + for d in ./-p ./--version; + do + test -d $d && rmdir $d + done + # $(mkinstalldirs) is defined by Automake if mkinstalldirs exists. + if test -f "$ac_aux_dir/mkinstalldirs"; then + mkdir_p='$(mkinstalldirs)' + else + mkdir_p='$(install_sh) -d' + fi +fi +AC_SUBST([mkdir_p])]) + +# Helper functions for option handling. -*- Autoconf -*- + +# Copyright (C) 2001, 2002, 2003, 2005 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# serial 3 + +# _AM_MANGLE_OPTION(NAME) +# ----------------------- +AC_DEFUN([_AM_MANGLE_OPTION], +[[_AM_OPTION_]m4_bpatsubst($1, [[^a-zA-Z0-9_]], [_])]) + +# _AM_SET_OPTION(NAME) +# ------------------------------ +# Set option NAME. Presently that only means defining a flag for this option. +AC_DEFUN([_AM_SET_OPTION], +[m4_define(_AM_MANGLE_OPTION([$1]), 1)]) + +# _AM_SET_OPTIONS(OPTIONS) +# ---------------------------------- +# OPTIONS is a space-separated list of Automake options. +AC_DEFUN([_AM_SET_OPTIONS], +[AC_FOREACH([_AM_Option], [$1], [_AM_SET_OPTION(_AM_Option)])]) + +# _AM_IF_OPTION(OPTION, IF-SET, [IF-NOT-SET]) +# ------------------------------------------- +# Execute IF-SET if OPTION is set, IF-NOT-SET otherwise. +AC_DEFUN([_AM_IF_OPTION], +[m4_ifset(_AM_MANGLE_OPTION([$1]), [$2], [$3])]) + +# Check to make sure that the build environment is sane. -*- Autoconf -*- + +# Copyright (C) 1996, 1997, 2000, 2001, 2003, 2005 +# Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# serial 4 + +# AM_SANITY_CHECK +# --------------- +AC_DEFUN([AM_SANITY_CHECK], +[AC_MSG_CHECKING([whether build environment is sane]) +# Just in case +sleep 1 +echo timestamp > conftest.file +# Do `set' in a subshell so we don't clobber the current shell's +# arguments. Must try -L first in case configure is actually a +# symlink; some systems play weird games with the mod time of symlinks +# (eg FreeBSD returns the mod time of the symlink's containing +# directory). +if ( + set X `ls -Lt $srcdir/configure conftest.file 2> /dev/null` + if test "$[*]" = "X"; then + # -L didn't work. + set X `ls -t $srcdir/configure conftest.file` + fi + rm -f conftest.file + if test "$[*]" != "X $srcdir/configure conftest.file" \ + && test "$[*]" != "X conftest.file $srcdir/configure"; then + + # If neither matched, then we have a broken ls. This can happen + # if, for instance, CONFIG_SHELL is bash and it inherits a + # broken ls alias from the environment. This has actually + # happened. Such a system could not be considered "sane". + AC_MSG_ERROR([ls -t appears to fail. Make sure there is not a broken +alias in your environment]) + fi + + test "$[2]" = conftest.file + ) +then + # Ok. + : +else + AC_MSG_ERROR([newly created file is older than distributed files! +Check your system clock]) +fi +AC_MSG_RESULT(yes)]) + +# Copyright (C) 2001, 2003, 2005 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# AM_PROG_INSTALL_STRIP +# --------------------- +# One issue with vendor `install' (even GNU) is that you can't +# specify the program used to strip binaries. This is especially +# annoying in cross-compiling environments, where the build's strip +# is unlikely to handle the host's binaries. +# Fortunately install-sh will honor a STRIPPROG variable, so we +# always use install-sh in `make install-strip', and initialize +# STRIPPROG with the value of the STRIP variable (set by the user). +AC_DEFUN([AM_PROG_INSTALL_STRIP], +[AC_REQUIRE([AM_PROG_INSTALL_SH])dnl +# Installed binaries are usually stripped using `strip' when the user +# run `make install-strip'. However `strip' might not be the right +# tool to use in cross-compilation environments, therefore Automake +# will honor the `STRIP' environment variable to overrule this program. +dnl Don't test for $cross_compiling = yes, because it might be `maybe'. +if test "$cross_compiling" != no; then + AC_CHECK_TOOL([STRIP], [strip], :) +fi +INSTALL_STRIP_PROGRAM="\${SHELL} \$(install_sh) -c -s" +AC_SUBST([INSTALL_STRIP_PROGRAM])]) + +# Check how to create a tarball. -*- Autoconf -*- + +# Copyright (C) 2004, 2005 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# serial 2 + +# _AM_PROG_TAR(FORMAT) +# -------------------- +# Check how to create a tarball in format FORMAT. +# FORMAT should be one of `v7', `ustar', or `pax'. +# +# Substitute a variable $(am__tar) that is a command +# writing to stdout a FORMAT-tarball containing the directory +# $tardir. +# tardir=directory && $(am__tar) > result.tar +# +# Substitute a variable $(am__untar) that extract such +# a tarball read from stdin. +# $(am__untar) < result.tar +AC_DEFUN([_AM_PROG_TAR], +[# Always define AMTAR for backward compatibility. +AM_MISSING_PROG([AMTAR], [tar]) +m4_if([$1], [v7], + [am__tar='${AMTAR} chof - "$$tardir"'; am__untar='${AMTAR} xf -'], + [m4_case([$1], [ustar],, [pax],, + [m4_fatal([Unknown tar format])]) +AC_MSG_CHECKING([how to create a $1 tar archive]) +# Loop over all known methods to create a tar archive until one works. +_am_tools='gnutar m4_if([$1], [ustar], [plaintar]) pax cpio none' +_am_tools=${am_cv_prog_tar_$1-$_am_tools} +# Do not fold the above two line into one, because Tru64 sh and +# Solaris sh will not grok spaces in the rhs of `-'. +for _am_tool in $_am_tools +do + case $_am_tool in + gnutar) + for _am_tar in tar gnutar gtar; + do + AM_RUN_LOG([$_am_tar --version]) && break + done + am__tar="$_am_tar --format=m4_if([$1], [pax], [posix], [$1]) -chf - "'"$$tardir"' + am__tar_="$_am_tar --format=m4_if([$1], [pax], [posix], [$1]) -chf - "'"$tardir"' + am__untar="$_am_tar -xf -" + ;; + plaintar) + # Must skip GNU tar: if it does not support --format= it doesn't create + # ustar tarball either. + (tar --version) >/dev/null 2>&1 && continue + am__tar='tar chf - "$$tardir"' + am__tar_='tar chf - "$tardir"' + am__untar='tar xf -' + ;; + pax) + am__tar='pax -L -x $1 -w "$$tardir"' + am__tar_='pax -L -x $1 -w "$tardir"' + am__untar='pax -r' + ;; + cpio) + am__tar='find "$$tardir" -print | cpio -o -H $1 -L' + am__tar_='find "$tardir" -print | cpio -o -H $1 -L' + am__untar='cpio -i -H $1 -d' + ;; + none) + am__tar=false + am__tar_=false + am__untar=false + ;; + esac + + # If the value was cached, stop now. We just wanted to have am__tar + # and am__untar set. + test -n "${am_cv_prog_tar_$1}" && break + + # tar/untar a dummy directory, and stop if the command works + rm -rf conftest.dir + mkdir conftest.dir + echo GrepMe > conftest.dir/file + AM_RUN_LOG([tardir=conftest.dir && eval $am__tar_ >conftest.tar]) + rm -rf conftest.dir + if test -s conftest.tar; then + AM_RUN_LOG([$am__untar <conftest.tar]) + grep GrepMe conftest.dir/file >/dev/null 2>&1 && break + fi +done +rm -rf conftest.dir + +AC_CACHE_VAL([am_cv_prog_tar_$1], [am_cv_prog_tar_$1=$_am_tool]) +AC_MSG_RESULT([$am_cv_prog_tar_$1])]) +AC_SUBST([am__tar]) +AC_SUBST([am__untar]) +]) # _AM_PROG_TAR + diff --git a/driver/xf86-input-mouse/config.guess b/driver/xf86-input-mouse/config.guess new file mode 100644 index 000000000..2fc3acce2 --- /dev/null +++ b/driver/xf86-input-mouse/config.guess @@ -0,0 +1,1411 @@ +#! /bin/sh +# Attempt to guess a canonical system name. +# Copyright (C) 1992, 1993, 1994, 1995, 1996, 1997, 1998, 1999, +# 2000, 2001, 2002, 2003 Free Software Foundation, Inc. + +timestamp='2003-06-17' + +# This file is free software; you can redistribute it and/or modify it +# under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, but +# WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +# General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. +# +# As a special exception to the GNU General Public License, if you +# distribute this file as part of a program that contains a +# configuration script generated by Autoconf, you may include it under +# the same distribution terms that you use for the rest of that program. + +# Originally written by Per Bothner <per@bothner.com>. +# Please send patches to <config-patches@gnu.org>. Submit a context +# diff and a properly formatted ChangeLog entry. +# +# This script attempts to guess a canonical system name similar to +# config.sub. If it succeeds, it prints the system name on stdout, and +# exits with 0. Otherwise, it exits with 1. +# +# The plan is that this can be called by configure scripts if you +# don't specify an explicit build system type. + +me=`echo "$0" | sed -e 's,.*/,,'` + +usage="\ +Usage: $0 [OPTION] + +Output the configuration name of the system \`$me' is run on. + +Operation modes: + -h, --help print this help, then exit + -t, --time-stamp print date of last modification, then exit + -v, --version print version number, then exit + +Report bugs and patches to <config-patches@gnu.org>." + +version="\ +GNU config.guess ($timestamp) + +Originally written by Per Bothner. +Copyright (C) 1992, 1993, 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001 +Free Software Foundation, Inc. + +This is free software; see the source for copying conditions. There is NO +warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE." + +help=" +Try \`$me --help' for more information." + +# Parse command line +while test $# -gt 0 ; do + case $1 in + --time-stamp | --time* | -t ) + echo "$timestamp" ; exit 0 ;; + --version | -v ) + echo "$version" ; exit 0 ;; + --help | --h* | -h ) + echo "$usage"; exit 0 ;; + -- ) # Stop option processing + shift; break ;; + - ) # Use stdin as input. + break ;; + -* ) + echo "$me: invalid option $1$help" >&2 + exit 1 ;; + * ) + break ;; + esac +done + +if test $# != 0; then + echo "$me: too many arguments$help" >&2 + exit 1 +fi + +trap 'exit 1' 1 2 15 + +# CC_FOR_BUILD -- compiler used by this script. Note that the use of a +# compiler to aid in system detection is discouraged as it requires +# temporary files to be created and, as you can see below, it is a +# headache to deal with in a portable fashion. + +# Historically, `CC_FOR_BUILD' used to be named `HOST_CC'. We still +# use `HOST_CC' if defined, but it is deprecated. + +# Portable tmp directory creation inspired by the Autoconf team. + +set_cc_for_build=' +trap "exitcode=\$?; (rm -f \$tmpfiles 2>/dev/null; rmdir \$tmp 2>/dev/null) && exit \$exitcode" 0 ; +trap "rm -f \$tmpfiles 2>/dev/null; rmdir \$tmp 2>/dev/null; exit 1" 1 2 13 15 ; +: ${TMPDIR=/tmp} ; + { tmp=`(umask 077 && mktemp -d -q "$TMPDIR/cgXXXXXX") 2>/dev/null` && test -n "$tmp" && test -d "$tmp" ; } || + { test -n "$RANDOM" && tmp=$TMPDIR/cg$$-$RANDOM && (umask 077 && mkdir $tmp) ; } || + { tmp=$TMPDIR/cg-$$ && (umask 077 && mkdir $tmp) && echo "Warning: creating insecure temp directory" >&2 ; } || + { echo "$me: cannot create a temporary directory in $TMPDIR" >&2 ; exit 1 ; } ; +dummy=$tmp/dummy ; +tmpfiles="$dummy.c $dummy.o $dummy.rel $dummy" ; +case $CC_FOR_BUILD,$HOST_CC,$CC in + ,,) echo "int x;" > $dummy.c ; + for c in cc gcc c89 c99 ; do + if ($c -c -o $dummy.o $dummy.c) >/dev/null 2>&1 ; then + CC_FOR_BUILD="$c"; break ; + fi ; + done ; + if test x"$CC_FOR_BUILD" = x ; then + CC_FOR_BUILD=no_compiler_found ; + fi + ;; + ,,*) CC_FOR_BUILD=$CC ;; + ,*,*) CC_FOR_BUILD=$HOST_CC ;; +esac ;' + +# This is needed to find uname on a Pyramid OSx when run in the BSD universe. +# (ghazi@noc.rutgers.edu 1994-08-24) +if (test -f /.attbin/uname) >/dev/null 2>&1 ; then + PATH=$PATH:/.attbin ; export PATH +fi + +UNAME_MACHINE=`(uname -m) 2>/dev/null` || UNAME_MACHINE=unknown +UNAME_RELEASE=`(uname -r) 2>/dev/null` || UNAME_RELEASE=unknown +UNAME_SYSTEM=`(uname -s) 2>/dev/null` || UNAME_SYSTEM=unknown +UNAME_VERSION=`(uname -v) 2>/dev/null` || UNAME_VERSION=unknown + +## for Red Hat Linux +if test -f /etc/redhat-release ; then + VENDOR=redhat ; +else + VENDOR= ; +fi + +# Note: order is significant - the case branches are not exclusive. + +case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in + *:NetBSD:*:*) + # NetBSD (nbsd) targets should (where applicable) match one or + # more of the tupples: *-*-netbsdelf*, *-*-netbsdaout*, + # *-*-netbsdecoff* and *-*-netbsd*. For targets that recently + # switched to ELF, *-*-netbsd* would select the old + # object file format. This provides both forward + # compatibility and a consistent mechanism for selecting the + # object file format. + # + # Note: NetBSD doesn't particularly care about the vendor + # portion of the name. We always set it to "unknown". + sysctl="sysctl -n hw.machine_arch" + UNAME_MACHINE_ARCH=`(/sbin/$sysctl 2>/dev/null || \ + /usr/sbin/$sysctl 2>/dev/null || echo unknown)` + case "${UNAME_MACHINE_ARCH}" in + armeb) machine=armeb-unknown ;; + arm*) machine=arm-unknown ;; + sh3el) machine=shl-unknown ;; + sh3eb) machine=sh-unknown ;; + *) machine=${UNAME_MACHINE_ARCH}-unknown ;; + esac + # The Operating System including object format, if it has switched + # to ELF recently, or will in the future. + case "${UNAME_MACHINE_ARCH}" in + arm*|i386|m68k|ns32k|sh3*|sparc|vax) + eval $set_cc_for_build + if echo __ELF__ | $CC_FOR_BUILD -E - 2>/dev/null \ + | grep __ELF__ >/dev/null + then + # Once all utilities can be ECOFF (netbsdecoff) or a.out (netbsdaout). + # Return netbsd for either. FIX? + os=netbsd + else + os=netbsdelf + fi + ;; + *) + os=netbsd + ;; + esac + # The OS release + # Debian GNU/NetBSD machines have a different userland, and + # thus, need a distinct triplet. However, they do not need + # kernel version information, so it can be replaced with a + # suitable tag, in the style of linux-gnu. + case "${UNAME_VERSION}" in + Debian*) + release='-gnu' + ;; + *) + release=`echo ${UNAME_RELEASE}|sed -e 's/[-_].*/\./'` + ;; + esac + # Since CPU_TYPE-MANUFACTURER-KERNEL-OPERATING_SYSTEM: + # contains redundant information, the shorter form: + # CPU_TYPE-MANUFACTURER-OPERATING_SYSTEM is used. + echo "${machine}-${os}${release}" + exit 0 ;; + amiga:OpenBSD:*:*) + echo m68k-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + arc:OpenBSD:*:*) + echo mipsel-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + hp300:OpenBSD:*:*) + echo m68k-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + mac68k:OpenBSD:*:*) + echo m68k-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + macppc:OpenBSD:*:*) + echo powerpc-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + mvme68k:OpenBSD:*:*) + echo m68k-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + mvme88k:OpenBSD:*:*) + echo m88k-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + mvmeppc:OpenBSD:*:*) + echo powerpc-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + pmax:OpenBSD:*:*) + echo mipsel-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + sgi:OpenBSD:*:*) + echo mipseb-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + sun3:OpenBSD:*:*) + echo m68k-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + wgrisc:OpenBSD:*:*) + echo mipsel-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + *:OpenBSD:*:*) + echo ${UNAME_MACHINE}-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + alpha:OSF1:*:*) + if test $UNAME_RELEASE = "V4.0"; then + UNAME_RELEASE=`/usr/sbin/sizer -v | awk '{print $3}'` + fi + # According to Compaq, /usr/sbin/psrinfo has been available on + # OSF/1 and Tru64 systems produced since 1995. I hope that + # covers most systems running today. This code pipes the CPU + # types through head -n 1, so we only detect the type of CPU 0. + ALPHA_CPU_TYPE=`/usr/sbin/psrinfo -v | sed -n -e 's/^ The alpha \(.*\) processor.*$/\1/p' | head -n 1` + case "$ALPHA_CPU_TYPE" in + "EV4 (21064)") + UNAME_MACHINE="alpha" ;; + "EV4.5 (21064)") + UNAME_MACHINE="alpha" ;; + "LCA4 (21066/21068)") + UNAME_MACHINE="alpha" ;; + "EV5 (21164)") + UNAME_MACHINE="alphaev5" ;; + "EV5.6 (21164A)") + UNAME_MACHINE="alphaev56" ;; + "EV5.6 (21164PC)") + UNAME_MACHINE="alphapca56" ;; + "EV5.7 (21164PC)") + UNAME_MACHINE="alphapca57" ;; + "EV6 (21264)") + UNAME_MACHINE="alphaev6" ;; + "EV6.7 (21264A)") + UNAME_MACHINE="alphaev67" ;; + "EV6.8CB (21264C)") + UNAME_MACHINE="alphaev68" ;; + "EV6.8AL (21264B)") + UNAME_MACHINE="alphaev68" ;; + "EV6.8CX (21264D)") + UNAME_MACHINE="alphaev68" ;; + "EV6.9A (21264/EV69A)") + UNAME_MACHINE="alphaev69" ;; + "EV7 (21364)") + UNAME_MACHINE="alphaev7" ;; + "EV7.9 (21364A)") + UNAME_MACHINE="alphaev79" ;; + esac + # A Vn.n version is a released version. + # A Tn.n version is a released field test version. + # A Xn.n version is an unreleased experimental baselevel. + # 1.2 uses "1.2" for uname -r. + echo ${UNAME_MACHINE}-dec-osf`echo ${UNAME_RELEASE} | sed -e 's/^[VTX]//' | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz'` + exit 0 ;; + Alpha*:OpenVMS:*:*) + echo alpha-hp-vms + exit 0 ;; + Alpha\ *:Windows_NT*:*) + # How do we know it's Interix rather than the generic POSIX subsystem? + # Should we change UNAME_MACHINE based on the output of uname instead + # of the specific Alpha model? + echo alpha-pc-interix + exit 0 ;; + 21064:Windows_NT:50:3) + echo alpha-dec-winnt3.5 + exit 0 ;; + Amiga*:UNIX_System_V:4.0:*) + echo m68k-unknown-sysv4 + exit 0;; + *:[Aa]miga[Oo][Ss]:*:*) + echo ${UNAME_MACHINE}-unknown-amigaos + exit 0 ;; + *:[Mm]orph[Oo][Ss]:*:*) + echo ${UNAME_MACHINE}-unknown-morphos + exit 0 ;; + *:OS/390:*:*) + echo i370-ibm-openedition + exit 0 ;; + arm:RISC*:1.[012]*:*|arm:riscix:1.[012]*:*) + echo arm-acorn-riscix${UNAME_RELEASE} + exit 0;; + SR2?01:HI-UX/MPP:*:* | SR8000:HI-UX/MPP:*:*) + echo hppa1.1-hitachi-hiuxmpp + exit 0;; + Pyramid*:OSx*:*:* | MIS*:OSx*:*:* | MIS*:SMP_DC-OSx*:*:*) + # akee@wpdis03.wpafb.af.mil (Earle F. Ake) contributed MIS and NILE. + if test "`(/bin/universe) 2>/dev/null`" = att ; then + echo pyramid-pyramid-sysv3 + else + echo pyramid-pyramid-bsd + fi + exit 0 ;; + NILE*:*:*:dcosx) + echo pyramid-pyramid-svr4 + exit 0 ;; + DRS?6000:unix:4.0:6*) + echo sparc-icl-nx6 + exit 0 ;; + DRS?6000:UNIX_SV:4.2*:7*) + case `/usr/bin/uname -p` in + sparc) echo sparc-icl-nx7 && exit 0 ;; + esac ;; + sun4H:SunOS:5.*:*) + echo sparc-hal-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'` + exit 0 ;; + sun4*:SunOS:5.*:* | tadpole*:SunOS:5.*:*) + echo sparc-sun-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'` + exit 0 ;; + i86pc:SunOS:5.*:*) + echo i386-pc-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'` + exit 0 ;; + sun4*:SunOS:6*:*) + # According to config.sub, this is the proper way to canonicalize + # SunOS6. Hard to guess exactly what SunOS6 will be like, but + # it's likely to be more like Solaris than SunOS4. + echo sparc-sun-solaris3`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'` + exit 0 ;; + sun4*:SunOS:*:*) + case "`/usr/bin/arch -k`" in + Series*|S4*) + UNAME_RELEASE=`uname -v` + ;; + esac + # Japanese Language versions have a version number like `4.1.3-JL'. + echo sparc-sun-sunos`echo ${UNAME_RELEASE}|sed -e 's/-/_/'` + exit 0 ;; + sun3*:SunOS:*:*) + echo m68k-sun-sunos${UNAME_RELEASE} + exit 0 ;; + sun*:*:4.2BSD:*) + UNAME_RELEASE=`(sed 1q /etc/motd | awk '{print substr($5,1,3)}') 2>/dev/null` + test "x${UNAME_RELEASE}" = "x" && UNAME_RELEASE=3 + case "`/bin/arch`" in + sun3) + echo m68k-sun-sunos${UNAME_RELEASE} + ;; + sun4) + echo sparc-sun-sunos${UNAME_RELEASE} + ;; + esac + exit 0 ;; + aushp:SunOS:*:*) + echo sparc-auspex-sunos${UNAME_RELEASE} + exit 0 ;; + # The situation for MiNT is a little confusing. The machine name + # can be virtually everything (everything which is not + # "atarist" or "atariste" at least should have a processor + # > m68000). The system name ranges from "MiNT" over "FreeMiNT" + # to the lowercase version "mint" (or "freemint"). Finally + # the system name "TOS" denotes a system which is actually not + # MiNT. But MiNT is downward compatible to TOS, so this should + # be no problem. + atarist[e]:*MiNT:*:* | atarist[e]:*mint:*:* | atarist[e]:*TOS:*:*) + echo m68k-atari-mint${UNAME_RELEASE} + exit 0 ;; + atari*:*MiNT:*:* | atari*:*mint:*:* | atarist[e]:*TOS:*:*) + echo m68k-atari-mint${UNAME_RELEASE} + exit 0 ;; + *falcon*:*MiNT:*:* | *falcon*:*mint:*:* | *falcon*:*TOS:*:*) + echo m68k-atari-mint${UNAME_RELEASE} + exit 0 ;; + milan*:*MiNT:*:* | milan*:*mint:*:* | *milan*:*TOS:*:*) + echo m68k-milan-mint${UNAME_RELEASE} + exit 0 ;; + hades*:*MiNT:*:* | hades*:*mint:*:* | *hades*:*TOS:*:*) + echo m68k-hades-mint${UNAME_RELEASE} + exit 0 ;; + *:*MiNT:*:* | *:*mint:*:* | *:*TOS:*:*) + echo m68k-unknown-mint${UNAME_RELEASE} + exit 0 ;; + powerpc:machten:*:*) + echo powerpc-apple-machten${UNAME_RELEASE} + exit 0 ;; + RISC*:Mach:*:*) + echo mips-dec-mach_bsd4.3 + exit 0 ;; + RISC*:ULTRIX:*:*) + echo mips-dec-ultrix${UNAME_RELEASE} + exit 0 ;; + VAX*:ULTRIX*:*:*) + echo vax-dec-ultrix${UNAME_RELEASE} + exit 0 ;; + 2020:CLIX:*:* | 2430:CLIX:*:*) + echo clipper-intergraph-clix${UNAME_RELEASE} + exit 0 ;; + mips:*:*:UMIPS | mips:*:*:RISCos) + eval $set_cc_for_build + sed 's/^ //' << EOF >$dummy.c +#ifdef __cplusplus +#include <stdio.h> /* for printf() prototype */ + int main (int argc, char *argv[]) { +#else + int main (argc, argv) int argc; char *argv[]; { +#endif + #if defined (host_mips) && defined (MIPSEB) + #if defined (SYSTYPE_SYSV) + printf ("mips-mips-riscos%ssysv\n", argv[1]); exit (0); + #endif + #if defined (SYSTYPE_SVR4) + printf ("mips-mips-riscos%ssvr4\n", argv[1]); exit (0); + #endif + #if defined (SYSTYPE_BSD43) || defined(SYSTYPE_BSD) + printf ("mips-mips-riscos%sbsd\n", argv[1]); exit (0); + #endif + #endif + exit (-1); + } +EOF + $CC_FOR_BUILD -o $dummy $dummy.c \ + && $dummy `echo "${UNAME_RELEASE}" | sed -n 's/\([0-9]*\).*/\1/p'` \ + && exit 0 + echo mips-mips-riscos${UNAME_RELEASE} + exit 0 ;; + Motorola:PowerMAX_OS:*:*) + echo powerpc-motorola-powermax + exit 0 ;; + Motorola:*:4.3:PL8-*) + echo powerpc-harris-powermax + exit 0 ;; + Night_Hawk:*:*:PowerMAX_OS | Synergy:PowerMAX_OS:*:*) + echo powerpc-harris-powermax + exit 0 ;; + Night_Hawk:Power_UNIX:*:*) + echo powerpc-harris-powerunix + exit 0 ;; + m88k:CX/UX:7*:*) + echo m88k-harris-cxux7 + exit 0 ;; + m88k:*:4*:R4*) + echo m88k-motorola-sysv4 + exit 0 ;; + m88k:*:3*:R3*) + echo m88k-motorola-sysv3 + exit 0 ;; + AViiON:dgux:*:*) + # DG/UX returns AViiON for all architectures + UNAME_PROCESSOR=`/usr/bin/uname -p` + if [ $UNAME_PROCESSOR = mc88100 ] || [ $UNAME_PROCESSOR = mc88110 ] + then + if [ ${TARGET_BINARY_INTERFACE}x = m88kdguxelfx ] || \ + [ ${TARGET_BINARY_INTERFACE}x = x ] + then + echo m88k-dg-dgux${UNAME_RELEASE} + else + echo m88k-dg-dguxbcs${UNAME_RELEASE} + fi + else + echo i586-dg-dgux${UNAME_RELEASE} + fi + exit 0 ;; + M88*:DolphinOS:*:*) # DolphinOS (SVR3) + echo m88k-dolphin-sysv3 + exit 0 ;; + M88*:*:R3*:*) + # Delta 88k system running SVR3 + echo m88k-motorola-sysv3 + exit 0 ;; + XD88*:*:*:*) # Tektronix XD88 system running UTekV (SVR3) + echo m88k-tektronix-sysv3 + exit 0 ;; + Tek43[0-9][0-9]:UTek:*:*) # Tektronix 4300 system running UTek (BSD) + echo m68k-tektronix-bsd + exit 0 ;; + *:IRIX*:*:*) + echo mips-sgi-irix`echo ${UNAME_RELEASE}|sed -e 's/-/_/g'` + exit 0 ;; + ????????:AIX?:[12].1:2) # AIX 2.2.1 or AIX 2.1.1 is RT/PC AIX. + echo romp-ibm-aix # uname -m gives an 8 hex-code CPU id + exit 0 ;; # Note that: echo "'`uname -s`'" gives 'AIX ' + i*86:AIX:*:*) + echo i386-ibm-aix + exit 0 ;; + ia64:AIX:*:*) + if [ -x /usr/bin/oslevel ] ; then + IBM_REV=`/usr/bin/oslevel` + else + IBM_REV=${UNAME_VERSION}.${UNAME_RELEASE} + fi + echo ${UNAME_MACHINE}-ibm-aix${IBM_REV} + exit 0 ;; + *:AIX:2:3) + if grep bos325 /usr/include/stdio.h >/dev/null 2>&1; then + eval $set_cc_for_build + sed 's/^ //' << EOF >$dummy.c + #include <sys/systemcfg.h> + + main() + { + if (!__power_pc()) + exit(1); + puts("powerpc-ibm-aix3.2.5"); + exit(0); + } +EOF + $CC_FOR_BUILD -o $dummy $dummy.c && $dummy && exit 0 + echo rs6000-ibm-aix3.2.5 + elif grep bos324 /usr/include/stdio.h >/dev/null 2>&1; then + echo rs6000-ibm-aix3.2.4 + else + echo rs6000-ibm-aix3.2 + fi + exit 0 ;; + *:AIX:*:[45]) + IBM_CPU_ID=`/usr/sbin/lsdev -C -c processor -S available | sed 1q | awk '{ print $1 }'` + if /usr/sbin/lsattr -El ${IBM_CPU_ID} | grep ' POWER' >/dev/null 2>&1; then + IBM_ARCH=rs6000 + else + IBM_ARCH=powerpc + fi + if [ -x /usr/bin/oslevel ] ; then + IBM_REV=`/usr/bin/oslevel` + else + IBM_REV=${UNAME_VERSION}.${UNAME_RELEASE} + fi + echo ${IBM_ARCH}-ibm-aix${IBM_REV} + exit 0 ;; + *:AIX:*:*) + echo rs6000-ibm-aix + exit 0 ;; + ibmrt:4.4BSD:*|romp-ibm:BSD:*) + echo romp-ibm-bsd4.4 + exit 0 ;; + ibmrt:*BSD:*|romp-ibm:BSD:*) # covers RT/PC BSD and + echo romp-ibm-bsd${UNAME_RELEASE} # 4.3 with uname added to + exit 0 ;; # report: romp-ibm BSD 4.3 + *:BOSX:*:*) + echo rs6000-bull-bosx + exit 0 ;; + DPX/2?00:B.O.S.:*:*) + echo m68k-bull-sysv3 + exit 0 ;; + 9000/[34]??:4.3bsd:1.*:*) + echo m68k-hp-bsd + exit 0 ;; + hp300:4.4BSD:*:* | 9000/[34]??:4.3bsd:2.*:*) + echo m68k-hp-bsd4.4 + exit 0 ;; + 9000/[34678]??:HP-UX:*:*) + HPUX_REV=`echo ${UNAME_RELEASE}|sed -e 's/[^.]*.[0B]*//'` + case "${UNAME_MACHINE}" in + 9000/31? ) HP_ARCH=m68000 ;; + 9000/[34]?? ) HP_ARCH=m68k ;; + 9000/[678][0-9][0-9]) + if [ -x /usr/bin/getconf ]; then + sc_cpu_version=`/usr/bin/getconf SC_CPU_VERSION 2>/dev/null` + sc_kernel_bits=`/usr/bin/getconf SC_KERNEL_BITS 2>/dev/null` + case "${sc_cpu_version}" in + 523) HP_ARCH="hppa1.0" ;; # CPU_PA_RISC1_0 + 528) HP_ARCH="hppa1.1" ;; # CPU_PA_RISC1_1 + 532) # CPU_PA_RISC2_0 + case "${sc_kernel_bits}" in + 32) HP_ARCH="hppa2.0n" ;; + 64) HP_ARCH="hppa2.0w" ;; + '') HP_ARCH="hppa2.0" ;; # HP-UX 10.20 + esac ;; + esac + fi + if [ "${HP_ARCH}" = "" ]; then + eval $set_cc_for_build + sed 's/^ //' << EOF >$dummy.c + + #define _HPUX_SOURCE + #include <stdlib.h> + #include <unistd.h> + + int main () + { + #if defined(_SC_KERNEL_BITS) + long bits = sysconf(_SC_KERNEL_BITS); + #endif + long cpu = sysconf (_SC_CPU_VERSION); + + switch (cpu) + { + case CPU_PA_RISC1_0: puts ("hppa1.0"); break; + case CPU_PA_RISC1_1: puts ("hppa1.1"); break; + case CPU_PA_RISC2_0: + #if defined(_SC_KERNEL_BITS) + switch (bits) + { + case 64: puts ("hppa2.0w"); break; + case 32: puts ("hppa2.0n"); break; + default: puts ("hppa2.0"); break; + } break; + #else /* !defined(_SC_KERNEL_BITS) */ + puts ("hppa2.0"); break; + #endif + default: puts ("hppa1.0"); break; + } + exit (0); + } +EOF + (CCOPTS= $CC_FOR_BUILD -o $dummy $dummy.c 2>/dev/null) && HP_ARCH=`$dummy` + test -z "$HP_ARCH" && HP_ARCH=hppa + fi ;; + esac + if [ ${HP_ARCH} = "hppa2.0w" ] + then + # avoid double evaluation of $set_cc_for_build + test -n "$CC_FOR_BUILD" || eval $set_cc_for_build + if echo __LP64__ | (CCOPTS= $CC_FOR_BUILD -E -) | grep __LP64__ >/dev/null + then + HP_ARCH="hppa2.0w" + else + HP_ARCH="hppa64" + fi + fi + echo ${HP_ARCH}-hp-hpux${HPUX_REV} + exit 0 ;; + ia64:HP-UX:*:*) + HPUX_REV=`echo ${UNAME_RELEASE}|sed -e 's/[^.]*.[0B]*//'` + echo ia64-hp-hpux${HPUX_REV} + exit 0 ;; + 3050*:HI-UX:*:*) + eval $set_cc_for_build + sed 's/^ //' << EOF >$dummy.c + #include <unistd.h> + int + main () + { + long cpu = sysconf (_SC_CPU_VERSION); + /* The order matters, because CPU_IS_HP_MC68K erroneously returns + true for CPU_PA_RISC1_0. CPU_IS_PA_RISC returns correct + results, however. */ + if (CPU_IS_PA_RISC (cpu)) + { + switch (cpu) + { + case CPU_PA_RISC1_0: puts ("hppa1.0-hitachi-hiuxwe2"); break; + case CPU_PA_RISC1_1: puts ("hppa1.1-hitachi-hiuxwe2"); break; + case CPU_PA_RISC2_0: puts ("hppa2.0-hitachi-hiuxwe2"); break; + default: puts ("hppa-hitachi-hiuxwe2"); break; + } + } + else if (CPU_IS_HP_MC68K (cpu)) + puts ("m68k-hitachi-hiuxwe2"); + else puts ("unknown-hitachi-hiuxwe2"); + exit (0); + } +EOF + $CC_FOR_BUILD -o $dummy $dummy.c && $dummy && exit 0 + echo unknown-hitachi-hiuxwe2 + exit 0 ;; + 9000/7??:4.3bsd:*:* | 9000/8?[79]:4.3bsd:*:* ) + echo hppa1.1-hp-bsd + exit 0 ;; + 9000/8??:4.3bsd:*:*) + echo hppa1.0-hp-bsd + exit 0 ;; + *9??*:MPE/iX:*:* | *3000*:MPE/iX:*:*) + echo hppa1.0-hp-mpeix + exit 0 ;; + hp7??:OSF1:*:* | hp8?[79]:OSF1:*:* ) + echo hppa1.1-hp-osf + exit 0 ;; + hp8??:OSF1:*:*) + echo hppa1.0-hp-osf + exit 0 ;; + i*86:OSF1:*:*) + if [ -x /usr/sbin/sysversion ] ; then + echo ${UNAME_MACHINE}-unknown-osf1mk + else + echo ${UNAME_MACHINE}-unknown-osf1 + fi + exit 0 ;; + parisc*:Lites*:*:*) + echo hppa1.1-hp-lites + exit 0 ;; + C1*:ConvexOS:*:* | convex:ConvexOS:C1*:*) + echo c1-convex-bsd + exit 0 ;; + C2*:ConvexOS:*:* | convex:ConvexOS:C2*:*) + if getsysinfo -f scalar_acc + then echo c32-convex-bsd + else echo c2-convex-bsd + fi + exit 0 ;; + C34*:ConvexOS:*:* | convex:ConvexOS:C34*:*) + echo c34-convex-bsd + exit 0 ;; + C38*:ConvexOS:*:* | convex:ConvexOS:C38*:*) + echo c38-convex-bsd + exit 0 ;; + C4*:ConvexOS:*:* | convex:ConvexOS:C4*:*) + echo c4-convex-bsd + exit 0 ;; + CRAY*Y-MP:*:*:*) + echo ymp-cray-unicos${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/' + exit 0 ;; + CRAY*[A-Z]90:*:*:*) + echo ${UNAME_MACHINE}-cray-unicos${UNAME_RELEASE} \ + | sed -e 's/CRAY.*\([A-Z]90\)/\1/' \ + -e y/ABCDEFGHIJKLMNOPQRSTUVWXYZ/abcdefghijklmnopqrstuvwxyz/ \ + -e 's/\.[^.]*$/.X/' + exit 0 ;; + CRAY*TS:*:*:*) + echo t90-cray-unicos${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/' + exit 0 ;; + CRAY*T3E:*:*:*) + echo alphaev5-cray-unicosmk${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/' + exit 0 ;; + CRAY*SV1:*:*:*) + echo sv1-cray-unicos${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/' + exit 0 ;; + *:UNICOS/mp:*:*) + echo nv1-cray-unicosmp${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/' + exit 0 ;; + F30[01]:UNIX_System_V:*:* | F700:UNIX_System_V:*:*) + FUJITSU_PROC=`uname -m | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz'` + FUJITSU_SYS=`uname -p | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz' | sed -e 's/\///'` + FUJITSU_REL=`echo ${UNAME_RELEASE} | sed -e 's/ /_/'` + echo "${FUJITSU_PROC}-fujitsu-${FUJITSU_SYS}${FUJITSU_REL}" + exit 0 ;; + i*86:BSD/386:*:* | i*86:BSD/OS:*:* | *:Ascend\ Embedded/OS:*:*) + echo ${UNAME_MACHINE}-pc-bsdi${UNAME_RELEASE} + exit 0 ;; + sparc*:BSD/OS:*:*) + echo sparc-unknown-bsdi${UNAME_RELEASE} + exit 0 ;; + *:BSD/OS:*:*) + echo ${UNAME_MACHINE}-unknown-bsdi${UNAME_RELEASE} + exit 0 ;; + *:FreeBSD:*:*|*:GNU/FreeBSD:*:*) + # Determine whether the default compiler uses glibc. + eval $set_cc_for_build + sed 's/^ //' << EOF >$dummy.c + #include <features.h> + #if __GLIBC__ >= 2 + LIBC=gnu + #else + LIBC= + #endif +EOF + eval `$CC_FOR_BUILD -E $dummy.c 2>/dev/null | grep ^LIBC=` + echo ${UNAME_MACHINE}-unknown-freebsd`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'`${LIBC:+-$LIBC} + exit 0 ;; + i*:CYGWIN*:*) + echo ${UNAME_MACHINE}-pc-cygwin + exit 0 ;; + i*:MINGW*:*) + echo ${UNAME_MACHINE}-pc-mingw32 + exit 0 ;; + i*:PW*:*) + echo ${UNAME_MACHINE}-pc-pw32 + exit 0 ;; + x86:Interix*:[34]*) + echo i586-pc-interix${UNAME_RELEASE}|sed -e 's/\..*//' + exit 0 ;; + [345]86:Windows_95:* | [345]86:Windows_98:* | [345]86:Windows_NT:*) + echo i${UNAME_MACHINE}-pc-mks + exit 0 ;; + i*:Windows_NT*:* | Pentium*:Windows_NT*:*) + # How do we know it's Interix rather than the generic POSIX subsystem? + # It also conflicts with pre-2.0 versions of AT&T UWIN. Should we + # UNAME_MACHINE based on the output of uname instead of i386? + echo i586-pc-interix + exit 0 ;; + i*:UWIN*:*) + echo ${UNAME_MACHINE}-pc-uwin + exit 0 ;; + p*:CYGWIN*:*) + echo powerpcle-unknown-cygwin + exit 0 ;; + prep*:SunOS:5.*:*) + echo powerpcle-unknown-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'` + exit 0 ;; + *:GNU:*:*) + echo `echo ${UNAME_MACHINE}|sed -e 's,[-/].*$,,'`-unknown-gnu`echo ${UNAME_RELEASE}|sed -e 's,/.*$,,'` + exit 0 ;; + i*86:Minix:*:*) + echo ${UNAME_MACHINE}-pc-minix + exit 0 ;; + arm*:Linux:*:*) + echo ${UNAME_MACHINE}-unknown-linux-gnu + exit 0 ;; + cris:Linux:*:*) + echo cris-axis-linux-gnu + exit 0 ;; + ia64:Linux:*:*) + echo ${UNAME_MACHINE}-${VENDOR:-unknown}-linux-gnu + exit 0 ;; + m68*:Linux:*:*) + echo ${UNAME_MACHINE}-unknown-linux-gnu + exit 0 ;; + mips:Linux:*:*) + eval $set_cc_for_build + sed 's/^ //' << EOF >$dummy.c + #undef CPU + #undef mips + #undef mipsel + #if defined(__MIPSEL__) || defined(__MIPSEL) || defined(_MIPSEL) || defined(MIPSEL) + CPU=mipsel + #else + #if defined(__MIPSEB__) || defined(__MIPSEB) || defined(_MIPSEB) || defined(MIPSEB) + CPU=mips + #else + CPU= + #endif + #endif +EOF + eval `$CC_FOR_BUILD -E $dummy.c 2>/dev/null | grep ^CPU=` + test x"${CPU}" != x && echo "${CPU}-unknown-linux-gnu" && exit 0 + ;; + mips64:Linux:*:*) + eval $set_cc_for_build + sed 's/^ //' << EOF >$dummy.c + #undef CPU + #undef mips64 + #undef mips64el + #if defined(__MIPSEL__) || defined(__MIPSEL) || defined(_MIPSEL) || defined(MIPSEL) + CPU=mips64el + #else + #if defined(__MIPSEB__) || defined(__MIPSEB) || defined(_MIPSEB) || defined(MIPSEB) + CPU=mips64 + #else + CPU= + #endif + #endif +EOF + eval `$CC_FOR_BUILD -E $dummy.c 2>/dev/null | grep ^CPU=` + test x"${CPU}" != x && echo "${CPU}-unknown-linux-gnu" && exit 0 + ;; + ppc:Linux:*:*) + echo powerpc-${VENDOR:-unknown}-linux-gnu + exit 0 ;; + ppc64:Linux:*:*) + echo powerpc64-${VENDOR:-unknown}-linux-gnu + exit 0 ;; + alpha:Linux:*:*) + case `sed -n '/^cpu model/s/^.*: \(.*\)/\1/p' < /proc/cpuinfo` in + EV5) UNAME_MACHINE=alphaev5 ;; + EV56) UNAME_MACHINE=alphaev56 ;; + PCA56) UNAME_MACHINE=alphapca56 ;; + PCA57) UNAME_MACHINE=alphapca56 ;; + EV6) UNAME_MACHINE=alphaev6 ;; + EV67) UNAME_MACHINE=alphaev67 ;; + EV68*) UNAME_MACHINE=alphaev68 ;; + esac + objdump --private-headers /bin/sh | grep ld.so.1 >/dev/null + if test "$?" = 0 ; then LIBC="libc1" ; else LIBC="" ; fi + echo ${UNAME_MACHINE}-unknown-linux-gnu${LIBC} + exit 0 ;; + parisc:Linux:*:* | hppa:Linux:*:*) + # Look for CPU level + case `grep '^cpu[^a-z]*:' /proc/cpuinfo 2>/dev/null | cut -d' ' -f2` in + PA7*) echo hppa1.1-unknown-linux-gnu ;; + PA8*) echo hppa2.0-unknown-linux-gnu ;; + *) echo hppa-unknown-linux-gnu ;; + esac + exit 0 ;; + parisc64:Linux:*:* | hppa64:Linux:*:*) + echo hppa64-unknown-linux-gnu + exit 0 ;; + s390:Linux:*:* | s390x:Linux:*:*) + echo ${UNAME_MACHINE}-${VENDOR:-ibm}-linux-gnu + exit 0 ;; + sh64*:Linux:*:*) + echo ${UNAME_MACHINE}-unknown-linux-gnu + exit 0 ;; + sh*:Linux:*:*) + echo ${UNAME_MACHINE}-unknown-linux-gnu + exit 0 ;; + sparc:Linux:*:* | sparc64:Linux:*:*) + echo ${UNAME_MACHINE}-unknown-linux-gnu + exit 0 ;; + x86_64:Linux:*:*) + echo x86_64-${VENDOR:-unknown}-linux-gnu + exit 0 ;; + i*86:Linux:*:*) + # The BFD linker knows what the default object file format is, so + # first see if it will tell us. cd to the root directory to prevent + # problems with other programs or directories called `ld' in the path. + # Set LC_ALL=C to ensure ld outputs messages in English. + ld_supported_targets=`cd /; LC_ALL=C ld --help 2>&1 \ + | sed -ne '/supported targets:/!d + s/[ ][ ]*/ /g + s/.*supported targets: *// + s/ .*// + p'` + case "$ld_supported_targets" in + elf32-i386) + TENTATIVE="${UNAME_MACHINE}-pc-linux-gnu" + ;; + a.out-i386-linux) + echo "${UNAME_MACHINE}-pc-linux-gnuaout" + exit 0 ;; + coff-i386) + echo "${UNAME_MACHINE}-pc-linux-gnucoff" + exit 0 ;; + "") + # Either a pre-BFD a.out linker (linux-gnuoldld) or + # one that does not give us useful --help. + echo "${UNAME_MACHINE}-pc-linux-gnuoldld" + exit 0 ;; + esac + # Determine whether the default compiler is a.out or elf + eval $set_cc_for_build + sed 's/^ //' << EOF >$dummy.c + #include <features.h> + #ifdef __ELF__ + # ifdef __GLIBC__ + # if __GLIBC__ >= 2 + LIBC=gnu + # else + LIBC=gnulibc1 + # endif + # else + LIBC=gnulibc1 + # endif + #else + #ifdef __INTEL_COMPILER + LIBC=gnu + #else + LIBC=gnuaout + #endif + #endif +EOF + eval `$CC_FOR_BUILD -E $dummy.c 2>/dev/null | grep ^LIBC=` + test x"${LIBC}" != x && echo "${UNAME_MACHINE}-${VENDOR:-pc}-linux-${LIBC}" && exit 0 + test x"${TENTATIVE}" != x && echo "${TENTATIVE}" && exit 0 + ;; + i*86:DYNIX/ptx:4*:*) + # ptx 4.0 does uname -s correctly, with DYNIX/ptx in there. + # earlier versions are messed up and put the nodename in both + # sysname and nodename. + echo i386-sequent-sysv4 + exit 0 ;; + i*86:UNIX_SV:4.2MP:2.*) + # Unixware is an offshoot of SVR4, but it has its own version + # number series starting with 2... + # I am not positive that other SVR4 systems won't match this, + # I just have to hope. -- rms. + # Use sysv4.2uw... so that sysv4* matches it. + echo ${UNAME_MACHINE}-pc-sysv4.2uw${UNAME_VERSION} + exit 0 ;; + i*86:OS/2:*:*) + # If we were able to find `uname', then EMX Unix compatibility + # is probably installed. + echo ${UNAME_MACHINE}-pc-os2-emx + exit 0 ;; + i*86:XTS-300:*:STOP) + echo ${UNAME_MACHINE}-unknown-stop + exit 0 ;; + i*86:atheos:*:*) + echo ${UNAME_MACHINE}-unknown-atheos + exit 0 ;; + i*86:LynxOS:2.*:* | i*86:LynxOS:3.[01]*:* | i*86:LynxOS:4.0*:*) + echo i386-unknown-lynxos${UNAME_RELEASE} + exit 0 ;; + i*86:*DOS:*:*) + echo ${UNAME_MACHINE}-pc-msdosdjgpp + exit 0 ;; + i*86:*:4.*:* | i*86:SYSTEM_V:4.*:*) + UNAME_REL=`echo ${UNAME_RELEASE} | sed 's/\/MP$//'` + if grep Novell /usr/include/link.h >/dev/null 2>/dev/null; then + echo ${UNAME_MACHINE}-univel-sysv${UNAME_REL} + else + echo ${UNAME_MACHINE}-pc-sysv${UNAME_REL} + fi + exit 0 ;; + i*86:*:5:[78]*) + case `/bin/uname -X | grep "^Machine"` in + *486*) UNAME_MACHINE=i486 ;; + *Pentium) UNAME_MACHINE=i586 ;; + *Pent*|*Celeron) UNAME_MACHINE=i686 ;; + esac + echo ${UNAME_MACHINE}-unknown-sysv${UNAME_RELEASE}${UNAME_SYSTEM}${UNAME_VERSION} + exit 0 ;; + i*86:*:3.2:*) + if test -f /usr/options/cb.name; then + UNAME_REL=`sed -n 's/.*Version //p' </usr/options/cb.name` + echo ${UNAME_MACHINE}-pc-isc$UNAME_REL + elif /bin/uname -X 2>/dev/null >/dev/null ; then + UNAME_REL=`(/bin/uname -X|grep Release|sed -e 's/.*= //')` + (/bin/uname -X|grep i80486 >/dev/null) && UNAME_MACHINE=i486 + (/bin/uname -X|grep '^Machine.*Pentium' >/dev/null) \ + && UNAME_MACHINE=i586 + (/bin/uname -X|grep '^Machine.*Pent *II' >/dev/null) \ + && UNAME_MACHINE=i686 + (/bin/uname -X|grep '^Machine.*Pentium Pro' >/dev/null) \ + && UNAME_MACHINE=i686 + echo ${UNAME_MACHINE}-pc-sco$UNAME_REL + else + echo ${UNAME_MACHINE}-pc-sysv32 + fi + exit 0 ;; + pc:*:*:*) + # Left here for compatibility: + # uname -m prints for DJGPP always 'pc', but it prints nothing about + # the processor, so we play safe by assuming i386. + echo i386-pc-msdosdjgpp + exit 0 ;; + Intel:Mach:3*:*) + echo i386-pc-mach3 + exit 0 ;; + paragon:*:*:*) + echo i860-intel-osf1 + exit 0 ;; + i860:*:4.*:*) # i860-SVR4 + if grep Stardent /usr/include/sys/uadmin.h >/dev/null 2>&1 ; then + echo i860-stardent-sysv${UNAME_RELEASE} # Stardent Vistra i860-SVR4 + else # Add other i860-SVR4 vendors below as they are discovered. + echo i860-unknown-sysv${UNAME_RELEASE} # Unknown i860-SVR4 + fi + exit 0 ;; + mini*:CTIX:SYS*5:*) + # "miniframe" + echo m68010-convergent-sysv + exit 0 ;; + mc68k:UNIX:SYSTEM5:3.51m) + echo m68k-convergent-sysv + exit 0 ;; + M680?0:D-NIX:5.3:*) + echo m68k-diab-dnix + exit 0 ;; + M68*:*:R3V[567]*:*) + test -r /sysV68 && echo 'm68k-motorola-sysv' && exit 0 ;; + 3[34]??:*:4.0:3.0 | 3[34]??A:*:4.0:3.0 | 3[34]??,*:*:4.0:3.0 | 3[34]??/*:*:4.0:3.0 | 4400:*:4.0:3.0 | 4850:*:4.0:3.0 | SKA40:*:4.0:3.0 | SDS2:*:4.0:3.0 | SHG2:*:4.0:3.0) + OS_REL='' + test -r /etc/.relid \ + && OS_REL=.`sed -n 's/[^ ]* [^ ]* \([0-9][0-9]\).*/\1/p' < /etc/.relid` + /bin/uname -p 2>/dev/null | grep 86 >/dev/null \ + && echo i486-ncr-sysv4.3${OS_REL} && exit 0 + /bin/uname -p 2>/dev/null | /bin/grep entium >/dev/null \ + && echo i586-ncr-sysv4.3${OS_REL} && exit 0 ;; + 3[34]??:*:4.0:* | 3[34]??,*:*:4.0:*) + /bin/uname -p 2>/dev/null | grep 86 >/dev/null \ + && echo i486-ncr-sysv4 && exit 0 ;; + m68*:LynxOS:2.*:* | m68*:LynxOS:3.0*:*) + echo m68k-unknown-lynxos${UNAME_RELEASE} + exit 0 ;; + mc68030:UNIX_System_V:4.*:*) + echo m68k-atari-sysv4 + exit 0 ;; + TSUNAMI:LynxOS:2.*:*) + echo sparc-unknown-lynxos${UNAME_RELEASE} + exit 0 ;; + rs6000:LynxOS:2.*:*) + echo rs6000-unknown-lynxos${UNAME_RELEASE} + exit 0 ;; + PowerPC:LynxOS:2.*:* | PowerPC:LynxOS:3.[01]*:* | PowerPC:LynxOS:4.0*:*) + echo powerpc-unknown-lynxos${UNAME_RELEASE} + exit 0 ;; + SM[BE]S:UNIX_SV:*:*) + echo mips-dde-sysv${UNAME_RELEASE} + exit 0 ;; + RM*:ReliantUNIX-*:*:*) + echo mips-sni-sysv4 + exit 0 ;; + RM*:SINIX-*:*:*) + echo mips-sni-sysv4 + exit 0 ;; + *:SINIX-*:*:*) + if uname -p 2>/dev/null >/dev/null ; then + UNAME_MACHINE=`(uname -p) 2>/dev/null` + echo ${UNAME_MACHINE}-sni-sysv4 + else + echo ns32k-sni-sysv + fi + exit 0 ;; + PENTIUM:*:4.0*:*) # Unisys `ClearPath HMP IX 4000' SVR4/MP effort + # says <Richard.M.Bartel@ccMail.Census.GOV> + echo i586-unisys-sysv4 + exit 0 ;; + *:UNIX_System_V:4*:FTX*) + # From Gerald Hewes <hewes@openmarket.com>. + # How about differentiating between stratus architectures? -djm + echo hppa1.1-stratus-sysv4 + exit 0 ;; + *:*:*:FTX*) + # From seanf@swdc.stratus.com. + echo i860-stratus-sysv4 + exit 0 ;; + *:VOS:*:*) + # From Paul.Green@stratus.com. + echo hppa1.1-stratus-vos + exit 0 ;; + mc68*:A/UX:*:*) + echo m68k-apple-aux${UNAME_RELEASE} + exit 0 ;; + news*:NEWS-OS:6*:*) + echo mips-sony-newsos6 + exit 0 ;; + R[34]000:*System_V*:*:* | R4000:UNIX_SYSV:*:* | R*000:UNIX_SV:*:*) + if [ -d /usr/nec ]; then + echo mips-nec-sysv${UNAME_RELEASE} + else + echo mips-unknown-sysv${UNAME_RELEASE} + fi + exit 0 ;; + BeBox:BeOS:*:*) # BeOS running on hardware made by Be, PPC only. + echo powerpc-be-beos + exit 0 ;; + BeMac:BeOS:*:*) # BeOS running on Mac or Mac clone, PPC only. + echo powerpc-apple-beos + exit 0 ;; + BePC:BeOS:*:*) # BeOS running on Intel PC compatible. + echo i586-pc-beos + exit 0 ;; + SX-4:SUPER-UX:*:*) + echo sx4-nec-superux${UNAME_RELEASE} + exit 0 ;; + SX-5:SUPER-UX:*:*) + echo sx5-nec-superux${UNAME_RELEASE} + exit 0 ;; + SX-6:SUPER-UX:*:*) + echo sx6-nec-superux${UNAME_RELEASE} + exit 0 ;; + Power*:Rhapsody:*:*) + echo powerpc-apple-rhapsody${UNAME_RELEASE} + exit 0 ;; + *:Rhapsody:*:*) + echo ${UNAME_MACHINE}-apple-rhapsody${UNAME_RELEASE} + exit 0 ;; + *:Darwin:*:*) + case `uname -p` in + *86) UNAME_PROCESSOR=i686 ;; + powerpc) UNAME_PROCESSOR=powerpc ;; + esac + echo ${UNAME_PROCESSOR}-apple-darwin${UNAME_RELEASE} + exit 0 ;; + *:procnto*:*:* | *:QNX:[0123456789]*:*) + UNAME_PROCESSOR=`uname -p` + if test "$UNAME_PROCESSOR" = "x86"; then + UNAME_PROCESSOR=i386 + UNAME_MACHINE=pc + fi + echo ${UNAME_PROCESSOR}-${UNAME_MACHINE}-nto-qnx${UNAME_RELEASE} + exit 0 ;; + *:QNX:*:4*) + echo i386-pc-qnx + exit 0 ;; + NSR-[DGKLNPTVW]:NONSTOP_KERNEL:*:*) + echo nsr-tandem-nsk${UNAME_RELEASE} + exit 0 ;; + *:NonStop-UX:*:*) + echo mips-compaq-nonstopux + exit 0 ;; + BS2000:POSIX*:*:*) + echo bs2000-siemens-sysv + exit 0 ;; + DS/*:UNIX_System_V:*:*) + echo ${UNAME_MACHINE}-${UNAME_SYSTEM}-${UNAME_RELEASE} + exit 0 ;; + *:Plan9:*:*) + # "uname -m" is not consistent, so use $cputype instead. 386 + # is converted to i386 for consistency with other x86 + # operating systems. + if test "$cputype" = "386"; then + UNAME_MACHINE=i386 + else + UNAME_MACHINE="$cputype" + fi + echo ${UNAME_MACHINE}-unknown-plan9 + exit 0 ;; + *:TOPS-10:*:*) + echo pdp10-unknown-tops10 + exit 0 ;; + *:TENEX:*:*) + echo pdp10-unknown-tenex + exit 0 ;; + KS10:TOPS-20:*:* | KL10:TOPS-20:*:* | TYPE4:TOPS-20:*:*) + echo pdp10-dec-tops20 + exit 0 ;; + XKL-1:TOPS-20:*:* | TYPE5:TOPS-20:*:*) + echo pdp10-xkl-tops20 + exit 0 ;; + *:TOPS-20:*:*) + echo pdp10-unknown-tops20 + exit 0 ;; + *:ITS:*:*) + echo pdp10-unknown-its + exit 0 ;; + SEI:*:*:SEIUX) + echo mips-sei-seiux${UNAME_RELEASE} + exit 0 ;; +esac + +#echo '(No uname command or uname output not recognized.)' 1>&2 +#echo "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" 1>&2 + +eval $set_cc_for_build +cat >$dummy.c <<EOF +#ifdef _SEQUENT_ +# include <sys/types.h> +# include <sys/utsname.h> +#endif +main () +{ +#if defined (sony) +#if defined (MIPSEB) + /* BFD wants "bsd" instead of "newsos". Perhaps BFD should be changed, + I don't know.... */ + printf ("mips-sony-bsd\n"); exit (0); +#else +#include <sys/param.h> + printf ("m68k-sony-newsos%s\n", +#ifdef NEWSOS4 + "4" +#else + "" +#endif + ); exit (0); +#endif +#endif + +#if defined (__arm) && defined (__acorn) && defined (__unix) + printf ("arm-acorn-riscix"); exit (0); +#endif + +#if defined (hp300) && !defined (hpux) + printf ("m68k-hp-bsd\n"); exit (0); +#endif + +#if defined (NeXT) +#if !defined (__ARCHITECTURE__) +#define __ARCHITECTURE__ "m68k" +#endif + int version; + version=`(hostinfo | sed -n 's/.*NeXT Mach \([0-9]*\).*/\1/p') 2>/dev/null`; + if (version < 4) + printf ("%s-next-nextstep%d\n", __ARCHITECTURE__, version); + else + printf ("%s-next-openstep%d\n", __ARCHITECTURE__, version); + exit (0); +#endif + +#if defined (MULTIMAX) || defined (n16) +#if defined (UMAXV) + printf ("ns32k-encore-sysv\n"); exit (0); +#else +#if defined (CMU) + printf ("ns32k-encore-mach\n"); exit (0); +#else + printf ("ns32k-encore-bsd\n"); exit (0); +#endif +#endif +#endif + +#if defined (__386BSD__) + printf ("i386-pc-bsd\n"); exit (0); +#endif + +#if defined (sequent) +#if defined (i386) + printf ("i386-sequent-dynix\n"); exit (0); +#endif +#if defined (ns32000) + printf ("ns32k-sequent-dynix\n"); exit (0); +#endif +#endif + +#if defined (_SEQUENT_) + struct utsname un; + + uname(&un); + + if (strncmp(un.version, "V2", 2) == 0) { + printf ("i386-sequent-ptx2\n"); exit (0); + } + if (strncmp(un.version, "V1", 2) == 0) { /* XXX is V1 correct? */ + printf ("i386-sequent-ptx1\n"); exit (0); + } + printf ("i386-sequent-ptx\n"); exit (0); + +#endif + +#if defined (vax) +# if !defined (ultrix) +# include <sys/param.h> +# if defined (BSD) +# if BSD == 43 + printf ("vax-dec-bsd4.3\n"); exit (0); +# else +# if BSD == 199006 + printf ("vax-dec-bsd4.3reno\n"); exit (0); +# else + printf ("vax-dec-bsd\n"); exit (0); +# endif +# endif +# else + printf ("vax-dec-bsd\n"); exit (0); +# endif +# else + printf ("vax-dec-ultrix\n"); exit (0); +# endif +#endif + +#if defined (alliant) && defined (i860) + printf ("i860-alliant-bsd\n"); exit (0); +#endif + + exit (1); +} +EOF + +$CC_FOR_BUILD -o $dummy $dummy.c 2>/dev/null && $dummy && exit 0 + +# Apollos put the system type in the environment. + +test -d /usr/apollo && { echo ${ISP}-apollo-${SYSTYPE}; exit 0; } + +# Convex versions that predate uname can use getsysinfo(1) + +if [ -x /usr/convex/getsysinfo ] +then + case `getsysinfo -f cpu_type` in + c1*) + echo c1-convex-bsd + exit 0 ;; + c2*) + if getsysinfo -f scalar_acc + then echo c32-convex-bsd + else echo c2-convex-bsd + fi + exit 0 ;; + c34*) + echo c34-convex-bsd + exit 0 ;; + c38*) + echo c38-convex-bsd + exit 0 ;; + c4*) + echo c4-convex-bsd + exit 0 ;; + esac +fi + +cat >&2 <<EOF +$0: unable to guess system type + +This script, last modified $timestamp, has failed to recognize +the operating system you are using. It is advised that you +download the most up to date version of the config scripts from + + ftp://ftp.gnu.org/pub/gnu/config/ + +If the version you run ($0) is already up to date, please +send the following data and any information you think might be +pertinent to <config-patches@gnu.org> in order to provide the needed +information to handle your system. + +config.guess timestamp = $timestamp + +uname -m = `(uname -m) 2>/dev/null || echo unknown` +uname -r = `(uname -r) 2>/dev/null || echo unknown` +uname -s = `(uname -s) 2>/dev/null || echo unknown` +uname -v = `(uname -v) 2>/dev/null || echo unknown` + +/usr/bin/uname -p = `(/usr/bin/uname -p) 2>/dev/null` +/bin/uname -X = `(/bin/uname -X) 2>/dev/null` + +hostinfo = `(hostinfo) 2>/dev/null` +/bin/universe = `(/bin/universe) 2>/dev/null` +/usr/bin/arch -k = `(/usr/bin/arch -k) 2>/dev/null` +/bin/arch = `(/bin/arch) 2>/dev/null` +/usr/bin/oslevel = `(/usr/bin/oslevel) 2>/dev/null` +/usr/convex/getsysinfo = `(/usr/convex/getsysinfo) 2>/dev/null` + +UNAME_MACHINE = ${UNAME_MACHINE} +UNAME_RELEASE = ${UNAME_RELEASE} +UNAME_SYSTEM = ${UNAME_SYSTEM} +UNAME_VERSION = ${UNAME_VERSION} +EOF + +exit 1 + +# Local variables: +# eval: (add-hook 'write-file-hooks 'time-stamp) +# time-stamp-start: "timestamp='" +# time-stamp-format: "%:y-%02m-%02d" +# time-stamp-end: "'" +# End: diff --git a/driver/xf86-input-mouse/config.h.in b/driver/xf86-input-mouse/config.h.in new file mode 100644 index 000000000..db6ccf22e --- /dev/null +++ b/driver/xf86-input-mouse/config.h.in @@ -0,0 +1,57 @@ +/* config.h.in. Generated from configure.ac by autoheader. */ + +#include "xorg-server.h" + +/* Define to 1 if you have the <dlfcn.h> header file. */ +#undef HAVE_DLFCN_H + +/* Define to 1 if you have the <inttypes.h> header file. */ +#undef HAVE_INTTYPES_H + +/* Define to 1 if you have the <memory.h> header file. */ +#undef HAVE_MEMORY_H + +/* Define to 1 if you have the <stdint.h> header file. */ +#undef HAVE_STDINT_H + +/* Define to 1 if you have the <stdlib.h> header file. */ +#undef HAVE_STDLIB_H + +/* Define to 1 if you have the <strings.h> header file. */ +#undef HAVE_STRINGS_H + +/* Define to 1 if you have the <string.h> header file. */ +#undef HAVE_STRING_H + +/* Define to 1 if you have the <sys/stat.h> header file. */ +#undef HAVE_SYS_STAT_H + +/* Define to 1 if you have the <sys/types.h> header file. */ +#undef HAVE_SYS_TYPES_H + +/* Define to 1 if you have the <unistd.h> header file. */ +#undef HAVE_UNISTD_H + +/* Name of package */ +#undef PACKAGE + +/* Define to the address where bug reports for this package should be sent. */ +#undef PACKAGE_BUGREPORT + +/* Define to the full name of this package. */ +#undef PACKAGE_NAME + +/* Define to the full name and version of this package. */ +#undef PACKAGE_STRING + +/* Define to the one symbol short name of this package. */ +#undef PACKAGE_TARNAME + +/* Define to the version of this package. */ +#undef PACKAGE_VERSION + +/* Define to 1 if you have the ANSI C header files. */ +#undef STDC_HEADERS + +/* Version number of package */ +#undef VERSION diff --git a/driver/xf86-input-mouse/config.sub b/driver/xf86-input-mouse/config.sub new file mode 100644 index 000000000..6b2ff9f6a --- /dev/null +++ b/driver/xf86-input-mouse/config.sub @@ -0,0 +1,1500 @@ +#! /bin/sh +# Configuration validation subroutine script. +# Copyright (C) 1992, 1993, 1994, 1995, 1996, 1997, 1998, 1999, +# 2000, 2001, 2002, 2003 Free Software Foundation, Inc. + +timestamp='2003-06-18' + +# This file is (in principle) common to ALL GNU software. +# The presence of a machine in this file suggests that SOME GNU software +# can handle that machine. It does not imply ALL GNU software can. +# +# This file is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place - Suite 330, +# Boston, MA 02111-1307, USA. + +# As a special exception to the GNU General Public License, if you +# distribute this file as part of a program that contains a +# configuration script generated by Autoconf, you may include it under +# the same distribution terms that you use for the rest of that program. + +# Please send patches to <config-patches@gnu.org>. Submit a context +# diff and a properly formatted ChangeLog entry. +# +# Configuration subroutine to validate and canonicalize a configuration type. +# Supply the specified configuration type as an argument. +# If it is invalid, we print an error message on stderr and exit with code 1. +# Otherwise, we print the canonical config type on stdout and succeed. + +# This file is supposed to be the same for all GNU packages +# and recognize all the CPU types, system types and aliases +# that are meaningful with *any* GNU software. +# Each package is responsible for reporting which valid configurations +# it does not support. The user should be able to distinguish +# a failure to support a valid configuration from a meaningless +# configuration. + +# The goal of this file is to map all the various variations of a given +# machine specification into a single specification in the form: +# CPU_TYPE-MANUFACTURER-OPERATING_SYSTEM +# or in some cases, the newer four-part form: +# CPU_TYPE-MANUFACTURER-KERNEL-OPERATING_SYSTEM +# It is wrong to echo any other type of specification. + +me=`echo "$0" | sed -e 's,.*/,,'` + +usage="\ +Usage: $0 [OPTION] CPU-MFR-OPSYS + $0 [OPTION] ALIAS + +Canonicalize a configuration name. + +Operation modes: + -h, --help print this help, then exit + -t, --time-stamp print date of last modification, then exit + -v, --version print version number, then exit + +Report bugs and patches to <config-patches@gnu.org>." + +version="\ +GNU config.sub ($timestamp) + +Copyright (C) 1992, 1993, 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001 +Free Software Foundation, Inc. + +This is free software; see the source for copying conditions. There is NO +warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE." + +help=" +Try \`$me --help' for more information." + +# Parse command line +while test $# -gt 0 ; do + case $1 in + --time-stamp | --time* | -t ) + echo "$timestamp" ; exit 0 ;; + --version | -v ) + echo "$version" ; exit 0 ;; + --help | --h* | -h ) + echo "$usage"; exit 0 ;; + -- ) # Stop option processing + shift; break ;; + - ) # Use stdin as input. + break ;; + -* ) + echo "$me: invalid option $1$help" + exit 1 ;; + + *local*) + # First pass through any local machine types. + echo $1 + exit 0;; + + * ) + break ;; + esac +done + +case $# in + 0) echo "$me: missing argument$help" >&2 + exit 1;; + 1) ;; + *) echo "$me: too many arguments$help" >&2 + exit 1;; +esac + +# Separate what the user gave into CPU-COMPANY and OS or KERNEL-OS (if any). +# Here we must recognize all the valid KERNEL-OS combinations. +maybe_os=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\2/'` +case $maybe_os in + nto-qnx* | linux-gnu* | freebsd*-gnu* | netbsd*-gnu* | storm-chaos* | os2-emx* | rtmk-nova*) + os=-$maybe_os + basic_machine=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\1/'` + ;; + *) + basic_machine=`echo $1 | sed 's/-[^-]*$//'` + if [ $basic_machine != $1 ] + then os=`echo $1 | sed 's/.*-/-/'` + else os=; fi + ;; +esac + +### Let's recognize common machines as not being operating systems so +### that things like config.sub decstation-3100 work. We also +### recognize some manufacturers as not being operating systems, so we +### can provide default operating systems below. +case $os in + -sun*os*) + # Prevent following clause from handling this invalid input. + ;; + -dec* | -mips* | -sequent* | -encore* | -pc532* | -sgi* | -sony* | \ + -att* | -7300* | -3300* | -delta* | -motorola* | -sun[234]* | \ + -unicom* | -ibm* | -next | -hp | -isi* | -apollo | -altos* | \ + -convergent* | -ncr* | -news | -32* | -3600* | -3100* | -hitachi* |\ + -c[123]* | -convex* | -sun | -crds | -omron* | -dg | -ultra | -tti* | \ + -harris | -dolphin | -highlevel | -gould | -cbm | -ns | -masscomp | \ + -apple | -axis) + os= + basic_machine=$1 + ;; + -sim | -cisco | -oki | -wec | -winbond) + os= + basic_machine=$1 + ;; + -scout) + ;; + -wrs) + os=-vxworks + basic_machine=$1 + ;; + -chorusos*) + os=-chorusos + basic_machine=$1 + ;; + -chorusrdb) + os=-chorusrdb + basic_machine=$1 + ;; + -hiux*) + os=-hiuxwe2 + ;; + -sco5) + os=-sco3.2v5 + basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'` + ;; + -sco4) + os=-sco3.2v4 + basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'` + ;; + -sco3.2.[4-9]*) + os=`echo $os | sed -e 's/sco3.2./sco3.2v/'` + basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'` + ;; + -sco3.2v[4-9]*) + # Don't forget version if it is 3.2v4 or newer. + basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'` + ;; + -sco*) + os=-sco3.2v2 + basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'` + ;; + -udk*) + basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'` + ;; + -isc) + os=-isc2.2 + basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'` + ;; + -clix*) + basic_machine=clipper-intergraph + ;; + -isc*) + basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'` + ;; + -lynx*) + os=-lynxos + ;; + -ptx*) + basic_machine=`echo $1 | sed -e 's/86-.*/86-sequent/'` + ;; + -windowsnt*) + os=`echo $os | sed -e 's/windowsnt/winnt/'` + ;; + -psos*) + os=-psos + ;; + -mint | -mint[0-9]*) + basic_machine=m68k-atari + os=-mint + ;; +esac + +# Decode aliases for certain CPU-COMPANY combinations. +case $basic_machine in + # Recognize the basic CPU types without company name. + # Some are omitted here because they have special meanings below. + 1750a | 580 \ + | a29k \ + | alpha | alphaev[4-8] | alphaev56 | alphaev6[78] | alphapca5[67] \ + | alpha64 | alpha64ev[4-8] | alpha64ev56 | alpha64ev6[78] | alpha64pca5[67] \ + | arc | arm | arm[bl]e | arme[lb] | armv[2345] | armv[345][lb] | avr \ + | c4x | clipper \ + | d10v | d30v | dlx | dsp16xx \ + | fr30 | frv \ + | h8300 | h8500 | hppa | hppa1.[01] | hppa2.0 | hppa2.0[nw] | hppa64 \ + | i370 | i860 | i960 | ia64 \ + | ip2k \ + | m32r | m68000 | m68k | m88k | mcore \ + | mips | mipsbe | mipseb | mipsel | mipsle \ + | mips16 \ + | mips64 | mips64el \ + | mips64vr | mips64vrel \ + | mips64orion | mips64orionel \ + | mips64vr4100 | mips64vr4100el \ + | mips64vr4300 | mips64vr4300el \ + | mips64vr5000 | mips64vr5000el \ + | mipsisa32 | mipsisa32el \ + | mipsisa32r2 | mipsisa32r2el \ + | mipsisa64 | mipsisa64el \ + | mipsisa64sb1 | mipsisa64sb1el \ + | mipsisa64sr71k | mipsisa64sr71kel \ + | mipstx39 | mipstx39el \ + | mn10200 | mn10300 \ + | msp430 \ + | ns16k | ns32k \ + | openrisc | or32 \ + | pdp10 | pdp11 | pj | pjl \ + | powerpc | powerpc64 | powerpc64le | powerpcle | ppcbe \ + | pyramid \ + | s390 | s390x \ + | sh | sh[1234] | sh[23]e | sh[34]eb | shbe | shle | sh[1234]le | sh3ele \ + | sh64 | sh64le \ + | sparc | sparc64 | sparc86x | sparclet | sparclite | sparcv8 | sparcv9 | sparcv9b \ + | strongarm \ + | tahoe | thumb | tic4x | tic80 | tron \ + | v850 | v850e \ + | we32k \ + | x86 | xscale | xstormy16 | xtensa \ + | z8k) + basic_machine=$basic_machine-unknown + ;; + m6811 | m68hc11 | m6812 | m68hc12) + # Motorola 68HC11/12. + basic_machine=$basic_machine-unknown + os=-none + ;; + m88110 | m680[12346]0 | m683?2 | m68360 | m5200 | v70 | w65 | z8k) + ;; + + # We use `pc' rather than `unknown' + # because (1) that's what they normally are, and + # (2) the word "unknown" tends to confuse beginning users. + i*86 | x86_64) + basic_machine=$basic_machine-pc + ;; + # Object if more than one company name word. + *-*-*) + echo Invalid configuration \`$1\': machine \`$basic_machine\' not recognized 1>&2 + exit 1 + ;; + # Recognize the basic CPU types with company name. + 580-* \ + | a29k-* \ + | alpha-* | alphaev[4-8]-* | alphaev56-* | alphaev6[78]-* \ + | alpha64-* | alpha64ev[4-8]-* | alpha64ev56-* | alpha64ev6[78]-* \ + | alphapca5[67]-* | alpha64pca5[67]-* | arc-* \ + | arm-* | armbe-* | armle-* | armeb-* | armv*-* \ + | avr-* \ + | bs2000-* \ + | c[123]* | c30-* | [cjt]90-* | c4x-* | c54x-* | c55x-* | c6x-* \ + | clipper-* | cydra-* \ + | d10v-* | d30v-* | dlx-* \ + | elxsi-* \ + | f30[01]-* | f700-* | fr30-* | frv-* | fx80-* \ + | h8300-* | h8500-* \ + | hppa-* | hppa1.[01]-* | hppa2.0-* | hppa2.0[nw]-* | hppa64-* \ + | i*86-* | i860-* | i960-* | ia64-* \ + | ip2k-* \ + | m32r-* \ + | m68000-* | m680[012346]0-* | m68360-* | m683?2-* | m68k-* \ + | m88110-* | m88k-* | mcore-* \ + | mips-* | mipsbe-* | mipseb-* | mipsel-* | mipsle-* \ + | mips16-* \ + | mips64-* | mips64el-* \ + | mips64vr-* | mips64vrel-* \ + | mips64orion-* | mips64orionel-* \ + | mips64vr4100-* | mips64vr4100el-* \ + | mips64vr4300-* | mips64vr4300el-* \ + | mips64vr5000-* | mips64vr5000el-* \ + | mipsisa32-* | mipsisa32el-* \ + | mipsisa32r2-* | mipsisa32r2el-* \ + | mipsisa64-* | mipsisa64el-* \ + | mipsisa64sb1-* | mipsisa64sb1el-* \ + | mipsisa64sr71k-* | mipsisa64sr71kel-* \ + | mipstx39-* | mipstx39el-* \ + | msp430-* \ + | none-* | np1-* | nv1-* | ns16k-* | ns32k-* \ + | orion-* \ + | pdp10-* | pdp11-* | pj-* | pjl-* | pn-* | power-* \ + | powerpc-* | powerpc64-* | powerpc64le-* | powerpcle-* | ppcbe-* \ + | pyramid-* \ + | romp-* | rs6000-* \ + | s390-* | s390x-* \ + | sh-* | sh[1234]-* | sh[23]e-* | sh[34]eb-* | shbe-* \ + | shle-* | sh[1234]le-* | sh3ele-* | sh64-* | sh64le-* \ + | sparc-* | sparc64-* | sparc86x-* | sparclet-* | sparclite-* \ + | sparcv8-* | sparcv9-* | sparcv9b-* | strongarm-* | sv1-* | sx?-* \ + | tahoe-* | thumb-* \ + | tic30-* | tic4x-* | tic54x-* | tic55x-* | tic6x-* | tic80-* \ + | tron-* \ + | v850-* | v850e-* | vax-* \ + | we32k-* \ + | x86-* | x86_64-* | xps100-* | xscale-* | xstormy16-* \ + | xtensa-* \ + | ymp-* \ + | z8k-*) + ;; + # Recognize the various machine names and aliases which stand + # for a CPU type and a company and sometimes even an OS. + 386bsd) + basic_machine=i386-unknown + os=-bsd + ;; + 3b1 | 7300 | 7300-att | att-7300 | pc7300 | safari | unixpc) + basic_machine=m68000-att + ;; + 3b*) + basic_machine=we32k-att + ;; + a29khif) + basic_machine=a29k-amd + os=-udi + ;; + adobe68k) + basic_machine=m68010-adobe + os=-scout + ;; + alliant | fx80) + basic_machine=fx80-alliant + ;; + altos | altos3068) + basic_machine=m68k-altos + ;; + am29k) + basic_machine=a29k-none + os=-bsd + ;; + amd64) + basic_machine=x86_64-pc + ;; + amdahl) + basic_machine=580-amdahl + os=-sysv + ;; + amiga | amiga-*) + basic_machine=m68k-unknown + ;; + amigaos | amigados) + basic_machine=m68k-unknown + os=-amigaos + ;; + amigaunix | amix) + basic_machine=m68k-unknown + os=-sysv4 + ;; + apollo68) + basic_machine=m68k-apollo + os=-sysv + ;; + apollo68bsd) + basic_machine=m68k-apollo + os=-bsd + ;; + aux) + basic_machine=m68k-apple + os=-aux + ;; + balance) + basic_machine=ns32k-sequent + os=-dynix + ;; + c90) + basic_machine=c90-cray + os=-unicos + ;; + convex-c1) + basic_machine=c1-convex + os=-bsd + ;; + convex-c2) + basic_machine=c2-convex + os=-bsd + ;; + convex-c32) + basic_machine=c32-convex + os=-bsd + ;; + convex-c34) + basic_machine=c34-convex + os=-bsd + ;; + convex-c38) + basic_machine=c38-convex + os=-bsd + ;; + cray | j90) + basic_machine=j90-cray + os=-unicos + ;; + crds | unos) + basic_machine=m68k-crds + ;; + cris | cris-* | etrax*) + basic_machine=cris-axis + ;; + da30 | da30-*) + basic_machine=m68k-da30 + ;; + decstation | decstation-3100 | pmax | pmax-* | pmin | dec3100 | decstatn) + basic_machine=mips-dec + ;; + decsystem10* | dec10*) + basic_machine=pdp10-dec + os=-tops10 + ;; + decsystem20* | dec20*) + basic_machine=pdp10-dec + os=-tops20 + ;; + delta | 3300 | motorola-3300 | motorola-delta \ + | 3300-motorola | delta-motorola) + basic_machine=m68k-motorola + ;; + delta88) + basic_machine=m88k-motorola + os=-sysv3 + ;; + dpx20 | dpx20-*) + basic_machine=rs6000-bull + os=-bosx + ;; + dpx2* | dpx2*-bull) + basic_machine=m68k-bull + os=-sysv3 + ;; + ebmon29k) + basic_machine=a29k-amd + os=-ebmon + ;; + elxsi) + basic_machine=elxsi-elxsi + os=-bsd + ;; + encore | umax | mmax) + basic_machine=ns32k-encore + ;; + es1800 | OSE68k | ose68k | ose | OSE) + basic_machine=m68k-ericsson + os=-ose + ;; + fx2800) + basic_machine=i860-alliant + ;; + genix) + basic_machine=ns32k-ns + ;; + gmicro) + basic_machine=tron-gmicro + os=-sysv + ;; + go32) + basic_machine=i386-pc + os=-go32 + ;; + h3050r* | hiux*) + basic_machine=hppa1.1-hitachi + os=-hiuxwe2 + ;; + h8300hms) + basic_machine=h8300-hitachi + os=-hms + ;; + h8300xray) + basic_machine=h8300-hitachi + os=-xray + ;; + h8500hms) + basic_machine=h8500-hitachi + os=-hms + ;; + harris) + basic_machine=m88k-harris + os=-sysv3 + ;; + hp300-*) + basic_machine=m68k-hp + ;; + hp300bsd) + basic_machine=m68k-hp + os=-bsd + ;; + hp300hpux) + basic_machine=m68k-hp + os=-hpux + ;; + hp3k9[0-9][0-9] | hp9[0-9][0-9]) + basic_machine=hppa1.0-hp + ;; + hp9k2[0-9][0-9] | hp9k31[0-9]) + basic_machine=m68000-hp + ;; + hp9k3[2-9][0-9]) + basic_machine=m68k-hp + ;; + hp9k6[0-9][0-9] | hp6[0-9][0-9]) + basic_machine=hppa1.0-hp + ;; + hp9k7[0-79][0-9] | hp7[0-79][0-9]) + basic_machine=hppa1.1-hp + ;; + hp9k78[0-9] | hp78[0-9]) + # FIXME: really hppa2.0-hp + basic_machine=hppa1.1-hp + ;; + hp9k8[67]1 | hp8[67]1 | hp9k80[24] | hp80[24] | hp9k8[78]9 | hp8[78]9 | hp9k893 | hp893) + # FIXME: really hppa2.0-hp + basic_machine=hppa1.1-hp + ;; + hp9k8[0-9][13679] | hp8[0-9][13679]) + basic_machine=hppa1.1-hp + ;; + hp9k8[0-9][0-9] | hp8[0-9][0-9]) + basic_machine=hppa1.0-hp + ;; + hppa-next) + os=-nextstep3 + ;; + hppaosf) + basic_machine=hppa1.1-hp + os=-osf + ;; + hppro) + basic_machine=hppa1.1-hp + os=-proelf + ;; + i370-ibm* | ibm*) + basic_machine=i370-ibm + ;; +# I'm not sure what "Sysv32" means. Should this be sysv3.2? + i*86v32) + basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'` + os=-sysv32 + ;; + i*86v4*) + basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'` + os=-sysv4 + ;; + i*86v) + basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'` + os=-sysv + ;; + i*86sol2) + basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'` + os=-solaris2 + ;; + i386mach) + basic_machine=i386-mach + os=-mach + ;; + i386-vsta | vsta) + basic_machine=i386-unknown + os=-vsta + ;; + iris | iris4d) + basic_machine=mips-sgi + case $os in + -irix*) + ;; + *) + os=-irix4 + ;; + esac + ;; + isi68 | isi) + basic_machine=m68k-isi + os=-sysv + ;; + m88k-omron*) + basic_machine=m88k-omron + ;; + magnum | m3230) + basic_machine=mips-mips + os=-sysv + ;; + merlin) + basic_machine=ns32k-utek + os=-sysv + ;; + mingw32) + basic_machine=i386-pc + os=-mingw32 + ;; + miniframe) + basic_machine=m68000-convergent + ;; + *mint | -mint[0-9]* | *MiNT | *MiNT[0-9]*) + basic_machine=m68k-atari + os=-mint + ;; + mips3*-*) + basic_machine=`echo $basic_machine | sed -e 's/mips3/mips64/'` + ;; + mips3*) + basic_machine=`echo $basic_machine | sed -e 's/mips3/mips64/'`-unknown + ;; + mmix*) + basic_machine=mmix-knuth + os=-mmixware + ;; + monitor) + basic_machine=m68k-rom68k + os=-coff + ;; + morphos) + basic_machine=powerpc-unknown + os=-morphos + ;; + msdos) + basic_machine=i386-pc + os=-msdos + ;; + mvs) + basic_machine=i370-ibm + os=-mvs + ;; + ncr3000) + basic_machine=i486-ncr + os=-sysv4 + ;; + netbsd386) + basic_machine=i386-unknown + os=-netbsd + ;; + netwinder) + basic_machine=armv4l-rebel + os=-linux + ;; + news | news700 | news800 | news900) + basic_machine=m68k-sony + os=-newsos + ;; + news1000) + basic_machine=m68030-sony + os=-newsos + ;; + news-3600 | risc-news) + basic_machine=mips-sony + os=-newsos + ;; + necv70) + basic_machine=v70-nec + os=-sysv + ;; + next | m*-next ) + basic_machine=m68k-next + case $os in + -nextstep* ) + ;; + -ns2*) + os=-nextstep2 + ;; + *) + os=-nextstep3 + ;; + esac + ;; + nh3000) + basic_machine=m68k-harris + os=-cxux + ;; + nh[45]000) + basic_machine=m88k-harris + os=-cxux + ;; + nindy960) + basic_machine=i960-intel + os=-nindy + ;; + mon960) + basic_machine=i960-intel + os=-mon960 + ;; + nonstopux) + basic_machine=mips-compaq + os=-nonstopux + ;; + np1) + basic_machine=np1-gould + ;; + nv1) + basic_machine=nv1-cray + os=-unicosmp + ;; + nsr-tandem) + basic_machine=nsr-tandem + ;; + op50n-* | op60c-*) + basic_machine=hppa1.1-oki + os=-proelf + ;; + or32 | or32-*) + basic_machine=or32-unknown + os=-coff + ;; + OSE68000 | ose68000) + basic_machine=m68000-ericsson + os=-ose + ;; + os68k) + basic_machine=m68k-none + os=-os68k + ;; + pa-hitachi) + basic_machine=hppa1.1-hitachi + os=-hiuxwe2 + ;; + paragon) + basic_machine=i860-intel + os=-osf + ;; + pbd) + basic_machine=sparc-tti + ;; + pbb) + basic_machine=m68k-tti + ;; + pc532 | pc532-*) + basic_machine=ns32k-pc532 + ;; + pentium | p5 | k5 | k6 | nexgen | viac3) + basic_machine=i586-pc + ;; + pentiumpro | p6 | 6x86 | athlon | athlon_*) + basic_machine=i686-pc + ;; + pentiumii | pentium2 | pentiumiii | pentium3) + basic_machine=i686-pc + ;; + pentium4) + basic_machine=i786-pc + ;; + pentium-* | p5-* | k5-* | k6-* | nexgen-* | viac3-*) + basic_machine=i586-`echo $basic_machine | sed 's/^[^-]*-//'` + ;; + pentiumpro-* | p6-* | 6x86-* | athlon-*) + basic_machine=i686-`echo $basic_machine | sed 's/^[^-]*-//'` + ;; + pentiumii-* | pentium2-* | pentiumiii-* | pentium3-*) + basic_machine=i686-`echo $basic_machine | sed 's/^[^-]*-//'` + ;; + pentium4-*) + basic_machine=i786-`echo $basic_machine | sed 's/^[^-]*-//'` + ;; + pn) + basic_machine=pn-gould + ;; + power) basic_machine=power-ibm + ;; + ppc) basic_machine=powerpc-unknown + ;; + ppc-*) basic_machine=powerpc-`echo $basic_machine | sed 's/^[^-]*-//'` + ;; + ppcle | powerpclittle | ppc-le | powerpc-little) + basic_machine=powerpcle-unknown + ;; + ppcle-* | powerpclittle-*) + basic_machine=powerpcle-`echo $basic_machine | sed 's/^[^-]*-//'` + ;; + ppc64) basic_machine=powerpc64-unknown + ;; + ppc64-*) basic_machine=powerpc64-`echo $basic_machine | sed 's/^[^-]*-//'` + ;; + ppc64le | powerpc64little | ppc64-le | powerpc64-little) + basic_machine=powerpc64le-unknown + ;; + ppc64le-* | powerpc64little-*) + basic_machine=powerpc64le-`echo $basic_machine | sed 's/^[^-]*-//'` + ;; + ps2) + basic_machine=i386-ibm + ;; + pw32) + basic_machine=i586-unknown + os=-pw32 + ;; + rom68k) + basic_machine=m68k-rom68k + os=-coff + ;; + rm[46]00) + basic_machine=mips-siemens + ;; + rtpc | rtpc-*) + basic_machine=romp-ibm + ;; + sa29200) + basic_machine=a29k-amd + os=-udi + ;; + sb1) + basic_machine=mipsisa64sb1-unknown + ;; + sb1el) + basic_machine=mipsisa64sb1el-unknown + ;; + sei) + basic_machine=mips-sei + os=-seiux + ;; + sequent) + basic_machine=i386-sequent + ;; + sh) + basic_machine=sh-hitachi + os=-hms + ;; + sh64) + basic_machine=sh64-unknown + ;; + sparclite-wrs | simso-wrs) + basic_machine=sparclite-wrs + os=-vxworks + ;; + sps7) + basic_machine=m68k-bull + os=-sysv2 + ;; + spur) + basic_machine=spur-unknown + ;; + st2000) + basic_machine=m68k-tandem + ;; + stratus) + basic_machine=i860-stratus + os=-sysv4 + ;; + sun2) + basic_machine=m68000-sun + ;; + sun2os3) + basic_machine=m68000-sun + os=-sunos3 + ;; + sun2os4) + basic_machine=m68000-sun + os=-sunos4 + ;; + sun3os3) + basic_machine=m68k-sun + os=-sunos3 + ;; + sun3os4) + basic_machine=m68k-sun + os=-sunos4 + ;; + sun4os3) + basic_machine=sparc-sun + os=-sunos3 + ;; + sun4os4) + basic_machine=sparc-sun + os=-sunos4 + ;; + sun4sol2) + basic_machine=sparc-sun + os=-solaris2 + ;; + sun3 | sun3-*) + basic_machine=m68k-sun + ;; + sun4) + basic_machine=sparc-sun + ;; + sun386 | sun386i | roadrunner) + basic_machine=i386-sun + ;; + sv1) + basic_machine=sv1-cray + os=-unicos + ;; + symmetry) + basic_machine=i386-sequent + os=-dynix + ;; + t3e) + basic_machine=alphaev5-cray + os=-unicos + ;; + t90) + basic_machine=t90-cray + os=-unicos + ;; + tic54x | c54x*) + basic_machine=tic54x-unknown + os=-coff + ;; + tic55x | c55x*) + basic_machine=tic55x-unknown + os=-coff + ;; + tic6x | c6x*) + basic_machine=tic6x-unknown + os=-coff + ;; + tx39) + basic_machine=mipstx39-unknown + ;; + tx39el) + basic_machine=mipstx39el-unknown + ;; + toad1) + basic_machine=pdp10-xkl + os=-tops20 + ;; + tower | tower-32) + basic_machine=m68k-ncr + ;; + udi29k) + basic_machine=a29k-amd + os=-udi + ;; + ultra3) + basic_machine=a29k-nyu + os=-sym1 + ;; + v810 | necv810) + basic_machine=v810-nec + os=-none + ;; + vaxv) + basic_machine=vax-dec + os=-sysv + ;; + vms) + basic_machine=vax-dec + os=-vms + ;; + vpp*|vx|vx-*) + basic_machine=f301-fujitsu + ;; + vxworks960) + basic_machine=i960-wrs + os=-vxworks + ;; + vxworks68) + basic_machine=m68k-wrs + os=-vxworks + ;; + vxworks29k) + basic_machine=a29k-wrs + os=-vxworks + ;; + w65*) + basic_machine=w65-wdc + os=-none + ;; + w89k-*) + basic_machine=hppa1.1-winbond + os=-proelf + ;; + xps | xps100) + basic_machine=xps100-honeywell + ;; + ymp) + basic_machine=ymp-cray + os=-unicos + ;; + z8k-*-coff) + basic_machine=z8k-unknown + os=-sim + ;; + none) + basic_machine=none-none + os=-none + ;; + +# Here we handle the default manufacturer of certain CPU types. It is in +# some cases the only manufacturer, in others, it is the most popular. + w89k) + basic_machine=hppa1.1-winbond + ;; + op50n) + basic_machine=hppa1.1-oki + ;; + op60c) + basic_machine=hppa1.1-oki + ;; + romp) + basic_machine=romp-ibm + ;; + rs6000) + basic_machine=rs6000-ibm + ;; + vax) + basic_machine=vax-dec + ;; + pdp10) + # there are many clones, so DEC is not a safe bet + basic_machine=pdp10-unknown + ;; + pdp11) + basic_machine=pdp11-dec + ;; + we32k) + basic_machine=we32k-att + ;; + sh3 | sh4 | sh[34]eb | sh[1234]le | sh[23]ele) + basic_machine=sh-unknown + ;; + sh64) + basic_machine=sh64-unknown + ;; + sparc | sparcv8 | sparcv9 | sparcv9b) + basic_machine=sparc-sun + ;; + cydra) + basic_machine=cydra-cydrome + ;; + orion) + basic_machine=orion-highlevel + ;; + orion105) + basic_machine=clipper-highlevel + ;; + mac | mpw | mac-mpw) + basic_machine=m68k-apple + ;; + pmac | pmac-mpw) + basic_machine=powerpc-apple + ;; + *-unknown) + # Make sure to match an already-canonicalized machine name. + ;; + *) + echo Invalid configuration \`$1\': machine \`$basic_machine\' not recognized 1>&2 + exit 1 + ;; +esac + +# Here we canonicalize certain aliases for manufacturers. +case $basic_machine in + *-digital*) + basic_machine=`echo $basic_machine | sed 's/digital.*/dec/'` + ;; + *-commodore*) + basic_machine=`echo $basic_machine | sed 's/commodore.*/cbm/'` + ;; + *) + ;; +esac + +# Decode manufacturer-specific aliases for certain operating systems. + +if [ x"$os" != x"" ] +then +case $os in + # First match some system type aliases + # that might get confused with valid system types. + # -solaris* is a basic system type, with this one exception. + -solaris1 | -solaris1.*) + os=`echo $os | sed -e 's|solaris1|sunos4|'` + ;; + -solaris) + os=-solaris2 + ;; + -svr4*) + os=-sysv4 + ;; + -unixware*) + os=-sysv4.2uw + ;; + -gnu/linux*) + os=`echo $os | sed -e 's|gnu/linux|linux-gnu|'` + ;; + # First accept the basic system types. + # The portable systems comes first. + # Each alternative MUST END IN A *, to match a version number. + # -sysv* is not here because it comes later, after sysvr4. + -gnu* | -bsd* | -mach* | -minix* | -genix* | -ultrix* | -irix* \ + | -*vms* | -sco* | -esix* | -isc* | -aix* | -sunos | -sunos[34]*\ + | -hpux* | -unos* | -osf* | -luna* | -dgux* | -solaris* | -sym* \ + | -amigaos* | -amigados* | -msdos* | -newsos* | -unicos* | -aof* \ + | -aos* \ + | -nindy* | -vxsim* | -vxworks* | -ebmon* | -hms* | -mvs* \ + | -clix* | -riscos* | -uniplus* | -iris* | -rtu* | -xenix* \ + | -hiux* | -386bsd* | -netbsd* | -openbsd* | -freebsd* | -riscix* \ + | -lynxos* | -bosx* | -nextstep* | -cxux* | -aout* | -elf* | -oabi* \ + | -ptx* | -coff* | -ecoff* | -winnt* | -domain* | -vsta* \ + | -udi* | -eabi* | -lites* | -ieee* | -go32* | -aux* \ + | -chorusos* | -chorusrdb* \ + | -cygwin* | -pe* | -psos* | -moss* | -proelf* | -rtems* \ + | -mingw32* | -linux-gnu* | -uxpv* | -beos* | -mpeix* | -udk* \ + | -interix* | -uwin* | -mks* | -rhapsody* | -darwin* | -opened* \ + | -openstep* | -oskit* | -conix* | -pw32* | -nonstopux* \ + | -storm-chaos* | -tops10* | -tenex* | -tops20* | -its* \ + | -os2* | -vos* | -palmos* | -uclinux* | -nucleus* \ + | -morphos* | -superux* | -rtmk* | -rtmk-nova* | -windiss* \ + | -powermax* | -dnix* | -nx6 | -nx7 | -sei*) + # Remember, each alternative MUST END IN *, to match a version number. + ;; + -qnx*) + case $basic_machine in + x86-* | i*86-*) + ;; + *) + os=-nto$os + ;; + esac + ;; + -nto-qnx*) + ;; + -nto*) + os=`echo $os | sed -e 's|nto|nto-qnx|'` + ;; + -sim | -es1800* | -hms* | -xray | -os68k* | -none* | -v88r* \ + | -windows* | -osx | -abug | -netware* | -os9* | -beos* \ + | -macos* | -mpw* | -magic* | -mmixware* | -mon960* | -lnews*) + ;; + -mac*) + os=`echo $os | sed -e 's|mac|macos|'` + ;; + -linux*) + os=`echo $os | sed -e 's|linux|linux-gnu|'` + ;; + -sunos5*) + os=`echo $os | sed -e 's|sunos5|solaris2|'` + ;; + -sunos6*) + os=`echo $os | sed -e 's|sunos6|solaris3|'` + ;; + -opened*) + os=-openedition + ;; + -wince*) + os=-wince + ;; + -osfrose*) + os=-osfrose + ;; + -osf*) + os=-osf + ;; + -utek*) + os=-bsd + ;; + -dynix*) + os=-bsd + ;; + -acis*) + os=-aos + ;; + -atheos*) + os=-atheos + ;; + -386bsd) + os=-bsd + ;; + -ctix* | -uts*) + os=-sysv + ;; + -nova*) + os=-rtmk-nova + ;; + -ns2 ) + os=-nextstep2 + ;; + -nsk*) + os=-nsk + ;; + # Preserve the version number of sinix5. + -sinix5.*) + os=`echo $os | sed -e 's|sinix|sysv|'` + ;; + -sinix*) + os=-sysv4 + ;; + -triton*) + os=-sysv3 + ;; + -oss*) + os=-sysv3 + ;; + -svr4) + os=-sysv4 + ;; + -svr3) + os=-sysv3 + ;; + -sysvr4) + os=-sysv4 + ;; + # This must come after -sysvr4. + -sysv*) + ;; + -ose*) + os=-ose + ;; + -es1800*) + os=-ose + ;; + -xenix) + os=-xenix + ;; + -*mint | -mint[0-9]* | -*MiNT | -MiNT[0-9]*) + os=-mint + ;; + -aros*) + os=-aros + ;; + -kaos*) + os=-kaos + ;; + -none) + ;; + *) + # Get rid of the `-' at the beginning of $os. + os=`echo $os | sed 's/[^-]*-//'` + echo Invalid configuration \`$1\': system \`$os\' not recognized 1>&2 + exit 1 + ;; +esac +else + +# Here we handle the default operating systems that come with various machines. +# The value should be what the vendor currently ships out the door with their +# machine or put another way, the most popular os provided with the machine. + +# Note that if you're going to try to match "-MANUFACTURER" here (say, +# "-sun"), then you have to tell the case statement up towards the top +# that MANUFACTURER isn't an operating system. Otherwise, code above +# will signal an error saying that MANUFACTURER isn't an operating +# system, and we'll never get to this point. + +case $basic_machine in + *-acorn) + os=-riscix1.2 + ;; + arm*-rebel) + os=-linux + ;; + arm*-semi) + os=-aout + ;; + c4x-* | tic4x-*) + os=-coff + ;; + # This must come before the *-dec entry. + pdp10-*) + os=-tops20 + ;; + pdp11-*) + os=-none + ;; + *-dec | vax-*) + os=-ultrix4.2 + ;; + m68*-apollo) + os=-domain + ;; + i386-sun) + os=-sunos4.0.2 + ;; + m68000-sun) + os=-sunos3 + # This also exists in the configure program, but was not the + # default. + # os=-sunos4 + ;; + m68*-cisco) + os=-aout + ;; + mips*-cisco) + os=-elf + ;; + mips*-*) + os=-elf + ;; + or32-*) + os=-coff + ;; + *-tti) # must be before sparc entry or we get the wrong os. + os=-sysv3 + ;; + sparc-* | *-sun) + os=-sunos4.1.1 + ;; + *-be) + os=-beos + ;; + *-ibm) + os=-aix + ;; + *-wec) + os=-proelf + ;; + *-winbond) + os=-proelf + ;; + *-oki) + os=-proelf + ;; + *-hp) + os=-hpux + ;; + *-hitachi) + os=-hiux + ;; + i860-* | *-att | *-ncr | *-altos | *-motorola | *-convergent) + os=-sysv + ;; + *-cbm) + os=-amigaos + ;; + *-dg) + os=-dgux + ;; + *-dolphin) + os=-sysv3 + ;; + m68k-ccur) + os=-rtu + ;; + m88k-omron*) + os=-luna + ;; + *-next ) + os=-nextstep + ;; + *-sequent) + os=-ptx + ;; + *-crds) + os=-unos + ;; + *-ns) + os=-genix + ;; + i370-*) + os=-mvs + ;; + *-next) + os=-nextstep3 + ;; + *-gould) + os=-sysv + ;; + *-highlevel) + os=-bsd + ;; + *-encore) + os=-bsd + ;; + *-sgi) + os=-irix + ;; + *-siemens) + os=-sysv4 + ;; + *-masscomp) + os=-rtu + ;; + f30[01]-fujitsu | f700-fujitsu) + os=-uxpv + ;; + *-rom68k) + os=-coff + ;; + *-*bug) + os=-coff + ;; + *-apple) + os=-macos + ;; + *-atari*) + os=-mint + ;; + *) + os=-none + ;; +esac +fi + +# Here we handle the case where we know the os, and the CPU type, but not the +# manufacturer. We pick the logical manufacturer. +vendor=unknown +case $basic_machine in + *-unknown) + case $os in + -riscix*) + vendor=acorn + ;; + -sunos*) + vendor=sun + ;; + -aix*) + vendor=ibm + ;; + -beos*) + vendor=be + ;; + -hpux*) + vendor=hp + ;; + -mpeix*) + vendor=hp + ;; + -hiux*) + vendor=hitachi + ;; + -unos*) + vendor=crds + ;; + -dgux*) + vendor=dg + ;; + -luna*) + vendor=omron + ;; + -genix*) + vendor=ns + ;; + -mvs* | -opened*) + vendor=ibm + ;; + -ptx*) + vendor=sequent + ;; + -vxsim* | -vxworks* | -windiss*) + vendor=wrs + ;; + -aux*) + vendor=apple + ;; + -hms*) + vendor=hitachi + ;; + -mpw* | -macos*) + vendor=apple + ;; + -*mint | -mint[0-9]* | -*MiNT | -MiNT[0-9]*) + vendor=atari + ;; + -vos*) + vendor=stratus + ;; + esac + basic_machine=`echo $basic_machine | sed "s/unknown/$vendor/"` + ;; +esac + +echo $basic_machine$os +exit 0 + +# Local variables: +# eval: (add-hook 'write-file-hooks 'time-stamp) +# time-stamp-start: "timestamp='" +# time-stamp-format: "%:y-%02m-%02d" +# time-stamp-end: "'" +# End: diff --git a/driver/xf86-input-mouse/configure b/driver/xf86-input-mouse/configure new file mode 100644 index 000000000..db629882d --- /dev/null +++ b/driver/xf86-input-mouse/configure @@ -0,0 +1,21799 @@ +#! /bin/sh +# Guess values for system-dependent variables and create Makefiles. +# Generated by GNU Autoconf 2.59 for xf86-input-mouse 1.1.2. +# +# Report bugs to <https://bugs.freedesktop.org/enter_bug.cgi?product=xorg>. +# +# Copyright (C) 2003 Free Software Foundation, Inc. +# This configure script is free software; the Free Software Foundation +# gives unlimited permission to copy, distribute and modify it. +## --------------------- ## +## M4sh Initialization. ## +## --------------------- ## + +# Be Bourne compatible +if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then + emulate sh + NULLCMD=: + # Zsh 3.x and 4.x performs word splitting on ${1+"$@"}, which + # is contrary to our usage. Disable this feature. + alias -g '${1+"$@"}'='"$@"' +elif test -n "${BASH_VERSION+set}" && (set -o posix) >/dev/null 2>&1; then + set -o posix +fi +DUALCASE=1; export DUALCASE # for MKS sh + +# Support unset when possible. +if ( (MAIL=60; unset MAIL) || exit) >/dev/null 2>&1; then + as_unset=unset +else + as_unset=false +fi + + +# Work around bugs in pre-3.0 UWIN ksh. +$as_unset ENV MAIL MAILPATH +PS1='$ ' +PS2='> ' +PS4='+ ' + +# NLS nuisances. +for as_var in \ + LANG LANGUAGE LC_ADDRESS LC_ALL LC_COLLATE LC_CTYPE LC_IDENTIFICATION \ + LC_MEASUREMENT LC_MESSAGES LC_MONETARY LC_NAME LC_NUMERIC LC_PAPER \ + LC_TELEPHONE LC_TIME +do + if (set +x; test -z "`(eval $as_var=C; export $as_var) 2>&1`"); then + eval $as_var=C; export $as_var + else + $as_unset $as_var + fi +done + +# Required to use basename. +if expr a : '\(a\)' >/dev/null 2>&1; then + as_expr=expr +else + as_expr=false +fi + +if (basename /) >/dev/null 2>&1 && test "X`basename / 2>&1`" = "X/"; then + as_basename=basename +else + as_basename=false +fi + + +# Name of the executable. +as_me=`$as_basename "$0" || +$as_expr X/"$0" : '.*/\([^/][^/]*\)/*$' \| \ + X"$0" : 'X\(//\)$' \| \ + X"$0" : 'X\(/\)$' \| \ + . : '\(.\)' 2>/dev/null || +echo X/"$0" | + sed '/^.*\/\([^/][^/]*\)\/*$/{ s//\1/; q; } + /^X\/\(\/\/\)$/{ s//\1/; q; } + /^X\/\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + + +# PATH needs CR, and LINENO needs CR and PATH. +# Avoid depending upon Character Ranges. +as_cr_letters='abcdefghijklmnopqrstuvwxyz' +as_cr_LETTERS='ABCDEFGHIJKLMNOPQRSTUVWXYZ' +as_cr_Letters=$as_cr_letters$as_cr_LETTERS +as_cr_digits='0123456789' +as_cr_alnum=$as_cr_Letters$as_cr_digits + +# The user is always right. +if test "${PATH_SEPARATOR+set}" != set; then + echo "#! /bin/sh" >conf$$.sh + echo "exit 0" >>conf$$.sh + chmod +x conf$$.sh + if (PATH="/nonexistent;."; conf$$.sh) >/dev/null 2>&1; then + PATH_SEPARATOR=';' + else + PATH_SEPARATOR=: + fi + rm -f conf$$.sh +fi + + + as_lineno_1=$LINENO + as_lineno_2=$LINENO + as_lineno_3=`(expr $as_lineno_1 + 1) 2>/dev/null` + test "x$as_lineno_1" != "x$as_lineno_2" && + test "x$as_lineno_3" = "x$as_lineno_2" || { + # Find who we are. Look in the path if we contain no path at all + # relative or not. + case $0 in + *[\\/]* ) as_myself=$0 ;; + *) as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + test -r "$as_dir/$0" && as_myself=$as_dir/$0 && break +done + + ;; + esac + # We did not find ourselves, most probably we were run as `sh COMMAND' + # in which case we are not to be found in the path. + if test "x$as_myself" = x; then + as_myself=$0 + fi + if test ! -f "$as_myself"; then + { echo "$as_me: error: cannot find myself; rerun with an absolute path" >&2 + { (exit 1); exit 1; }; } + fi + case $CONFIG_SHELL in + '') + as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in /bin$PATH_SEPARATOR/usr/bin$PATH_SEPARATOR$PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for as_base in sh bash ksh sh5; do + case $as_dir in + /*) + if ("$as_dir/$as_base" -c ' + as_lineno_1=$LINENO + as_lineno_2=$LINENO + as_lineno_3=`(expr $as_lineno_1 + 1) 2>/dev/null` + test "x$as_lineno_1" != "x$as_lineno_2" && + test "x$as_lineno_3" = "x$as_lineno_2" ') 2>/dev/null; then + $as_unset BASH_ENV || test "${BASH_ENV+set}" != set || { BASH_ENV=; export BASH_ENV; } + $as_unset ENV || test "${ENV+set}" != set || { ENV=; export ENV; } + CONFIG_SHELL=$as_dir/$as_base + export CONFIG_SHELL + exec "$CONFIG_SHELL" "$0" ${1+"$@"} + fi;; + esac + done +done +;; + esac + + # Create $as_me.lineno as a copy of $as_myself, but with $LINENO + # uniformly replaced by the line number. The first 'sed' inserts a + # line-number line before each line; the second 'sed' does the real + # work. The second script uses 'N' to pair each line-number line + # with the numbered line, and appends trailing '-' during + # substitution so that $LINENO is not a special case at line end. + # (Raja R Harinath suggested sed '=', and Paul Eggert wrote the + # second 'sed' script. Blame Lee E. McMahon for sed's syntax. :-) + sed '=' <$as_myself | + sed ' + N + s,$,-, + : loop + s,^\(['$as_cr_digits']*\)\(.*\)[$]LINENO\([^'$as_cr_alnum'_]\),\1\2\1\3, + t loop + s,-$,, + s,^['$as_cr_digits']*\n,, + ' >$as_me.lineno && + chmod +x $as_me.lineno || + { echo "$as_me: error: cannot create $as_me.lineno; rerun with a POSIX shell" >&2 + { (exit 1); exit 1; }; } + + # Don't try to exec as it changes $[0], causing all sort of problems + # (the dirname of $[0] is not the place where we might find the + # original and so on. Autoconf is especially sensible to this). + . ./$as_me.lineno + # Exit status is that of the last command. + exit +} + + +case `echo "testing\c"; echo 1,2,3`,`echo -n testing; echo 1,2,3` in + *c*,-n*) ECHO_N= ECHO_C=' +' ECHO_T=' ' ;; + *c*,* ) ECHO_N=-n ECHO_C= ECHO_T= ;; + *) ECHO_N= ECHO_C='\c' ECHO_T= ;; +esac + +if expr a : '\(a\)' >/dev/null 2>&1; then + as_expr=expr +else + as_expr=false +fi + +rm -f conf$$ conf$$.exe conf$$.file +echo >conf$$.file +if ln -s conf$$.file conf$$ 2>/dev/null; then + # We could just check for DJGPP; but this test a) works b) is more generic + # and c) will remain valid once DJGPP supports symlinks (DJGPP 2.04). + if test -f conf$$.exe; then + # Don't use ln at all; we don't have any links + as_ln_s='cp -p' + else + as_ln_s='ln -s' + fi +elif ln conf$$.file conf$$ 2>/dev/null; then + as_ln_s=ln +else + as_ln_s='cp -p' +fi +rm -f conf$$ conf$$.exe conf$$.file + +if mkdir -p . 2>/dev/null; then + as_mkdir_p=: +else + test -d ./-p && rmdir ./-p + as_mkdir_p=false +fi + +as_executable_p="test -f" + +# Sed expression to map a string onto a valid CPP name. +as_tr_cpp="eval sed 'y%*$as_cr_letters%P$as_cr_LETTERS%;s%[^_$as_cr_alnum]%_%g'" + +# Sed expression to map a string onto a valid variable name. +as_tr_sh="eval sed 'y%*+%pp%;s%[^_$as_cr_alnum]%_%g'" + + +# IFS +# We need space, tab and new line, in precisely that order. +as_nl=' +' +IFS=" $as_nl" + +# CDPATH. +$as_unset CDPATH + + + +# Check that we are running under the correct shell. +SHELL=${CONFIG_SHELL-/bin/sh} + +case X$ECHO in +X*--fallback-echo) + # Remove one level of quotation (which was required for Make). + ECHO=`echo "$ECHO" | sed 's,\\\\\$\\$0,'$0','` + ;; +esac + +echo=${ECHO-echo} +if test "X$1" = X--no-reexec; then + # Discard the --no-reexec flag, and continue. + shift +elif test "X$1" = X--fallback-echo; then + # Avoid inline document here, it may be left over + : +elif test "X`($echo '\t') 2>/dev/null`" = 'X\t' ; then + # Yippee, $echo works! + : +else + # Restart under the correct shell. + exec $SHELL "$0" --no-reexec ${1+"$@"} +fi + +if test "X$1" = X--fallback-echo; then + # used as fallback echo + shift + cat <<EOF +$* +EOF + exit 0 +fi + +# The HP-UX ksh and POSIX shell print the target directory to stdout +# if CDPATH is set. +(unset CDPATH) >/dev/null 2>&1 && unset CDPATH + +if test -z "$ECHO"; then +if test "X${echo_test_string+set}" != Xset; then +# find a string as large as possible, as long as the shell can cope with it + for cmd in 'sed 50q "$0"' 'sed 20q "$0"' 'sed 10q "$0"' 'sed 2q "$0"' 'echo test'; do + # expected sizes: less than 2Kb, 1Kb, 512 bytes, 16 bytes, ... + if (echo_test_string=`eval $cmd`) 2>/dev/null && + echo_test_string=`eval $cmd` && + (test "X$echo_test_string" = "X$echo_test_string") 2>/dev/null + then + break + fi + done +fi + +if test "X`($echo '\t') 2>/dev/null`" = 'X\t' && + echo_testing_string=`($echo "$echo_test_string") 2>/dev/null` && + test "X$echo_testing_string" = "X$echo_test_string"; then + : +else + # The Solaris, AIX, and Digital Unix default echo programs unquote + # backslashes. This makes it impossible to quote backslashes using + # echo "$something" | sed 's/\\/\\\\/g' + # + # So, first we look for a working echo in the user's PATH. + + lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR + for dir in $PATH /usr/ucb; do + IFS="$lt_save_ifs" + if (test -f $dir/echo || test -f $dir/echo$ac_exeext) && + test "X`($dir/echo '\t') 2>/dev/null`" = 'X\t' && + echo_testing_string=`($dir/echo "$echo_test_string") 2>/dev/null` && + test "X$echo_testing_string" = "X$echo_test_string"; then + echo="$dir/echo" + break + fi + done + IFS="$lt_save_ifs" + + if test "X$echo" = Xecho; then + # We didn't find a better echo, so look for alternatives. + if test "X`(print -r '\t') 2>/dev/null`" = 'X\t' && + echo_testing_string=`(print -r "$echo_test_string") 2>/dev/null` && + test "X$echo_testing_string" = "X$echo_test_string"; then + # This shell has a builtin print -r that does the trick. + echo='print -r' + elif (test -f /bin/ksh || test -f /bin/ksh$ac_exeext) && + test "X$CONFIG_SHELL" != X/bin/ksh; then + # If we have ksh, try running configure again with it. + ORIGINAL_CONFIG_SHELL=${CONFIG_SHELL-/bin/sh} + export ORIGINAL_CONFIG_SHELL + CONFIG_SHELL=/bin/ksh + export CONFIG_SHELL + exec $CONFIG_SHELL "$0" --no-reexec ${1+"$@"} + else + # Try using printf. + echo='printf %s\n' + if test "X`($echo '\t') 2>/dev/null`" = 'X\t' && + echo_testing_string=`($echo "$echo_test_string") 2>/dev/null` && + test "X$echo_testing_string" = "X$echo_test_string"; then + # Cool, printf works + : + elif echo_testing_string=`($ORIGINAL_CONFIG_SHELL "$0" --fallback-echo '\t') 2>/dev/null` && + test "X$echo_testing_string" = 'X\t' && + echo_testing_string=`($ORIGINAL_CONFIG_SHELL "$0" --fallback-echo "$echo_test_string") 2>/dev/null` && + test "X$echo_testing_string" = "X$echo_test_string"; then + CONFIG_SHELL=$ORIGINAL_CONFIG_SHELL + export CONFIG_SHELL + SHELL="$CONFIG_SHELL" + export SHELL + echo="$CONFIG_SHELL $0 --fallback-echo" + elif echo_testing_string=`($CONFIG_SHELL "$0" --fallback-echo '\t') 2>/dev/null` && + test "X$echo_testing_string" = 'X\t' && + echo_testing_string=`($CONFIG_SHELL "$0" --fallback-echo "$echo_test_string") 2>/dev/null` && + test "X$echo_testing_string" = "X$echo_test_string"; then + echo="$CONFIG_SHELL $0 --fallback-echo" + else + # maybe with a smaller string... + prev=: + + for cmd in 'echo test' 'sed 2q "$0"' 'sed 10q "$0"' 'sed 20q "$0"' 'sed 50q "$0"'; do + if (test "X$echo_test_string" = "X`eval $cmd`") 2>/dev/null + then + break + fi + prev="$cmd" + done + + if test "$prev" != 'sed 50q "$0"'; then + echo_test_string=`eval $prev` + export echo_test_string + exec ${ORIGINAL_CONFIG_SHELL-${CONFIG_SHELL-/bin/sh}} "$0" ${1+"$@"} + else + # Oops. We lost completely, so just stick with echo. + echo=echo + fi + fi + fi + fi +fi +fi + +# Copy echo and quote the copy suitably for passing to libtool from +# the Makefile, instead of quoting the original, which is used later. +ECHO=$echo +if test "X$ECHO" = "X$CONFIG_SHELL $0 --fallback-echo"; then + ECHO="$CONFIG_SHELL \\\$\$0 --fallback-echo" +fi + + + + +tagnames=${tagnames+${tagnames},}CXX + +tagnames=${tagnames+${tagnames},}F77 + +# Name of the host. +# hostname on some systems (SVR3.2, Linux) returns a bogus exit status, +# so uname gets run too. +ac_hostname=`(hostname || uname -n) 2>/dev/null | sed 1q` + +exec 6>&1 + +# +# Initializations. +# +ac_default_prefix=/usr/local +ac_config_libobj_dir=. +cross_compiling=no +subdirs= +MFLAGS= +MAKEFLAGS= +SHELL=${CONFIG_SHELL-/bin/sh} + +# Maximum number of lines to put in a shell here document. +# This variable seems obsolete. It should probably be removed, and +# only ac_max_sed_lines should be used. +: ${ac_max_here_lines=38} + +# Identity of this package. +PACKAGE_NAME='xf86-input-mouse' +PACKAGE_TARNAME='xf86-input-mouse' +PACKAGE_VERSION='1.1.2' +PACKAGE_STRING='xf86-input-mouse 1.1.2' +PACKAGE_BUGREPORT='https://bugs.freedesktop.org/enter_bug.cgi?product=xorg' + +ac_unique_file="Makefile.am" +# Factoring default headers for most tests. +ac_includes_default="\ +#include <stdio.h> +#if HAVE_SYS_TYPES_H +# include <sys/types.h> +#endif +#if HAVE_SYS_STAT_H +# include <sys/stat.h> +#endif +#if STDC_HEADERS +# include <stdlib.h> +# include <stddef.h> +#else +# if HAVE_STDLIB_H +# include <stdlib.h> +# endif +#endif +#if HAVE_STRING_H +# if !STDC_HEADERS && HAVE_MEMORY_H +# include <memory.h> +# endif +# include <string.h> +#endif +#if HAVE_STRINGS_H +# include <strings.h> +#endif +#if HAVE_INTTYPES_H +# include <inttypes.h> +#else +# if HAVE_STDINT_H +# include <stdint.h> +# endif +#endif +#if HAVE_UNISTD_H +# include <unistd.h> +#endif" + +ac_subst_vars='SHELL PATH_SEPARATOR PACKAGE_NAME PACKAGE_TARNAME PACKAGE_VERSION PACKAGE_STRING PACKAGE_BUGREPORT exec_prefix prefix program_transform_name bindir sbindir libexecdir datadir sysconfdir sharedstatedir localstatedir libdir includedir oldincludedir infodir mandir build_alias host_alias target_alias DEFS ECHO_C ECHO_N ECHO_T LIBS INSTALL_PROGRAM INSTALL_SCRIPT INSTALL_DATA CYGPATH_W PACKAGE VERSION ACLOCAL AUTOCONF AUTOMAKE AUTOHEADER MAKEINFO install_sh STRIP ac_ct_STRIP INSTALL_STRIP_PROGRAM mkdir_p AWK SET_MAKE am__leading_dot AMTAR am__tar am__untar MAINTAINER_MODE_TRUE MAINTAINER_MODE_FALSE MAINT DRIVER_NAME build build_cpu build_vendor build_os host host_cpu host_vendor host_os CC CFLAGS LDFLAGS CPPFLAGS ac_ct_CC EXEEXT OBJEXT DEPDIR am__include am__quote AMDEP_TRUE AMDEP_FALSE AMDEPBACKSLASH CCDEPMODE am__fastdepCC_TRUE am__fastdepCC_FALSE SED EGREP LN_S ECHO AR ac_ct_AR RANLIB ac_ct_RANLIB CPP CXX CXXFLAGS ac_ct_CXX CXXDEPMODE am__fastdepCXX_TRUE am__fastdepCXX_FALSE CXXCPP F77 FFLAGS ac_ct_F77 LIBTOOL inputdir PKG_CONFIG ac_pt_PKG_CONFIG XORG_CFLAGS XORG_LIBS APP_MAN_SUFFIX LIB_MAN_SUFFIX FILE_MAN_SUFFIX MISC_MAN_SUFFIX DRIVER_MAN_SUFFIX ADMIN_MAN_SUFFIX APP_MAN_DIR LIB_MAN_DIR FILE_MAN_DIR MISC_MAN_DIR DRIVER_MAN_DIR ADMIN_MAN_DIR LINUXDOC PS2PDF BUILD_LINUXDOC_TRUE BUILD_LINUXDOC_FALSE BUILD_PDFDOC_TRUE BUILD_PDFDOC_FALSE MAKE_TEXT MAKE_PS MAKE_PDF MAKE_HTML LIBOBJS LTLIBOBJS' +ac_subst_files='' + +# Initialize some variables set by options. +ac_init_help= +ac_init_version=false +# The variables have the same names as the options, with +# dashes changed to underlines. +cache_file=/dev/null +exec_prefix=NONE +no_create= +no_recursion= +prefix=NONE +program_prefix=NONE +program_suffix=NONE +program_transform_name=s,x,x, +silent= +site= +srcdir= +verbose= +x_includes=NONE +x_libraries=NONE + +# Installation directory options. +# These are left unexpanded so users can "make install exec_prefix=/foo" +# and all the variables that are supposed to be based on exec_prefix +# by default will actually change. +# Use braces instead of parens because sh, perl, etc. also accept them. +bindir='${exec_prefix}/bin' +sbindir='${exec_prefix}/sbin' +libexecdir='${exec_prefix}/libexec' +datadir='${prefix}/share' +sysconfdir='${prefix}/etc' +sharedstatedir='${prefix}/com' +localstatedir='${prefix}/var' +libdir='${exec_prefix}/lib' +includedir='${prefix}/include' +oldincludedir='/usr/include' +infodir='${prefix}/info' +mandir='${prefix}/man' + +ac_prev= +for ac_option +do + # If the previous option needs an argument, assign it. + if test -n "$ac_prev"; then + eval "$ac_prev=\$ac_option" + ac_prev= + continue + fi + + ac_optarg=`expr "x$ac_option" : 'x[^=]*=\(.*\)'` + + # Accept the important Cygnus configure options, so we can diagnose typos. + + case $ac_option in + + -bindir | --bindir | --bindi | --bind | --bin | --bi) + ac_prev=bindir ;; + -bindir=* | --bindir=* | --bindi=* | --bind=* | --bin=* | --bi=*) + bindir=$ac_optarg ;; + + -build | --build | --buil | --bui | --bu) + ac_prev=build_alias ;; + -build=* | --build=* | --buil=* | --bui=* | --bu=*) + build_alias=$ac_optarg ;; + + -cache-file | --cache-file | --cache-fil | --cache-fi \ + | --cache-f | --cache- | --cache | --cach | --cac | --ca | --c) + ac_prev=cache_file ;; + -cache-file=* | --cache-file=* | --cache-fil=* | --cache-fi=* \ + | --cache-f=* | --cache-=* | --cache=* | --cach=* | --cac=* | --ca=* | --c=*) + cache_file=$ac_optarg ;; + + --config-cache | -C) + cache_file=config.cache ;; + + -datadir | --datadir | --datadi | --datad | --data | --dat | --da) + ac_prev=datadir ;; + -datadir=* | --datadir=* | --datadi=* | --datad=* | --data=* | --dat=* \ + | --da=*) + datadir=$ac_optarg ;; + + -disable-* | --disable-*) + ac_feature=`expr "x$ac_option" : 'x-*disable-\(.*\)'` + # Reject names that are not valid shell variable names. + expr "x$ac_feature" : ".*[^-_$as_cr_alnum]" >/dev/null && + { echo "$as_me: error: invalid feature name: $ac_feature" >&2 + { (exit 1); exit 1; }; } + ac_feature=`echo $ac_feature | sed 's/-/_/g'` + eval "enable_$ac_feature=no" ;; + + -enable-* | --enable-*) + ac_feature=`expr "x$ac_option" : 'x-*enable-\([^=]*\)'` + # Reject names that are not valid shell variable names. + expr "x$ac_feature" : ".*[^-_$as_cr_alnum]" >/dev/null && + { echo "$as_me: error: invalid feature name: $ac_feature" >&2 + { (exit 1); exit 1; }; } + ac_feature=`echo $ac_feature | sed 's/-/_/g'` + case $ac_option in + *=*) ac_optarg=`echo "$ac_optarg" | sed "s/'/'\\\\\\\\''/g"`;; + *) ac_optarg=yes ;; + esac + eval "enable_$ac_feature='$ac_optarg'" ;; + + -exec-prefix | --exec_prefix | --exec-prefix | --exec-prefi \ + | --exec-pref | --exec-pre | --exec-pr | --exec-p | --exec- \ + | --exec | --exe | --ex) + ac_prev=exec_prefix ;; + -exec-prefix=* | --exec_prefix=* | --exec-prefix=* | --exec-prefi=* \ + | --exec-pref=* | --exec-pre=* | --exec-pr=* | --exec-p=* | --exec-=* \ + | --exec=* | --exe=* | --ex=*) + exec_prefix=$ac_optarg ;; + + -gas | --gas | --ga | --g) + # Obsolete; use --with-gas. + with_gas=yes ;; + + -help | --help | --hel | --he | -h) + ac_init_help=long ;; + -help=r* | --help=r* | --hel=r* | --he=r* | -hr*) + ac_init_help=recursive ;; + -help=s* | --help=s* | --hel=s* | --he=s* | -hs*) + ac_init_help=short ;; + + -host | --host | --hos | --ho) + ac_prev=host_alias ;; + -host=* | --host=* | --hos=* | --ho=*) + host_alias=$ac_optarg ;; + + -includedir | --includedir | --includedi | --included | --include \ + | --includ | --inclu | --incl | --inc) + ac_prev=includedir ;; + -includedir=* | --includedir=* | --includedi=* | --included=* | --include=* \ + | --includ=* | --inclu=* | --incl=* | --inc=*) + includedir=$ac_optarg ;; + + -infodir | --infodir | --infodi | --infod | --info | --inf) + ac_prev=infodir ;; + -infodir=* | --infodir=* | --infodi=* | --infod=* | --info=* | --inf=*) + infodir=$ac_optarg ;; + + -libdir | --libdir | --libdi | --libd) + ac_prev=libdir ;; + -libdir=* | --libdir=* | --libdi=* | --libd=*) + libdir=$ac_optarg ;; + + -libexecdir | --libexecdir | --libexecdi | --libexecd | --libexec \ + | --libexe | --libex | --libe) + ac_prev=libexecdir ;; + -libexecdir=* | --libexecdir=* | --libexecdi=* | --libexecd=* | --libexec=* \ + | --libexe=* | --libex=* | --libe=*) + libexecdir=$ac_optarg ;; + + -localstatedir | --localstatedir | --localstatedi | --localstated \ + | --localstate | --localstat | --localsta | --localst \ + | --locals | --local | --loca | --loc | --lo) + ac_prev=localstatedir ;; + -localstatedir=* | --localstatedir=* | --localstatedi=* | --localstated=* \ + | --localstate=* | --localstat=* | --localsta=* | --localst=* \ + | --locals=* | --local=* | --loca=* | --loc=* | --lo=*) + localstatedir=$ac_optarg ;; + + -mandir | --mandir | --mandi | --mand | --man | --ma | --m) + ac_prev=mandir ;; + -mandir=* | --mandir=* | --mandi=* | --mand=* | --man=* | --ma=* | --m=*) + mandir=$ac_optarg ;; + + -nfp | --nfp | --nf) + # Obsolete; use --without-fp. + with_fp=no ;; + + -no-create | --no-create | --no-creat | --no-crea | --no-cre \ + | --no-cr | --no-c | -n) + no_create=yes ;; + + -no-recursion | --no-recursion | --no-recursio | --no-recursi \ + | --no-recurs | --no-recur | --no-recu | --no-rec | --no-re | --no-r) + no_recursion=yes ;; + + -oldincludedir | --oldincludedir | --oldincludedi | --oldincluded \ + | --oldinclude | --oldinclud | --oldinclu | --oldincl | --oldinc \ + | --oldin | --oldi | --old | --ol | --o) + ac_prev=oldincludedir ;; + -oldincludedir=* | --oldincludedir=* | --oldincludedi=* | --oldincluded=* \ + | --oldinclude=* | --oldinclud=* | --oldinclu=* | --oldincl=* | --oldinc=* \ + | --oldin=* | --oldi=* | --old=* | --ol=* | --o=*) + oldincludedir=$ac_optarg ;; + + -prefix | --prefix | --prefi | --pref | --pre | --pr | --p) + ac_prev=prefix ;; + -prefix=* | --prefix=* | --prefi=* | --pref=* | --pre=* | --pr=* | --p=*) + prefix=$ac_optarg ;; + + -program-prefix | --program-prefix | --program-prefi | --program-pref \ + | --program-pre | --program-pr | --program-p) + ac_prev=program_prefix ;; + -program-prefix=* | --program-prefix=* | --program-prefi=* \ + | --program-pref=* | --program-pre=* | --program-pr=* | --program-p=*) + program_prefix=$ac_optarg ;; + + -program-suffix | --program-suffix | --program-suffi | --program-suff \ + | --program-suf | --program-su | --program-s) + ac_prev=program_suffix ;; + -program-suffix=* | --program-suffix=* | --program-suffi=* \ + | --program-suff=* | --program-suf=* | --program-su=* | --program-s=*) + program_suffix=$ac_optarg ;; + + -program-transform-name | --program-transform-name \ + | --program-transform-nam | --program-transform-na \ + | --program-transform-n | --program-transform- \ + | --program-transform | --program-transfor \ + | --program-transfo | --program-transf \ + | --program-trans | --program-tran \ + | --progr-tra | --program-tr | --program-t) + ac_prev=program_transform_name ;; + -program-transform-name=* | --program-transform-name=* \ + | --program-transform-nam=* | --program-transform-na=* \ + | --program-transform-n=* | --program-transform-=* \ + | --program-transform=* | --program-transfor=* \ + | --program-transfo=* | --program-transf=* \ + | --program-trans=* | --program-tran=* \ + | --progr-tra=* | --program-tr=* | --program-t=*) + program_transform_name=$ac_optarg ;; + + -q | -quiet | --quiet | --quie | --qui | --qu | --q \ + | -silent | --silent | --silen | --sile | --sil) + silent=yes ;; + + -sbindir | --sbindir | --sbindi | --sbind | --sbin | --sbi | --sb) + ac_prev=sbindir ;; + -sbindir=* | --sbindir=* | --sbindi=* | --sbind=* | --sbin=* \ + | --sbi=* | --sb=*) + sbindir=$ac_optarg ;; + + -sharedstatedir | --sharedstatedir | --sharedstatedi \ + | --sharedstated | --sharedstate | --sharedstat | --sharedsta \ + | --sharedst | --shareds | --shared | --share | --shar \ + | --sha | --sh) + ac_prev=sharedstatedir ;; + -sharedstatedir=* | --sharedstatedir=* | --sharedstatedi=* \ + | --sharedstated=* | --sharedstate=* | --sharedstat=* | --sharedsta=* \ + | --sharedst=* | --shareds=* | --shared=* | --share=* | --shar=* \ + | --sha=* | --sh=*) + sharedstatedir=$ac_optarg ;; + + -site | --site | --sit) + ac_prev=site ;; + -site=* | --site=* | --sit=*) + site=$ac_optarg ;; + + -srcdir | --srcdir | --srcdi | --srcd | --src | --sr) + ac_prev=srcdir ;; + -srcdir=* | --srcdir=* | --srcdi=* | --srcd=* | --src=* | --sr=*) + srcdir=$ac_optarg ;; + + -sysconfdir | --sysconfdir | --sysconfdi | --sysconfd | --sysconf \ + | --syscon | --sysco | --sysc | --sys | --sy) + ac_prev=sysconfdir ;; + -sysconfdir=* | --sysconfdir=* | --sysconfdi=* | --sysconfd=* | --sysconf=* \ + | --syscon=* | --sysco=* | --sysc=* | --sys=* | --sy=*) + sysconfdir=$ac_optarg ;; + + -target | --target | --targe | --targ | --tar | --ta | --t) + ac_prev=target_alias ;; + -target=* | --target=* | --targe=* | --targ=* | --tar=* | --ta=* | --t=*) + target_alias=$ac_optarg ;; + + -v | -verbose | --verbose | --verbos | --verbo | --verb) + verbose=yes ;; + + -version | --version | --versio | --versi | --vers | -V) + ac_init_version=: ;; + + -with-* | --with-*) + ac_package=`expr "x$ac_option" : 'x-*with-\([^=]*\)'` + # Reject names that are not valid shell variable names. + expr "x$ac_package" : ".*[^-_$as_cr_alnum]" >/dev/null && + { echo "$as_me: error: invalid package name: $ac_package" >&2 + { (exit 1); exit 1; }; } + ac_package=`echo $ac_package| sed 's/-/_/g'` + case $ac_option in + *=*) ac_optarg=`echo "$ac_optarg" | sed "s/'/'\\\\\\\\''/g"`;; + *) ac_optarg=yes ;; + esac + eval "with_$ac_package='$ac_optarg'" ;; + + -without-* | --without-*) + ac_package=`expr "x$ac_option" : 'x-*without-\(.*\)'` + # Reject names that are not valid shell variable names. + expr "x$ac_package" : ".*[^-_$as_cr_alnum]" >/dev/null && + { echo "$as_me: error: invalid package name: $ac_package" >&2 + { (exit 1); exit 1; }; } + ac_package=`echo $ac_package | sed 's/-/_/g'` + eval "with_$ac_package=no" ;; + + --x) + # Obsolete; use --with-x. + with_x=yes ;; + + -x-includes | --x-includes | --x-include | --x-includ | --x-inclu \ + | --x-incl | --x-inc | --x-in | --x-i) + ac_prev=x_includes ;; + -x-includes=* | --x-includes=* | --x-include=* | --x-includ=* | --x-inclu=* \ + | --x-incl=* | --x-inc=* | --x-in=* | --x-i=*) + x_includes=$ac_optarg ;; + + -x-libraries | --x-libraries | --x-librarie | --x-librari \ + | --x-librar | --x-libra | --x-libr | --x-lib | --x-li | --x-l) + ac_prev=x_libraries ;; + -x-libraries=* | --x-libraries=* | --x-librarie=* | --x-librari=* \ + | --x-librar=* | --x-libra=* | --x-libr=* | --x-lib=* | --x-li=* | --x-l=*) + x_libraries=$ac_optarg ;; + + -*) { echo "$as_me: error: unrecognized option: $ac_option +Try \`$0 --help' for more information." >&2 + { (exit 1); exit 1; }; } + ;; + + *=*) + ac_envvar=`expr "x$ac_option" : 'x\([^=]*\)='` + # Reject names that are not valid shell variable names. + expr "x$ac_envvar" : ".*[^_$as_cr_alnum]" >/dev/null && + { echo "$as_me: error: invalid variable name: $ac_envvar" >&2 + { (exit 1); exit 1; }; } + ac_optarg=`echo "$ac_optarg" | sed "s/'/'\\\\\\\\''/g"` + eval "$ac_envvar='$ac_optarg'" + export $ac_envvar ;; + + *) + # FIXME: should be removed in autoconf 3.0. + echo "$as_me: WARNING: you should use --build, --host, --target" >&2 + expr "x$ac_option" : ".*[^-._$as_cr_alnum]" >/dev/null && + echo "$as_me: WARNING: invalid host type: $ac_option" >&2 + : ${build_alias=$ac_option} ${host_alias=$ac_option} ${target_alias=$ac_option} + ;; + + esac +done + +if test -n "$ac_prev"; then + ac_option=--`echo $ac_prev | sed 's/_/-/g'` + { echo "$as_me: error: missing argument to $ac_option" >&2 + { (exit 1); exit 1; }; } +fi + +# Be sure to have absolute paths. +for ac_var in exec_prefix prefix +do + eval ac_val=$`echo $ac_var` + case $ac_val in + [\\/$]* | ?:[\\/]* | NONE | '' ) ;; + *) { echo "$as_me: error: expected an absolute directory name for --$ac_var: $ac_val" >&2 + { (exit 1); exit 1; }; };; + esac +done + +# Be sure to have absolute paths. +for ac_var in bindir sbindir libexecdir datadir sysconfdir sharedstatedir \ + localstatedir libdir includedir oldincludedir infodir mandir +do + eval ac_val=$`echo $ac_var` + case $ac_val in + [\\/$]* | ?:[\\/]* ) ;; + *) { echo "$as_me: error: expected an absolute directory name for --$ac_var: $ac_val" >&2 + { (exit 1); exit 1; }; };; + esac +done + +# There might be people who depend on the old broken behavior: `$host' +# used to hold the argument of --host etc. +# FIXME: To remove some day. +build=$build_alias +host=$host_alias +target=$target_alias + +# FIXME: To remove some day. +if test "x$host_alias" != x; then + if test "x$build_alias" = x; then + cross_compiling=maybe + echo "$as_me: WARNING: If you wanted to set the --build type, don't use --host. + If a cross compiler is detected then cross compile mode will be used." >&2 + elif test "x$build_alias" != "x$host_alias"; then + cross_compiling=yes + fi +fi + +ac_tool_prefix= +test -n "$host_alias" && ac_tool_prefix=$host_alias- + +test "$silent" = yes && exec 6>/dev/null + + +# Find the source files, if location was not specified. +if test -z "$srcdir"; then + ac_srcdir_defaulted=yes + # Try the directory containing this script, then its parent. + ac_confdir=`(dirname "$0") 2>/dev/null || +$as_expr X"$0" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$0" : 'X\(//\)[^/]' \| \ + X"$0" : 'X\(//\)$' \| \ + X"$0" : 'X\(/\)' \| \ + . : '\(.\)' 2>/dev/null || +echo X"$0" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; } + /^X\(\/\/\)[^/].*/{ s//\1/; q; } + /^X\(\/\/\)$/{ s//\1/; q; } + /^X\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + srcdir=$ac_confdir + if test ! -r $srcdir/$ac_unique_file; then + srcdir=.. + fi +else + ac_srcdir_defaulted=no +fi +if test ! -r $srcdir/$ac_unique_file; then + if test "$ac_srcdir_defaulted" = yes; then + { echo "$as_me: error: cannot find sources ($ac_unique_file) in $ac_confdir or .." >&2 + { (exit 1); exit 1; }; } + else + { echo "$as_me: error: cannot find sources ($ac_unique_file) in $srcdir" >&2 + { (exit 1); exit 1; }; } + fi +fi +(cd $srcdir && test -r ./$ac_unique_file) 2>/dev/null || + { echo "$as_me: error: sources are in $srcdir, but \`cd $srcdir' does not work" >&2 + { (exit 1); exit 1; }; } +srcdir=`echo "$srcdir" | sed 's%\([^\\/]\)[\\/]*$%\1%'` +ac_env_build_alias_set=${build_alias+set} +ac_env_build_alias_value=$build_alias +ac_cv_env_build_alias_set=${build_alias+set} +ac_cv_env_build_alias_value=$build_alias +ac_env_host_alias_set=${host_alias+set} +ac_env_host_alias_value=$host_alias +ac_cv_env_host_alias_set=${host_alias+set} +ac_cv_env_host_alias_value=$host_alias +ac_env_target_alias_set=${target_alias+set} +ac_env_target_alias_value=$target_alias +ac_cv_env_target_alias_set=${target_alias+set} +ac_cv_env_target_alias_value=$target_alias +ac_env_CC_set=${CC+set} +ac_env_CC_value=$CC +ac_cv_env_CC_set=${CC+set} +ac_cv_env_CC_value=$CC +ac_env_CFLAGS_set=${CFLAGS+set} +ac_env_CFLAGS_value=$CFLAGS +ac_cv_env_CFLAGS_set=${CFLAGS+set} +ac_cv_env_CFLAGS_value=$CFLAGS +ac_env_LDFLAGS_set=${LDFLAGS+set} +ac_env_LDFLAGS_value=$LDFLAGS +ac_cv_env_LDFLAGS_set=${LDFLAGS+set} +ac_cv_env_LDFLAGS_value=$LDFLAGS +ac_env_CPPFLAGS_set=${CPPFLAGS+set} +ac_env_CPPFLAGS_value=$CPPFLAGS +ac_cv_env_CPPFLAGS_set=${CPPFLAGS+set} +ac_cv_env_CPPFLAGS_value=$CPPFLAGS +ac_env_CPP_set=${CPP+set} +ac_env_CPP_value=$CPP +ac_cv_env_CPP_set=${CPP+set} +ac_cv_env_CPP_value=$CPP +ac_env_CXX_set=${CXX+set} +ac_env_CXX_value=$CXX +ac_cv_env_CXX_set=${CXX+set} +ac_cv_env_CXX_value=$CXX +ac_env_CXXFLAGS_set=${CXXFLAGS+set} +ac_env_CXXFLAGS_value=$CXXFLAGS +ac_cv_env_CXXFLAGS_set=${CXXFLAGS+set} +ac_cv_env_CXXFLAGS_value=$CXXFLAGS +ac_env_CXXCPP_set=${CXXCPP+set} +ac_env_CXXCPP_value=$CXXCPP +ac_cv_env_CXXCPP_set=${CXXCPP+set} +ac_cv_env_CXXCPP_value=$CXXCPP +ac_env_F77_set=${F77+set} +ac_env_F77_value=$F77 +ac_cv_env_F77_set=${F77+set} +ac_cv_env_F77_value=$F77 +ac_env_FFLAGS_set=${FFLAGS+set} +ac_env_FFLAGS_value=$FFLAGS +ac_cv_env_FFLAGS_set=${FFLAGS+set} +ac_cv_env_FFLAGS_value=$FFLAGS +ac_env_PKG_CONFIG_set=${PKG_CONFIG+set} +ac_env_PKG_CONFIG_value=$PKG_CONFIG +ac_cv_env_PKG_CONFIG_set=${PKG_CONFIG+set} +ac_cv_env_PKG_CONFIG_value=$PKG_CONFIG +ac_env_XORG_CFLAGS_set=${XORG_CFLAGS+set} +ac_env_XORG_CFLAGS_value=$XORG_CFLAGS +ac_cv_env_XORG_CFLAGS_set=${XORG_CFLAGS+set} +ac_cv_env_XORG_CFLAGS_value=$XORG_CFLAGS +ac_env_XORG_LIBS_set=${XORG_LIBS+set} +ac_env_XORG_LIBS_value=$XORG_LIBS +ac_cv_env_XORG_LIBS_set=${XORG_LIBS+set} +ac_cv_env_XORG_LIBS_value=$XORG_LIBS + +# +# Report the --help message. +# +if test "$ac_init_help" = "long"; then + # Omit some internal or obsolete options to make the list less imposing. + # This message is too long to be a string in the A/UX 3.1 sh. + cat <<_ACEOF +\`configure' configures xf86-input-mouse 1.1.2 to adapt to many kinds of systems. + +Usage: $0 [OPTION]... [VAR=VALUE]... + +To assign environment variables (e.g., CC, CFLAGS...), specify them as +VAR=VALUE. See below for descriptions of some of the useful variables. + +Defaults for the options are specified in brackets. + +Configuration: + -h, --help display this help and exit + --help=short display options specific to this package + --help=recursive display the short help of all the included packages + -V, --version display version information and exit + -q, --quiet, --silent do not print \`checking...' messages + --cache-file=FILE cache test results in FILE [disabled] + -C, --config-cache alias for \`--cache-file=config.cache' + -n, --no-create do not create output files + --srcdir=DIR find the sources in DIR [configure dir or \`..'] + +_ACEOF + + cat <<_ACEOF +Installation directories: + --prefix=PREFIX install architecture-independent files in PREFIX + [$ac_default_prefix] + --exec-prefix=EPREFIX install architecture-dependent files in EPREFIX + [PREFIX] + +By default, \`make install' will install all the files in +\`$ac_default_prefix/bin', \`$ac_default_prefix/lib' etc. You can specify +an installation prefix other than \`$ac_default_prefix' using \`--prefix', +for instance \`--prefix=\$HOME'. + +For better control, use the options below. + +Fine tuning of the installation directories: + --bindir=DIR user executables [EPREFIX/bin] + --sbindir=DIR system admin executables [EPREFIX/sbin] + --libexecdir=DIR program executables [EPREFIX/libexec] + --datadir=DIR read-only architecture-independent data [PREFIX/share] + --sysconfdir=DIR read-only single-machine data [PREFIX/etc] + --sharedstatedir=DIR modifiable architecture-independent data [PREFIX/com] + --localstatedir=DIR modifiable single-machine data [PREFIX/var] + --libdir=DIR object code libraries [EPREFIX/lib] + --includedir=DIR C header files [PREFIX/include] + --oldincludedir=DIR C header files for non-gcc [/usr/include] + --infodir=DIR info documentation [PREFIX/info] + --mandir=DIR man documentation [PREFIX/man] +_ACEOF + + cat <<\_ACEOF + +Program names: + --program-prefix=PREFIX prepend PREFIX to installed program names + --program-suffix=SUFFIX append SUFFIX to installed program names + --program-transform-name=PROGRAM run sed PROGRAM on installed program names + +System types: + --build=BUILD configure for building on BUILD [guessed] + --host=HOST cross-compile to build programs to run on HOST [BUILD] +_ACEOF +fi + +if test -n "$ac_init_help"; then + case $ac_init_help in + short | recursive ) echo "Configuration of xf86-input-mouse 1.1.2:";; + esac + cat <<\_ACEOF + +Optional Features: + --disable-FEATURE do not include FEATURE (same as --enable-FEATURE=no) + --enable-FEATURE[=ARG] include FEATURE [ARG=yes] + --enable-maintainer-mode enable make rules and dependencies not useful + (and sometimes confusing) to the casual installer + --enable-static[=PKGS] + build static libraries [default=no] + --enable-shared[=PKGS] + build shared libraries [default=yes] + --enable-fast-install[=PKGS] + optimize for fast installation [default=yes] + --disable-dependency-tracking speeds up one-time build + --enable-dependency-tracking do not reject slow dependency extractors + --disable-libtool-lock avoid locking (might break parallel builds) + +Optional Packages: + --with-PACKAGE[=ARG] use PACKAGE [ARG=yes] + --without-PACKAGE do not use PACKAGE (same as --with-PACKAGE=no) + --with-gnu-ld assume the C compiler uses GNU ld [default=no] + --with-pic try to use only PIC/non-PIC objects [default=use + both] + --with-tags[=TAGS] + include additional configurations [automatic] + --with-xorg-module-dir=DIR + Default xorg module directory + [default=$libdir/xorg/modules] + --with-release-version=STRING + Use release version string in package name + +Some influential environment variables: + CC C compiler command + CFLAGS C compiler flags + LDFLAGS linker flags, e.g. -L<lib dir> if you have libraries in a + nonstandard directory <lib dir> + CPPFLAGS C/C++ preprocessor flags, e.g. -I<include dir> if you have + headers in a nonstandard directory <include dir> + CPP C preprocessor + CXX C++ compiler command + CXXFLAGS C++ compiler flags + CXXCPP C++ preprocessor + F77 Fortran 77 compiler command + FFLAGS Fortran 77 compiler flags + PKG_CONFIG path to pkg-config utility + XORG_CFLAGS C compiler flags for XORG, overriding pkg-config + XORG_LIBS linker flags for XORG, overriding pkg-config + +Use these variables to override the choices made by `configure' or to help +it to find libraries and programs with nonstandard names/locations. + +Report bugs to <https://bugs.freedesktop.org/enter_bug.cgi?product=xorg>. +_ACEOF +fi + +if test "$ac_init_help" = "recursive"; then + # If there are subdirs, report their specific --help. + ac_popdir=`pwd` + for ac_dir in : $ac_subdirs_all; do test "x$ac_dir" = x: && continue + test -d $ac_dir || continue + ac_builddir=. + +if test "$ac_dir" != .; then + ac_dir_suffix=/`echo "$ac_dir" | sed 's,^\.[\\/],,'` + # A "../" for each directory in $ac_dir_suffix. + ac_top_builddir=`echo "$ac_dir_suffix" | sed 's,/[^\\/]*,../,g'` +else + ac_dir_suffix= ac_top_builddir= +fi + +case $srcdir in + .) # No --srcdir option. We are building in place. + ac_srcdir=. + if test -z "$ac_top_builddir"; then + ac_top_srcdir=. + else + ac_top_srcdir=`echo $ac_top_builddir | sed 's,/$,,'` + fi ;; + [\\/]* | ?:[\\/]* ) # Absolute path. + ac_srcdir=$srcdir$ac_dir_suffix; + ac_top_srcdir=$srcdir ;; + *) # Relative path. + ac_srcdir=$ac_top_builddir$srcdir$ac_dir_suffix + ac_top_srcdir=$ac_top_builddir$srcdir ;; +esac + +# Do not use `cd foo && pwd` to compute absolute paths, because +# the directories may not exist. +case `pwd` in +.) ac_abs_builddir="$ac_dir";; +*) + case "$ac_dir" in + .) ac_abs_builddir=`pwd`;; + [\\/]* | ?:[\\/]* ) ac_abs_builddir="$ac_dir";; + *) ac_abs_builddir=`pwd`/"$ac_dir";; + esac;; +esac +case $ac_abs_builddir in +.) ac_abs_top_builddir=${ac_top_builddir}.;; +*) + case ${ac_top_builddir}. in + .) ac_abs_top_builddir=$ac_abs_builddir;; + [\\/]* | ?:[\\/]* ) ac_abs_top_builddir=${ac_top_builddir}.;; + *) ac_abs_top_builddir=$ac_abs_builddir/${ac_top_builddir}.;; + esac;; +esac +case $ac_abs_builddir in +.) ac_abs_srcdir=$ac_srcdir;; +*) + case $ac_srcdir in + .) ac_abs_srcdir=$ac_abs_builddir;; + [\\/]* | ?:[\\/]* ) ac_abs_srcdir=$ac_srcdir;; + *) ac_abs_srcdir=$ac_abs_builddir/$ac_srcdir;; + esac;; +esac +case $ac_abs_builddir in +.) ac_abs_top_srcdir=$ac_top_srcdir;; +*) + case $ac_top_srcdir in + .) ac_abs_top_srcdir=$ac_abs_builddir;; + [\\/]* | ?:[\\/]* ) ac_abs_top_srcdir=$ac_top_srcdir;; + *) ac_abs_top_srcdir=$ac_abs_builddir/$ac_top_srcdir;; + esac;; +esac + + cd $ac_dir + # Check for guested configure; otherwise get Cygnus style configure. + if test -f $ac_srcdir/configure.gnu; then + echo + $SHELL $ac_srcdir/configure.gnu --help=recursive + elif test -f $ac_srcdir/configure; then + echo + $SHELL $ac_srcdir/configure --help=recursive + elif test -f $ac_srcdir/configure.ac || + test -f $ac_srcdir/configure.in; then + echo + $ac_configure --help + else + echo "$as_me: WARNING: no configuration information is in $ac_dir" >&2 + fi + cd $ac_popdir + done +fi + +test -n "$ac_init_help" && exit 0 +if $ac_init_version; then + cat <<\_ACEOF +xf86-input-mouse configure 1.1.2 +generated by GNU Autoconf 2.59 + +Copyright (C) 2003 Free Software Foundation, Inc. +This configure script is free software; the Free Software Foundation +gives unlimited permission to copy, distribute and modify it. +_ACEOF + exit 0 +fi +exec 5>config.log +cat >&5 <<_ACEOF +This file contains any messages produced by compilers while +running configure, to aid debugging if configure makes a mistake. + +It was created by xf86-input-mouse $as_me 1.1.2, which was +generated by GNU Autoconf 2.59. Invocation command line was + + $ $0 $@ + +_ACEOF +{ +cat <<_ASUNAME +## --------- ## +## Platform. ## +## --------- ## + +hostname = `(hostname || uname -n) 2>/dev/null | sed 1q` +uname -m = `(uname -m) 2>/dev/null || echo unknown` +uname -r = `(uname -r) 2>/dev/null || echo unknown` +uname -s = `(uname -s) 2>/dev/null || echo unknown` +uname -v = `(uname -v) 2>/dev/null || echo unknown` + +/usr/bin/uname -p = `(/usr/bin/uname -p) 2>/dev/null || echo unknown` +/bin/uname -X = `(/bin/uname -X) 2>/dev/null || echo unknown` + +/bin/arch = `(/bin/arch) 2>/dev/null || echo unknown` +/usr/bin/arch -k = `(/usr/bin/arch -k) 2>/dev/null || echo unknown` +/usr/convex/getsysinfo = `(/usr/convex/getsysinfo) 2>/dev/null || echo unknown` +hostinfo = `(hostinfo) 2>/dev/null || echo unknown` +/bin/machine = `(/bin/machine) 2>/dev/null || echo unknown` +/usr/bin/oslevel = `(/usr/bin/oslevel) 2>/dev/null || echo unknown` +/bin/universe = `(/bin/universe) 2>/dev/null || echo unknown` + +_ASUNAME + +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + echo "PATH: $as_dir" +done + +} >&5 + +cat >&5 <<_ACEOF + + +## ----------- ## +## Core tests. ## +## ----------- ## + +_ACEOF + + +# Keep a trace of the command line. +# Strip out --no-create and --no-recursion so they do not pile up. +# Strip out --silent because we don't want to record it for future runs. +# Also quote any args containing shell meta-characters. +# Make two passes to allow for proper duplicate-argument suppression. +ac_configure_args= +ac_configure_args0= +ac_configure_args1= +ac_sep= +ac_must_keep_next=false +for ac_pass in 1 2 +do + for ac_arg + do + case $ac_arg in + -no-create | --no-c* | -n | -no-recursion | --no-r*) continue ;; + -q | -quiet | --quiet | --quie | --qui | --qu | --q \ + | -silent | --silent | --silen | --sile | --sil) + continue ;; + *" "*|*" "*|*[\[\]\~\#\$\^\&\*\(\)\{\}\\\|\;\<\>\?\"\']*) + ac_arg=`echo "$ac_arg" | sed "s/'/'\\\\\\\\''/g"` ;; + esac + case $ac_pass in + 1) ac_configure_args0="$ac_configure_args0 '$ac_arg'" ;; + 2) + ac_configure_args1="$ac_configure_args1 '$ac_arg'" + if test $ac_must_keep_next = true; then + ac_must_keep_next=false # Got value, back to normal. + else + case $ac_arg in + *=* | --config-cache | -C | -disable-* | --disable-* \ + | -enable-* | --enable-* | -gas | --g* | -nfp | --nf* \ + | -q | -quiet | --q* | -silent | --sil* | -v | -verb* \ + | -with-* | --with-* | -without-* | --without-* | --x) + case "$ac_configure_args0 " in + "$ac_configure_args1"*" '$ac_arg' "* ) continue ;; + esac + ;; + -* ) ac_must_keep_next=true ;; + esac + fi + ac_configure_args="$ac_configure_args$ac_sep'$ac_arg'" + # Get rid of the leading space. + ac_sep=" " + ;; + esac + done +done +$as_unset ac_configure_args0 || test "${ac_configure_args0+set}" != set || { ac_configure_args0=; export ac_configure_args0; } +$as_unset ac_configure_args1 || test "${ac_configure_args1+set}" != set || { ac_configure_args1=; export ac_configure_args1; } + +# When interrupted or exit'd, cleanup temporary files, and complete +# config.log. We remove comments because anyway the quotes in there +# would cause problems or look ugly. +# WARNING: Be sure not to use single quotes in there, as some shells, +# such as our DU 5.0 friend, will then `close' the trap. +trap 'exit_status=$? + # Save into config.log some information that might help in debugging. + { + echo + + cat <<\_ASBOX +## ---------------- ## +## Cache variables. ## +## ---------------- ## +_ASBOX + echo + # The following way of writing the cache mishandles newlines in values, +{ + (set) 2>&1 | + case `(ac_space='"'"' '"'"'; set | grep ac_space) 2>&1` in + *ac_space=\ *) + sed -n \ + "s/'"'"'/'"'"'\\\\'"'"''"'"'/g; + s/^\\([_$as_cr_alnum]*_cv_[_$as_cr_alnum]*\\)=\\(.*\\)/\\1='"'"'\\2'"'"'/p" + ;; + *) + sed -n \ + "s/^\\([_$as_cr_alnum]*_cv_[_$as_cr_alnum]*\\)=\\(.*\\)/\\1=\\2/p" + ;; + esac; +} + echo + + cat <<\_ASBOX +## ----------------- ## +## Output variables. ## +## ----------------- ## +_ASBOX + echo + for ac_var in $ac_subst_vars + do + eval ac_val=$`echo $ac_var` + echo "$ac_var='"'"'$ac_val'"'"'" + done | sort + echo + + if test -n "$ac_subst_files"; then + cat <<\_ASBOX +## ------------- ## +## Output files. ## +## ------------- ## +_ASBOX + echo + for ac_var in $ac_subst_files + do + eval ac_val=$`echo $ac_var` + echo "$ac_var='"'"'$ac_val'"'"'" + done | sort + echo + fi + + if test -s confdefs.h; then + cat <<\_ASBOX +## ----------- ## +## confdefs.h. ## +## ----------- ## +_ASBOX + echo + sed "/^$/d" confdefs.h | sort + echo + fi + test "$ac_signal" != 0 && + echo "$as_me: caught signal $ac_signal" + echo "$as_me: exit $exit_status" + } >&5 + rm -f core *.core && + rm -rf conftest* confdefs* conf$$* $ac_clean_files && + exit $exit_status + ' 0 +for ac_signal in 1 2 13 15; do + trap 'ac_signal='$ac_signal'; { (exit 1); exit 1; }' $ac_signal +done +ac_signal=0 + +# confdefs.h avoids OS command line length limits that DEFS can exceed. +rm -rf conftest* confdefs.h +# AIX cpp loses on an empty file, so make sure it contains at least a newline. +echo >confdefs.h + +# Predefined preprocessor variables. + +cat >>confdefs.h <<_ACEOF +#define PACKAGE_NAME "$PACKAGE_NAME" +_ACEOF + + +cat >>confdefs.h <<_ACEOF +#define PACKAGE_TARNAME "$PACKAGE_TARNAME" +_ACEOF + + +cat >>confdefs.h <<_ACEOF +#define PACKAGE_VERSION "$PACKAGE_VERSION" +_ACEOF + + +cat >>confdefs.h <<_ACEOF +#define PACKAGE_STRING "$PACKAGE_STRING" +_ACEOF + + +cat >>confdefs.h <<_ACEOF +#define PACKAGE_BUGREPORT "$PACKAGE_BUGREPORT" +_ACEOF + + +# Let the site file select an alternate cache file if it wants to. +# Prefer explicitly selected file to automatically selected ones. +if test -z "$CONFIG_SITE"; then + if test "x$prefix" != xNONE; then + CONFIG_SITE="$prefix/share/config.site $prefix/etc/config.site" + else + CONFIG_SITE="$ac_default_prefix/share/config.site $ac_default_prefix/etc/config.site" + fi +fi +for ac_site_file in $CONFIG_SITE; do + if test -r "$ac_site_file"; then + { echo "$as_me:$LINENO: loading site script $ac_site_file" >&5 +echo "$as_me: loading site script $ac_site_file" >&6;} + sed 's/^/| /' "$ac_site_file" >&5 + . "$ac_site_file" + fi +done + +if test -r "$cache_file"; then + # Some versions of bash will fail to source /dev/null (special + # files actually), so we avoid doing that. + if test -f "$cache_file"; then + { echo "$as_me:$LINENO: loading cache $cache_file" >&5 +echo "$as_me: loading cache $cache_file" >&6;} + case $cache_file in + [\\/]* | ?:[\\/]* ) . $cache_file;; + *) . ./$cache_file;; + esac + fi +else + { echo "$as_me:$LINENO: creating cache $cache_file" >&5 +echo "$as_me: creating cache $cache_file" >&6;} + >$cache_file +fi + +# Check that the precious variables saved in the cache have kept the same +# value. +ac_cache_corrupted=false +for ac_var in `(set) 2>&1 | + sed -n 's/^ac_env_\([a-zA-Z_0-9]*\)_set=.*/\1/p'`; do + eval ac_old_set=\$ac_cv_env_${ac_var}_set + eval ac_new_set=\$ac_env_${ac_var}_set + eval ac_old_val="\$ac_cv_env_${ac_var}_value" + eval ac_new_val="\$ac_env_${ac_var}_value" + case $ac_old_set,$ac_new_set in + set,) + { echo "$as_me:$LINENO: error: \`$ac_var' was set to \`$ac_old_val' in the previous run" >&5 +echo "$as_me: error: \`$ac_var' was set to \`$ac_old_val' in the previous run" >&2;} + ac_cache_corrupted=: ;; + ,set) + { echo "$as_me:$LINENO: error: \`$ac_var' was not set in the previous run" >&5 +echo "$as_me: error: \`$ac_var' was not set in the previous run" >&2;} + ac_cache_corrupted=: ;; + ,);; + *) + if test "x$ac_old_val" != "x$ac_new_val"; then + { echo "$as_me:$LINENO: error: \`$ac_var' has changed since the previous run:" >&5 +echo "$as_me: error: \`$ac_var' has changed since the previous run:" >&2;} + { echo "$as_me:$LINENO: former value: $ac_old_val" >&5 +echo "$as_me: former value: $ac_old_val" >&2;} + { echo "$as_me:$LINENO: current value: $ac_new_val" >&5 +echo "$as_me: current value: $ac_new_val" >&2;} + ac_cache_corrupted=: + fi;; + esac + # Pass precious variables to config.status. + if test "$ac_new_set" = set; then + case $ac_new_val in + *" "*|*" "*|*[\[\]\~\#\$\^\&\*\(\)\{\}\\\|\;\<\>\?\"\']*) + ac_arg=$ac_var=`echo "$ac_new_val" | sed "s/'/'\\\\\\\\''/g"` ;; + *) ac_arg=$ac_var=$ac_new_val ;; + esac + case " $ac_configure_args " in + *" '$ac_arg' "*) ;; # Avoid dups. Use of quotes ensures accuracy. + *) ac_configure_args="$ac_configure_args '$ac_arg'" ;; + esac + fi +done +if $ac_cache_corrupted; then + { echo "$as_me:$LINENO: error: changes in the environment can compromise the build" >&5 +echo "$as_me: error: changes in the environment can compromise the build" >&2;} + { { echo "$as_me:$LINENO: error: run \`make distclean' and/or \`rm $cache_file' and start over" >&5 +echo "$as_me: error: run \`make distclean' and/or \`rm $cache_file' and start over" >&2;} + { (exit 1); exit 1; }; } +fi + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +ac_aux_dir= +for ac_dir in . $srcdir/.; do + if test -f $ac_dir/install-sh; then + ac_aux_dir=$ac_dir + ac_install_sh="$ac_aux_dir/install-sh -c" + break + elif test -f $ac_dir/install.sh; then + ac_aux_dir=$ac_dir + ac_install_sh="$ac_aux_dir/install.sh -c" + break + elif test -f $ac_dir/shtool; then + ac_aux_dir=$ac_dir + ac_install_sh="$ac_aux_dir/shtool install -c" + break + fi +done +if test -z "$ac_aux_dir"; then + { { echo "$as_me:$LINENO: error: cannot find install-sh or install.sh in . $srcdir/." >&5 +echo "$as_me: error: cannot find install-sh or install.sh in . $srcdir/." >&2;} + { (exit 1); exit 1; }; } +fi +ac_config_guess="$SHELL $ac_aux_dir/config.guess" +ac_config_sub="$SHELL $ac_aux_dir/config.sub" +ac_configure="$SHELL $ac_aux_dir/configure" # This should be Cygnus configure. + +am__api_version="1.9" +# Find a good install program. We prefer a C program (faster), +# so one script is as good as another. But avoid the broken or +# incompatible versions: +# SysV /etc/install, /usr/sbin/install +# SunOS /usr/etc/install +# IRIX /sbin/install +# AIX /bin/install +# AmigaOS /C/install, which installs bootblocks on floppy discs +# AIX 4 /usr/bin/installbsd, which doesn't work without a -g flag +# AFS /usr/afsws/bin/install, which mishandles nonexistent args +# SVR4 /usr/ucb/install, which tries to use the nonexistent group "staff" +# OS/2's system install, which has a completely different semantic +# ./install, which can be erroneously created by make from ./install.sh. +echo "$as_me:$LINENO: checking for a BSD-compatible install" >&5 +echo $ECHO_N "checking for a BSD-compatible install... $ECHO_C" >&6 +if test -z "$INSTALL"; then +if test "${ac_cv_path_install+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + # Account for people who put trailing slashes in PATH elements. +case $as_dir/ in + ./ | .// | /cC/* | \ + /etc/* | /usr/sbin/* | /usr/etc/* | /sbin/* | /usr/afsws/bin/* | \ + ?:\\/os2\\/install\\/* | ?:\\/OS2\\/INSTALL\\/* | \ + /usr/ucb/* ) ;; + *) + # OSF1 and SCO ODT 3.0 have their own names for install. + # Don't use installbsd from OSF since it installs stuff as root + # by default. + for ac_prog in ginstall scoinst install; do + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_prog$ac_exec_ext"; then + if test $ac_prog = install && + grep dspmsg "$as_dir/$ac_prog$ac_exec_ext" >/dev/null 2>&1; then + # AIX install. It has an incompatible calling convention. + : + elif test $ac_prog = install && + grep pwplus "$as_dir/$ac_prog$ac_exec_ext" >/dev/null 2>&1; then + # program-specific install script used by HP pwplus--don't use. + : + else + ac_cv_path_install="$as_dir/$ac_prog$ac_exec_ext -c" + break 3 + fi + fi + done + done + ;; +esac +done + + +fi + if test "${ac_cv_path_install+set}" = set; then + INSTALL=$ac_cv_path_install + else + # As a last resort, use the slow shell script. We don't cache a + # path for INSTALL within a source directory, because that will + # break other packages using the cache if that directory is + # removed, or if the path is relative. + INSTALL=$ac_install_sh + fi +fi +echo "$as_me:$LINENO: result: $INSTALL" >&5 +echo "${ECHO_T}$INSTALL" >&6 + +# Use test -z because SunOS4 sh mishandles braces in ${var-val}. +# It thinks the first close brace ends the variable substitution. +test -z "$INSTALL_PROGRAM" && INSTALL_PROGRAM='${INSTALL}' + +test -z "$INSTALL_SCRIPT" && INSTALL_SCRIPT='${INSTALL}' + +test -z "$INSTALL_DATA" && INSTALL_DATA='${INSTALL} -m 644' + +echo "$as_me:$LINENO: checking whether build environment is sane" >&5 +echo $ECHO_N "checking whether build environment is sane... $ECHO_C" >&6 +# Just in case +sleep 1 +echo timestamp > conftest.file +# Do `set' in a subshell so we don't clobber the current shell's +# arguments. Must try -L first in case configure is actually a +# symlink; some systems play weird games with the mod time of symlinks +# (eg FreeBSD returns the mod time of the symlink's containing +# directory). +if ( + set X `ls -Lt $srcdir/configure conftest.file 2> /dev/null` + if test "$*" = "X"; then + # -L didn't work. + set X `ls -t $srcdir/configure conftest.file` + fi + rm -f conftest.file + if test "$*" != "X $srcdir/configure conftest.file" \ + && test "$*" != "X conftest.file $srcdir/configure"; then + + # If neither matched, then we have a broken ls. This can happen + # if, for instance, CONFIG_SHELL is bash and it inherits a + # broken ls alias from the environment. This has actually + # happened. Such a system could not be considered "sane". + { { echo "$as_me:$LINENO: error: ls -t appears to fail. Make sure there is not a broken +alias in your environment" >&5 +echo "$as_me: error: ls -t appears to fail. Make sure there is not a broken +alias in your environment" >&2;} + { (exit 1); exit 1; }; } + fi + + test "$2" = conftest.file + ) +then + # Ok. + : +else + { { echo "$as_me:$LINENO: error: newly created file is older than distributed files! +Check your system clock" >&5 +echo "$as_me: error: newly created file is older than distributed files! +Check your system clock" >&2;} + { (exit 1); exit 1; }; } +fi +echo "$as_me:$LINENO: result: yes" >&5 +echo "${ECHO_T}yes" >&6 +test "$program_prefix" != NONE && + program_transform_name="s,^,$program_prefix,;$program_transform_name" +# Use a double $ so make ignores it. +test "$program_suffix" != NONE && + program_transform_name="s,\$,$program_suffix,;$program_transform_name" +# Double any \ or $. echo might interpret backslashes. +# By default was `s,x,x', remove it if useless. +cat <<\_ACEOF >conftest.sed +s/[\\$]/&&/g;s/;s,x,x,$// +_ACEOF +program_transform_name=`echo $program_transform_name | sed -f conftest.sed` +rm conftest.sed + +# expand $ac_aux_dir to an absolute path +am_aux_dir=`cd $ac_aux_dir && pwd` + +test x"${MISSING+set}" = xset || MISSING="\${SHELL} $am_aux_dir/missing" +# Use eval to expand $SHELL +if eval "$MISSING --run true"; then + am_missing_run="$MISSING --run " +else + am_missing_run= + { echo "$as_me:$LINENO: WARNING: \`missing' script is too old or missing" >&5 +echo "$as_me: WARNING: \`missing' script is too old or missing" >&2;} +fi + +if mkdir -p --version . >/dev/null 2>&1 && test ! -d ./--version; then + # We used to keeping the `.' as first argument, in order to + # allow $(mkdir_p) to be used without argument. As in + # $(mkdir_p) $(somedir) + # where $(somedir) is conditionally defined. However this is wrong + # for two reasons: + # 1. if the package is installed by a user who cannot write `.' + # make install will fail, + # 2. the above comment should most certainly read + # $(mkdir_p) $(DESTDIR)$(somedir) + # so it does not work when $(somedir) is undefined and + # $(DESTDIR) is not. + # To support the latter case, we have to write + # test -z "$(somedir)" || $(mkdir_p) $(DESTDIR)$(somedir), + # so the `.' trick is pointless. + mkdir_p='mkdir -p --' +else + # On NextStep and OpenStep, the `mkdir' command does not + # recognize any option. It will interpret all options as + # directories to create, and then abort because `.' already + # exists. + for d in ./-p ./--version; + do + test -d $d && rmdir $d + done + # $(mkinstalldirs) is defined by Automake if mkinstalldirs exists. + if test -f "$ac_aux_dir/mkinstalldirs"; then + mkdir_p='$(mkinstalldirs)' + else + mkdir_p='$(install_sh) -d' + fi +fi + +for ac_prog in gawk mawk nawk awk +do + # Extract the first word of "$ac_prog", so it can be a program name with args. +set dummy $ac_prog; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_AWK+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$AWK"; then + ac_cv_prog_AWK="$AWK" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_AWK="$ac_prog" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +AWK=$ac_cv_prog_AWK +if test -n "$AWK"; then + echo "$as_me:$LINENO: result: $AWK" >&5 +echo "${ECHO_T}$AWK" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + test -n "$AWK" && break +done + +echo "$as_me:$LINENO: checking whether ${MAKE-make} sets \$(MAKE)" >&5 +echo $ECHO_N "checking whether ${MAKE-make} sets \$(MAKE)... $ECHO_C" >&6 +set dummy ${MAKE-make}; ac_make=`echo "$2" | sed 'y,:./+-,___p_,'` +if eval "test \"\${ac_cv_prog_make_${ac_make}_set+set}\" = set"; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.make <<\_ACEOF +all: + @echo 'ac_maketemp="$(MAKE)"' +_ACEOF +# GNU make sometimes prints "make[1]: Entering...", which would confuse us. +eval `${MAKE-make} -f conftest.make 2>/dev/null | grep temp=` +if test -n "$ac_maketemp"; then + eval ac_cv_prog_make_${ac_make}_set=yes +else + eval ac_cv_prog_make_${ac_make}_set=no +fi +rm -f conftest.make +fi +if eval "test \"`echo '$ac_cv_prog_make_'${ac_make}_set`\" = yes"; then + echo "$as_me:$LINENO: result: yes" >&5 +echo "${ECHO_T}yes" >&6 + SET_MAKE= +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 + SET_MAKE="MAKE=${MAKE-make}" +fi + +rm -rf .tst 2>/dev/null +mkdir .tst 2>/dev/null +if test -d .tst; then + am__leading_dot=. +else + am__leading_dot=_ +fi +rmdir .tst 2>/dev/null + +# test to see if srcdir already configured +if test "`cd $srcdir && pwd`" != "`pwd`" && + test -f $srcdir/config.status; then + { { echo "$as_me:$LINENO: error: source directory already configured; run \"make distclean\" there first" >&5 +echo "$as_me: error: source directory already configured; run \"make distclean\" there first" >&2;} + { (exit 1); exit 1; }; } +fi + +# test whether we have cygpath +if test -z "$CYGPATH_W"; then + if (cygpath --version) >/dev/null 2>/dev/null; then + CYGPATH_W='cygpath -w' + else + CYGPATH_W=echo + fi +fi + + +# Define the identity of the package. + PACKAGE='xf86-input-mouse' + VERSION='1.1.2' + + +cat >>confdefs.h <<_ACEOF +#define PACKAGE "$PACKAGE" +_ACEOF + + +cat >>confdefs.h <<_ACEOF +#define VERSION "$VERSION" +_ACEOF + +# Some tools Automake needs. + +ACLOCAL=${ACLOCAL-"${am_missing_run}aclocal-${am__api_version}"} + + +AUTOCONF=${AUTOCONF-"${am_missing_run}autoconf"} + + +AUTOMAKE=${AUTOMAKE-"${am_missing_run}automake-${am__api_version}"} + + +AUTOHEADER=${AUTOHEADER-"${am_missing_run}autoheader"} + + +MAKEINFO=${MAKEINFO-"${am_missing_run}makeinfo"} + +install_sh=${install_sh-"$am_aux_dir/install-sh"} + +# Installed binaries are usually stripped using `strip' when the user +# run `make install-strip'. However `strip' might not be the right +# tool to use in cross-compilation environments, therefore Automake +# will honor the `STRIP' environment variable to overrule this program. +if test "$cross_compiling" != no; then + if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}strip", so it can be a program name with args. +set dummy ${ac_tool_prefix}strip; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_STRIP+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$STRIP"; then + ac_cv_prog_STRIP="$STRIP" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_STRIP="${ac_tool_prefix}strip" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +STRIP=$ac_cv_prog_STRIP +if test -n "$STRIP"; then + echo "$as_me:$LINENO: result: $STRIP" >&5 +echo "${ECHO_T}$STRIP" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + +fi +if test -z "$ac_cv_prog_STRIP"; then + ac_ct_STRIP=$STRIP + # Extract the first word of "strip", so it can be a program name with args. +set dummy strip; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_ac_ct_STRIP+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_STRIP"; then + ac_cv_prog_ac_ct_STRIP="$ac_ct_STRIP" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_STRIP="strip" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + + test -z "$ac_cv_prog_ac_ct_STRIP" && ac_cv_prog_ac_ct_STRIP=":" +fi +fi +ac_ct_STRIP=$ac_cv_prog_ac_ct_STRIP +if test -n "$ac_ct_STRIP"; then + echo "$as_me:$LINENO: result: $ac_ct_STRIP" >&5 +echo "${ECHO_T}$ac_ct_STRIP" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + STRIP=$ac_ct_STRIP +else + STRIP="$ac_cv_prog_STRIP" +fi + +fi +INSTALL_STRIP_PROGRAM="\${SHELL} \$(install_sh) -c -s" + +# We need awk for the "check" target. The system "awk" is bad on +# some platforms. +# Always define AMTAR for backward compatibility. + +AMTAR=${AMTAR-"${am_missing_run}tar"} + +am__tar='${AMTAR} chof - "$$tardir"'; am__untar='${AMTAR} xf -' + + + + + + +echo "$as_me:$LINENO: checking whether to enable maintainer-specific portions of Makefiles" >&5 +echo $ECHO_N "checking whether to enable maintainer-specific portions of Makefiles... $ECHO_C" >&6 + # Check whether --enable-maintainer-mode or --disable-maintainer-mode was given. +if test "${enable_maintainer_mode+set}" = set; then + enableval="$enable_maintainer_mode" + USE_MAINTAINER_MODE=$enableval +else + USE_MAINTAINER_MODE=no +fi; + echo "$as_me:$LINENO: result: $USE_MAINTAINER_MODE" >&5 +echo "${ECHO_T}$USE_MAINTAINER_MODE" >&6 + + +if test $USE_MAINTAINER_MODE = yes; then + MAINTAINER_MODE_TRUE= + MAINTAINER_MODE_FALSE='#' +else + MAINTAINER_MODE_TRUE='#' + MAINTAINER_MODE_FALSE= +fi + + MAINT=$MAINTAINER_MODE_TRUE + + + +DRIVER_NAME=mouse + + + ac_config_headers="$ac_config_headers config.h" + + +# Checks for programs. +# Check whether --enable-static or --disable-static was given. +if test "${enable_static+set}" = set; then + enableval="$enable_static" + p=${PACKAGE-default} + case $enableval in + yes) enable_static=yes ;; + no) enable_static=no ;; + *) + enable_static=no + # Look at the argument we got. We use all the common list separators. + lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR," + for pkg in $enableval; do + IFS="$lt_save_ifs" + if test "X$pkg" = "X$p"; then + enable_static=yes + fi + done + IFS="$lt_save_ifs" + ;; + esac +else + enable_static=no +fi; + + +# Check whether --enable-shared or --disable-shared was given. +if test "${enable_shared+set}" = set; then + enableval="$enable_shared" + p=${PACKAGE-default} + case $enableval in + yes) enable_shared=yes ;; + no) enable_shared=no ;; + *) + enable_shared=no + # Look at the argument we got. We use all the common list separators. + lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR," + for pkg in $enableval; do + IFS="$lt_save_ifs" + if test "X$pkg" = "X$p"; then + enable_shared=yes + fi + done + IFS="$lt_save_ifs" + ;; + esac +else + enable_shared=yes +fi; + +# Check whether --enable-fast-install or --disable-fast-install was given. +if test "${enable_fast_install+set}" = set; then + enableval="$enable_fast_install" + p=${PACKAGE-default} + case $enableval in + yes) enable_fast_install=yes ;; + no) enable_fast_install=no ;; + *) + enable_fast_install=no + # Look at the argument we got. We use all the common list separators. + lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR," + for pkg in $enableval; do + IFS="$lt_save_ifs" + if test "X$pkg" = "X$p"; then + enable_fast_install=yes + fi + done + IFS="$lt_save_ifs" + ;; + esac +else + enable_fast_install=yes +fi; + +# Make sure we can run config.sub. +$ac_config_sub sun4 >/dev/null 2>&1 || + { { echo "$as_me:$LINENO: error: cannot run $ac_config_sub" >&5 +echo "$as_me: error: cannot run $ac_config_sub" >&2;} + { (exit 1); exit 1; }; } + +echo "$as_me:$LINENO: checking build system type" >&5 +echo $ECHO_N "checking build system type... $ECHO_C" >&6 +if test "${ac_cv_build+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_cv_build_alias=$build_alias +test -z "$ac_cv_build_alias" && + ac_cv_build_alias=`$ac_config_guess` +test -z "$ac_cv_build_alias" && + { { echo "$as_me:$LINENO: error: cannot guess build type; you must specify one" >&5 +echo "$as_me: error: cannot guess build type; you must specify one" >&2;} + { (exit 1); exit 1; }; } +ac_cv_build=`$ac_config_sub $ac_cv_build_alias` || + { { echo "$as_me:$LINENO: error: $ac_config_sub $ac_cv_build_alias failed" >&5 +echo "$as_me: error: $ac_config_sub $ac_cv_build_alias failed" >&2;} + { (exit 1); exit 1; }; } + +fi +echo "$as_me:$LINENO: result: $ac_cv_build" >&5 +echo "${ECHO_T}$ac_cv_build" >&6 +build=$ac_cv_build +build_cpu=`echo $ac_cv_build | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\1/'` +build_vendor=`echo $ac_cv_build | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\2/'` +build_os=`echo $ac_cv_build | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\3/'` + + +echo "$as_me:$LINENO: checking host system type" >&5 +echo $ECHO_N "checking host system type... $ECHO_C" >&6 +if test "${ac_cv_host+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_cv_host_alias=$host_alias +test -z "$ac_cv_host_alias" && + ac_cv_host_alias=$ac_cv_build_alias +ac_cv_host=`$ac_config_sub $ac_cv_host_alias` || + { { echo "$as_me:$LINENO: error: $ac_config_sub $ac_cv_host_alias failed" >&5 +echo "$as_me: error: $ac_config_sub $ac_cv_host_alias failed" >&2;} + { (exit 1); exit 1; }; } + +fi +echo "$as_me:$LINENO: result: $ac_cv_host" >&5 +echo "${ECHO_T}$ac_cv_host" >&6 +host=$ac_cv_host +host_cpu=`echo $ac_cv_host | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\1/'` +host_vendor=`echo $ac_cv_host | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\2/'` +host_os=`echo $ac_cv_host | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\3/'` + + +DEPDIR="${am__leading_dot}deps" + + ac_config_commands="$ac_config_commands depfiles" + + +am_make=${MAKE-make} +cat > confinc << 'END' +am__doit: + @echo done +.PHONY: am__doit +END +# If we don't find an include directive, just comment out the code. +echo "$as_me:$LINENO: checking for style of include used by $am_make" >&5 +echo $ECHO_N "checking for style of include used by $am_make... $ECHO_C" >&6 +am__include="#" +am__quote= +_am_result=none +# First try GNU make style include. +echo "include confinc" > confmf +# We grep out `Entering directory' and `Leaving directory' +# messages which can occur if `w' ends up in MAKEFLAGS. +# In particular we don't look at `^make:' because GNU make might +# be invoked under some other name (usually "gmake"), in which +# case it prints its new name instead of `make'. +if test "`$am_make -s -f confmf 2> /dev/null | grep -v 'ing directory'`" = "done"; then + am__include=include + am__quote= + _am_result=GNU +fi +# Now try BSD make style include. +if test "$am__include" = "#"; then + echo '.include "confinc"' > confmf + if test "`$am_make -s -f confmf 2> /dev/null`" = "done"; then + am__include=.include + am__quote="\"" + _am_result=BSD + fi +fi + + +echo "$as_me:$LINENO: result: $_am_result" >&5 +echo "${ECHO_T}$_am_result" >&6 +rm -f confinc confmf + +# Check whether --enable-dependency-tracking or --disable-dependency-tracking was given. +if test "${enable_dependency_tracking+set}" = set; then + enableval="$enable_dependency_tracking" + +fi; +if test "x$enable_dependency_tracking" != xno; then + am_depcomp="$ac_aux_dir/depcomp" + AMDEPBACKSLASH='\' +fi + + +if test "x$enable_dependency_tracking" != xno; then + AMDEP_TRUE= + AMDEP_FALSE='#' +else + AMDEP_TRUE='#' + AMDEP_FALSE= +fi + + + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu +if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}gcc", so it can be a program name with args. +set dummy ${ac_tool_prefix}gcc; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$CC"; then + ac_cv_prog_CC="$CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_CC="${ac_tool_prefix}gcc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +CC=$ac_cv_prog_CC +if test -n "$CC"; then + echo "$as_me:$LINENO: result: $CC" >&5 +echo "${ECHO_T}$CC" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + +fi +if test -z "$ac_cv_prog_CC"; then + ac_ct_CC=$CC + # Extract the first word of "gcc", so it can be a program name with args. +set dummy gcc; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_ac_ct_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_CC"; then + ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_CC="gcc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +ac_ct_CC=$ac_cv_prog_ac_ct_CC +if test -n "$ac_ct_CC"; then + echo "$as_me:$LINENO: result: $ac_ct_CC" >&5 +echo "${ECHO_T}$ac_ct_CC" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + CC=$ac_ct_CC +else + CC="$ac_cv_prog_CC" +fi + +if test -z "$CC"; then + if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}cc", so it can be a program name with args. +set dummy ${ac_tool_prefix}cc; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$CC"; then + ac_cv_prog_CC="$CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_CC="${ac_tool_prefix}cc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +CC=$ac_cv_prog_CC +if test -n "$CC"; then + echo "$as_me:$LINENO: result: $CC" >&5 +echo "${ECHO_T}$CC" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + +fi +if test -z "$ac_cv_prog_CC"; then + ac_ct_CC=$CC + # Extract the first word of "cc", so it can be a program name with args. +set dummy cc; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_ac_ct_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_CC"; then + ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_CC="cc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +ac_ct_CC=$ac_cv_prog_ac_ct_CC +if test -n "$ac_ct_CC"; then + echo "$as_me:$LINENO: result: $ac_ct_CC" >&5 +echo "${ECHO_T}$ac_ct_CC" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + CC=$ac_ct_CC +else + CC="$ac_cv_prog_CC" +fi + +fi +if test -z "$CC"; then + # Extract the first word of "cc", so it can be a program name with args. +set dummy cc; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$CC"; then + ac_cv_prog_CC="$CC" # Let the user override the test. +else + ac_prog_rejected=no +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + if test "$as_dir/$ac_word$ac_exec_ext" = "/usr/ucb/cc"; then + ac_prog_rejected=yes + continue + fi + ac_cv_prog_CC="cc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +if test $ac_prog_rejected = yes; then + # We found a bogon in the path, so make sure we never use it. + set dummy $ac_cv_prog_CC + shift + if test $# != 0; then + # We chose a different compiler from the bogus one. + # However, it has the same basename, so the bogon will be chosen + # first if we set CC to just the basename; use the full file name. + shift + ac_cv_prog_CC="$as_dir/$ac_word${1+' '}$@" + fi +fi +fi +fi +CC=$ac_cv_prog_CC +if test -n "$CC"; then + echo "$as_me:$LINENO: result: $CC" >&5 +echo "${ECHO_T}$CC" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + +fi +if test -z "$CC"; then + if test -n "$ac_tool_prefix"; then + for ac_prog in cl + do + # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args. +set dummy $ac_tool_prefix$ac_prog; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$CC"; then + ac_cv_prog_CC="$CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_CC="$ac_tool_prefix$ac_prog" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +CC=$ac_cv_prog_CC +if test -n "$CC"; then + echo "$as_me:$LINENO: result: $CC" >&5 +echo "${ECHO_T}$CC" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + test -n "$CC" && break + done +fi +if test -z "$CC"; then + ac_ct_CC=$CC + for ac_prog in cl +do + # Extract the first word of "$ac_prog", so it can be a program name with args. +set dummy $ac_prog; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_ac_ct_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_CC"; then + ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_CC="$ac_prog" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +ac_ct_CC=$ac_cv_prog_ac_ct_CC +if test -n "$ac_ct_CC"; then + echo "$as_me:$LINENO: result: $ac_ct_CC" >&5 +echo "${ECHO_T}$ac_ct_CC" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + test -n "$ac_ct_CC" && break +done + + CC=$ac_ct_CC +fi + +fi + + +test -z "$CC" && { { echo "$as_me:$LINENO: error: no acceptable C compiler found in \$PATH +See \`config.log' for more details." >&5 +echo "$as_me: error: no acceptable C compiler found in \$PATH +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } + +# Provide some information about the compiler. +echo "$as_me:$LINENO:" \ + "checking for C compiler version" >&5 +ac_compiler=`set X $ac_compile; echo $2` +{ (eval echo "$as_me:$LINENO: \"$ac_compiler --version </dev/null >&5\"") >&5 + (eval $ac_compiler --version </dev/null >&5) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } +{ (eval echo "$as_me:$LINENO: \"$ac_compiler -v </dev/null >&5\"") >&5 + (eval $ac_compiler -v </dev/null >&5) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } +{ (eval echo "$as_me:$LINENO: \"$ac_compiler -V </dev/null >&5\"") >&5 + (eval $ac_compiler -V </dev/null >&5) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } + +cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +ac_clean_files_save=$ac_clean_files +ac_clean_files="$ac_clean_files a.out a.exe b.out" +# Try to create an executable without -o first, disregard a.out. +# It will help us diagnose broken compilers, and finding out an intuition +# of exeext. +echo "$as_me:$LINENO: checking for C compiler default output file name" >&5 +echo $ECHO_N "checking for C compiler default output file name... $ECHO_C" >&6 +ac_link_default=`echo "$ac_link" | sed 's/ -o *conftest[^ ]*//'` +if { (eval echo "$as_me:$LINENO: \"$ac_link_default\"") >&5 + (eval $ac_link_default) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + # Find the output, starting from the most likely. This scheme is +# not robust to junk in `.', hence go to wildcards (a.*) only as a last +# resort. + +# Be careful to initialize this variable, since it used to be cached. +# Otherwise an old cache value of `no' led to `EXEEXT = no' in a Makefile. +ac_cv_exeext= +# b.out is created by i960 compilers. +for ac_file in a_out.exe a.exe conftest.exe a.out conftest a.* conftest.* b.out +do + test -f "$ac_file" || continue + case $ac_file in + *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.o | *.obj ) + ;; + conftest.$ac_ext ) + # This is the source file. + ;; + [ab].out ) + # We found the default executable, but exeext='' is most + # certainly right. + break;; + *.* ) + ac_cv_exeext=`expr "$ac_file" : '[^.]*\(\..*\)'` + # FIXME: I believe we export ac_cv_exeext for Libtool, + # but it would be cool to find out if it's true. Does anybody + # maintain Libtool? --akim. + export ac_cv_exeext + break;; + * ) + break;; + esac +done +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +{ { echo "$as_me:$LINENO: error: C compiler cannot create executables +See \`config.log' for more details." >&5 +echo "$as_me: error: C compiler cannot create executables +See \`config.log' for more details." >&2;} + { (exit 77); exit 77; }; } +fi + +ac_exeext=$ac_cv_exeext +echo "$as_me:$LINENO: result: $ac_file" >&5 +echo "${ECHO_T}$ac_file" >&6 + +# Check the compiler produces executables we can run. If not, either +# the compiler is broken, or we cross compile. +echo "$as_me:$LINENO: checking whether the C compiler works" >&5 +echo $ECHO_N "checking whether the C compiler works... $ECHO_C" >&6 +# FIXME: These cross compiler hacks should be removed for Autoconf 3.0 +# If not cross compiling, check that we can run a simple program. +if test "$cross_compiling" != yes; then + if { ac_try='./$ac_file' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + cross_compiling=no + else + if test "$cross_compiling" = maybe; then + cross_compiling=yes + else + { { echo "$as_me:$LINENO: error: cannot run C compiled programs. +If you meant to cross compile, use \`--host'. +See \`config.log' for more details." >&5 +echo "$as_me: error: cannot run C compiled programs. +If you meant to cross compile, use \`--host'. +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } + fi + fi +fi +echo "$as_me:$LINENO: result: yes" >&5 +echo "${ECHO_T}yes" >&6 + +rm -f a.out a.exe conftest$ac_cv_exeext b.out +ac_clean_files=$ac_clean_files_save +# Check the compiler produces executables we can run. If not, either +# the compiler is broken, or we cross compile. +echo "$as_me:$LINENO: checking whether we are cross compiling" >&5 +echo $ECHO_N "checking whether we are cross compiling... $ECHO_C" >&6 +echo "$as_me:$LINENO: result: $cross_compiling" >&5 +echo "${ECHO_T}$cross_compiling" >&6 + +echo "$as_me:$LINENO: checking for suffix of executables" >&5 +echo $ECHO_N "checking for suffix of executables... $ECHO_C" >&6 +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + # If both `conftest.exe' and `conftest' are `present' (well, observable) +# catch `conftest.exe'. For instance with Cygwin, `ls conftest' will +# work properly (i.e., refer to `conftest.exe'), while it won't with +# `rm'. +for ac_file in conftest.exe conftest conftest.*; do + test -f "$ac_file" || continue + case $ac_file in + *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.o | *.obj ) ;; + *.* ) ac_cv_exeext=`expr "$ac_file" : '[^.]*\(\..*\)'` + export ac_cv_exeext + break;; + * ) break;; + esac +done +else + { { echo "$as_me:$LINENO: error: cannot compute suffix of executables: cannot compile and link +See \`config.log' for more details." >&5 +echo "$as_me: error: cannot compute suffix of executables: cannot compile and link +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } +fi + +rm -f conftest$ac_cv_exeext +echo "$as_me:$LINENO: result: $ac_cv_exeext" >&5 +echo "${ECHO_T}$ac_cv_exeext" >&6 + +rm -f conftest.$ac_ext +EXEEXT=$ac_cv_exeext +ac_exeext=$EXEEXT +echo "$as_me:$LINENO: checking for suffix of object files" >&5 +echo $ECHO_N "checking for suffix of object files... $ECHO_C" >&6 +if test "${ac_cv_objext+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.o conftest.obj +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + for ac_file in `(ls conftest.o conftest.obj; ls conftest.*) 2>/dev/null`; do + case $ac_file in + *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg ) ;; + *) ac_cv_objext=`expr "$ac_file" : '.*\.\(.*\)'` + break;; + esac +done +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +{ { echo "$as_me:$LINENO: error: cannot compute suffix of object files: cannot compile +See \`config.log' for more details." >&5 +echo "$as_me: error: cannot compute suffix of object files: cannot compile +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } +fi + +rm -f conftest.$ac_cv_objext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: $ac_cv_objext" >&5 +echo "${ECHO_T}$ac_cv_objext" >&6 +OBJEXT=$ac_cv_objext +ac_objext=$OBJEXT +echo "$as_me:$LINENO: checking whether we are using the GNU C compiler" >&5 +echo $ECHO_N "checking whether we are using the GNU C compiler... $ECHO_C" >&6 +if test "${ac_cv_c_compiler_gnu+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ +#ifndef __GNUC__ + choke me +#endif + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_compiler_gnu=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_compiler_gnu=no +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext +ac_cv_c_compiler_gnu=$ac_compiler_gnu + +fi +echo "$as_me:$LINENO: result: $ac_cv_c_compiler_gnu" >&5 +echo "${ECHO_T}$ac_cv_c_compiler_gnu" >&6 +GCC=`test $ac_compiler_gnu = yes && echo yes` +ac_test_CFLAGS=${CFLAGS+set} +ac_save_CFLAGS=$CFLAGS +CFLAGS="-g" +echo "$as_me:$LINENO: checking whether $CC accepts -g" >&5 +echo $ECHO_N "checking whether $CC accepts -g... $ECHO_C" >&6 +if test "${ac_cv_prog_cc_g+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_prog_cc_g=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_prog_cc_g=no +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: $ac_cv_prog_cc_g" >&5 +echo "${ECHO_T}$ac_cv_prog_cc_g" >&6 +if test "$ac_test_CFLAGS" = set; then + CFLAGS=$ac_save_CFLAGS +elif test $ac_cv_prog_cc_g = yes; then + if test "$GCC" = yes; then + CFLAGS="-g -O2" + else + CFLAGS="-g" + fi +else + if test "$GCC" = yes; then + CFLAGS="-O2" + else + CFLAGS= + fi +fi +echo "$as_me:$LINENO: checking for $CC option to accept ANSI C" >&5 +echo $ECHO_N "checking for $CC option to accept ANSI C... $ECHO_C" >&6 +if test "${ac_cv_prog_cc_stdc+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_cv_prog_cc_stdc=no +ac_save_CC=$CC +cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include <stdarg.h> +#include <stdio.h> +#include <sys/types.h> +#include <sys/stat.h> +/* Most of the following tests are stolen from RCS 5.7's src/conf.sh. */ +struct buf { int x; }; +FILE * (*rcsopen) (struct buf *, struct stat *, int); +static char *e (p, i) + char **p; + int i; +{ + return p[i]; +} +static char *f (char * (*g) (char **, int), char **p, ...) +{ + char *s; + va_list v; + va_start (v,p); + s = g (p, va_arg (v,int)); + va_end (v); + return s; +} + +/* OSF 4.0 Compaq cc is some sort of almost-ANSI by default. It has + function prototypes and stuff, but not '\xHH' hex character constants. + These don't provoke an error unfortunately, instead are silently treated + as 'x'. The following induces an error, until -std1 is added to get + proper ANSI mode. Curiously '\x00'!='x' always comes out true, for an + array size at least. It's necessary to write '\x00'==0 to get something + that's true only with -std1. */ +int osf4_cc_array ['\x00' == 0 ? 1 : -1]; + +int test (int i, double x); +struct s1 {int (*f) (int a);}; +struct s2 {int (*f) (double a);}; +int pairnames (int, char **, FILE *(*)(struct buf *, struct stat *, int), int, int); +int argc; +char **argv; +int +main () +{ +return f (e, argv, 0) != argv[0] || f (e, argv, 1) != argv[1]; + ; + return 0; +} +_ACEOF +# Don't try gcc -ansi; that turns off useful extensions and +# breaks some systems' header files. +# AIX -qlanglvl=ansi +# Ultrix and OSF/1 -std1 +# HP-UX 10.20 and later -Ae +# HP-UX older versions -Aa -D_HPUX_SOURCE +# SVR4 -Xc -D__EXTENSIONS__ +for ac_arg in "" -qlanglvl=ansi -std1 -Ae "-Aa -D_HPUX_SOURCE" "-Xc -D__EXTENSIONS__" +do + CC="$ac_save_CC $ac_arg" + rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_prog_cc_stdc=$ac_arg +break +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +fi +rm -f conftest.err conftest.$ac_objext +done +rm -f conftest.$ac_ext conftest.$ac_objext +CC=$ac_save_CC + +fi + +case "x$ac_cv_prog_cc_stdc" in + x|xno) + echo "$as_me:$LINENO: result: none needed" >&5 +echo "${ECHO_T}none needed" >&6 ;; + *) + echo "$as_me:$LINENO: result: $ac_cv_prog_cc_stdc" >&5 +echo "${ECHO_T}$ac_cv_prog_cc_stdc" >&6 + CC="$CC $ac_cv_prog_cc_stdc" ;; +esac + +# Some people use a C++ compiler to compile C. Since we use `exit', +# in C++ we need to declare it. In case someone uses the same compiler +# for both compiling C and C++ we need to have the C++ compiler decide +# the declaration of exit, since it's the most demanding environment. +cat >conftest.$ac_ext <<_ACEOF +#ifndef __cplusplus + choke me +#endif +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + for ac_declaration in \ + '' \ + 'extern "C" void std::exit (int) throw (); using std::exit;' \ + 'extern "C" void std::exit (int); using std::exit;' \ + 'extern "C" void exit (int) throw ();' \ + 'extern "C" void exit (int);' \ + 'void exit (int);' +do + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_declaration +#include <stdlib.h> +int +main () +{ +exit (42); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + : +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +continue +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_declaration +int +main () +{ +exit (42); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + break +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext +done +rm -f conftest* +if test -n "$ac_declaration"; then + echo '#ifdef __cplusplus' >>confdefs.h + echo $ac_declaration >>confdefs.h + echo '#endif' >>confdefs.h +fi + +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + +depcc="$CC" am_compiler_list= + +echo "$as_me:$LINENO: checking dependency style of $depcc" >&5 +echo $ECHO_N "checking dependency style of $depcc... $ECHO_C" >&6 +if test "${am_cv_CC_dependencies_compiler_type+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -z "$AMDEP_TRUE" && test -f "$am_depcomp"; then + # We make a subdir and do the tests there. Otherwise we can end up + # making bogus files that we don't know about and never remove. For + # instance it was reported that on HP-UX the gcc test will end up + # making a dummy file named `D' -- because `-MD' means `put the output + # in D'. + mkdir conftest.dir + # Copy depcomp to subdir because otherwise we won't find it if we're + # using a relative directory. + cp "$am_depcomp" conftest.dir + cd conftest.dir + # We will build objects and dependencies in a subdirectory because + # it helps to detect inapplicable dependency modes. For instance + # both Tru64's cc and ICC support -MD to output dependencies as a + # side effect of compilation, but ICC will put the dependencies in + # the current directory while Tru64 will put them in the object + # directory. + mkdir sub + + am_cv_CC_dependencies_compiler_type=none + if test "$am_compiler_list" = ""; then + am_compiler_list=`sed -n 's/^#*\([a-zA-Z0-9]*\))$/\1/p' < ./depcomp` + fi + for depmode in $am_compiler_list; do + # Setup a source with many dependencies, because some compilers + # like to wrap large dependency lists on column 80 (with \), and + # we should not choose a depcomp mode which is confused by this. + # + # We need to recreate these files for each test, as the compiler may + # overwrite some of them when testing with obscure command lines. + # This happens at least with the AIX C compiler. + : > sub/conftest.c + for i in 1 2 3 4 5 6; do + echo '#include "conftst'$i'.h"' >> sub/conftest.c + # Using `: > sub/conftst$i.h' creates only sub/conftst1.h with + # Solaris 8's {/usr,}/bin/sh. + touch sub/conftst$i.h + done + echo "${am__include} ${am__quote}sub/conftest.Po${am__quote}" > confmf + + case $depmode in + nosideeffect) + # after this tag, mechanisms are not by side-effect, so they'll + # only be used when explicitly requested + if test "x$enable_dependency_tracking" = xyes; then + continue + else + break + fi + ;; + none) break ;; + esac + # We check with `-c' and `-o' for the sake of the "dashmstdout" + # mode. It turns out that the SunPro C++ compiler does not properly + # handle `-M -o', and we need to detect this. + if depmode=$depmode \ + source=sub/conftest.c object=sub/conftest.${OBJEXT-o} \ + depfile=sub/conftest.Po tmpdepfile=sub/conftest.TPo \ + $SHELL ./depcomp $depcc -c -o sub/conftest.${OBJEXT-o} sub/conftest.c \ + >/dev/null 2>conftest.err && + grep sub/conftst6.h sub/conftest.Po > /dev/null 2>&1 && + grep sub/conftest.${OBJEXT-o} sub/conftest.Po > /dev/null 2>&1 && + ${MAKE-make} -s -f confmf > /dev/null 2>&1; then + # icc doesn't choke on unknown options, it will just issue warnings + # or remarks (even with -Werror). So we grep stderr for any message + # that says an option was ignored or not supported. + # When given -MP, icc 7.0 and 7.1 complain thusly: + # icc: Command line warning: ignoring option '-M'; no argument required + # The diagnosis changed in icc 8.0: + # icc: Command line remark: option '-MP' not supported + if (grep 'ignoring option' conftest.err || + grep 'not supported' conftest.err) >/dev/null 2>&1; then :; else + am_cv_CC_dependencies_compiler_type=$depmode + break + fi + fi + done + + cd .. + rm -rf conftest.dir +else + am_cv_CC_dependencies_compiler_type=none +fi + +fi +echo "$as_me:$LINENO: result: $am_cv_CC_dependencies_compiler_type" >&5 +echo "${ECHO_T}$am_cv_CC_dependencies_compiler_type" >&6 +CCDEPMODE=depmode=$am_cv_CC_dependencies_compiler_type + + + +if + test "x$enable_dependency_tracking" != xno \ + && test "$am_cv_CC_dependencies_compiler_type" = gcc3; then + am__fastdepCC_TRUE= + am__fastdepCC_FALSE='#' +else + am__fastdepCC_TRUE='#' + am__fastdepCC_FALSE= +fi + + +echo "$as_me:$LINENO: checking for a sed that does not truncate output" >&5 +echo $ECHO_N "checking for a sed that does not truncate output... $ECHO_C" >&6 +if test "${lt_cv_path_SED+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + # Loop through the user's path and test for sed and gsed. +# Then use that list of sed's as ones to test for truncation. +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for lt_ac_prog in sed gsed; do + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$lt_ac_prog$ac_exec_ext"; then + lt_ac_sed_list="$lt_ac_sed_list $as_dir/$lt_ac_prog$ac_exec_ext" + fi + done + done +done +IFS=$as_save_IFS +lt_ac_max=0 +lt_ac_count=0 +# Add /usr/xpg4/bin/sed as it is typically found on Solaris +# along with /bin/sed that truncates output. +for lt_ac_sed in $lt_ac_sed_list /usr/xpg4/bin/sed; do + test ! -f $lt_ac_sed && continue + cat /dev/null > conftest.in + lt_ac_count=0 + echo $ECHO_N "0123456789$ECHO_C" >conftest.in + # Check for GNU sed and select it if it is found. + if "$lt_ac_sed" --version 2>&1 < /dev/null | grep 'GNU' > /dev/null; then + lt_cv_path_SED=$lt_ac_sed + break + fi + while true; do + cat conftest.in conftest.in >conftest.tmp + mv conftest.tmp conftest.in + cp conftest.in conftest.nl + echo >>conftest.nl + $lt_ac_sed -e 's/a$//' < conftest.nl >conftest.out || break + cmp -s conftest.out conftest.nl || break + # 10000 chars as input seems more than enough + test $lt_ac_count -gt 10 && break + lt_ac_count=`expr $lt_ac_count + 1` + if test $lt_ac_count -gt $lt_ac_max; then + lt_ac_max=$lt_ac_count + lt_cv_path_SED=$lt_ac_sed + fi + done +done + +fi + +SED=$lt_cv_path_SED + +echo "$as_me:$LINENO: result: $SED" >&5 +echo "${ECHO_T}$SED" >&6 + +echo "$as_me:$LINENO: checking for egrep" >&5 +echo $ECHO_N "checking for egrep... $ECHO_C" >&6 +if test "${ac_cv_prog_egrep+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if echo a | (grep -E '(a|b)') >/dev/null 2>&1 + then ac_cv_prog_egrep='grep -E' + else ac_cv_prog_egrep='egrep' + fi +fi +echo "$as_me:$LINENO: result: $ac_cv_prog_egrep" >&5 +echo "${ECHO_T}$ac_cv_prog_egrep" >&6 + EGREP=$ac_cv_prog_egrep + + + +# Check whether --with-gnu-ld or --without-gnu-ld was given. +if test "${with_gnu_ld+set}" = set; then + withval="$with_gnu_ld" + test "$withval" = no || with_gnu_ld=yes +else + with_gnu_ld=no +fi; +ac_prog=ld +if test "$GCC" = yes; then + # Check if gcc -print-prog-name=ld gives a path. + echo "$as_me:$LINENO: checking for ld used by $CC" >&5 +echo $ECHO_N "checking for ld used by $CC... $ECHO_C" >&6 + case $host in + *-*-mingw*) + # gcc leaves a trailing carriage return which upsets mingw + ac_prog=`($CC -print-prog-name=ld) 2>&5 | tr -d '\015'` ;; + *) + ac_prog=`($CC -print-prog-name=ld) 2>&5` ;; + esac + case $ac_prog in + # Accept absolute paths. + [\\/]* | ?:[\\/]*) + re_direlt='/[^/][^/]*/\.\./' + # Canonicalize the pathname of ld + ac_prog=`echo $ac_prog| $SED 's%\\\\%/%g'` + while echo $ac_prog | grep "$re_direlt" > /dev/null 2>&1; do + ac_prog=`echo $ac_prog| $SED "s%$re_direlt%/%"` + done + test -z "$LD" && LD="$ac_prog" + ;; + "") + # If it fails, then pretend we aren't using GCC. + ac_prog=ld + ;; + *) + # If it is relative, then search for the first ld in PATH. + with_gnu_ld=unknown + ;; + esac +elif test "$with_gnu_ld" = yes; then + echo "$as_me:$LINENO: checking for GNU ld" >&5 +echo $ECHO_N "checking for GNU ld... $ECHO_C" >&6 +else + echo "$as_me:$LINENO: checking for non-GNU ld" >&5 +echo $ECHO_N "checking for non-GNU ld... $ECHO_C" >&6 +fi +if test "${lt_cv_path_LD+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -z "$LD"; then + lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR + for ac_dir in $PATH; do + IFS="$lt_save_ifs" + test -z "$ac_dir" && ac_dir=. + if test -f "$ac_dir/$ac_prog" || test -f "$ac_dir/$ac_prog$ac_exeext"; then + lt_cv_path_LD="$ac_dir/$ac_prog" + # Check to see if the program is GNU ld. I'd rather use --version, + # but apparently some variants of GNU ld only accept -v. + # Break only if it was the GNU/non-GNU ld that we prefer. + case `"$lt_cv_path_LD" -v 2>&1 </dev/null` in + *GNU* | *'with BFD'*) + test "$with_gnu_ld" != no && break + ;; + *) + test "$with_gnu_ld" != yes && break + ;; + esac + fi + done + IFS="$lt_save_ifs" +else + lt_cv_path_LD="$LD" # Let the user override the test with a path. +fi +fi + +LD="$lt_cv_path_LD" +if test -n "$LD"; then + echo "$as_me:$LINENO: result: $LD" >&5 +echo "${ECHO_T}$LD" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi +test -z "$LD" && { { echo "$as_me:$LINENO: error: no acceptable ld found in \$PATH" >&5 +echo "$as_me: error: no acceptable ld found in \$PATH" >&2;} + { (exit 1); exit 1; }; } +echo "$as_me:$LINENO: checking if the linker ($LD) is GNU ld" >&5 +echo $ECHO_N "checking if the linker ($LD) is GNU ld... $ECHO_C" >&6 +if test "${lt_cv_prog_gnu_ld+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + # I'd rather use --version here, but apparently some GNU lds only accept -v. +case `$LD -v 2>&1 </dev/null` in +*GNU* | *'with BFD'*) + lt_cv_prog_gnu_ld=yes + ;; +*) + lt_cv_prog_gnu_ld=no + ;; +esac +fi +echo "$as_me:$LINENO: result: $lt_cv_prog_gnu_ld" >&5 +echo "${ECHO_T}$lt_cv_prog_gnu_ld" >&6 +with_gnu_ld=$lt_cv_prog_gnu_ld + + +echo "$as_me:$LINENO: checking for $LD option to reload object files" >&5 +echo $ECHO_N "checking for $LD option to reload object files... $ECHO_C" >&6 +if test "${lt_cv_ld_reload_flag+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_ld_reload_flag='-r' +fi +echo "$as_me:$LINENO: result: $lt_cv_ld_reload_flag" >&5 +echo "${ECHO_T}$lt_cv_ld_reload_flag" >&6 +reload_flag=$lt_cv_ld_reload_flag +case $reload_flag in +"" | " "*) ;; +*) reload_flag=" $reload_flag" ;; +esac +reload_cmds='$LD$reload_flag -o $output$reload_objs' +case $host_os in + darwin*) + if test "$GCC" = yes; then + reload_cmds='$LTCC $LTCFLAGS -nostdlib ${wl}-r -o $output$reload_objs' + else + reload_cmds='$LD$reload_flag -o $output$reload_objs' + fi + ;; +esac + +echo "$as_me:$LINENO: checking for BSD-compatible nm" >&5 +echo $ECHO_N "checking for BSD-compatible nm... $ECHO_C" >&6 +if test "${lt_cv_path_NM+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$NM"; then + # Let the user override the test. + lt_cv_path_NM="$NM" +else + lt_nm_to_check="${ac_tool_prefix}nm" + if test -n "$ac_tool_prefix" && test "$build" = "$host"; then + lt_nm_to_check="$lt_nm_to_check nm" + fi + for lt_tmp_nm in $lt_nm_to_check; do + lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR + for ac_dir in $PATH /usr/ccs/bin/elf /usr/ccs/bin /usr/ucb /bin; do + IFS="$lt_save_ifs" + test -z "$ac_dir" && ac_dir=. + tmp_nm="$ac_dir/$lt_tmp_nm" + if test -f "$tmp_nm" || test -f "$tmp_nm$ac_exeext" ; then + # Check to see if the nm accepts a BSD-compat flag. + # Adding the `sed 1q' prevents false positives on HP-UX, which says: + # nm: unknown option "B" ignored + # Tru64's nm complains that /dev/null is an invalid object file + case `"$tmp_nm" -B /dev/null 2>&1 | sed '1q'` in + */dev/null* | *'Invalid file or object type'*) + lt_cv_path_NM="$tmp_nm -B" + break + ;; + *) + case `"$tmp_nm" -p /dev/null 2>&1 | sed '1q'` in + */dev/null*) + lt_cv_path_NM="$tmp_nm -p" + break + ;; + *) + lt_cv_path_NM=${lt_cv_path_NM="$tmp_nm"} # keep the first match, but + continue # so that we can try to find one that supports BSD flags + ;; + esac + ;; + esac + fi + done + IFS="$lt_save_ifs" + done + test -z "$lt_cv_path_NM" && lt_cv_path_NM=nm +fi +fi +echo "$as_me:$LINENO: result: $lt_cv_path_NM" >&5 +echo "${ECHO_T}$lt_cv_path_NM" >&6 +NM="$lt_cv_path_NM" + +echo "$as_me:$LINENO: checking whether ln -s works" >&5 +echo $ECHO_N "checking whether ln -s works... $ECHO_C" >&6 +LN_S=$as_ln_s +if test "$LN_S" = "ln -s"; then + echo "$as_me:$LINENO: result: yes" >&5 +echo "${ECHO_T}yes" >&6 +else + echo "$as_me:$LINENO: result: no, using $LN_S" >&5 +echo "${ECHO_T}no, using $LN_S" >&6 +fi + +echo "$as_me:$LINENO: checking how to recognise dependent libraries" >&5 +echo $ECHO_N "checking how to recognise dependent libraries... $ECHO_C" >&6 +if test "${lt_cv_deplibs_check_method+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_file_magic_cmd='$MAGIC_CMD' +lt_cv_file_magic_test_file= +lt_cv_deplibs_check_method='unknown' +# Need to set the preceding variable on all platforms that support +# interlibrary dependencies. +# 'none' -- dependencies not supported. +# `unknown' -- same as none, but documents that we really don't know. +# 'pass_all' -- all dependencies passed with no checks. +# 'test_compile' -- check by making test program. +# 'file_magic [[regex]]' -- check by looking for files in library path +# which responds to the $file_magic_cmd with a given extended regex. +# If you have `file' or equivalent on your system and you're not sure +# whether `pass_all' will *always* work, you probably want this one. + +case $host_os in +aix4* | aix5*) + lt_cv_deplibs_check_method=pass_all + ;; + +beos*) + lt_cv_deplibs_check_method=pass_all + ;; + +bsdi[45]*) + lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [ML]SB (shared object|dynamic lib)' + lt_cv_file_magic_cmd='/usr/bin/file -L' + lt_cv_file_magic_test_file=/shlib/libc.so + ;; + +cygwin*) + # func_win32_libid is a shell function defined in ltmain.sh + lt_cv_deplibs_check_method='file_magic ^x86 archive import|^x86 DLL' + lt_cv_file_magic_cmd='func_win32_libid' + ;; + +mingw* | pw32*) + # Base MSYS/MinGW do not provide the 'file' command needed by + # func_win32_libid shell function, so use a weaker test based on 'objdump'. + lt_cv_deplibs_check_method='file_magic file format pei*-i386(.*architecture: i386)?' + lt_cv_file_magic_cmd='$OBJDUMP -f' + ;; + +darwin* | rhapsody*) + lt_cv_deplibs_check_method=pass_all + ;; + +freebsd* | kfreebsd*-gnu | dragonfly*) + if echo __ELF__ | $CC -E - | grep __ELF__ > /dev/null; then + case $host_cpu in + i*86 ) + # Not sure whether the presence of OpenBSD here was a mistake. + # Let's accept both of them until this is cleared up. + lt_cv_deplibs_check_method='file_magic (FreeBSD|OpenBSD|DragonFly)/i[3-9]86 (compact )?demand paged shared library' + lt_cv_file_magic_cmd=/usr/bin/file + lt_cv_file_magic_test_file=`echo /usr/lib/libc.so.*` + ;; + esac + else + lt_cv_deplibs_check_method=pass_all + fi + ;; + +gnu*) + lt_cv_deplibs_check_method=pass_all + ;; + +hpux10.20* | hpux11*) + lt_cv_file_magic_cmd=/usr/bin/file + case $host_cpu in + ia64*) + lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|ELF-[0-9][0-9]) shared object file - IA64' + lt_cv_file_magic_test_file=/usr/lib/hpux32/libc.so + ;; + hppa*64*) + lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|ELF-[0-9][0-9]) shared object file - PA-RISC [0-9].[0-9]' + lt_cv_file_magic_test_file=/usr/lib/pa20_64/libc.sl + ;; + *) + lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|PA-RISC[0-9].[0-9]) shared library' + lt_cv_file_magic_test_file=/usr/lib/libc.sl + ;; + esac + ;; + +interix3*) + # PIC code is broken on Interix 3.x, that's why |\.a not |_pic\.a here + lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so|\.a)$' + ;; + +irix5* | irix6* | nonstopux*) + case $LD in + *-32|*"-32 ") libmagic=32-bit;; + *-n32|*"-n32 ") libmagic=N32;; + *-64|*"-64 ") libmagic=64-bit;; + *) libmagic=never-match;; + esac + lt_cv_deplibs_check_method=pass_all + ;; + +# This must be Linux ELF. +linux*) + lt_cv_deplibs_check_method=pass_all + ;; + +netbsd*) + if echo __ELF__ | $CC -E - | grep __ELF__ > /dev/null; then + lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so\.[0-9]+\.[0-9]+|_pic\.a)$' + else + lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so|_pic\.a)$' + fi + ;; + +newos6*) + lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [ML]SB (executable|dynamic lib)' + lt_cv_file_magic_cmd=/usr/bin/file + lt_cv_file_magic_test_file=/usr/lib/libnls.so + ;; + +nto-qnx*) + lt_cv_deplibs_check_method=unknown + ;; + +openbsd*) + if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then + lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so\.[0-9]+\.[0-9]+|\.so|_pic\.a)$' + else + lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so\.[0-9]+\.[0-9]+|_pic\.a)$' + fi + ;; + +osf3* | osf4* | osf5*) + lt_cv_deplibs_check_method=pass_all + ;; + +solaris*) + lt_cv_deplibs_check_method=pass_all + ;; + +sysv4 | sysv4.3*) + case $host_vendor in + motorola) + lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [ML]SB (shared object|dynamic lib) M[0-9][0-9]* Version [0-9]' + lt_cv_file_magic_test_file=`echo /usr/lib/libc.so*` + ;; + ncr) + lt_cv_deplibs_check_method=pass_all + ;; + sequent) + lt_cv_file_magic_cmd='/bin/file' + lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [LM]SB (shared object|dynamic lib )' + ;; + sni) + lt_cv_file_magic_cmd='/bin/file' + lt_cv_deplibs_check_method="file_magic ELF [0-9][0-9]*-bit [LM]SB dynamic lib" + lt_cv_file_magic_test_file=/lib/libc.so + ;; + siemens) + lt_cv_deplibs_check_method=pass_all + ;; + pc) + lt_cv_deplibs_check_method=pass_all + ;; + esac + ;; + +sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*) + lt_cv_deplibs_check_method=pass_all + ;; +esac + +fi +echo "$as_me:$LINENO: result: $lt_cv_deplibs_check_method" >&5 +echo "${ECHO_T}$lt_cv_deplibs_check_method" >&6 +file_magic_cmd=$lt_cv_file_magic_cmd +deplibs_check_method=$lt_cv_deplibs_check_method +test -z "$deplibs_check_method" && deplibs_check_method=unknown + + + + +# If no C compiler was specified, use CC. +LTCC=${LTCC-"$CC"} + +# If no C compiler flags were specified, use CFLAGS. +LTCFLAGS=${LTCFLAGS-"$CFLAGS"} + +# Allow CC to be a program name with arguments. +compiler=$CC + + +# Check whether --enable-libtool-lock or --disable-libtool-lock was given. +if test "${enable_libtool_lock+set}" = set; then + enableval="$enable_libtool_lock" + +fi; +test "x$enable_libtool_lock" != xno && enable_libtool_lock=yes + +# Some flags need to be propagated to the compiler or linker for good +# libtool support. +case $host in +ia64-*-hpux*) + # Find out which ABI we are using. + echo 'int i;' > conftest.$ac_ext + if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + case `/usr/bin/file conftest.$ac_objext` in + *ELF-32*) + HPUX_IA64_MODE="32" + ;; + *ELF-64*) + HPUX_IA64_MODE="64" + ;; + esac + fi + rm -rf conftest* + ;; +*-*-irix6*) + # Find out which ABI we are using. + echo '#line 3733 "configure"' > conftest.$ac_ext + if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + if test "$lt_cv_prog_gnu_ld" = yes; then + case `/usr/bin/file conftest.$ac_objext` in + *32-bit*) + LD="${LD-ld} -melf32bsmip" + ;; + *N32*) + LD="${LD-ld} -melf32bmipn32" + ;; + *64-bit*) + LD="${LD-ld} -melf64bmip" + ;; + esac + else + case `/usr/bin/file conftest.$ac_objext` in + *32-bit*) + LD="${LD-ld} -32" + ;; + *N32*) + LD="${LD-ld} -n32" + ;; + *64-bit*) + LD="${LD-ld} -64" + ;; + esac + fi + fi + rm -rf conftest* + ;; + +x86_64-*linux*|ppc*-*linux*|powerpc*-*linux*|s390*-*linux*|sparc*-*linux*) + # Find out which ABI we are using. + echo 'int i;' > conftest.$ac_ext + if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + case `/usr/bin/file conftest.o` in + *32-bit*) + case $host in + x86_64-*linux*) + LD="${LD-ld} -m elf_i386" + ;; + ppc64-*linux*|powerpc64-*linux*) + LD="${LD-ld} -m elf32ppclinux" + ;; + s390x-*linux*) + LD="${LD-ld} -m elf_s390" + ;; + sparc64-*linux*) + LD="${LD-ld} -m elf32_sparc" + ;; + esac + ;; + *64-bit*) + case $host in + x86_64-*linux*) + LD="${LD-ld} -m elf_x86_64" + ;; + ppc*-*linux*|powerpc*-*linux*) + LD="${LD-ld} -m elf64ppc" + ;; + s390*-*linux*) + LD="${LD-ld} -m elf64_s390" + ;; + sparc*-*linux*) + LD="${LD-ld} -m elf64_sparc" + ;; + esac + ;; + esac + fi + rm -rf conftest* + ;; + +*-*-sco3.2v5*) + # On SCO OpenServer 5, we need -belf to get full-featured binaries. + SAVE_CFLAGS="$CFLAGS" + CFLAGS="$CFLAGS -belf" + echo "$as_me:$LINENO: checking whether the C compiler needs -belf" >&5 +echo $ECHO_N "checking whether the C compiler needs -belf... $ECHO_C" >&6 +if test "${lt_cv_cc_needs_belf+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + lt_cv_cc_needs_belf=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +lt_cv_cc_needs_belf=no +fi +rm -f conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext + ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + +fi +echo "$as_me:$LINENO: result: $lt_cv_cc_needs_belf" >&5 +echo "${ECHO_T}$lt_cv_cc_needs_belf" >&6 + if test x"$lt_cv_cc_needs_belf" != x"yes"; then + # this is probably gcc 2.8.0, egcs 1.0 or newer; no need for -belf + CFLAGS="$SAVE_CFLAGS" + fi + ;; +sparc*-*solaris*) + # Find out which ABI we are using. + echo 'int i;' > conftest.$ac_ext + if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + case `/usr/bin/file conftest.o` in + *64-bit*) + case $lt_cv_prog_gnu_ld in + yes*) LD="${LD-ld} -m elf64_sparc" ;; + *) LD="${LD-ld} -64" ;; + esac + ;; + esac + fi + rm -rf conftest* + ;; + + +esac + +need_locks="$enable_libtool_lock" + + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu +echo "$as_me:$LINENO: checking how to run the C preprocessor" >&5 +echo $ECHO_N "checking how to run the C preprocessor... $ECHO_C" >&6 +# On Suns, sometimes $CPP names a directory. +if test -n "$CPP" && test -d "$CPP"; then + CPP= +fi +if test -z "$CPP"; then + if test "${ac_cv_prog_CPP+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + # Double quotes because CPP needs to be expanded + for CPP in "$CC -E" "$CC -E -traditional-cpp" "/lib/cpp" + do + ac_preproc_ok=false +for ac_c_preproc_warn_flag in '' yes +do + # Use a header file that comes with gcc, so configuring glibc + # with a fresh cross-compiler works. + # Prefer <limits.h> to <assert.h> if __STDC__ is defined, since + # <limits.h> exists even on freestanding compilers. + # On the NeXT, cc -E runs the code through the compiler's parser, + # not just through cpp. "Syntax error" is here to catch this case. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#ifdef __STDC__ +# include <limits.h> +#else +# include <assert.h> +#endif + Syntax error +_ACEOF +if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5 + (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null; then + if test -s conftest.err; then + ac_cpp_err=$ac_c_preproc_warn_flag + ac_cpp_err=$ac_cpp_err$ac_c_werror_flag + else + ac_cpp_err= + fi +else + ac_cpp_err=yes +fi +if test -z "$ac_cpp_err"; then + : +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + # Broken: fails on valid input. +continue +fi +rm -f conftest.err conftest.$ac_ext + + # OK, works on sane cases. Now check whether non-existent headers + # can be detected and how. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include <ac_nonexistent.h> +_ACEOF +if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5 + (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null; then + if test -s conftest.err; then + ac_cpp_err=$ac_c_preproc_warn_flag + ac_cpp_err=$ac_cpp_err$ac_c_werror_flag + else + ac_cpp_err= + fi +else + ac_cpp_err=yes +fi +if test -z "$ac_cpp_err"; then + # Broken: success on invalid input. +continue +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + # Passes both tests. +ac_preproc_ok=: +break +fi +rm -f conftest.err conftest.$ac_ext + +done +# Because of `break', _AC_PREPROC_IFELSE's cleaning code was skipped. +rm -f conftest.err conftest.$ac_ext +if $ac_preproc_ok; then + break +fi + + done + ac_cv_prog_CPP=$CPP + +fi + CPP=$ac_cv_prog_CPP +else + ac_cv_prog_CPP=$CPP +fi +echo "$as_me:$LINENO: result: $CPP" >&5 +echo "${ECHO_T}$CPP" >&6 +ac_preproc_ok=false +for ac_c_preproc_warn_flag in '' yes +do + # Use a header file that comes with gcc, so configuring glibc + # with a fresh cross-compiler works. + # Prefer <limits.h> to <assert.h> if __STDC__ is defined, since + # <limits.h> exists even on freestanding compilers. + # On the NeXT, cc -E runs the code through the compiler's parser, + # not just through cpp. "Syntax error" is here to catch this case. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#ifdef __STDC__ +# include <limits.h> +#else +# include <assert.h> +#endif + Syntax error +_ACEOF +if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5 + (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null; then + if test -s conftest.err; then + ac_cpp_err=$ac_c_preproc_warn_flag + ac_cpp_err=$ac_cpp_err$ac_c_werror_flag + else + ac_cpp_err= + fi +else + ac_cpp_err=yes +fi +if test -z "$ac_cpp_err"; then + : +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + # Broken: fails on valid input. +continue +fi +rm -f conftest.err conftest.$ac_ext + + # OK, works on sane cases. Now check whether non-existent headers + # can be detected and how. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include <ac_nonexistent.h> +_ACEOF +if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5 + (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null; then + if test -s conftest.err; then + ac_cpp_err=$ac_c_preproc_warn_flag + ac_cpp_err=$ac_cpp_err$ac_c_werror_flag + else + ac_cpp_err= + fi +else + ac_cpp_err=yes +fi +if test -z "$ac_cpp_err"; then + # Broken: success on invalid input. +continue +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + # Passes both tests. +ac_preproc_ok=: +break +fi +rm -f conftest.err conftest.$ac_ext + +done +# Because of `break', _AC_PREPROC_IFELSE's cleaning code was skipped. +rm -f conftest.err conftest.$ac_ext +if $ac_preproc_ok; then + : +else + { { echo "$as_me:$LINENO: error: C preprocessor \"$CPP\" fails sanity check +See \`config.log' for more details." >&5 +echo "$as_me: error: C preprocessor \"$CPP\" fails sanity check +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } +fi + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + + +echo "$as_me:$LINENO: checking for ANSI C header files" >&5 +echo $ECHO_N "checking for ANSI C header files... $ECHO_C" >&6 +if test "${ac_cv_header_stdc+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include <stdlib.h> +#include <stdarg.h> +#include <string.h> +#include <float.h> + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_header_stdc=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_header_stdc=no +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext + +if test $ac_cv_header_stdc = yes; then + # SunOS 4.x string.h does not declare mem*, contrary to ANSI. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include <string.h> + +_ACEOF +if (eval "$ac_cpp conftest.$ac_ext") 2>&5 | + $EGREP "memchr" >/dev/null 2>&1; then + : +else + ac_cv_header_stdc=no +fi +rm -f conftest* + +fi + +if test $ac_cv_header_stdc = yes; then + # ISC 2.0.2 stdlib.h does not declare free, contrary to ANSI. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include <stdlib.h> + +_ACEOF +if (eval "$ac_cpp conftest.$ac_ext") 2>&5 | + $EGREP "free" >/dev/null 2>&1; then + : +else + ac_cv_header_stdc=no +fi +rm -f conftest* + +fi + +if test $ac_cv_header_stdc = yes; then + # /bin/cc in Irix-4.0.5 gets non-ANSI ctype macros unless using -ansi. + if test "$cross_compiling" = yes; then + : +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include <ctype.h> +#if ((' ' & 0x0FF) == 0x020) +# define ISLOWER(c) ('a' <= (c) && (c) <= 'z') +# define TOUPPER(c) (ISLOWER(c) ? 'A' + ((c) - 'a') : (c)) +#else +# define ISLOWER(c) \ + (('a' <= (c) && (c) <= 'i') \ + || ('j' <= (c) && (c) <= 'r') \ + || ('s' <= (c) && (c) <= 'z')) +# define TOUPPER(c) (ISLOWER(c) ? ((c) | 0x40) : (c)) +#endif + +#define XOR(e, f) (((e) && !(f)) || (!(e) && (f))) +int +main () +{ + int i; + for (i = 0; i < 256; i++) + if (XOR (islower (i), ISLOWER (i)) + || toupper (i) != TOUPPER (i)) + exit(2); + exit (0); +} +_ACEOF +rm -f conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { ac_try='./conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + : +else + echo "$as_me: program exited with status $ac_status" >&5 +echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +( exit $ac_status ) +ac_cv_header_stdc=no +fi +rm -f core *.core gmon.out bb.out conftest$ac_exeext conftest.$ac_objext conftest.$ac_ext +fi +fi +fi +echo "$as_me:$LINENO: result: $ac_cv_header_stdc" >&5 +echo "${ECHO_T}$ac_cv_header_stdc" >&6 +if test $ac_cv_header_stdc = yes; then + +cat >>confdefs.h <<\_ACEOF +#define STDC_HEADERS 1 +_ACEOF + +fi + +# On IRIX 5.3, sys/types and inttypes.h are conflicting. + + + + + + + + + +for ac_header in sys/types.h sys/stat.h stdlib.h string.h memory.h strings.h \ + inttypes.h stdint.h unistd.h +do +as_ac_Header=`echo "ac_cv_header_$ac_header" | $as_tr_sh` +echo "$as_me:$LINENO: checking for $ac_header" >&5 +echo $ECHO_N "checking for $ac_header... $ECHO_C" >&6 +if eval "test \"\${$as_ac_Header+set}\" = set"; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_includes_default + +#include <$ac_header> +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + eval "$as_ac_Header=yes" +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +eval "$as_ac_Header=no" +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: `eval echo '${'$as_ac_Header'}'`" >&5 +echo "${ECHO_T}`eval echo '${'$as_ac_Header'}'`" >&6 +if test `eval echo '${'$as_ac_Header'}'` = yes; then + cat >>confdefs.h <<_ACEOF +#define `echo "HAVE_$ac_header" | $as_tr_cpp` 1 +_ACEOF + +fi + +done + + + +for ac_header in dlfcn.h +do +as_ac_Header=`echo "ac_cv_header_$ac_header" | $as_tr_sh` +if eval "test \"\${$as_ac_Header+set}\" = set"; then + echo "$as_me:$LINENO: checking for $ac_header" >&5 +echo $ECHO_N "checking for $ac_header... $ECHO_C" >&6 +if eval "test \"\${$as_ac_Header+set}\" = set"; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +fi +echo "$as_me:$LINENO: result: `eval echo '${'$as_ac_Header'}'`" >&5 +echo "${ECHO_T}`eval echo '${'$as_ac_Header'}'`" >&6 +else + # Is the header compilable? +echo "$as_me:$LINENO: checking $ac_header usability" >&5 +echo $ECHO_N "checking $ac_header usability... $ECHO_C" >&6 +cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_includes_default +#include <$ac_header> +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_header_compiler=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_header_compiler=no +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext +echo "$as_me:$LINENO: result: $ac_header_compiler" >&5 +echo "${ECHO_T}$ac_header_compiler" >&6 + +# Is the header present? +echo "$as_me:$LINENO: checking $ac_header presence" >&5 +echo $ECHO_N "checking $ac_header presence... $ECHO_C" >&6 +cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include <$ac_header> +_ACEOF +if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5 + (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null; then + if test -s conftest.err; then + ac_cpp_err=$ac_c_preproc_warn_flag + ac_cpp_err=$ac_cpp_err$ac_c_werror_flag + else + ac_cpp_err= + fi +else + ac_cpp_err=yes +fi +if test -z "$ac_cpp_err"; then + ac_header_preproc=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + ac_header_preproc=no +fi +rm -f conftest.err conftest.$ac_ext +echo "$as_me:$LINENO: result: $ac_header_preproc" >&5 +echo "${ECHO_T}$ac_header_preproc" >&6 + +# So? What about this header? +case $ac_header_compiler:$ac_header_preproc:$ac_c_preproc_warn_flag in + yes:no: ) + { echo "$as_me:$LINENO: WARNING: $ac_header: accepted by the compiler, rejected by the preprocessor!" >&5 +echo "$as_me: WARNING: $ac_header: accepted by the compiler, rejected by the preprocessor!" >&2;} + { echo "$as_me:$LINENO: WARNING: $ac_header: proceeding with the compiler's result" >&5 +echo "$as_me: WARNING: $ac_header: proceeding with the compiler's result" >&2;} + ac_header_preproc=yes + ;; + no:yes:* ) + { echo "$as_me:$LINENO: WARNING: $ac_header: present but cannot be compiled" >&5 +echo "$as_me: WARNING: $ac_header: present but cannot be compiled" >&2;} + { echo "$as_me:$LINENO: WARNING: $ac_header: check for missing prerequisite headers?" >&5 +echo "$as_me: WARNING: $ac_header: check for missing prerequisite headers?" >&2;} + { echo "$as_me:$LINENO: WARNING: $ac_header: see the Autoconf documentation" >&5 +echo "$as_me: WARNING: $ac_header: see the Autoconf documentation" >&2;} + { echo "$as_me:$LINENO: WARNING: $ac_header: section \"Present But Cannot Be Compiled\"" >&5 +echo "$as_me: WARNING: $ac_header: section \"Present But Cannot Be Compiled\"" >&2;} + { echo "$as_me:$LINENO: WARNING: $ac_header: proceeding with the preprocessor's result" >&5 +echo "$as_me: WARNING: $ac_header: proceeding with the preprocessor's result" >&2;} + { echo "$as_me:$LINENO: WARNING: $ac_header: in the future, the compiler will take precedence" >&5 +echo "$as_me: WARNING: $ac_header: in the future, the compiler will take precedence" >&2;} + ( + cat <<\_ASBOX +## ---------------------------------------------------------------------- ## +## Report this to https://bugs.freedesktop.org/enter_bug.cgi?product=xorg ## +## ---------------------------------------------------------------------- ## +_ASBOX + ) | + sed "s/^/$as_me: WARNING: /" >&2 + ;; +esac +echo "$as_me:$LINENO: checking for $ac_header" >&5 +echo $ECHO_N "checking for $ac_header... $ECHO_C" >&6 +if eval "test \"\${$as_ac_Header+set}\" = set"; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + eval "$as_ac_Header=\$ac_header_preproc" +fi +echo "$as_me:$LINENO: result: `eval echo '${'$as_ac_Header'}'`" >&5 +echo "${ECHO_T}`eval echo '${'$as_ac_Header'}'`" >&6 + +fi +if test `eval echo '${'$as_ac_Header'}'` = yes; then + cat >>confdefs.h <<_ACEOF +#define `echo "HAVE_$ac_header" | $as_tr_cpp` 1 +_ACEOF + +fi + +done + +ac_ext=cc +ac_cpp='$CXXCPP $CPPFLAGS' +ac_compile='$CXX -c $CXXFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CXX -o conftest$ac_exeext $CXXFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_cxx_compiler_gnu +if test -n "$ac_tool_prefix"; then + for ac_prog in $CCC g++ c++ gpp aCC CC cxx cc++ cl FCC KCC RCC xlC_r xlC + do + # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args. +set dummy $ac_tool_prefix$ac_prog; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_CXX+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$CXX"; then + ac_cv_prog_CXX="$CXX" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_CXX="$ac_tool_prefix$ac_prog" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +CXX=$ac_cv_prog_CXX +if test -n "$CXX"; then + echo "$as_me:$LINENO: result: $CXX" >&5 +echo "${ECHO_T}$CXX" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + test -n "$CXX" && break + done +fi +if test -z "$CXX"; then + ac_ct_CXX=$CXX + for ac_prog in $CCC g++ c++ gpp aCC CC cxx cc++ cl FCC KCC RCC xlC_r xlC +do + # Extract the first word of "$ac_prog", so it can be a program name with args. +set dummy $ac_prog; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_ac_ct_CXX+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_CXX"; then + ac_cv_prog_ac_ct_CXX="$ac_ct_CXX" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_CXX="$ac_prog" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +ac_ct_CXX=$ac_cv_prog_ac_ct_CXX +if test -n "$ac_ct_CXX"; then + echo "$as_me:$LINENO: result: $ac_ct_CXX" >&5 +echo "${ECHO_T}$ac_ct_CXX" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + test -n "$ac_ct_CXX" && break +done +test -n "$ac_ct_CXX" || ac_ct_CXX="g++" + + CXX=$ac_ct_CXX +fi + + +# Provide some information about the compiler. +echo "$as_me:$LINENO:" \ + "checking for C++ compiler version" >&5 +ac_compiler=`set X $ac_compile; echo $2` +{ (eval echo "$as_me:$LINENO: \"$ac_compiler --version </dev/null >&5\"") >&5 + (eval $ac_compiler --version </dev/null >&5) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } +{ (eval echo "$as_me:$LINENO: \"$ac_compiler -v </dev/null >&5\"") >&5 + (eval $ac_compiler -v </dev/null >&5) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } +{ (eval echo "$as_me:$LINENO: \"$ac_compiler -V </dev/null >&5\"") >&5 + (eval $ac_compiler -V </dev/null >&5) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } + +echo "$as_me:$LINENO: checking whether we are using the GNU C++ compiler" >&5 +echo $ECHO_N "checking whether we are using the GNU C++ compiler... $ECHO_C" >&6 +if test "${ac_cv_cxx_compiler_gnu+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ +#ifndef __GNUC__ + choke me +#endif + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_cxx_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_compiler_gnu=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_compiler_gnu=no +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext +ac_cv_cxx_compiler_gnu=$ac_compiler_gnu + +fi +echo "$as_me:$LINENO: result: $ac_cv_cxx_compiler_gnu" >&5 +echo "${ECHO_T}$ac_cv_cxx_compiler_gnu" >&6 +GXX=`test $ac_compiler_gnu = yes && echo yes` +ac_test_CXXFLAGS=${CXXFLAGS+set} +ac_save_CXXFLAGS=$CXXFLAGS +CXXFLAGS="-g" +echo "$as_me:$LINENO: checking whether $CXX accepts -g" >&5 +echo $ECHO_N "checking whether $CXX accepts -g... $ECHO_C" >&6 +if test "${ac_cv_prog_cxx_g+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_cxx_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_prog_cxx_g=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_prog_cxx_g=no +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: $ac_cv_prog_cxx_g" >&5 +echo "${ECHO_T}$ac_cv_prog_cxx_g" >&6 +if test "$ac_test_CXXFLAGS" = set; then + CXXFLAGS=$ac_save_CXXFLAGS +elif test $ac_cv_prog_cxx_g = yes; then + if test "$GXX" = yes; then + CXXFLAGS="-g -O2" + else + CXXFLAGS="-g" + fi +else + if test "$GXX" = yes; then + CXXFLAGS="-O2" + else + CXXFLAGS= + fi +fi +for ac_declaration in \ + '' \ + 'extern "C" void std::exit (int) throw (); using std::exit;' \ + 'extern "C" void std::exit (int); using std::exit;' \ + 'extern "C" void exit (int) throw ();' \ + 'extern "C" void exit (int);' \ + 'void exit (int);' +do + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_declaration +#include <stdlib.h> +int +main () +{ +exit (42); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_cxx_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + : +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +continue +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_declaration +int +main () +{ +exit (42); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_cxx_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + break +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext +done +rm -f conftest* +if test -n "$ac_declaration"; then + echo '#ifdef __cplusplus' >>confdefs.h + echo $ac_declaration >>confdefs.h + echo '#endif' >>confdefs.h +fi + +ac_ext=cc +ac_cpp='$CXXCPP $CPPFLAGS' +ac_compile='$CXX -c $CXXFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CXX -o conftest$ac_exeext $CXXFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_cxx_compiler_gnu + +depcc="$CXX" am_compiler_list= + +echo "$as_me:$LINENO: checking dependency style of $depcc" >&5 +echo $ECHO_N "checking dependency style of $depcc... $ECHO_C" >&6 +if test "${am_cv_CXX_dependencies_compiler_type+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -z "$AMDEP_TRUE" && test -f "$am_depcomp"; then + # We make a subdir and do the tests there. Otherwise we can end up + # making bogus files that we don't know about and never remove. For + # instance it was reported that on HP-UX the gcc test will end up + # making a dummy file named `D' -- because `-MD' means `put the output + # in D'. + mkdir conftest.dir + # Copy depcomp to subdir because otherwise we won't find it if we're + # using a relative directory. + cp "$am_depcomp" conftest.dir + cd conftest.dir + # We will build objects and dependencies in a subdirectory because + # it helps to detect inapplicable dependency modes. For instance + # both Tru64's cc and ICC support -MD to output dependencies as a + # side effect of compilation, but ICC will put the dependencies in + # the current directory while Tru64 will put them in the object + # directory. + mkdir sub + + am_cv_CXX_dependencies_compiler_type=none + if test "$am_compiler_list" = ""; then + am_compiler_list=`sed -n 's/^#*\([a-zA-Z0-9]*\))$/\1/p' < ./depcomp` + fi + for depmode in $am_compiler_list; do + # Setup a source with many dependencies, because some compilers + # like to wrap large dependency lists on column 80 (with \), and + # we should not choose a depcomp mode which is confused by this. + # + # We need to recreate these files for each test, as the compiler may + # overwrite some of them when testing with obscure command lines. + # This happens at least with the AIX C compiler. + : > sub/conftest.c + for i in 1 2 3 4 5 6; do + echo '#include "conftst'$i'.h"' >> sub/conftest.c + # Using `: > sub/conftst$i.h' creates only sub/conftst1.h with + # Solaris 8's {/usr,}/bin/sh. + touch sub/conftst$i.h + done + echo "${am__include} ${am__quote}sub/conftest.Po${am__quote}" > confmf + + case $depmode in + nosideeffect) + # after this tag, mechanisms are not by side-effect, so they'll + # only be used when explicitly requested + if test "x$enable_dependency_tracking" = xyes; then + continue + else + break + fi + ;; + none) break ;; + esac + # We check with `-c' and `-o' for the sake of the "dashmstdout" + # mode. It turns out that the SunPro C++ compiler does not properly + # handle `-M -o', and we need to detect this. + if depmode=$depmode \ + source=sub/conftest.c object=sub/conftest.${OBJEXT-o} \ + depfile=sub/conftest.Po tmpdepfile=sub/conftest.TPo \ + $SHELL ./depcomp $depcc -c -o sub/conftest.${OBJEXT-o} sub/conftest.c \ + >/dev/null 2>conftest.err && + grep sub/conftst6.h sub/conftest.Po > /dev/null 2>&1 && + grep sub/conftest.${OBJEXT-o} sub/conftest.Po > /dev/null 2>&1 && + ${MAKE-make} -s -f confmf > /dev/null 2>&1; then + # icc doesn't choke on unknown options, it will just issue warnings + # or remarks (even with -Werror). So we grep stderr for any message + # that says an option was ignored or not supported. + # When given -MP, icc 7.0 and 7.1 complain thusly: + # icc: Command line warning: ignoring option '-M'; no argument required + # The diagnosis changed in icc 8.0: + # icc: Command line remark: option '-MP' not supported + if (grep 'ignoring option' conftest.err || + grep 'not supported' conftest.err) >/dev/null 2>&1; then :; else + am_cv_CXX_dependencies_compiler_type=$depmode + break + fi + fi + done + + cd .. + rm -rf conftest.dir +else + am_cv_CXX_dependencies_compiler_type=none +fi + +fi +echo "$as_me:$LINENO: result: $am_cv_CXX_dependencies_compiler_type" >&5 +echo "${ECHO_T}$am_cv_CXX_dependencies_compiler_type" >&6 +CXXDEPMODE=depmode=$am_cv_CXX_dependencies_compiler_type + + + +if + test "x$enable_dependency_tracking" != xno \ + && test "$am_cv_CXX_dependencies_compiler_type" = gcc3; then + am__fastdepCXX_TRUE= + am__fastdepCXX_FALSE='#' +else + am__fastdepCXX_TRUE='#' + am__fastdepCXX_FALSE= +fi + + + + +if test -n "$CXX" && ( test "X$CXX" != "Xno" && + ( (test "X$CXX" = "Xg++" && `g++ -v >/dev/null 2>&1` ) || + (test "X$CXX" != "Xg++"))) ; then + ac_ext=cc +ac_cpp='$CXXCPP $CPPFLAGS' +ac_compile='$CXX -c $CXXFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CXX -o conftest$ac_exeext $CXXFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_cxx_compiler_gnu +echo "$as_me:$LINENO: checking how to run the C++ preprocessor" >&5 +echo $ECHO_N "checking how to run the C++ preprocessor... $ECHO_C" >&6 +if test -z "$CXXCPP"; then + if test "${ac_cv_prog_CXXCPP+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + # Double quotes because CXXCPP needs to be expanded + for CXXCPP in "$CXX -E" "/lib/cpp" + do + ac_preproc_ok=false +for ac_cxx_preproc_warn_flag in '' yes +do + # Use a header file that comes with gcc, so configuring glibc + # with a fresh cross-compiler works. + # Prefer <limits.h> to <assert.h> if __STDC__ is defined, since + # <limits.h> exists even on freestanding compilers. + # On the NeXT, cc -E runs the code through the compiler's parser, + # not just through cpp. "Syntax error" is here to catch this case. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#ifdef __STDC__ +# include <limits.h> +#else +# include <assert.h> +#endif + Syntax error +_ACEOF +if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5 + (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null; then + if test -s conftest.err; then + ac_cpp_err=$ac_cxx_preproc_warn_flag + ac_cpp_err=$ac_cpp_err$ac_cxx_werror_flag + else + ac_cpp_err= + fi +else + ac_cpp_err=yes +fi +if test -z "$ac_cpp_err"; then + : +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + # Broken: fails on valid input. +continue +fi +rm -f conftest.err conftest.$ac_ext + + # OK, works on sane cases. Now check whether non-existent headers + # can be detected and how. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include <ac_nonexistent.h> +_ACEOF +if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5 + (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null; then + if test -s conftest.err; then + ac_cpp_err=$ac_cxx_preproc_warn_flag + ac_cpp_err=$ac_cpp_err$ac_cxx_werror_flag + else + ac_cpp_err= + fi +else + ac_cpp_err=yes +fi +if test -z "$ac_cpp_err"; then + # Broken: success on invalid input. +continue +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + # Passes both tests. +ac_preproc_ok=: +break +fi +rm -f conftest.err conftest.$ac_ext + +done +# Because of `break', _AC_PREPROC_IFELSE's cleaning code was skipped. +rm -f conftest.err conftest.$ac_ext +if $ac_preproc_ok; then + break +fi + + done + ac_cv_prog_CXXCPP=$CXXCPP + +fi + CXXCPP=$ac_cv_prog_CXXCPP +else + ac_cv_prog_CXXCPP=$CXXCPP +fi +echo "$as_me:$LINENO: result: $CXXCPP" >&5 +echo "${ECHO_T}$CXXCPP" >&6 +ac_preproc_ok=false +for ac_cxx_preproc_warn_flag in '' yes +do + # Use a header file that comes with gcc, so configuring glibc + # with a fresh cross-compiler works. + # Prefer <limits.h> to <assert.h> if __STDC__ is defined, since + # <limits.h> exists even on freestanding compilers. + # On the NeXT, cc -E runs the code through the compiler's parser, + # not just through cpp. "Syntax error" is here to catch this case. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#ifdef __STDC__ +# include <limits.h> +#else +# include <assert.h> +#endif + Syntax error +_ACEOF +if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5 + (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null; then + if test -s conftest.err; then + ac_cpp_err=$ac_cxx_preproc_warn_flag + ac_cpp_err=$ac_cpp_err$ac_cxx_werror_flag + else + ac_cpp_err= + fi +else + ac_cpp_err=yes +fi +if test -z "$ac_cpp_err"; then + : +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + # Broken: fails on valid input. +continue +fi +rm -f conftest.err conftest.$ac_ext + + # OK, works on sane cases. Now check whether non-existent headers + # can be detected and how. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include <ac_nonexistent.h> +_ACEOF +if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5 + (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null; then + if test -s conftest.err; then + ac_cpp_err=$ac_cxx_preproc_warn_flag + ac_cpp_err=$ac_cpp_err$ac_cxx_werror_flag + else + ac_cpp_err= + fi +else + ac_cpp_err=yes +fi +if test -z "$ac_cpp_err"; then + # Broken: success on invalid input. +continue +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + # Passes both tests. +ac_preproc_ok=: +break +fi +rm -f conftest.err conftest.$ac_ext + +done +# Because of `break', _AC_PREPROC_IFELSE's cleaning code was skipped. +rm -f conftest.err conftest.$ac_ext +if $ac_preproc_ok; then + : +else + { { echo "$as_me:$LINENO: error: C++ preprocessor \"$CXXCPP\" fails sanity check +See \`config.log' for more details." >&5 +echo "$as_me: error: C++ preprocessor \"$CXXCPP\" fails sanity check +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } +fi + +ac_ext=cc +ac_cpp='$CXXCPP $CPPFLAGS' +ac_compile='$CXX -c $CXXFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CXX -o conftest$ac_exeext $CXXFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_cxx_compiler_gnu + +fi + + +ac_ext=f +ac_compile='$F77 -c $FFLAGS conftest.$ac_ext >&5' +ac_link='$F77 -o conftest$ac_exeext $FFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_f77_compiler_gnu +if test -n "$ac_tool_prefix"; then + for ac_prog in g77 f77 xlf frt pgf77 fort77 fl32 af77 f90 xlf90 pgf90 epcf90 f95 fort xlf95 ifc efc pgf95 lf95 gfortran + do + # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args. +set dummy $ac_tool_prefix$ac_prog; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_F77+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$F77"; then + ac_cv_prog_F77="$F77" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_F77="$ac_tool_prefix$ac_prog" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +F77=$ac_cv_prog_F77 +if test -n "$F77"; then + echo "$as_me:$LINENO: result: $F77" >&5 +echo "${ECHO_T}$F77" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + test -n "$F77" && break + done +fi +if test -z "$F77"; then + ac_ct_F77=$F77 + for ac_prog in g77 f77 xlf frt pgf77 fort77 fl32 af77 f90 xlf90 pgf90 epcf90 f95 fort xlf95 ifc efc pgf95 lf95 gfortran +do + # Extract the first word of "$ac_prog", so it can be a program name with args. +set dummy $ac_prog; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_ac_ct_F77+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_F77"; then + ac_cv_prog_ac_ct_F77="$ac_ct_F77" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_F77="$ac_prog" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +ac_ct_F77=$ac_cv_prog_ac_ct_F77 +if test -n "$ac_ct_F77"; then + echo "$as_me:$LINENO: result: $ac_ct_F77" >&5 +echo "${ECHO_T}$ac_ct_F77" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + test -n "$ac_ct_F77" && break +done + + F77=$ac_ct_F77 +fi + + +# Provide some information about the compiler. +echo "$as_me:5332:" \ + "checking for Fortran 77 compiler version" >&5 +ac_compiler=`set X $ac_compile; echo $2` +{ (eval echo "$as_me:$LINENO: \"$ac_compiler --version </dev/null >&5\"") >&5 + (eval $ac_compiler --version </dev/null >&5) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } +{ (eval echo "$as_me:$LINENO: \"$ac_compiler -v </dev/null >&5\"") >&5 + (eval $ac_compiler -v </dev/null >&5) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } +{ (eval echo "$as_me:$LINENO: \"$ac_compiler -V </dev/null >&5\"") >&5 + (eval $ac_compiler -V </dev/null >&5) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } +rm -f a.out + +# If we don't use `.F' as extension, the preprocessor is not run on the +# input file. (Note that this only needs to work for GNU compilers.) +ac_save_ext=$ac_ext +ac_ext=F +echo "$as_me:$LINENO: checking whether we are using the GNU Fortran 77 compiler" >&5 +echo $ECHO_N "checking whether we are using the GNU Fortran 77 compiler... $ECHO_C" >&6 +if test "${ac_cv_f77_compiler_gnu+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF + program main +#ifndef __GNUC__ + choke me +#endif + + end +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_f77_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_compiler_gnu=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_compiler_gnu=no +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext +ac_cv_f77_compiler_gnu=$ac_compiler_gnu + +fi +echo "$as_me:$LINENO: result: $ac_cv_f77_compiler_gnu" >&5 +echo "${ECHO_T}$ac_cv_f77_compiler_gnu" >&6 +ac_ext=$ac_save_ext +ac_test_FFLAGS=${FFLAGS+set} +ac_save_FFLAGS=$FFLAGS +FFLAGS= +echo "$as_me:$LINENO: checking whether $F77 accepts -g" >&5 +echo $ECHO_N "checking whether $F77 accepts -g... $ECHO_C" >&6 +if test "${ac_cv_prog_f77_g+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + FFLAGS=-g +cat >conftest.$ac_ext <<_ACEOF + program main + + end +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_f77_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_prog_f77_g=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_prog_f77_g=no +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext + +fi +echo "$as_me:$LINENO: result: $ac_cv_prog_f77_g" >&5 +echo "${ECHO_T}$ac_cv_prog_f77_g" >&6 +if test "$ac_test_FFLAGS" = set; then + FFLAGS=$ac_save_FFLAGS +elif test $ac_cv_prog_f77_g = yes; then + if test "x$ac_cv_f77_compiler_gnu" = xyes; then + FFLAGS="-g -O2" + else + FFLAGS="-g" + fi +else + if test "x$ac_cv_f77_compiler_gnu" = xyes; then + FFLAGS="-O2" + else + FFLAGS= + fi +fi + +G77=`test $ac_compiler_gnu = yes && echo yes` +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + + + +# Autoconf 2.13's AC_OBJEXT and AC_EXEEXT macros only works for C compilers! + +# find the maximum length of command line arguments +echo "$as_me:$LINENO: checking the maximum length of command line arguments" >&5 +echo $ECHO_N "checking the maximum length of command line arguments... $ECHO_C" >&6 +if test "${lt_cv_sys_max_cmd_len+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + i=0 + teststring="ABCD" + + case $build_os in + msdosdjgpp*) + # On DJGPP, this test can blow up pretty badly due to problems in libc + # (any single argument exceeding 2000 bytes causes a buffer overrun + # during glob expansion). Even if it were fixed, the result of this + # check would be larger than it should be. + lt_cv_sys_max_cmd_len=12288; # 12K is about right + ;; + + gnu*) + # Under GNU Hurd, this test is not required because there is + # no limit to the length of command line arguments. + # Libtool will interpret -1 as no limit whatsoever + lt_cv_sys_max_cmd_len=-1; + ;; + + cygwin* | mingw*) + # On Win9x/ME, this test blows up -- it succeeds, but takes + # about 5 minutes as the teststring grows exponentially. + # Worse, since 9x/ME are not pre-emptively multitasking, + # you end up with a "frozen" computer, even though with patience + # the test eventually succeeds (with a max line length of 256k). + # Instead, let's just punt: use the minimum linelength reported by + # all of the supported platforms: 8192 (on NT/2K/XP). + lt_cv_sys_max_cmd_len=8192; + ;; + + amigaos*) + # On AmigaOS with pdksh, this test takes hours, literally. + # So we just punt and use a minimum line length of 8192. + lt_cv_sys_max_cmd_len=8192; + ;; + + netbsd* | freebsd* | openbsd* | darwin* | dragonfly*) + # This has been around since 386BSD, at least. Likely further. + if test -x /sbin/sysctl; then + lt_cv_sys_max_cmd_len=`/sbin/sysctl -n kern.argmax` + elif test -x /usr/sbin/sysctl; then + lt_cv_sys_max_cmd_len=`/usr/sbin/sysctl -n kern.argmax` + else + lt_cv_sys_max_cmd_len=65536 # usable default for all BSDs + fi + # And add a safety zone + lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 4` + lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \* 3` + ;; + + interix*) + # We know the value 262144 and hardcode it with a safety zone (like BSD) + lt_cv_sys_max_cmd_len=196608 + ;; + + osf*) + # Dr. Hans Ekkehard Plesser reports seeing a kernel panic running configure + # due to this test when exec_disable_arg_limit is 1 on Tru64. It is not + # nice to cause kernel panics so lets avoid the loop below. + # First set a reasonable default. + lt_cv_sys_max_cmd_len=16384 + # + if test -x /sbin/sysconfig; then + case `/sbin/sysconfig -q proc exec_disable_arg_limit` in + *1*) lt_cv_sys_max_cmd_len=-1 ;; + esac + fi + ;; + sco3.2v5*) + lt_cv_sys_max_cmd_len=102400 + ;; + sysv5* | sco5v6* | sysv4.2uw2*) + kargmax=`grep ARG_MAX /etc/conf/cf.d/stune 2>/dev/null` + if test -n "$kargmax"; then + lt_cv_sys_max_cmd_len=`echo $kargmax | sed 's/.*[ ]//'` + else + lt_cv_sys_max_cmd_len=32768 + fi + ;; + *) + # If test is not a shell built-in, we'll probably end up computing a + # maximum length that is only half of the actual maximum length, but + # we can't tell. + SHELL=${SHELL-${CONFIG_SHELL-/bin/sh}} + while (test "X"`$SHELL $0 --fallback-echo "X$teststring" 2>/dev/null` \ + = "XX$teststring") >/dev/null 2>&1 && + new_result=`expr "X$teststring" : ".*" 2>&1` && + lt_cv_sys_max_cmd_len=$new_result && + test $i != 17 # 1/2 MB should be enough + do + i=`expr $i + 1` + teststring=$teststring$teststring + done + teststring= + # Add a significant safety factor because C++ compilers can tack on massive + # amounts of additional arguments before passing them to the linker. + # It appears as though 1/2 is a usable value. + lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 2` + ;; + esac + +fi + +if test -n $lt_cv_sys_max_cmd_len ; then + echo "$as_me:$LINENO: result: $lt_cv_sys_max_cmd_len" >&5 +echo "${ECHO_T}$lt_cv_sys_max_cmd_len" >&6 +else + echo "$as_me:$LINENO: result: none" >&5 +echo "${ECHO_T}none" >&6 +fi + + + + +# Check for command to grab the raw symbol name followed by C symbol from nm. +echo "$as_me:$LINENO: checking command to parse $NM output from $compiler object" >&5 +echo $ECHO_N "checking command to parse $NM output from $compiler object... $ECHO_C" >&6 +if test "${lt_cv_sys_global_symbol_pipe+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + +# These are sane defaults that work on at least a few old systems. +# [They come from Ultrix. What could be older than Ultrix?!! ;)] + +# Character class describing NM global symbol codes. +symcode='[BCDEGRST]' + +# Regexp to match symbols that can be accessed directly from C. +sympat='\([_A-Za-z][_A-Za-z0-9]*\)' + +# Transform an extracted symbol line into a proper C declaration +lt_cv_sys_global_symbol_to_cdecl="sed -n -e 's/^. .* \(.*\)$/extern int \1;/p'" + +# Transform an extracted symbol line into symbol name and symbol address +lt_cv_sys_global_symbol_to_c_name_address="sed -n -e 's/^: \([^ ]*\) $/ {\\\"\1\\\", (lt_ptr) 0},/p' -e 's/^$symcode \([^ ]*\) \([^ ]*\)$/ {\"\2\", (lt_ptr) \&\2},/p'" + +# Define system-specific variables. +case $host_os in +aix*) + symcode='[BCDT]' + ;; +cygwin* | mingw* | pw32*) + symcode='[ABCDGISTW]' + ;; +hpux*) # Its linker distinguishes data from code symbols + if test "$host_cpu" = ia64; then + symcode='[ABCDEGRST]' + fi + lt_cv_sys_global_symbol_to_cdecl="sed -n -e 's/^T .* \(.*\)$/extern int \1();/p' -e 's/^$symcode* .* \(.*\)$/extern char \1;/p'" + lt_cv_sys_global_symbol_to_c_name_address="sed -n -e 's/^: \([^ ]*\) $/ {\\\"\1\\\", (lt_ptr) 0},/p' -e 's/^$symcode* \([^ ]*\) \([^ ]*\)$/ {\"\2\", (lt_ptr) \&\2},/p'" + ;; +linux*) + if test "$host_cpu" = ia64; then + symcode='[ABCDGIRSTW]' + lt_cv_sys_global_symbol_to_cdecl="sed -n -e 's/^T .* \(.*\)$/extern int \1();/p' -e 's/^$symcode* .* \(.*\)$/extern char \1;/p'" + lt_cv_sys_global_symbol_to_c_name_address="sed -n -e 's/^: \([^ ]*\) $/ {\\\"\1\\\", (lt_ptr) 0},/p' -e 's/^$symcode* \([^ ]*\) \([^ ]*\)$/ {\"\2\", (lt_ptr) \&\2},/p'" + fi + ;; +irix* | nonstopux*) + symcode='[BCDEGRST]' + ;; +osf*) + symcode='[BCDEGQRST]' + ;; +solaris*) + symcode='[BDRT]' + ;; +sco3.2v5*) + symcode='[DT]' + ;; +sysv4.2uw2*) + symcode='[DT]' + ;; +sysv5* | sco5v6* | unixware* | OpenUNIX*) + symcode='[ABDT]' + ;; +sysv4) + symcode='[DFNSTU]' + ;; +esac + +# Handle CRLF in mingw tool chain +opt_cr= +case $build_os in +mingw*) + opt_cr=`echo 'x\{0,1\}' | tr x '\015'` # option cr in regexp + ;; +esac + +# If we're using GNU nm, then use its standard symbol codes. +case `$NM -V 2>&1` in +*GNU* | *'with BFD'*) + symcode='[ABCDGIRSTW]' ;; +esac + +# Try without a prefix undercore, then with it. +for ac_symprfx in "" "_"; do + + # Transform symcode, sympat, and symprfx into a raw symbol and a C symbol. + symxfrm="\\1 $ac_symprfx\\2 \\2" + + # Write the raw and C identifiers. + lt_cv_sys_global_symbol_pipe="sed -n -e 's/^.*[ ]\($symcode$symcode*\)[ ][ ]*$ac_symprfx$sympat$opt_cr$/$symxfrm/p'" + + # Check to see that the pipe works correctly. + pipe_works=no + + rm -f conftest* + cat > conftest.$ac_ext <<EOF +#ifdef __cplusplus +extern "C" { +#endif +char nm_test_var; +void nm_test_func(){} +#ifdef __cplusplus +} +#endif +int main(){nm_test_var='a';nm_test_func();return(0);} +EOF + + if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + # Now try to grab the symbols. + nlist=conftest.nm + if { (eval echo "$as_me:$LINENO: \"$NM conftest.$ac_objext \| $lt_cv_sys_global_symbol_pipe \> $nlist\"") >&5 + (eval $NM conftest.$ac_objext \| $lt_cv_sys_global_symbol_pipe \> $nlist) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && test -s "$nlist"; then + # Try sorting and uniquifying the output. + if sort "$nlist" | uniq > "$nlist"T; then + mv -f "$nlist"T "$nlist" + else + rm -f "$nlist"T + fi + + # Make sure that we snagged all the symbols we need. + if grep ' nm_test_var$' "$nlist" >/dev/null; then + if grep ' nm_test_func$' "$nlist" >/dev/null; then + cat <<EOF > conftest.$ac_ext +#ifdef __cplusplus +extern "C" { +#endif + +EOF + # Now generate the symbol file. + eval "$lt_cv_sys_global_symbol_to_cdecl"' < "$nlist" | grep -v main >> conftest.$ac_ext' + + cat <<EOF >> conftest.$ac_ext +#if defined (__STDC__) && __STDC__ +# define lt_ptr_t void * +#else +# define lt_ptr_t char * +# define const +#endif + +/* The mapping between symbol names and symbols. */ +const struct { + const char *name; + lt_ptr_t address; +} +lt_preloaded_symbols[] = +{ +EOF + $SED "s/^$symcode$symcode* \(.*\) \(.*\)$/ {\"\2\", (lt_ptr_t) \&\2},/" < "$nlist" | grep -v main >> conftest.$ac_ext + cat <<\EOF >> conftest.$ac_ext + {0, (lt_ptr_t) 0} +}; + +#ifdef __cplusplus +} +#endif +EOF + # Now try linking the two files. + mv conftest.$ac_objext conftstm.$ac_objext + lt_save_LIBS="$LIBS" + lt_save_CFLAGS="$CFLAGS" + LIBS="conftstm.$ac_objext" + CFLAGS="$CFLAGS$lt_prog_compiler_no_builtin_flag" + if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && test -s conftest${ac_exeext}; then + pipe_works=yes + fi + LIBS="$lt_save_LIBS" + CFLAGS="$lt_save_CFLAGS" + else + echo "cannot find nm_test_func in $nlist" >&5 + fi + else + echo "cannot find nm_test_var in $nlist" >&5 + fi + else + echo "cannot run $lt_cv_sys_global_symbol_pipe" >&5 + fi + else + echo "$progname: failed program was:" >&5 + cat conftest.$ac_ext >&5 + fi + rm -f conftest* conftst* + + # Do not use the global_symbol_pipe unless it works. + if test "$pipe_works" = yes; then + break + else + lt_cv_sys_global_symbol_pipe= + fi +done + +fi + +if test -z "$lt_cv_sys_global_symbol_pipe"; then + lt_cv_sys_global_symbol_to_cdecl= +fi +if test -z "$lt_cv_sys_global_symbol_pipe$lt_cv_sys_global_symbol_to_cdecl"; then + echo "$as_me:$LINENO: result: failed" >&5 +echo "${ECHO_T}failed" >&6 +else + echo "$as_me:$LINENO: result: ok" >&5 +echo "${ECHO_T}ok" >&6 +fi + +echo "$as_me:$LINENO: checking for objdir" >&5 +echo $ECHO_N "checking for objdir... $ECHO_C" >&6 +if test "${lt_cv_objdir+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + rm -f .libs 2>/dev/null +mkdir .libs 2>/dev/null +if test -d .libs; then + lt_cv_objdir=.libs +else + # MS-DOS does not allow filenames that begin with a dot. + lt_cv_objdir=_libs +fi +rmdir .libs 2>/dev/null +fi +echo "$as_me:$LINENO: result: $lt_cv_objdir" >&5 +echo "${ECHO_T}$lt_cv_objdir" >&6 +objdir=$lt_cv_objdir + + + + + +case $host_os in +aix3*) + # AIX sometimes has problems with the GCC collect2 program. For some + # reason, if we set the COLLECT_NAMES environment variable, the problems + # vanish in a puff of smoke. + if test "X${COLLECT_NAMES+set}" != Xset; then + COLLECT_NAMES= + export COLLECT_NAMES + fi + ;; +esac + +# Sed substitution that helps us do robust quoting. It backslashifies +# metacharacters that are still active within double-quoted strings. +Xsed='sed -e 1s/^X//' +sed_quote_subst='s/\([\\"\\`$\\\\]\)/\\\1/g' + +# Same as above, but do not quote variable references. +double_quote_subst='s/\([\\"\\`\\\\]\)/\\\1/g' + +# Sed substitution to delay expansion of an escaped shell variable in a +# double_quote_subst'ed string. +delay_variable_subst='s/\\\\\\\\\\\$/\\\\\\$/g' + +# Sed substitution to avoid accidental globbing in evaled expressions +no_glob_subst='s/\*/\\\*/g' + +# Constants: +rm="rm -f" + +# Global variables: +default_ofile=libtool +can_build_shared=yes + +# All known linkers require a `.a' archive for static linking (except MSVC, +# which needs '.lib'). +libext=a +ltmain="$ac_aux_dir/ltmain.sh" +ofile="$default_ofile" +with_gnu_ld="$lt_cv_prog_gnu_ld" + +if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}ar", so it can be a program name with args. +set dummy ${ac_tool_prefix}ar; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_AR+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$AR"; then + ac_cv_prog_AR="$AR" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_AR="${ac_tool_prefix}ar" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +AR=$ac_cv_prog_AR +if test -n "$AR"; then + echo "$as_me:$LINENO: result: $AR" >&5 +echo "${ECHO_T}$AR" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + +fi +if test -z "$ac_cv_prog_AR"; then + ac_ct_AR=$AR + # Extract the first word of "ar", so it can be a program name with args. +set dummy ar; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_ac_ct_AR+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_AR"; then + ac_cv_prog_ac_ct_AR="$ac_ct_AR" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_AR="ar" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + + test -z "$ac_cv_prog_ac_ct_AR" && ac_cv_prog_ac_ct_AR="false" +fi +fi +ac_ct_AR=$ac_cv_prog_ac_ct_AR +if test -n "$ac_ct_AR"; then + echo "$as_me:$LINENO: result: $ac_ct_AR" >&5 +echo "${ECHO_T}$ac_ct_AR" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + AR=$ac_ct_AR +else + AR="$ac_cv_prog_AR" +fi + +if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}ranlib", so it can be a program name with args. +set dummy ${ac_tool_prefix}ranlib; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_RANLIB+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$RANLIB"; then + ac_cv_prog_RANLIB="$RANLIB" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_RANLIB="${ac_tool_prefix}ranlib" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +RANLIB=$ac_cv_prog_RANLIB +if test -n "$RANLIB"; then + echo "$as_me:$LINENO: result: $RANLIB" >&5 +echo "${ECHO_T}$RANLIB" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + +fi +if test -z "$ac_cv_prog_RANLIB"; then + ac_ct_RANLIB=$RANLIB + # Extract the first word of "ranlib", so it can be a program name with args. +set dummy ranlib; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_ac_ct_RANLIB+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_RANLIB"; then + ac_cv_prog_ac_ct_RANLIB="$ac_ct_RANLIB" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_RANLIB="ranlib" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + + test -z "$ac_cv_prog_ac_ct_RANLIB" && ac_cv_prog_ac_ct_RANLIB=":" +fi +fi +ac_ct_RANLIB=$ac_cv_prog_ac_ct_RANLIB +if test -n "$ac_ct_RANLIB"; then + echo "$as_me:$LINENO: result: $ac_ct_RANLIB" >&5 +echo "${ECHO_T}$ac_ct_RANLIB" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + RANLIB=$ac_ct_RANLIB +else + RANLIB="$ac_cv_prog_RANLIB" +fi + +if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}strip", so it can be a program name with args. +set dummy ${ac_tool_prefix}strip; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_STRIP+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$STRIP"; then + ac_cv_prog_STRIP="$STRIP" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_STRIP="${ac_tool_prefix}strip" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +STRIP=$ac_cv_prog_STRIP +if test -n "$STRIP"; then + echo "$as_me:$LINENO: result: $STRIP" >&5 +echo "${ECHO_T}$STRIP" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + +fi +if test -z "$ac_cv_prog_STRIP"; then + ac_ct_STRIP=$STRIP + # Extract the first word of "strip", so it can be a program name with args. +set dummy strip; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_ac_ct_STRIP+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_STRIP"; then + ac_cv_prog_ac_ct_STRIP="$ac_ct_STRIP" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_STRIP="strip" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + + test -z "$ac_cv_prog_ac_ct_STRIP" && ac_cv_prog_ac_ct_STRIP=":" +fi +fi +ac_ct_STRIP=$ac_cv_prog_ac_ct_STRIP +if test -n "$ac_ct_STRIP"; then + echo "$as_me:$LINENO: result: $ac_ct_STRIP" >&5 +echo "${ECHO_T}$ac_ct_STRIP" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + STRIP=$ac_ct_STRIP +else + STRIP="$ac_cv_prog_STRIP" +fi + + +old_CC="$CC" +old_CFLAGS="$CFLAGS" + +# Set sane defaults for various variables +test -z "$AR" && AR=ar +test -z "$AR_FLAGS" && AR_FLAGS=cru +test -z "$AS" && AS=as +test -z "$CC" && CC=cc +test -z "$LTCC" && LTCC=$CC +test -z "$LTCFLAGS" && LTCFLAGS=$CFLAGS +test -z "$DLLTOOL" && DLLTOOL=dlltool +test -z "$LD" && LD=ld +test -z "$LN_S" && LN_S="ln -s" +test -z "$MAGIC_CMD" && MAGIC_CMD=file +test -z "$NM" && NM=nm +test -z "$SED" && SED=sed +test -z "$OBJDUMP" && OBJDUMP=objdump +test -z "$RANLIB" && RANLIB=: +test -z "$STRIP" && STRIP=: +test -z "$ac_objext" && ac_objext=o + +# Determine commands to create old-style static archives. +old_archive_cmds='$AR $AR_FLAGS $oldlib$oldobjs$old_deplibs' +old_postinstall_cmds='chmod 644 $oldlib' +old_postuninstall_cmds= + +if test -n "$RANLIB"; then + case $host_os in + openbsd*) + old_postinstall_cmds="$old_postinstall_cmds~\$RANLIB -t \$oldlib" + ;; + *) + old_postinstall_cmds="$old_postinstall_cmds~\$RANLIB \$oldlib" + ;; + esac + old_archive_cmds="$old_archive_cmds~\$RANLIB \$oldlib" +fi + +for cc_temp in $compiler""; do + case $cc_temp in + compile | *[\\/]compile | ccache | *[\\/]ccache ) ;; + distcc | *[\\/]distcc | purify | *[\\/]purify ) ;; + \-*) ;; + *) break;; + esac +done +cc_basename=`$echo "X$cc_temp" | $Xsed -e 's%.*/%%' -e "s%^$host_alias-%%"` + + +# Only perform the check for file, if the check method requires it +case $deplibs_check_method in +file_magic*) + if test "$file_magic_cmd" = '$MAGIC_CMD'; then + echo "$as_me:$LINENO: checking for ${ac_tool_prefix}file" >&5 +echo $ECHO_N "checking for ${ac_tool_prefix}file... $ECHO_C" >&6 +if test "${lt_cv_path_MAGIC_CMD+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + case $MAGIC_CMD in +[\\/*] | ?:[\\/]*) + lt_cv_path_MAGIC_CMD="$MAGIC_CMD" # Let the user override the test with a path. + ;; +*) + lt_save_MAGIC_CMD="$MAGIC_CMD" + lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR + ac_dummy="/usr/bin$PATH_SEPARATOR$PATH" + for ac_dir in $ac_dummy; do + IFS="$lt_save_ifs" + test -z "$ac_dir" && ac_dir=. + if test -f $ac_dir/${ac_tool_prefix}file; then + lt_cv_path_MAGIC_CMD="$ac_dir/${ac_tool_prefix}file" + if test -n "$file_magic_test_file"; then + case $deplibs_check_method in + "file_magic "*) + file_magic_regex=`expr "$deplibs_check_method" : "file_magic \(.*\)"` + MAGIC_CMD="$lt_cv_path_MAGIC_CMD" + if eval $file_magic_cmd \$file_magic_test_file 2> /dev/null | + $EGREP "$file_magic_regex" > /dev/null; then + : + else + cat <<EOF 1>&2 + +*** Warning: the command libtool uses to detect shared libraries, +*** $file_magic_cmd, produces output that libtool cannot recognize. +*** The result is that libtool may fail to recognize shared libraries +*** as such. This will affect the creation of libtool libraries that +*** depend on shared libraries, but programs linked with such libtool +*** libraries will work regardless of this problem. Nevertheless, you +*** may want to report the problem to your system manager and/or to +*** bug-libtool@gnu.org + +EOF + fi ;; + esac + fi + break + fi + done + IFS="$lt_save_ifs" + MAGIC_CMD="$lt_save_MAGIC_CMD" + ;; +esac +fi + +MAGIC_CMD="$lt_cv_path_MAGIC_CMD" +if test -n "$MAGIC_CMD"; then + echo "$as_me:$LINENO: result: $MAGIC_CMD" >&5 +echo "${ECHO_T}$MAGIC_CMD" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + +if test -z "$lt_cv_path_MAGIC_CMD"; then + if test -n "$ac_tool_prefix"; then + echo "$as_me:$LINENO: checking for file" >&5 +echo $ECHO_N "checking for file... $ECHO_C" >&6 +if test "${lt_cv_path_MAGIC_CMD+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + case $MAGIC_CMD in +[\\/*] | ?:[\\/]*) + lt_cv_path_MAGIC_CMD="$MAGIC_CMD" # Let the user override the test with a path. + ;; +*) + lt_save_MAGIC_CMD="$MAGIC_CMD" + lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR + ac_dummy="/usr/bin$PATH_SEPARATOR$PATH" + for ac_dir in $ac_dummy; do + IFS="$lt_save_ifs" + test -z "$ac_dir" && ac_dir=. + if test -f $ac_dir/file; then + lt_cv_path_MAGIC_CMD="$ac_dir/file" + if test -n "$file_magic_test_file"; then + case $deplibs_check_method in + "file_magic "*) + file_magic_regex=`expr "$deplibs_check_method" : "file_magic \(.*\)"` + MAGIC_CMD="$lt_cv_path_MAGIC_CMD" + if eval $file_magic_cmd \$file_magic_test_file 2> /dev/null | + $EGREP "$file_magic_regex" > /dev/null; then + : + else + cat <<EOF 1>&2 + +*** Warning: the command libtool uses to detect shared libraries, +*** $file_magic_cmd, produces output that libtool cannot recognize. +*** The result is that libtool may fail to recognize shared libraries +*** as such. This will affect the creation of libtool libraries that +*** depend on shared libraries, but programs linked with such libtool +*** libraries will work regardless of this problem. Nevertheless, you +*** may want to report the problem to your system manager and/or to +*** bug-libtool@gnu.org + +EOF + fi ;; + esac + fi + break + fi + done + IFS="$lt_save_ifs" + MAGIC_CMD="$lt_save_MAGIC_CMD" + ;; +esac +fi + +MAGIC_CMD="$lt_cv_path_MAGIC_CMD" +if test -n "$MAGIC_CMD"; then + echo "$as_me:$LINENO: result: $MAGIC_CMD" >&5 +echo "${ECHO_T}$MAGIC_CMD" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + else + MAGIC_CMD=: + fi +fi + + fi + ;; +esac + +enable_dlopen=no +enable_win32_dll=no + +# Check whether --enable-libtool-lock or --disable-libtool-lock was given. +if test "${enable_libtool_lock+set}" = set; then + enableval="$enable_libtool_lock" + +fi; +test "x$enable_libtool_lock" != xno && enable_libtool_lock=yes + + +# Check whether --with-pic or --without-pic was given. +if test "${with_pic+set}" = set; then + withval="$with_pic" + pic_mode="$withval" +else + pic_mode=default +fi; +test -z "$pic_mode" && pic_mode=default + +# Use C for the default configuration in the libtool script +tagname= +lt_save_CC="$CC" +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + + +# Source file extension for C test sources. +ac_ext=c + +# Object file extension for compiled C test sources. +objext=o +objext=$objext + +# Code to be used in simple compile tests +lt_simple_compile_test_code="int some_variable = 0;\n" + +# Code to be used in simple link tests +lt_simple_link_test_code='int main(){return(0);}\n' + + +# If no C compiler was specified, use CC. +LTCC=${LTCC-"$CC"} + +# If no C compiler flags were specified, use CFLAGS. +LTCFLAGS=${LTCFLAGS-"$CFLAGS"} + +# Allow CC to be a program name with arguments. +compiler=$CC + + +# save warnings/boilerplate of simple test code +ac_outfile=conftest.$ac_objext +printf "$lt_simple_compile_test_code" >conftest.$ac_ext +eval "$ac_compile" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err +_lt_compiler_boilerplate=`cat conftest.err` +$rm conftest* + +ac_outfile=conftest.$ac_objext +printf "$lt_simple_link_test_code" >conftest.$ac_ext +eval "$ac_link" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err +_lt_linker_boilerplate=`cat conftest.err` +$rm conftest* + + + +lt_prog_compiler_no_builtin_flag= + +if test "$GCC" = yes; then + lt_prog_compiler_no_builtin_flag=' -fno-builtin' + + +echo "$as_me:$LINENO: checking if $compiler supports -fno-rtti -fno-exceptions" >&5 +echo $ECHO_N "checking if $compiler supports -fno-rtti -fno-exceptions... $ECHO_C" >&6 +if test "${lt_cv_prog_compiler_rtti_exceptions+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_prog_compiler_rtti_exceptions=no + ac_outfile=conftest.$ac_objext + printf "$lt_simple_compile_test_code" > conftest.$ac_ext + lt_compiler_flag="-fno-rtti -fno-exceptions" + # Insert the option either (1) after the last *FLAGS variable, or + # (2) before a word containing "conftest.", or (3) at the end. + # Note that $ac_compile itself does not contain backslashes and begins + # with a dollar sign (not a hyphen), so the echo should work correctly. + # The option is referenced via a variable to avoid confusing sed. + lt_compile=`echo "$ac_compile" | $SED \ + -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \ + -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \ + -e 's:$: $lt_compiler_flag:'` + (eval echo "\"\$as_me:6395: $lt_compile\"" >&5) + (eval "$lt_compile" 2>conftest.err) + ac_status=$? + cat conftest.err >&5 + echo "$as_me:6399: \$? = $ac_status" >&5 + if (exit $ac_status) && test -s "$ac_outfile"; then + # The compiler can only warn and ignore the option if not recognized + # So say no if there are warnings other than the usual output. + $echo "X$_lt_compiler_boilerplate" | $Xsed -e '/^$/d' >conftest.exp + $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2 + if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then + lt_cv_prog_compiler_rtti_exceptions=yes + fi + fi + $rm conftest* + +fi +echo "$as_me:$LINENO: result: $lt_cv_prog_compiler_rtti_exceptions" >&5 +echo "${ECHO_T}$lt_cv_prog_compiler_rtti_exceptions" >&6 + +if test x"$lt_cv_prog_compiler_rtti_exceptions" = xyes; then + lt_prog_compiler_no_builtin_flag="$lt_prog_compiler_no_builtin_flag -fno-rtti -fno-exceptions" +else + : +fi + +fi + +lt_prog_compiler_wl= +lt_prog_compiler_pic= +lt_prog_compiler_static= + +echo "$as_me:$LINENO: checking for $compiler option to produce PIC" >&5 +echo $ECHO_N "checking for $compiler option to produce PIC... $ECHO_C" >&6 + + if test "$GCC" = yes; then + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_static='-static' + + case $host_os in + aix*) + # All AIX code is PIC. + if test "$host_cpu" = ia64; then + # AIX 5 now supports IA64 processor + lt_prog_compiler_static='-Bstatic' + fi + ;; + + amigaos*) + # FIXME: we need at least 68020 code to build shared libraries, but + # adding the `-m68020' flag to GCC prevents building anything better, + # like `-m68040'. + lt_prog_compiler_pic='-m68020 -resident32 -malways-restore-a4' + ;; + + beos* | cygwin* | irix5* | irix6* | nonstopux* | osf3* | osf4* | osf5*) + # PIC is the default for these OSes. + ;; + + mingw* | pw32* | os2*) + # This hack is so that the source file can tell whether it is being + # built for inclusion in a dll (and should export symbols for example). + lt_prog_compiler_pic='-DDLL_EXPORT' + ;; + + darwin* | rhapsody*) + # PIC is the default on this platform + # Common symbols not allowed in MH_DYLIB files + lt_prog_compiler_pic='-fno-common' + ;; + + interix3*) + # Interix 3.x gcc -fpic/-fPIC options generate broken code. + # Instead, we relocate shared libraries at runtime. + ;; + + msdosdjgpp*) + # Just because we use GCC doesn't mean we suddenly get shared libraries + # on systems that don't support them. + lt_prog_compiler_can_build_shared=no + enable_shared=no + ;; + + sysv4*MP*) + if test -d /usr/nec; then + lt_prog_compiler_pic=-Kconform_pic + fi + ;; + + hpux*) + # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but + # not for PA HP-UX. + case $host_cpu in + hppa*64*|ia64*) + # +Z the default + ;; + *) + lt_prog_compiler_pic='-fPIC' + ;; + esac + ;; + + *) + lt_prog_compiler_pic='-fPIC' + ;; + esac + else + # PORTME Check for flag to pass linker flags through the system compiler. + case $host_os in + aix*) + lt_prog_compiler_wl='-Wl,' + if test "$host_cpu" = ia64; then + # AIX 5 now supports IA64 processor + lt_prog_compiler_static='-Bstatic' + else + lt_prog_compiler_static='-bnso -bI:/lib/syscalls.exp' + fi + ;; + darwin*) + # PIC is the default on this platform + # Common symbols not allowed in MH_DYLIB files + case $cc_basename in + xlc*) + lt_prog_compiler_pic='-qnocommon' + lt_prog_compiler_wl='-Wl,' + ;; + esac + ;; + + mingw* | pw32* | os2*) + # This hack is so that the source file can tell whether it is being + # built for inclusion in a dll (and should export symbols for example). + lt_prog_compiler_pic='-DDLL_EXPORT' + ;; + + hpux9* | hpux10* | hpux11*) + lt_prog_compiler_wl='-Wl,' + # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but + # not for PA HP-UX. + case $host_cpu in + hppa*64*|ia64*) + # +Z the default + ;; + *) + lt_prog_compiler_pic='+Z' + ;; + esac + # Is there a better lt_prog_compiler_static that works with the bundled CC? + lt_prog_compiler_static='${wl}-a ${wl}archive' + ;; + + irix5* | irix6* | nonstopux*) + lt_prog_compiler_wl='-Wl,' + # PIC (with -KPIC) is the default. + lt_prog_compiler_static='-non_shared' + ;; + + newsos6) + lt_prog_compiler_pic='-KPIC' + lt_prog_compiler_static='-Bstatic' + ;; + + linux*) + case $cc_basename in + icc* | ecc*) + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_pic='-KPIC' + lt_prog_compiler_static='-static' + ;; + pgcc* | pgf77* | pgf90* | pgf95*) + # Portland Group compilers (*not* the Pentium gcc compiler, + # which looks to be a dead project) + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_pic='-fpic' + lt_prog_compiler_static='-Bstatic' + ;; + ccc*) + lt_prog_compiler_wl='-Wl,' + # All Alpha code is PIC. + lt_prog_compiler_static='-non_shared' + ;; + esac + ;; + + osf3* | osf4* | osf5*) + lt_prog_compiler_wl='-Wl,' + # All OSF/1 code is PIC. + lt_prog_compiler_static='-non_shared' + ;; + + solaris*) + lt_prog_compiler_pic='-KPIC' + lt_prog_compiler_static='-Bstatic' + case $cc_basename in + f77* | f90* | f95*) + lt_prog_compiler_wl='-Qoption ld ';; + *) + lt_prog_compiler_wl='-Wl,';; + esac + ;; + + sunos4*) + lt_prog_compiler_wl='-Qoption ld ' + lt_prog_compiler_pic='-PIC' + lt_prog_compiler_static='-Bstatic' + ;; + + sysv4 | sysv4.2uw2* | sysv4.3*) + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_pic='-KPIC' + lt_prog_compiler_static='-Bstatic' + ;; + + sysv4*MP*) + if test -d /usr/nec ;then + lt_prog_compiler_pic='-Kconform_pic' + lt_prog_compiler_static='-Bstatic' + fi + ;; + + sysv5* | unixware* | sco3.2v5* | sco5v6* | OpenUNIX*) + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_pic='-KPIC' + lt_prog_compiler_static='-Bstatic' + ;; + + unicos*) + lt_prog_compiler_wl='-Wl,' + lt_prog_compiler_can_build_shared=no + ;; + + uts4*) + lt_prog_compiler_pic='-pic' + lt_prog_compiler_static='-Bstatic' + ;; + + *) + lt_prog_compiler_can_build_shared=no + ;; + esac + fi + +echo "$as_me:$LINENO: result: $lt_prog_compiler_pic" >&5 +echo "${ECHO_T}$lt_prog_compiler_pic" >&6 + +# +# Check to make sure the PIC flag actually works. +# +if test -n "$lt_prog_compiler_pic"; then + +echo "$as_me:$LINENO: checking if $compiler PIC flag $lt_prog_compiler_pic works" >&5 +echo $ECHO_N "checking if $compiler PIC flag $lt_prog_compiler_pic works... $ECHO_C" >&6 +if test "${lt_prog_compiler_pic_works+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_prog_compiler_pic_works=no + ac_outfile=conftest.$ac_objext + printf "$lt_simple_compile_test_code" > conftest.$ac_ext + lt_compiler_flag="$lt_prog_compiler_pic -DPIC" + # Insert the option either (1) after the last *FLAGS variable, or + # (2) before a word containing "conftest.", or (3) at the end. + # Note that $ac_compile itself does not contain backslashes and begins + # with a dollar sign (not a hyphen), so the echo should work correctly. + # The option is referenced via a variable to avoid confusing sed. + lt_compile=`echo "$ac_compile" | $SED \ + -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \ + -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \ + -e 's:$: $lt_compiler_flag:'` + (eval echo "\"\$as_me:6663: $lt_compile\"" >&5) + (eval "$lt_compile" 2>conftest.err) + ac_status=$? + cat conftest.err >&5 + echo "$as_me:6667: \$? = $ac_status" >&5 + if (exit $ac_status) && test -s "$ac_outfile"; then + # The compiler can only warn and ignore the option if not recognized + # So say no if there are warnings other than the usual output. + $echo "X$_lt_compiler_boilerplate" | $Xsed -e '/^$/d' >conftest.exp + $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2 + if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then + lt_prog_compiler_pic_works=yes + fi + fi + $rm conftest* + +fi +echo "$as_me:$LINENO: result: $lt_prog_compiler_pic_works" >&5 +echo "${ECHO_T}$lt_prog_compiler_pic_works" >&6 + +if test x"$lt_prog_compiler_pic_works" = xyes; then + case $lt_prog_compiler_pic in + "" | " "*) ;; + *) lt_prog_compiler_pic=" $lt_prog_compiler_pic" ;; + esac +else + lt_prog_compiler_pic= + lt_prog_compiler_can_build_shared=no +fi + +fi +case $host_os in + # For platforms which do not support PIC, -DPIC is meaningless: + *djgpp*) + lt_prog_compiler_pic= + ;; + *) + lt_prog_compiler_pic="$lt_prog_compiler_pic -DPIC" + ;; +esac + +# +# Check to make sure the static flag actually works. +# +wl=$lt_prog_compiler_wl eval lt_tmp_static_flag=\"$lt_prog_compiler_static\" +echo "$as_me:$LINENO: checking if $compiler static flag $lt_tmp_static_flag works" >&5 +echo $ECHO_N "checking if $compiler static flag $lt_tmp_static_flag works... $ECHO_C" >&6 +if test "${lt_prog_compiler_static_works+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_prog_compiler_static_works=no + save_LDFLAGS="$LDFLAGS" + LDFLAGS="$LDFLAGS $lt_tmp_static_flag" + printf "$lt_simple_link_test_code" > conftest.$ac_ext + if (eval $ac_link 2>conftest.err) && test -s conftest$ac_exeext; then + # The linker can only warn and ignore the option if not recognized + # So say no if there are warnings + if test -s conftest.err; then + # Append any errors to the config.log. + cat conftest.err 1>&5 + $echo "X$_lt_linker_boilerplate" | $Xsed -e '/^$/d' > conftest.exp + $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2 + if diff conftest.exp conftest.er2 >/dev/null; then + lt_prog_compiler_static_works=yes + fi + else + lt_prog_compiler_static_works=yes + fi + fi + $rm conftest* + LDFLAGS="$save_LDFLAGS" + +fi +echo "$as_me:$LINENO: result: $lt_prog_compiler_static_works" >&5 +echo "${ECHO_T}$lt_prog_compiler_static_works" >&6 + +if test x"$lt_prog_compiler_static_works" = xyes; then + : +else + lt_prog_compiler_static= +fi + + +echo "$as_me:$LINENO: checking if $compiler supports -c -o file.$ac_objext" >&5 +echo $ECHO_N "checking if $compiler supports -c -o file.$ac_objext... $ECHO_C" >&6 +if test "${lt_cv_prog_compiler_c_o+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_prog_compiler_c_o=no + $rm -r conftest 2>/dev/null + mkdir conftest + cd conftest + mkdir out + printf "$lt_simple_compile_test_code" > conftest.$ac_ext + + lt_compiler_flag="-o out/conftest2.$ac_objext" + # Insert the option either (1) after the last *FLAGS variable, or + # (2) before a word containing "conftest.", or (3) at the end. + # Note that $ac_compile itself does not contain backslashes and begins + # with a dollar sign (not a hyphen), so the echo should work correctly. + lt_compile=`echo "$ac_compile" | $SED \ + -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \ + -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \ + -e 's:$: $lt_compiler_flag:'` + (eval echo "\"\$as_me:6767: $lt_compile\"" >&5) + (eval "$lt_compile" 2>out/conftest.err) + ac_status=$? + cat out/conftest.err >&5 + echo "$as_me:6771: \$? = $ac_status" >&5 + if (exit $ac_status) && test -s out/conftest2.$ac_objext + then + # The compiler can only warn and ignore the option if not recognized + # So say no if there are warnings + $echo "X$_lt_compiler_boilerplate" | $Xsed -e '/^$/d' > out/conftest.exp + $SED '/^$/d; /^ *+/d' out/conftest.err >out/conftest.er2 + if test ! -s out/conftest.er2 || diff out/conftest.exp out/conftest.er2 >/dev/null; then + lt_cv_prog_compiler_c_o=yes + fi + fi + chmod u+w . 2>&5 + $rm conftest* + # SGI C++ compiler will create directory out/ii_files/ for + # template instantiation + test -d out/ii_files && $rm out/ii_files/* && rmdir out/ii_files + $rm out/* && rmdir out + cd .. + rmdir conftest + $rm conftest* + +fi +echo "$as_me:$LINENO: result: $lt_cv_prog_compiler_c_o" >&5 +echo "${ECHO_T}$lt_cv_prog_compiler_c_o" >&6 + + +hard_links="nottested" +if test "$lt_cv_prog_compiler_c_o" = no && test "$need_locks" != no; then + # do not overwrite the value of need_locks provided by the user + echo "$as_me:$LINENO: checking if we can lock with hard links" >&5 +echo $ECHO_N "checking if we can lock with hard links... $ECHO_C" >&6 + hard_links=yes + $rm conftest* + ln conftest.a conftest.b 2>/dev/null && hard_links=no + touch conftest.a + ln conftest.a conftest.b 2>&5 || hard_links=no + ln conftest.a conftest.b 2>/dev/null && hard_links=no + echo "$as_me:$LINENO: result: $hard_links" >&5 +echo "${ECHO_T}$hard_links" >&6 + if test "$hard_links" = no; then + { echo "$as_me:$LINENO: WARNING: \`$CC' does not support \`-c -o', so \`make -j' may be unsafe" >&5 +echo "$as_me: WARNING: \`$CC' does not support \`-c -o', so \`make -j' may be unsafe" >&2;} + need_locks=warn + fi +else + need_locks=no +fi + +echo "$as_me:$LINENO: checking whether the $compiler linker ($LD) supports shared libraries" >&5 +echo $ECHO_N "checking whether the $compiler linker ($LD) supports shared libraries... $ECHO_C" >&6 + + runpath_var= + allow_undefined_flag= + enable_shared_with_static_runtimes=no + archive_cmds= + archive_expsym_cmds= + old_archive_From_new_cmds= + old_archive_from_expsyms_cmds= + export_dynamic_flag_spec= + whole_archive_flag_spec= + thread_safe_flag_spec= + hardcode_libdir_flag_spec= + hardcode_libdir_flag_spec_ld= + hardcode_libdir_separator= + hardcode_direct=no + hardcode_minus_L=no + hardcode_shlibpath_var=unsupported + link_all_deplibs=unknown + hardcode_automatic=no + module_cmds= + module_expsym_cmds= + always_export_symbols=no + export_symbols_cmds='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols' + # include_expsyms should be a list of space-separated symbols to be *always* + # included in the symbol list + include_expsyms= + # exclude_expsyms can be an extended regexp of symbols to exclude + # it will be wrapped by ` (' and `)$', so one must not match beginning or + # end of line. Example: `a|bc|.*d.*' will exclude the symbols `a' and `bc', + # as well as any symbol that contains `d'. + exclude_expsyms="_GLOBAL_OFFSET_TABLE_" + # Although _GLOBAL_OFFSET_TABLE_ is a valid symbol C name, most a.out + # platforms (ab)use it in PIC code, but their linkers get confused if + # the symbol is explicitly referenced. Since portable code cannot + # rely on this symbol name, it's probably fine to never include it in + # preloaded symbol tables. + extract_expsyms_cmds= + # Just being paranoid about ensuring that cc_basename is set. + for cc_temp in $compiler""; do + case $cc_temp in + compile | *[\\/]compile | ccache | *[\\/]ccache ) ;; + distcc | *[\\/]distcc | purify | *[\\/]purify ) ;; + \-*) ;; + *) break;; + esac +done +cc_basename=`$echo "X$cc_temp" | $Xsed -e 's%.*/%%' -e "s%^$host_alias-%%"` + + case $host_os in + cygwin* | mingw* | pw32*) + # FIXME: the MSVC++ port hasn't been tested in a loooong time + # When not using gcc, we currently assume that we are using + # Microsoft Visual C++. + if test "$GCC" != yes; then + with_gnu_ld=no + fi + ;; + interix*) + # we just hope/assume this is gcc and not c89 (= MSVC++) + with_gnu_ld=yes + ;; + openbsd*) + with_gnu_ld=no + ;; + esac + + ld_shlibs=yes + if test "$with_gnu_ld" = yes; then + # If archive_cmds runs LD, not CC, wlarc should be empty + wlarc='${wl}' + + # Set some defaults for GNU ld with shared library support. These + # are reset later if shared libraries are not supported. Putting them + # here allows them to be overridden if necessary. + runpath_var=LD_RUN_PATH + hardcode_libdir_flag_spec='${wl}--rpath ${wl}$libdir' + export_dynamic_flag_spec='${wl}--export-dynamic' + # ancient GNU ld didn't support --whole-archive et. al. + if $LD --help 2>&1 | grep 'no-whole-archive' > /dev/null; then + whole_archive_flag_spec="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive' + else + whole_archive_flag_spec= + fi + supports_anon_versioning=no + case `$LD -v 2>/dev/null` in + *\ [01].* | *\ 2.[0-9].* | *\ 2.10.*) ;; # catch versions < 2.11 + *\ 2.11.93.0.2\ *) supports_anon_versioning=yes ;; # RH7.3 ... + *\ 2.11.92.0.12\ *) supports_anon_versioning=yes ;; # Mandrake 8.2 ... + *\ 2.11.*) ;; # other 2.11 versions + *) supports_anon_versioning=yes ;; + esac + + # See if GNU ld supports shared libraries. + case $host_os in + aix3* | aix4* | aix5*) + # On AIX/PPC, the GNU linker is very broken + if test "$host_cpu" != ia64; then + ld_shlibs=no + cat <<EOF 1>&2 + +*** Warning: the GNU linker, at least up to release 2.9.1, is reported +*** to be unable to reliably create shared libraries on AIX. +*** Therefore, libtool is disabling shared libraries support. If you +*** really care for shared libraries, you may want to modify your PATH +*** so that a non-GNU linker is found, and then restart. + +EOF + fi + ;; + + amigaos*) + archive_cmds='$rm $output_objdir/a2ixlibrary.data~$echo "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$echo "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$echo "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$echo "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)' + hardcode_libdir_flag_spec='-L$libdir' + hardcode_minus_L=yes + + # Samuel A. Falvo II <kc5tja@dolphin.openprojects.net> reports + # that the semantics of dynamic libraries on AmigaOS, at least up + # to version 4, is to share data among multiple programs linked + # with the same dynamic library. Since this doesn't match the + # behavior of shared libraries on other platforms, we can't use + # them. + ld_shlibs=no + ;; + + beos*) + if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then + allow_undefined_flag=unsupported + # Joseph Beckenbach <jrb3@best.com> says some releases of gcc + # support --undefined. This deserves some investigation. FIXME + archive_cmds='$CC -nostart $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + else + ld_shlibs=no + fi + ;; + + cygwin* | mingw* | pw32*) + # _LT_AC_TAGVAR(hardcode_libdir_flag_spec, ) is actually meaningless, + # as there is no search path for DLLs. + hardcode_libdir_flag_spec='-L$libdir' + allow_undefined_flag=unsupported + always_export_symbols=no + enable_shared_with_static_runtimes=yes + export_symbols_cmds='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[BCDGRS] /s/.* \([^ ]*\)/\1 DATA/'\'' | $SED -e '\''/^[AITW] /s/.* //'\'' | sort | uniq > $export_symbols' + + if $LD --help 2>&1 | grep 'auto-import' > /dev/null; then + archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib' + # If the export-symbols file already is a .def file (1st line + # is EXPORTS), use it as is; otherwise, prepend... + archive_expsym_cmds='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then + cp $export_symbols $output_objdir/$soname.def; + else + echo EXPORTS > $output_objdir/$soname.def; + cat $export_symbols >> $output_objdir/$soname.def; + fi~ + $CC -shared $output_objdir/$soname.def $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib' + else + ld_shlibs=no + fi + ;; + + interix3*) + hardcode_direct=no + hardcode_shlibpath_var=no + hardcode_libdir_flag_spec='${wl}-rpath,$libdir' + export_dynamic_flag_spec='${wl}-E' + # Hack: On Interix 3.x, we cannot compile PIC because of a broken gcc. + # Instead, shared libraries are loaded at an image base (0x10000000 by + # default) and relocated if they conflict, which is a slow very memory + # consuming and fragmenting process. To avoid this, we pick a random, + # 256 KiB-aligned image base between 0x50000000 and 0x6FFC0000 at link + # time. Moving up from 0x10000000 also allows more sbrk(2) space. + archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib' + archive_expsym_cmds='sed "s,^,_," $export_symbols >$output_objdir/$soname.expsym~$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--retain-symbols-file,$output_objdir/$soname.expsym ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib' + ;; + + linux*) + if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then + tmp_addflag= + case $cc_basename,$host_cpu in + pgcc*) # Portland Group C compiler + whole_archive_flag_spec='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}--no-whole-archive' + tmp_addflag=' $pic_flag' + ;; + pgf77* | pgf90* | pgf95*) # Portland Group f77 and f90 compilers + whole_archive_flag_spec='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}--no-whole-archive' + tmp_addflag=' $pic_flag -Mnomain' ;; + ecc*,ia64* | icc*,ia64*) # Intel C compiler on ia64 + tmp_addflag=' -i_dynamic' ;; + efc*,ia64* | ifort*,ia64*) # Intel Fortran compiler on ia64 + tmp_addflag=' -i_dynamic -nofor_main' ;; + ifc* | ifort*) # Intel Fortran compiler + tmp_addflag=' -nofor_main' ;; + esac + archive_cmds='$CC -shared'"$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + + if test $supports_anon_versioning = yes; then + archive_expsym_cmds='$echo "{ global:" > $output_objdir/$libname.ver~ + cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~ + $echo "local: *; };" >> $output_objdir/$libname.ver~ + $CC -shared'"$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-version-script ${wl}$output_objdir/$libname.ver -o $lib' + fi + else + ld_shlibs=no + fi + ;; + + netbsd*) + if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then + archive_cmds='$LD -Bshareable $libobjs $deplibs $linker_flags -o $lib' + wlarc= + else + archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + archive_expsym_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + fi + ;; + + solaris*) + if $LD -v 2>&1 | grep 'BFD 2\.8' > /dev/null; then + ld_shlibs=no + cat <<EOF 1>&2 + +*** Warning: The releases 2.8.* of the GNU linker cannot reliably +*** create shared libraries on Solaris systems. Therefore, libtool +*** is disabling shared libraries support. We urge you to upgrade GNU +*** binutils to release 2.9.1 or newer. Another option is to modify +*** your PATH or compiler configuration so that the native linker is +*** used, and then restart. + +EOF + elif $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then + archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + archive_expsym_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + else + ld_shlibs=no + fi + ;; + + sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX*) + case `$LD -v 2>&1` in + *\ [01].* | *\ 2.[0-9].* | *\ 2.1[0-5].*) + ld_shlibs=no + cat <<_LT_EOF 1>&2 + +*** Warning: Releases of the GNU linker prior to 2.16.91.0.3 can not +*** reliably create shared libraries on SCO systems. Therefore, libtool +*** is disabling shared libraries support. We urge you to upgrade GNU +*** binutils to release 2.16.91.0.3 or newer. Another option is to modify +*** your PATH or compiler configuration so that the native linker is +*** used, and then restart. + +_LT_EOF + ;; + *) + if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then + hardcode_libdir_flag_spec='`test -z "$SCOABSPATH" && echo ${wl}-rpath,$libdir`' + archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib' + archive_expsym_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname,\${SCOABSPATH:+${install_libdir}/}$soname,-retain-symbols-file,$export_symbols -o $lib' + else + ld_shlibs=no + fi + ;; + esac + ;; + + sunos4*) + archive_cmds='$LD -assert pure-text -Bshareable -o $lib $libobjs $deplibs $linker_flags' + wlarc= + hardcode_direct=yes + hardcode_shlibpath_var=no + ;; + + *) + if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then + archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + archive_expsym_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + else + ld_shlibs=no + fi + ;; + esac + + if test "$ld_shlibs" = no; then + runpath_var= + hardcode_libdir_flag_spec= + export_dynamic_flag_spec= + whole_archive_flag_spec= + fi + else + # PORTME fill in a description of your system's linker (not GNU ld) + case $host_os in + aix3*) + allow_undefined_flag=unsupported + always_export_symbols=yes + archive_expsym_cmds='$LD -o $output_objdir/$soname $libobjs $deplibs $linker_flags -bE:$export_symbols -T512 -H512 -bM:SRE~$AR $AR_FLAGS $lib $output_objdir/$soname' + # Note: this linker hardcodes the directories in LIBPATH if there + # are no directories specified by -L. + hardcode_minus_L=yes + if test "$GCC" = yes && test -z "$lt_prog_compiler_static"; then + # Neither direct hardcoding nor static linking is supported with a + # broken collect2. + hardcode_direct=unsupported + fi + ;; + + aix4* | aix5*) + if test "$host_cpu" = ia64; then + # On IA64, the linker does run time linking by default, so we don't + # have to do anything special. + aix_use_runtimelinking=no + exp_sym_flag='-Bexport' + no_entry_flag="" + else + # If we're using GNU nm, then we don't want the "-C" option. + # -C means demangle to AIX nm, but means don't demangle with GNU nm + if $NM -V 2>&1 | grep 'GNU' > /dev/null; then + export_symbols_cmds='$NM -Bpg $libobjs $convenience | awk '\''{ if (((\$2 == "T") || (\$2 == "D") || (\$2 == "B")) && (substr(\$3,1,1) != ".")) { print \$3 } }'\'' | sort -u > $export_symbols' + else + export_symbols_cmds='$NM -BCpg $libobjs $convenience | awk '\''{ if (((\$2 == "T") || (\$2 == "D") || (\$2 == "B")) && (substr(\$3,1,1) != ".")) { print \$3 } }'\'' | sort -u > $export_symbols' + fi + aix_use_runtimelinking=no + + # Test if we are trying to use run time linking or normal + # AIX style linking. If -brtl is somewhere in LDFLAGS, we + # need to do runtime linking. + case $host_os in aix4.[23]|aix4.[23].*|aix5*) + for ld_flag in $LDFLAGS; do + if (test $ld_flag = "-brtl" || test $ld_flag = "-Wl,-brtl"); then + aix_use_runtimelinking=yes + break + fi + done + ;; + esac + + exp_sym_flag='-bexport' + no_entry_flag='-bnoentry' + fi + + # When large executables or shared objects are built, AIX ld can + # have problems creating the table of contents. If linking a library + # or program results in "error TOC overflow" add -mminimal-toc to + # CXXFLAGS/CFLAGS for g++/gcc. In the cases where that is not + # enough to fix the problem, add -Wl,-bbigtoc to LDFLAGS. + + archive_cmds='' + hardcode_direct=yes + hardcode_libdir_separator=':' + link_all_deplibs=yes + + if test "$GCC" = yes; then + case $host_os in aix4.[012]|aix4.[012].*) + # We only want to do this on AIX 4.2 and lower, the check + # below for broken collect2 doesn't work under 4.3+ + collect2name=`${CC} -print-prog-name=collect2` + if test -f "$collect2name" && \ + strings "$collect2name" | grep resolve_lib_name >/dev/null + then + # We have reworked collect2 + hardcode_direct=yes + else + # We have old collect2 + hardcode_direct=unsupported + # It fails to find uninstalled libraries when the uninstalled + # path is not listed in the libpath. Setting hardcode_minus_L + # to unsupported forces relinking + hardcode_minus_L=yes + hardcode_libdir_flag_spec='-L$libdir' + hardcode_libdir_separator= + fi + ;; + esac + shared_flag='-shared' + if test "$aix_use_runtimelinking" = yes; then + shared_flag="$shared_flag "'${wl}-G' + fi + else + # not using gcc + if test "$host_cpu" = ia64; then + # VisualAge C++, Version 5.5 for AIX 5L for IA-64, Beta 3 Release + # chokes on -Wl,-G. The following line is correct: + shared_flag='-G' + else + if test "$aix_use_runtimelinking" = yes; then + shared_flag='${wl}-G' + else + shared_flag='${wl}-bM:SRE' + fi + fi + fi + + # It seems that -bexpall does not export symbols beginning with + # underscore (_), so it is better to generate a list of symbols to export. + always_export_symbols=yes + if test "$aix_use_runtimelinking" = yes; then + # Warning - without using the other runtime loading flags (-brtl), + # -berok will link without error, but may produce a broken library. + allow_undefined_flag='-berok' + # Determine the default libpath from the value encoded in an empty executable. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + +aix_libpath=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; } +}'` +# Check for a 64-bit object if we didn't find anything. +if test -z "$aix_libpath"; then aix_libpath=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; } +}'`; fi +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +fi +rm -f conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext +if test -z "$aix_libpath"; then aix_libpath="/usr/lib:/lib"; fi + + hardcode_libdir_flag_spec='${wl}-blibpath:$libdir:'"$aix_libpath" + archive_expsym_cmds="\$CC"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags `if test "x${allow_undefined_flag}" != "x"; then echo "${wl}${allow_undefined_flag}"; else :; fi` '"\${wl}$exp_sym_flag:\$export_symbols $shared_flag" + else + if test "$host_cpu" = ia64; then + hardcode_libdir_flag_spec='${wl}-R $libdir:/usr/lib:/lib' + allow_undefined_flag="-z nodefs" + archive_expsym_cmds="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags ${wl}${allow_undefined_flag} '"\${wl}$exp_sym_flag:\$export_symbols" + else + # Determine the default libpath from the value encoded in an empty executable. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + +aix_libpath=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; } +}'` +# Check for a 64-bit object if we didn't find anything. +if test -z "$aix_libpath"; then aix_libpath=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; } +}'`; fi +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +fi +rm -f conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext +if test -z "$aix_libpath"; then aix_libpath="/usr/lib:/lib"; fi + + hardcode_libdir_flag_spec='${wl}-blibpath:$libdir:'"$aix_libpath" + # Warning - without using the other run time loading flags, + # -berok will link without error, but may produce a broken library. + no_undefined_flag=' ${wl}-bernotok' + allow_undefined_flag=' ${wl}-berok' + # Exported symbols can be pulled into shared objects from archives + whole_archive_flag_spec='$convenience' + archive_cmds_need_lc=yes + # This is similar to how AIX traditionally builds its shared libraries. + archive_expsym_cmds="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs ${wl}-bnoentry $compiler_flags ${wl}-bE:$export_symbols${allow_undefined_flag}~$AR $AR_FLAGS $output_objdir/$libname$release.a $output_objdir/$soname' + fi + fi + ;; + + amigaos*) + archive_cmds='$rm $output_objdir/a2ixlibrary.data~$echo "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$echo "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$echo "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$echo "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)' + hardcode_libdir_flag_spec='-L$libdir' + hardcode_minus_L=yes + # see comment about different semantics on the GNU ld section + ld_shlibs=no + ;; + + bsdi[45]*) + export_dynamic_flag_spec=-rdynamic + ;; + + cygwin* | mingw* | pw32*) + # When not using gcc, we currently assume that we are using + # Microsoft Visual C++. + # hardcode_libdir_flag_spec is actually meaningless, as there is + # no search path for DLLs. + hardcode_libdir_flag_spec=' ' + allow_undefined_flag=unsupported + # Tell ltmain to make .lib files, not .a files. + libext=lib + # Tell ltmain to make .dll files, not .so files. + shrext_cmds=".dll" + # FIXME: Setting linknames here is a bad hack. + archive_cmds='$CC -o $lib $libobjs $compiler_flags `echo "$deplibs" | $SED -e '\''s/ -lc$//'\''` -link -dll~linknames=' + # The linker will automatically build a .lib file if we build a DLL. + old_archive_From_new_cmds='true' + # FIXME: Should let the user specify the lib program. + old_archive_cmds='lib /OUT:$oldlib$oldobjs$old_deplibs' + fix_srcfile_path='`cygpath -w "$srcfile"`' + enable_shared_with_static_runtimes=yes + ;; + + darwin* | rhapsody*) + case $host_os in + rhapsody* | darwin1.[012]) + allow_undefined_flag='${wl}-undefined ${wl}suppress' + ;; + *) # Darwin 1.3 on + if test -z ${MACOSX_DEPLOYMENT_TARGET} ; then + allow_undefined_flag='${wl}-flat_namespace ${wl}-undefined ${wl}suppress' + else + case ${MACOSX_DEPLOYMENT_TARGET} in + 10.[012]) + allow_undefined_flag='${wl}-flat_namespace ${wl}-undefined ${wl}suppress' + ;; + 10.*) + allow_undefined_flag='${wl}-undefined ${wl}dynamic_lookup' + ;; + esac + fi + ;; + esac + archive_cmds_need_lc=no + hardcode_direct=no + hardcode_automatic=yes + hardcode_shlibpath_var=unsupported + whole_archive_flag_spec='' + link_all_deplibs=yes + if test "$GCC" = yes ; then + output_verbose_link_cmd='echo' + archive_cmds='$CC -dynamiclib $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags -install_name $rpath/$soname $verstring' + module_cmds='$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags' + # Don't fix this by using the ld -exported_symbols_list flag, it doesn't exist in older darwin lds + archive_expsym_cmds='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -dynamiclib $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags -install_name $rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}' + module_expsym_cmds='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}' + else + case $cc_basename in + xlc*) + output_verbose_link_cmd='echo' + archive_cmds='$CC -qmkshrobj $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-install_name ${wl}`echo $rpath/$soname` $verstring' + module_cmds='$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags' + # Don't fix this by using the ld -exported_symbols_list flag, it doesn't exist in older darwin lds + archive_expsym_cmds='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -qmkshrobj $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-install_name ${wl}$rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}' + module_expsym_cmds='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}' + ;; + *) + ld_shlibs=no + ;; + esac + fi + ;; + + dgux*) + archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_libdir_flag_spec='-L$libdir' + hardcode_shlibpath_var=no + ;; + + freebsd1*) + ld_shlibs=no + ;; + + # FreeBSD 2.2.[012] allows us to include c++rt0.o to get C++ constructor + # support. Future versions do this automatically, but an explicit c++rt0.o + # does not break anything, and helps significantly (at the cost of a little + # extra space). + freebsd2.2*) + archive_cmds='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags /usr/lib/c++rt0.o' + hardcode_libdir_flag_spec='-R$libdir' + hardcode_direct=yes + hardcode_shlibpath_var=no + ;; + + # Unfortunately, older versions of FreeBSD 2 do not have this feature. + freebsd2*) + archive_cmds='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' + hardcode_direct=yes + hardcode_minus_L=yes + hardcode_shlibpath_var=no + ;; + + # FreeBSD 3 and greater uses gcc -shared to do shared libraries. + freebsd* | kfreebsd*-gnu | dragonfly*) + archive_cmds='$CC -shared -o $lib $libobjs $deplibs $compiler_flags' + hardcode_libdir_flag_spec='-R$libdir' + hardcode_direct=yes + hardcode_shlibpath_var=no + ;; + + hpux9*) + if test "$GCC" = yes; then + archive_cmds='$rm $output_objdir/$soname~$CC -shared -fPIC ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $libobjs $deplibs $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib' + else + archive_cmds='$rm $output_objdir/$soname~$LD -b +b $install_libdir -o $output_objdir/$soname $libobjs $deplibs $linker_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib' + fi + hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir' + hardcode_libdir_separator=: + hardcode_direct=yes + + # hardcode_minus_L: Not really in the search PATH, + # but as the default location of the library. + hardcode_minus_L=yes + export_dynamic_flag_spec='${wl}-E' + ;; + + hpux10*) + if test "$GCC" = yes -a "$with_gnu_ld" = no; then + archive_cmds='$CC -shared -fPIC ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags' + else + archive_cmds='$LD -b +h $soname +b $install_libdir -o $lib $libobjs $deplibs $linker_flags' + fi + if test "$with_gnu_ld" = no; then + hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir' + hardcode_libdir_separator=: + + hardcode_direct=yes + export_dynamic_flag_spec='${wl}-E' + + # hardcode_minus_L: Not really in the search PATH, + # but as the default location of the library. + hardcode_minus_L=yes + fi + ;; + + hpux11*) + if test "$GCC" = yes -a "$with_gnu_ld" = no; then + case $host_cpu in + hppa*64*) + archive_cmds='$CC -shared ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags' + ;; + ia64*) + archive_cmds='$CC -shared ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags' + ;; + *) + archive_cmds='$CC -shared -fPIC ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags' + ;; + esac + else + case $host_cpu in + hppa*64*) + archive_cmds='$CC -b ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags' + ;; + ia64*) + archive_cmds='$CC -b ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags' + ;; + *) + archive_cmds='$CC -b ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags' + ;; + esac + fi + if test "$with_gnu_ld" = no; then + hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir' + hardcode_libdir_separator=: + + case $host_cpu in + hppa*64*|ia64*) + hardcode_libdir_flag_spec_ld='+b $libdir' + hardcode_direct=no + hardcode_shlibpath_var=no + ;; + *) + hardcode_direct=yes + export_dynamic_flag_spec='${wl}-E' + + # hardcode_minus_L: Not really in the search PATH, + # but as the default location of the library. + hardcode_minus_L=yes + ;; + esac + fi + ;; + + irix5* | irix6* | nonstopux*) + if test "$GCC" = yes; then + archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + else + archive_cmds='$LD -shared $libobjs $deplibs $linker_flags -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib' + hardcode_libdir_flag_spec_ld='-rpath $libdir' + fi + hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir' + hardcode_libdir_separator=: + link_all_deplibs=yes + ;; + + netbsd*) + if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then + archive_cmds='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' # a.out + else + archive_cmds='$LD -shared -o $lib $libobjs $deplibs $linker_flags' # ELF + fi + hardcode_libdir_flag_spec='-R$libdir' + hardcode_direct=yes + hardcode_shlibpath_var=no + ;; + + newsos6) + archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_direct=yes + hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir' + hardcode_libdir_separator=: + hardcode_shlibpath_var=no + ;; + + openbsd*) + hardcode_direct=yes + hardcode_shlibpath_var=no + if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then + archive_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-retain-symbols-file,$export_symbols' + hardcode_libdir_flag_spec='${wl}-rpath,$libdir' + export_dynamic_flag_spec='${wl}-E' + else + case $host_os in + openbsd[01].* | openbsd2.[0-7] | openbsd2.[0-7].*) + archive_cmds='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' + hardcode_libdir_flag_spec='-R$libdir' + ;; + *) + archive_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags' + hardcode_libdir_flag_spec='${wl}-rpath,$libdir' + ;; + esac + fi + ;; + + os2*) + hardcode_libdir_flag_spec='-L$libdir' + hardcode_minus_L=yes + allow_undefined_flag=unsupported + archive_cmds='$echo "LIBRARY $libname INITINSTANCE" > $output_objdir/$libname.def~$echo "DESCRIPTION \"$libname\"" >> $output_objdir/$libname.def~$echo DATA >> $output_objdir/$libname.def~$echo " SINGLE NONSHARED" >> $output_objdir/$libname.def~$echo EXPORTS >> $output_objdir/$libname.def~emxexp $libobjs >> $output_objdir/$libname.def~$CC -Zdll -Zcrtdll -o $lib $libobjs $deplibs $compiler_flags $output_objdir/$libname.def' + old_archive_From_new_cmds='emximp -o $output_objdir/$libname.a $output_objdir/$libname.def' + ;; + + osf3*) + if test "$GCC" = yes; then + allow_undefined_flag=' ${wl}-expect_unresolved ${wl}\*' + archive_cmds='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + else + allow_undefined_flag=' -expect_unresolved \*' + archive_cmds='$LD -shared${allow_undefined_flag} $libobjs $deplibs $linker_flags -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib' + fi + hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir' + hardcode_libdir_separator=: + ;; + + osf4* | osf5*) # as osf3* with the addition of -msym flag + if test "$GCC" = yes; then + allow_undefined_flag=' ${wl}-expect_unresolved ${wl}\*' + archive_cmds='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags ${wl}-msym ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir' + else + allow_undefined_flag=' -expect_unresolved \*' + archive_cmds='$LD -shared${allow_undefined_flag} $libobjs $deplibs $linker_flags -msym -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib' + archive_expsym_cmds='for i in `cat $export_symbols`; do printf "%s %s\\n" -exported_symbol "\$i" >> $lib.exp; done; echo "-hidden">> $lib.exp~ + $LD -shared${allow_undefined_flag} -input $lib.exp $linker_flags $libobjs $deplibs -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib~$rm $lib.exp' + + # Both c and cxx compiler support -rpath directly + hardcode_libdir_flag_spec='-rpath $libdir' + fi + hardcode_libdir_separator=: + ;; + + solaris*) + no_undefined_flag=' -z text' + if test "$GCC" = yes; then + wlarc='${wl}' + archive_cmds='$CC -shared ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~ + $CC -shared ${wl}-M ${wl}$lib.exp ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags~$rm $lib.exp' + else + wlarc='' + archive_cmds='$LD -G${allow_undefined_flag} -h $soname -o $lib $libobjs $deplibs $linker_flags' + archive_expsym_cmds='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~ + $LD -G${allow_undefined_flag} -M $lib.exp -h $soname -o $lib $libobjs $deplibs $linker_flags~$rm $lib.exp' + fi + hardcode_libdir_flag_spec='-R$libdir' + hardcode_shlibpath_var=no + case $host_os in + solaris2.[0-5] | solaris2.[0-5].*) ;; + *) + # The compiler driver will combine linker options so we + # cannot just pass the convience library names through + # without $wl, iff we do not link with $LD. + # Luckily, gcc supports the same syntax we need for Sun Studio. + # Supported since Solaris 2.6 (maybe 2.5.1?) + case $wlarc in + '') + whole_archive_flag_spec='-z allextract$convenience -z defaultextract' ;; + *) + whole_archive_flag_spec='${wl}-z ${wl}allextract`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}-z ${wl}defaultextract' ;; + esac ;; + esac + link_all_deplibs=yes + ;; + + sunos4*) + if test "x$host_vendor" = xsequent; then + # Use $CC to link under sequent, because it throws in some extra .o + # files that make .init and .fini sections work. + archive_cmds='$CC -G ${wl}-h $soname -o $lib $libobjs $deplibs $compiler_flags' + else + archive_cmds='$LD -assert pure-text -Bstatic -o $lib $libobjs $deplibs $linker_flags' + fi + hardcode_libdir_flag_spec='-L$libdir' + hardcode_direct=yes + hardcode_minus_L=yes + hardcode_shlibpath_var=no + ;; + + sysv4) + case $host_vendor in + sni) + archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_direct=yes # is this really true??? + ;; + siemens) + ## LD is ld it makes a PLAMLIB + ## CC just makes a GrossModule. + archive_cmds='$LD -G -o $lib $libobjs $deplibs $linker_flags' + reload_cmds='$CC -r -o $output$reload_objs' + hardcode_direct=no + ;; + motorola) + archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_direct=no #Motorola manual says yes, but my tests say they lie + ;; + esac + runpath_var='LD_RUN_PATH' + hardcode_shlibpath_var=no + ;; + + sysv4.3*) + archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_shlibpath_var=no + export_dynamic_flag_spec='-Bexport' + ;; + + sysv4*MP*) + if test -d /usr/nec; then + archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_shlibpath_var=no + runpath_var=LD_RUN_PATH + hardcode_runpath_var=yes + ld_shlibs=yes + fi + ;; + + sysv4*uw2* | sysv5OpenUNIX* | sysv5UnixWare7.[01].[10]* | unixware7*) + no_undefined_flag='${wl}-z,text' + archive_cmds_need_lc=no + hardcode_shlibpath_var=no + runpath_var='LD_RUN_PATH' + + if test "$GCC" = yes; then + archive_cmds='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + else + archive_cmds='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + fi + ;; + + sysv5* | sco3.2v5* | sco5v6*) + # Note: We can NOT use -z defs as we might desire, because we do not + # link with -lc, and that would cause any symbols used from libc to + # always be unresolved, which means just about no library would + # ever link correctly. If we're not using GNU ld we use -z text + # though, which does catch some bad symbols but isn't as heavy-handed + # as -z defs. + no_undefined_flag='${wl}-z,text' + allow_undefined_flag='${wl}-z,nodefs' + archive_cmds_need_lc=no + hardcode_shlibpath_var=no + hardcode_libdir_flag_spec='`test -z "$SCOABSPATH" && echo ${wl}-R,$libdir`' + hardcode_libdir_separator=':' + link_all_deplibs=yes + export_dynamic_flag_spec='${wl}-Bexport' + runpath_var='LD_RUN_PATH' + + if test "$GCC" = yes; then + archive_cmds='$CC -shared ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags' + else + archive_cmds='$CC -G ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags' + fi + ;; + + uts4*) + archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_libdir_flag_spec='-L$libdir' + hardcode_shlibpath_var=no + ;; + + *) + ld_shlibs=no + ;; + esac + fi + +echo "$as_me:$LINENO: result: $ld_shlibs" >&5 +echo "${ECHO_T}$ld_shlibs" >&6 +test "$ld_shlibs" = no && can_build_shared=no + +# +# Do we need to explicitly link libc? +# +case "x$archive_cmds_need_lc" in +x|xyes) + # Assume -lc should be added + archive_cmds_need_lc=yes + + if test "$enable_shared" = yes && test "$GCC" = yes; then + case $archive_cmds in + *'~'*) + # FIXME: we may have to deal with multi-command sequences. + ;; + '$CC '*) + # Test whether the compiler implicitly links with -lc since on some + # systems, -lgcc has to come before -lc. If gcc already passes -lc + # to ld, don't add -lc before -lgcc. + echo "$as_me:$LINENO: checking whether -lc should be explicitly linked in" >&5 +echo $ECHO_N "checking whether -lc should be explicitly linked in... $ECHO_C" >&6 + $rm conftest* + printf "$lt_simple_compile_test_code" > conftest.$ac_ext + + if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } 2>conftest.err; then + soname=conftest + lib=conftest + libobjs=conftest.$ac_objext + deplibs= + wl=$lt_prog_compiler_wl + pic_flag=$lt_prog_compiler_pic + compiler_flags=-v + linker_flags=-v + verstring= + output_objdir=. + libname=conftest + lt_save_allow_undefined_flag=$allow_undefined_flag + allow_undefined_flag= + if { (eval echo "$as_me:$LINENO: \"$archive_cmds 2\>\&1 \| grep \" -lc \" \>/dev/null 2\>\&1\"") >&5 + (eval $archive_cmds 2\>\&1 \| grep \" -lc \" \>/dev/null 2\>\&1) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } + then + archive_cmds_need_lc=no + else + archive_cmds_need_lc=yes + fi + allow_undefined_flag=$lt_save_allow_undefined_flag + else + cat conftest.err 1>&5 + fi + $rm conftest* + echo "$as_me:$LINENO: result: $archive_cmds_need_lc" >&5 +echo "${ECHO_T}$archive_cmds_need_lc" >&6 + ;; + esac + fi + ;; +esac + +echo "$as_me:$LINENO: checking dynamic linker characteristics" >&5 +echo $ECHO_N "checking dynamic linker characteristics... $ECHO_C" >&6 +library_names_spec= +libname_spec='lib$name' +soname_spec= +shrext_cmds=".so" +postinstall_cmds= +postuninstall_cmds= +finish_cmds= +finish_eval= +shlibpath_var= +shlibpath_overrides_runpath=unknown +version_type=none +dynamic_linker="$host_os ld.so" +sys_lib_dlsearch_path_spec="/lib /usr/lib" +if test "$GCC" = yes; then + sys_lib_search_path_spec=`$CC -print-search-dirs | grep "^libraries:" | $SED -e "s/^libraries://" -e "s,=/,/,g"` + if echo "$sys_lib_search_path_spec" | grep ';' >/dev/null ; then + # if the path contains ";" then we assume it to be the separator + # otherwise default to the standard path separator (i.e. ":") - it is + # assumed that no part of a normal pathname contains ";" but that should + # okay in the real world where ";" in dirpaths is itself problematic. + sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'` + else + sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"` + fi +else + sys_lib_search_path_spec="/lib /usr/lib /usr/local/lib" +fi +need_lib_prefix=unknown +hardcode_into_libs=no + +# when you set need_version to no, make sure it does not cause -set_version +# flags to be left without arguments +need_version=unknown + +case $host_os in +aix3*) + version_type=linux + library_names_spec='${libname}${release}${shared_ext}$versuffix $libname.a' + shlibpath_var=LIBPATH + + # AIX 3 has no versioning support, so we append a major version to the name. + soname_spec='${libname}${release}${shared_ext}$major' + ;; + +aix4* | aix5*) + version_type=linux + need_lib_prefix=no + need_version=no + hardcode_into_libs=yes + if test "$host_cpu" = ia64; then + # AIX 5 supports IA64 + library_names_spec='${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext}$versuffix $libname${shared_ext}' + shlibpath_var=LD_LIBRARY_PATH + else + # With GCC up to 2.95.x, collect2 would create an import file + # for dependence libraries. The import file would start with + # the line `#! .'. This would cause the generated library to + # depend on `.', always an invalid library. This was fixed in + # development snapshots of GCC prior to 3.0. + case $host_os in + aix4 | aix4.[01] | aix4.[01].*) + if { echo '#if __GNUC__ > 2 || (__GNUC__ == 2 && __GNUC_MINOR__ >= 97)' + echo ' yes ' + echo '#endif'; } | ${CC} -E - | grep yes > /dev/null; then + : + else + can_build_shared=no + fi + ;; + esac + # AIX (on Power*) has no versioning support, so currently we can not hardcode correct + # soname into executable. Probably we can add versioning support to + # collect2, so additional links can be useful in future. + if test "$aix_use_runtimelinking" = yes; then + # If using run time linking (on AIX 4.2 or later) use lib<name>.so + # instead of lib<name>.a to let people know that these are not + # typical AIX shared libraries. + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + else + # We preserve .a as extension for shared libraries through AIX4.2 + # and later when we are not doing run time linking. + library_names_spec='${libname}${release}.a $libname.a' + soname_spec='${libname}${release}${shared_ext}$major' + fi + shlibpath_var=LIBPATH + fi + ;; + +amigaos*) + library_names_spec='$libname.ixlibrary $libname.a' + # Create ${libname}_ixlibrary.a entries in /sys/libs. + finish_eval='for lib in `ls $libdir/*.ixlibrary 2>/dev/null`; do libname=`$echo "X$lib" | $Xsed -e '\''s%^.*/\([^/]*\)\.ixlibrary$%\1%'\''`; test $rm /sys/libs/${libname}_ixlibrary.a; $show "cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a"; cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a || exit 1; done' + ;; + +beos*) + library_names_spec='${libname}${shared_ext}' + dynamic_linker="$host_os ld.so" + shlibpath_var=LIBRARY_PATH + ;; + +bsdi[45]*) + version_type=linux + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + finish_cmds='PATH="\$PATH:/sbin" ldconfig $libdir' + shlibpath_var=LD_LIBRARY_PATH + sys_lib_search_path_spec="/shlib /usr/lib /usr/X11/lib /usr/contrib/lib /lib /usr/local/lib" + sys_lib_dlsearch_path_spec="/shlib /usr/lib /usr/local/lib" + # the default ld.so.conf also contains /usr/contrib/lib and + # /usr/X11R6/lib (/usr/X11 is a link to /usr/X11R6), but let us allow + # libtool to hard-code these into programs + ;; + +cygwin* | mingw* | pw32*) + version_type=windows + shrext_cmds=".dll" + need_version=no + need_lib_prefix=no + + case $GCC,$host_os in + yes,cygwin* | yes,mingw* | yes,pw32*) + library_names_spec='$libname.dll.a' + # DLL is installed to $(libdir)/../bin by postinstall_cmds + postinstall_cmds='base_file=`basename \${file}`~ + dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\${base_file}'\''i;echo \$dlname'\''`~ + dldir=$destdir/`dirname \$dlpath`~ + test -d \$dldir || mkdir -p \$dldir~ + $install_prog $dir/$dlname \$dldir/$dlname~ + chmod a+x \$dldir/$dlname' + postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~ + dlpath=$dir/\$dldll~ + $rm \$dlpath' + shlibpath_overrides_runpath=yes + + case $host_os in + cygwin*) + # Cygwin DLLs use 'cyg' prefix rather than 'lib' + soname_spec='`echo ${libname} | sed -e 's/^lib/cyg/'``echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}' + sys_lib_search_path_spec="/usr/lib /lib/w32api /lib /usr/local/lib" + ;; + mingw*) + # MinGW DLLs use traditional 'lib' prefix + soname_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}' + sys_lib_search_path_spec=`$CC -print-search-dirs | grep "^libraries:" | $SED -e "s/^libraries://" -e "s,=/,/,g"` + if echo "$sys_lib_search_path_spec" | grep ';[c-zC-Z]:/' >/dev/null; then + # It is most probably a Windows format PATH printed by + # mingw gcc, but we are running on Cygwin. Gcc prints its search + # path with ; separators, and with drive letters. We can handle the + # drive letters (cygwin fileutils understands them), so leave them, + # especially as we might pass files found there to a mingw objdump, + # which wouldn't understand a cygwinified path. Ahh. + sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'` + else + sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"` + fi + ;; + pw32*) + # pw32 DLLs use 'pw' prefix rather than 'lib' + library_names_spec='`echo ${libname} | sed -e 's/^lib/pw/'``echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}' + ;; + esac + ;; + + *) + library_names_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext} $libname.lib' + ;; + esac + dynamic_linker='Win32 ld.exe' + # FIXME: first we should search . and the directory the executable is in + shlibpath_var=PATH + ;; + +darwin* | rhapsody*) + dynamic_linker="$host_os dyld" + version_type=darwin + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${versuffix}$shared_ext ${libname}${release}${major}$shared_ext ${libname}$shared_ext' + soname_spec='${libname}${release}${major}$shared_ext' + shlibpath_overrides_runpath=yes + shlibpath_var=DYLD_LIBRARY_PATH + shrext_cmds='`test .$module = .yes && echo .so || echo .dylib`' + # Apple's gcc prints 'gcc -print-search-dirs' doesn't operate the same. + if test "$GCC" = yes; then + sys_lib_search_path_spec=`$CC -print-search-dirs | tr "\n" "$PATH_SEPARATOR" | sed -e 's/libraries:/@libraries:/' | tr "@" "\n" | grep "^libraries:" | sed -e "s/^libraries://" -e "s,=/,/,g" -e "s,$PATH_SEPARATOR, ,g" -e "s,.*,& /lib /usr/lib /usr/local/lib,g"` + else + sys_lib_search_path_spec='/lib /usr/lib /usr/local/lib' + fi + sys_lib_dlsearch_path_spec='/usr/local/lib /lib /usr/lib' + ;; + +dgux*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname$shared_ext' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + ;; + +freebsd1*) + dynamic_linker=no + ;; + +kfreebsd*-gnu) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + dynamic_linker='GNU ld.so' + ;; + +freebsd* | dragonfly*) + # DragonFly does not have aout. When/if they implement a new + # versioning mechanism, adjust this. + if test -x /usr/bin/objformat; then + objformat=`/usr/bin/objformat` + else + case $host_os in + freebsd[123]*) objformat=aout ;; + *) objformat=elf ;; + esac + fi + version_type=freebsd-$objformat + case $version_type in + freebsd-elf*) + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}' + need_version=no + need_lib_prefix=no + ;; + freebsd-*) + library_names_spec='${libname}${release}${shared_ext}$versuffix $libname${shared_ext}$versuffix' + need_version=yes + ;; + esac + shlibpath_var=LD_LIBRARY_PATH + case $host_os in + freebsd2*) + shlibpath_overrides_runpath=yes + ;; + freebsd3.[01]* | freebsdelf3.[01]*) + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + ;; + freebsd3.[2-9]* | freebsdelf3.[2-9]* | \ + freebsd4.[0-5] | freebsdelf4.[0-5] | freebsd4.1.1 | freebsdelf4.1.1) + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + ;; + freebsd*) # from 4.6 on + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + ;; + esac + ;; + +gnu*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}${major} ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + hardcode_into_libs=yes + ;; + +hpux9* | hpux10* | hpux11*) + # Give a soname corresponding to the major version so that dld.sl refuses to + # link against other versions. + version_type=sunos + need_lib_prefix=no + need_version=no + case $host_cpu in + ia64*) + shrext_cmds='.so' + hardcode_into_libs=yes + dynamic_linker="$host_os dld.so" + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes # Unless +noenvvar is specified. + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + if test "X$HPUX_IA64_MODE" = X32; then + sys_lib_search_path_spec="/usr/lib/hpux32 /usr/local/lib/hpux32 /usr/local/lib" + else + sys_lib_search_path_spec="/usr/lib/hpux64 /usr/local/lib/hpux64" + fi + sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec + ;; + hppa*64*) + shrext_cmds='.sl' + hardcode_into_libs=yes + dynamic_linker="$host_os dld.sl" + shlibpath_var=LD_LIBRARY_PATH # How should we handle SHLIB_PATH + shlibpath_overrides_runpath=yes # Unless +noenvvar is specified. + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + sys_lib_search_path_spec="/usr/lib/pa20_64 /usr/ccs/lib/pa20_64" + sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec + ;; + *) + shrext_cmds='.sl' + dynamic_linker="$host_os dld.sl" + shlibpath_var=SHLIB_PATH + shlibpath_overrides_runpath=no # +s is required to enable SHLIB_PATH + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + ;; + esac + # HP-UX runs *really* slowly unless shared libraries are mode 555. + postinstall_cmds='chmod 555 $lib' + ;; + +interix3*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + dynamic_linker='Interix 3.x ld.so.1 (PE, like ELF)' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + ;; + +irix5* | irix6* | nonstopux*) + case $host_os in + nonstopux*) version_type=nonstopux ;; + *) + if test "$lt_cv_prog_gnu_ld" = yes; then + version_type=linux + else + version_type=irix + fi ;; + esac + need_lib_prefix=no + need_version=no + soname_spec='${libname}${release}${shared_ext}$major' + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext} $libname${shared_ext}' + case $host_os in + irix5* | nonstopux*) + libsuff= shlibsuff= + ;; + *) + case $LD in # libtool.m4 will add one of these switches to LD + *-32|*"-32 "|*-melf32bsmip|*"-melf32bsmip ") + libsuff= shlibsuff= libmagic=32-bit;; + *-n32|*"-n32 "|*-melf32bmipn32|*"-melf32bmipn32 ") + libsuff=32 shlibsuff=N32 libmagic=N32;; + *-64|*"-64 "|*-melf64bmip|*"-melf64bmip ") + libsuff=64 shlibsuff=64 libmagic=64-bit;; + *) libsuff= shlibsuff= libmagic=never-match;; + esac + ;; + esac + shlibpath_var=LD_LIBRARY${shlibsuff}_PATH + shlibpath_overrides_runpath=no + sys_lib_search_path_spec="/usr/lib${libsuff} /lib${libsuff} /usr/local/lib${libsuff}" + sys_lib_dlsearch_path_spec="/usr/lib${libsuff} /lib${libsuff}" + hardcode_into_libs=yes + ;; + +# No shared lib support for Linux oldld, aout, or coff. +linux*oldld* | linux*aout* | linux*coff*) + dynamic_linker=no + ;; + +# This must be Linux ELF. +linux*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -n $libdir' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + # This implies no fast_install, which is unacceptable. + # Some rework will be needed to allow for fast_install + # before this can be enabled. + hardcode_into_libs=yes + + # find out which ABI we are using + libsuff= + case "$host_cpu" in + x86_64*|s390x*|powerpc64*) + echo '#line 8236 "configure"' > conftest.$ac_ext + if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + case `/usr/bin/file conftest.$ac_objext` in + *64-bit*) + libsuff=64 + sys_lib_search_path_spec="/lib${libsuff} /usr/lib${libsuff} /usr/local/lib${libsuff}" + ;; + esac + fi + rm -rf conftest* + ;; + esac + + # Append ld.so.conf contents to the search path + if test -f /etc/ld.so.conf; then + lt_ld_extra=`awk '/^include / { system(sprintf("cd /etc; cat %s 2>/dev/null", \$2)); skip = 1; } { if (!skip) print \$0; skip = 0; }' < /etc/ld.so.conf | $SED -e 's/#.*//;s/[:, ]/ /g;s/=[^=]*$//;s/=[^= ]* / /g;/^$/d' | tr '\n' ' '` + sys_lib_dlsearch_path_spec="/lib${libsuff} /usr/lib${libsuff} $lt_ld_extra" + fi + + # We used to test for /lib/ld.so.1 and disable shared libraries on + # powerpc, because MkLinux only supported shared libraries with the + # GNU dynamic linker. Since this was broken with cross compilers, + # most powerpc-linux boxes support dynamic linking these days and + # people can always --disable-shared, the test was removed, and we + # assume the GNU/Linux dynamic linker is in use. + dynamic_linker='GNU/Linux ld.so' + ;; + +knetbsd*-gnu) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + dynamic_linker='GNU ld.so' + ;; + +netbsd*) + version_type=sunos + need_lib_prefix=no + need_version=no + if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir' + dynamic_linker='NetBSD (a.out) ld.so' + else + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + dynamic_linker='NetBSD ld.elf_so' + fi + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + ;; + +newsos6) + version_type=linux + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + ;; + +nto-qnx*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + ;; + +openbsd*) + version_type=sunos + sys_lib_dlsearch_path_spec="/usr/lib" + need_lib_prefix=no + # Some older versions of OpenBSD (3.3 at least) *do* need versioned libs. + case $host_os in + openbsd3.3 | openbsd3.3.*) need_version=yes ;; + *) need_version=no ;; + esac + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir' + shlibpath_var=LD_LIBRARY_PATH + if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then + case $host_os in + openbsd2.[89] | openbsd2.[89].*) + shlibpath_overrides_runpath=no + ;; + *) + shlibpath_overrides_runpath=yes + ;; + esac + else + shlibpath_overrides_runpath=yes + fi + ;; + +os2*) + libname_spec='$name' + shrext_cmds=".dll" + need_lib_prefix=no + library_names_spec='$libname${shared_ext} $libname.a' + dynamic_linker='OS/2 ld.exe' + shlibpath_var=LIBPATH + ;; + +osf3* | osf4* | osf5*) + version_type=osf + need_lib_prefix=no + need_version=no + soname_spec='${libname}${release}${shared_ext}$major' + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + shlibpath_var=LD_LIBRARY_PATH + sys_lib_search_path_spec="/usr/shlib /usr/ccs/lib /usr/lib/cmplrs/cc /usr/lib /usr/local/lib /var/shlib" + sys_lib_dlsearch_path_spec="$sys_lib_search_path_spec" + ;; + +solaris*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + # ldd complains unless libraries are executable + postinstall_cmds='chmod +x $lib' + ;; + +sunos4*) + version_type=sunos + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix' + finish_cmds='PATH="\$PATH:/usr/etc" ldconfig $libdir' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + if test "$with_gnu_ld" = yes; then + need_lib_prefix=no + fi + need_version=yes + ;; + +sysv4 | sysv4.3*) + version_type=linux + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + case $host_vendor in + sni) + shlibpath_overrides_runpath=no + need_lib_prefix=no + export_dynamic_flag_spec='${wl}-Blargedynsym' + runpath_var=LD_RUN_PATH + ;; + siemens) + need_lib_prefix=no + ;; + motorola) + need_lib_prefix=no + need_version=no + shlibpath_overrides_runpath=no + sys_lib_search_path_spec='/lib /usr/lib /usr/ccs/lib' + ;; + esac + ;; + +sysv4*MP*) + if test -d /usr/nec ;then + version_type=linux + library_names_spec='$libname${shared_ext}.$versuffix $libname${shared_ext}.$major $libname${shared_ext}' + soname_spec='$libname${shared_ext}.$major' + shlibpath_var=LD_LIBRARY_PATH + fi + ;; + +sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*) + version_type=freebsd-elf + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + hardcode_into_libs=yes + if test "$with_gnu_ld" = yes; then + sys_lib_search_path_spec='/usr/local/lib /usr/gnu/lib /usr/ccs/lib /usr/lib /lib' + shlibpath_overrides_runpath=no + else + sys_lib_search_path_spec='/usr/ccs/lib /usr/lib' + shlibpath_overrides_runpath=yes + case $host_os in + sco3.2v5*) + sys_lib_search_path_spec="$sys_lib_search_path_spec /lib" + ;; + esac + fi + sys_lib_dlsearch_path_spec='/usr/lib' + ;; + +uts4*) + version_type=linux + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + ;; + +*) + dynamic_linker=no + ;; +esac +echo "$as_me:$LINENO: result: $dynamic_linker" >&5 +echo "${ECHO_T}$dynamic_linker" >&6 +test "$dynamic_linker" = no && can_build_shared=no + +variables_saved_for_relink="PATH $shlibpath_var $runpath_var" +if test "$GCC" = yes; then + variables_saved_for_relink="$variables_saved_for_relink GCC_EXEC_PREFIX COMPILER_PATH LIBRARY_PATH" +fi + +echo "$as_me:$LINENO: checking how to hardcode library paths into programs" >&5 +echo $ECHO_N "checking how to hardcode library paths into programs... $ECHO_C" >&6 +hardcode_action= +if test -n "$hardcode_libdir_flag_spec" || \ + test -n "$runpath_var" || \ + test "X$hardcode_automatic" = "Xyes" ; then + + # We can hardcode non-existant directories. + if test "$hardcode_direct" != no && + # If the only mechanism to avoid hardcoding is shlibpath_var, we + # have to relink, otherwise we might link with an installed library + # when we should be linking with a yet-to-be-installed one + ## test "$_LT_AC_TAGVAR(hardcode_shlibpath_var, )" != no && + test "$hardcode_minus_L" != no; then + # Linking always hardcodes the temporary library directory. + hardcode_action=relink + else + # We can link without hardcoding, and we can hardcode nonexisting dirs. + hardcode_action=immediate + fi +else + # We cannot hardcode anything, or else we can only hardcode existing + # directories. + hardcode_action=unsupported +fi +echo "$as_me:$LINENO: result: $hardcode_action" >&5 +echo "${ECHO_T}$hardcode_action" >&6 + +if test "$hardcode_action" = relink; then + # Fast installation is not supported + enable_fast_install=no +elif test "$shlibpath_overrides_runpath" = yes || + test "$enable_shared" = no; then + # Fast installation is not necessary + enable_fast_install=needless +fi + +striplib= +old_striplib= +echo "$as_me:$LINENO: checking whether stripping libraries is possible" >&5 +echo $ECHO_N "checking whether stripping libraries is possible... $ECHO_C" >&6 +if test -n "$STRIP" && $STRIP -V 2>&1 | grep "GNU strip" >/dev/null; then + test -z "$old_striplib" && old_striplib="$STRIP --strip-debug" + test -z "$striplib" && striplib="$STRIP --strip-unneeded" + echo "$as_me:$LINENO: result: yes" >&5 +echo "${ECHO_T}yes" >&6 +else +# FIXME - insert some real tests, host_os isn't really good enough + case $host_os in + darwin*) + if test -n "$STRIP" ; then + striplib="$STRIP -x" + echo "$as_me:$LINENO: result: yes" >&5 +echo "${ECHO_T}yes" >&6 + else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + ;; + *) + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 + ;; + esac +fi + +if test "x$enable_dlopen" != xyes; then + enable_dlopen=unknown + enable_dlopen_self=unknown + enable_dlopen_self_static=unknown +else + lt_cv_dlopen=no + lt_cv_dlopen_libs= + + case $host_os in + beos*) + lt_cv_dlopen="load_add_on" + lt_cv_dlopen_libs= + lt_cv_dlopen_self=yes + ;; + + mingw* | pw32*) + lt_cv_dlopen="LoadLibrary" + lt_cv_dlopen_libs= + ;; + + cygwin*) + lt_cv_dlopen="dlopen" + lt_cv_dlopen_libs= + ;; + + darwin*) + # if libdl is installed we need to link against it + echo "$as_me:$LINENO: checking for dlopen in -ldl" >&5 +echo $ECHO_N "checking for dlopen in -ldl... $ECHO_C" >&6 +if test "${ac_cv_lib_dl_dlopen+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_check_lib_save_LIBS=$LIBS +LIBS="-ldl $LIBS" +cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +/* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +#endif +/* We use char because int might match the return type of a gcc2 + builtin and then its argument prototype would still apply. */ +char dlopen (); +int +main () +{ +dlopen (); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_lib_dl_dlopen=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_lib_dl_dlopen=no +fi +rm -f conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +echo "$as_me:$LINENO: result: $ac_cv_lib_dl_dlopen" >&5 +echo "${ECHO_T}$ac_cv_lib_dl_dlopen" >&6 +if test $ac_cv_lib_dl_dlopen = yes; then + lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-ldl" +else + + lt_cv_dlopen="dyld" + lt_cv_dlopen_libs= + lt_cv_dlopen_self=yes + +fi + + ;; + + *) + echo "$as_me:$LINENO: checking for shl_load" >&5 +echo $ECHO_N "checking for shl_load... $ECHO_C" >&6 +if test "${ac_cv_func_shl_load+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +/* Define shl_load to an innocuous variant, in case <limits.h> declares shl_load. + For example, HP-UX 11i <limits.h> declares gettimeofday. */ +#define shl_load innocuous_shl_load + +/* System header to define __stub macros and hopefully few prototypes, + which can conflict with char shl_load (); below. + Prefer <limits.h> to <assert.h> if __STDC__ is defined, since + <limits.h> exists even on freestanding compilers. */ + +#ifdef __STDC__ +# include <limits.h> +#else +# include <assert.h> +#endif + +#undef shl_load + +/* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +{ +#endif +/* We use char because int might match the return type of a gcc2 + builtin and then its argument prototype would still apply. */ +char shl_load (); +/* The GNU C library defines this for functions which it implements + to always fail with ENOSYS. Some functions are actually named + something starting with __ and the normal name is an alias. */ +#if defined (__stub_shl_load) || defined (__stub___shl_load) +choke me +#else +char (*f) () = shl_load; +#endif +#ifdef __cplusplus +} +#endif + +int +main () +{ +return f != shl_load; + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_func_shl_load=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_func_shl_load=no +fi +rm -f conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: $ac_cv_func_shl_load" >&5 +echo "${ECHO_T}$ac_cv_func_shl_load" >&6 +if test $ac_cv_func_shl_load = yes; then + lt_cv_dlopen="shl_load" +else + echo "$as_me:$LINENO: checking for shl_load in -ldld" >&5 +echo $ECHO_N "checking for shl_load in -ldld... $ECHO_C" >&6 +if test "${ac_cv_lib_dld_shl_load+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_check_lib_save_LIBS=$LIBS +LIBS="-ldld $LIBS" +cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +/* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +#endif +/* We use char because int might match the return type of a gcc2 + builtin and then its argument prototype would still apply. */ +char shl_load (); +int +main () +{ +shl_load (); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_lib_dld_shl_load=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_lib_dld_shl_load=no +fi +rm -f conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +echo "$as_me:$LINENO: result: $ac_cv_lib_dld_shl_load" >&5 +echo "${ECHO_T}$ac_cv_lib_dld_shl_load" >&6 +if test $ac_cv_lib_dld_shl_load = yes; then + lt_cv_dlopen="shl_load" lt_cv_dlopen_libs="-dld" +else + echo "$as_me:$LINENO: checking for dlopen" >&5 +echo $ECHO_N "checking for dlopen... $ECHO_C" >&6 +if test "${ac_cv_func_dlopen+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +/* Define dlopen to an innocuous variant, in case <limits.h> declares dlopen. + For example, HP-UX 11i <limits.h> declares gettimeofday. */ +#define dlopen innocuous_dlopen + +/* System header to define __stub macros and hopefully few prototypes, + which can conflict with char dlopen (); below. + Prefer <limits.h> to <assert.h> if __STDC__ is defined, since + <limits.h> exists even on freestanding compilers. */ + +#ifdef __STDC__ +# include <limits.h> +#else +# include <assert.h> +#endif + +#undef dlopen + +/* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +{ +#endif +/* We use char because int might match the return type of a gcc2 + builtin and then its argument prototype would still apply. */ +char dlopen (); +/* The GNU C library defines this for functions which it implements + to always fail with ENOSYS. Some functions are actually named + something starting with __ and the normal name is an alias. */ +#if defined (__stub_dlopen) || defined (__stub___dlopen) +choke me +#else +char (*f) () = dlopen; +#endif +#ifdef __cplusplus +} +#endif + +int +main () +{ +return f != dlopen; + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_func_dlopen=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_func_dlopen=no +fi +rm -f conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: $ac_cv_func_dlopen" >&5 +echo "${ECHO_T}$ac_cv_func_dlopen" >&6 +if test $ac_cv_func_dlopen = yes; then + lt_cv_dlopen="dlopen" +else + echo "$as_me:$LINENO: checking for dlopen in -ldl" >&5 +echo $ECHO_N "checking for dlopen in -ldl... $ECHO_C" >&6 +if test "${ac_cv_lib_dl_dlopen+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_check_lib_save_LIBS=$LIBS +LIBS="-ldl $LIBS" +cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +/* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +#endif +/* We use char because int might match the return type of a gcc2 + builtin and then its argument prototype would still apply. */ +char dlopen (); +int +main () +{ +dlopen (); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_lib_dl_dlopen=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_lib_dl_dlopen=no +fi +rm -f conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +echo "$as_me:$LINENO: result: $ac_cv_lib_dl_dlopen" >&5 +echo "${ECHO_T}$ac_cv_lib_dl_dlopen" >&6 +if test $ac_cv_lib_dl_dlopen = yes; then + lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-ldl" +else + echo "$as_me:$LINENO: checking for dlopen in -lsvld" >&5 +echo $ECHO_N "checking for dlopen in -lsvld... $ECHO_C" >&6 +if test "${ac_cv_lib_svld_dlopen+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_check_lib_save_LIBS=$LIBS +LIBS="-lsvld $LIBS" +cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +/* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +#endif +/* We use char because int might match the return type of a gcc2 + builtin and then its argument prototype would still apply. */ +char dlopen (); +int +main () +{ +dlopen (); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_lib_svld_dlopen=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_lib_svld_dlopen=no +fi +rm -f conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +echo "$as_me:$LINENO: result: $ac_cv_lib_svld_dlopen" >&5 +echo "${ECHO_T}$ac_cv_lib_svld_dlopen" >&6 +if test $ac_cv_lib_svld_dlopen = yes; then + lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-lsvld" +else + echo "$as_me:$LINENO: checking for dld_link in -ldld" >&5 +echo $ECHO_N "checking for dld_link in -ldld... $ECHO_C" >&6 +if test "${ac_cv_lib_dld_dld_link+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_check_lib_save_LIBS=$LIBS +LIBS="-ldld $LIBS" +cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +/* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +#endif +/* We use char because int might match the return type of a gcc2 + builtin and then its argument prototype would still apply. */ +char dld_link (); +int +main () +{ +dld_link (); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_lib_dld_dld_link=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_lib_dld_dld_link=no +fi +rm -f conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +echo "$as_me:$LINENO: result: $ac_cv_lib_dld_dld_link" >&5 +echo "${ECHO_T}$ac_cv_lib_dld_dld_link" >&6 +if test $ac_cv_lib_dld_dld_link = yes; then + lt_cv_dlopen="dld_link" lt_cv_dlopen_libs="-dld" +fi + + +fi + + +fi + + +fi + + +fi + + +fi + + ;; + esac + + if test "x$lt_cv_dlopen" != xno; then + enable_dlopen=yes + else + enable_dlopen=no + fi + + case $lt_cv_dlopen in + dlopen) + save_CPPFLAGS="$CPPFLAGS" + test "x$ac_cv_header_dlfcn_h" = xyes && CPPFLAGS="$CPPFLAGS -DHAVE_DLFCN_H" + + save_LDFLAGS="$LDFLAGS" + wl=$lt_prog_compiler_wl eval LDFLAGS=\"\$LDFLAGS $export_dynamic_flag_spec\" + + save_LIBS="$LIBS" + LIBS="$lt_cv_dlopen_libs $LIBS" + + echo "$as_me:$LINENO: checking whether a program can dlopen itself" >&5 +echo $ECHO_N "checking whether a program can dlopen itself... $ECHO_C" >&6 +if test "${lt_cv_dlopen_self+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test "$cross_compiling" = yes; then : + lt_cv_dlopen_self=cross +else + lt_dlunknown=0; lt_dlno_uscore=1; lt_dlneed_uscore=2 + lt_status=$lt_dlunknown + cat > conftest.$ac_ext <<EOF +#line 9133 "configure" +#include "confdefs.h" + +#if HAVE_DLFCN_H +#include <dlfcn.h> +#endif + +#include <stdio.h> + +#ifdef RTLD_GLOBAL +# define LT_DLGLOBAL RTLD_GLOBAL +#else +# ifdef DL_GLOBAL +# define LT_DLGLOBAL DL_GLOBAL +# else +# define LT_DLGLOBAL 0 +# endif +#endif + +/* We may have to define LT_DLLAZY_OR_NOW in the command line if we + find out it does not work in some platform. */ +#ifndef LT_DLLAZY_OR_NOW +# ifdef RTLD_LAZY +# define LT_DLLAZY_OR_NOW RTLD_LAZY +# else +# ifdef DL_LAZY +# define LT_DLLAZY_OR_NOW DL_LAZY +# else +# ifdef RTLD_NOW +# define LT_DLLAZY_OR_NOW RTLD_NOW +# else +# ifdef DL_NOW +# define LT_DLLAZY_OR_NOW DL_NOW +# else +# define LT_DLLAZY_OR_NOW 0 +# endif +# endif +# endif +# endif +#endif + +#ifdef __cplusplus +extern "C" void exit (int); +#endif + +void fnord() { int i=42;} +int main () +{ + void *self = dlopen (0, LT_DLGLOBAL|LT_DLLAZY_OR_NOW); + int status = $lt_dlunknown; + + if (self) + { + if (dlsym (self,"fnord")) status = $lt_dlno_uscore; + else if (dlsym( self,"_fnord")) status = $lt_dlneed_uscore; + /* dlclose (self); */ + } + else + puts (dlerror ()); + + exit (status); +} +EOF + if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && test -s conftest${ac_exeext} 2>/dev/null; then + (./conftest; exit; ) >&5 2>/dev/null + lt_status=$? + case x$lt_status in + x$lt_dlno_uscore) lt_cv_dlopen_self=yes ;; + x$lt_dlneed_uscore) lt_cv_dlopen_self=yes ;; + x$lt_dlunknown|x*) lt_cv_dlopen_self=no ;; + esac + else : + # compilation failed + lt_cv_dlopen_self=no + fi +fi +rm -fr conftest* + + +fi +echo "$as_me:$LINENO: result: $lt_cv_dlopen_self" >&5 +echo "${ECHO_T}$lt_cv_dlopen_self" >&6 + + if test "x$lt_cv_dlopen_self" = xyes; then + wl=$lt_prog_compiler_wl eval LDFLAGS=\"\$LDFLAGS $lt_prog_compiler_static\" + echo "$as_me:$LINENO: checking whether a statically linked program can dlopen itself" >&5 +echo $ECHO_N "checking whether a statically linked program can dlopen itself... $ECHO_C" >&6 +if test "${lt_cv_dlopen_self_static+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test "$cross_compiling" = yes; then : + lt_cv_dlopen_self_static=cross +else + lt_dlunknown=0; lt_dlno_uscore=1; lt_dlneed_uscore=2 + lt_status=$lt_dlunknown + cat > conftest.$ac_ext <<EOF +#line 9233 "configure" +#include "confdefs.h" + +#if HAVE_DLFCN_H +#include <dlfcn.h> +#endif + +#include <stdio.h> + +#ifdef RTLD_GLOBAL +# define LT_DLGLOBAL RTLD_GLOBAL +#else +# ifdef DL_GLOBAL +# define LT_DLGLOBAL DL_GLOBAL +# else +# define LT_DLGLOBAL 0 +# endif +#endif + +/* We may have to define LT_DLLAZY_OR_NOW in the command line if we + find out it does not work in some platform. */ +#ifndef LT_DLLAZY_OR_NOW +# ifdef RTLD_LAZY +# define LT_DLLAZY_OR_NOW RTLD_LAZY +# else +# ifdef DL_LAZY +# define LT_DLLAZY_OR_NOW DL_LAZY +# else +# ifdef RTLD_NOW +# define LT_DLLAZY_OR_NOW RTLD_NOW +# else +# ifdef DL_NOW +# define LT_DLLAZY_OR_NOW DL_NOW +# else +# define LT_DLLAZY_OR_NOW 0 +# endif +# endif +# endif +# endif +#endif + +#ifdef __cplusplus +extern "C" void exit (int); +#endif + +void fnord() { int i=42;} +int main () +{ + void *self = dlopen (0, LT_DLGLOBAL|LT_DLLAZY_OR_NOW); + int status = $lt_dlunknown; + + if (self) + { + if (dlsym (self,"fnord")) status = $lt_dlno_uscore; + else if (dlsym( self,"_fnord")) status = $lt_dlneed_uscore; + /* dlclose (self); */ + } + else + puts (dlerror ()); + + exit (status); +} +EOF + if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && test -s conftest${ac_exeext} 2>/dev/null; then + (./conftest; exit; ) >&5 2>/dev/null + lt_status=$? + case x$lt_status in + x$lt_dlno_uscore) lt_cv_dlopen_self_static=yes ;; + x$lt_dlneed_uscore) lt_cv_dlopen_self_static=yes ;; + x$lt_dlunknown|x*) lt_cv_dlopen_self_static=no ;; + esac + else : + # compilation failed + lt_cv_dlopen_self_static=no + fi +fi +rm -fr conftest* + + +fi +echo "$as_me:$LINENO: result: $lt_cv_dlopen_self_static" >&5 +echo "${ECHO_T}$lt_cv_dlopen_self_static" >&6 + fi + + CPPFLAGS="$save_CPPFLAGS" + LDFLAGS="$save_LDFLAGS" + LIBS="$save_LIBS" + ;; + esac + + case $lt_cv_dlopen_self in + yes|no) enable_dlopen_self=$lt_cv_dlopen_self ;; + *) enable_dlopen_self=unknown ;; + esac + + case $lt_cv_dlopen_self_static in + yes|no) enable_dlopen_self_static=$lt_cv_dlopen_self_static ;; + *) enable_dlopen_self_static=unknown ;; + esac +fi + + +# Report which library types will actually be built +echo "$as_me:$LINENO: checking if libtool supports shared libraries" >&5 +echo $ECHO_N "checking if libtool supports shared libraries... $ECHO_C" >&6 +echo "$as_me:$LINENO: result: $can_build_shared" >&5 +echo "${ECHO_T}$can_build_shared" >&6 + +echo "$as_me:$LINENO: checking whether to build shared libraries" >&5 +echo $ECHO_N "checking whether to build shared libraries... $ECHO_C" >&6 +test "$can_build_shared" = "no" && enable_shared=no + +# On AIX, shared libraries and static libraries use the same namespace, and +# are all built from PIC. +case $host_os in +aix3*) + test "$enable_shared" = yes && enable_static=no + if test -n "$RANLIB"; then + archive_cmds="$archive_cmds~\$RANLIB \$lib" + postinstall_cmds='$RANLIB $lib' + fi + ;; + +aix4* | aix5*) + if test "$host_cpu" != ia64 && test "$aix_use_runtimelinking" = no ; then + test "$enable_shared" = yes && enable_static=no + fi + ;; +esac +echo "$as_me:$LINENO: result: $enable_shared" >&5 +echo "${ECHO_T}$enable_shared" >&6 + +echo "$as_me:$LINENO: checking whether to build static libraries" >&5 +echo $ECHO_N "checking whether to build static libraries... $ECHO_C" >&6 +# Make sure either enable_shared or enable_static is yes. +test "$enable_shared" = yes || enable_static=yes +echo "$as_me:$LINENO: result: $enable_static" >&5 +echo "${ECHO_T}$enable_static" >&6 + +# The else clause should only fire when bootstrapping the +# libtool distribution, otherwise you forgot to ship ltmain.sh +# with your package, and you will get complaints that there are +# no rules to generate ltmain.sh. +if test -f "$ltmain"; then + # See if we are running on zsh, and set the options which allow our commands through + # without removal of \ escapes. + if test -n "${ZSH_VERSION+set}" ; then + setopt NO_GLOB_SUBST + fi + # Now quote all the things that may contain metacharacters while being + # careful not to overquote the AC_SUBSTed values. We take copies of the + # variables and quote the copies for generation of the libtool script. + for var in echo old_CC old_CFLAGS AR AR_FLAGS EGREP RANLIB LN_S LTCC LTCFLAGS NM \ + SED SHELL STRIP \ + libname_spec library_names_spec soname_spec extract_expsyms_cmds \ + old_striplib striplib file_magic_cmd finish_cmds finish_eval \ + deplibs_check_method reload_flag reload_cmds need_locks \ + lt_cv_sys_global_symbol_pipe lt_cv_sys_global_symbol_to_cdecl \ + lt_cv_sys_global_symbol_to_c_name_address \ + sys_lib_search_path_spec sys_lib_dlsearch_path_spec \ + old_postinstall_cmds old_postuninstall_cmds \ + compiler \ + CC \ + LD \ + lt_prog_compiler_wl \ + lt_prog_compiler_pic \ + lt_prog_compiler_static \ + lt_prog_compiler_no_builtin_flag \ + export_dynamic_flag_spec \ + thread_safe_flag_spec \ + whole_archive_flag_spec \ + enable_shared_with_static_runtimes \ + old_archive_cmds \ + old_archive_from_new_cmds \ + predep_objects \ + postdep_objects \ + predeps \ + postdeps \ + compiler_lib_search_path \ + archive_cmds \ + archive_expsym_cmds \ + postinstall_cmds \ + postuninstall_cmds \ + old_archive_from_expsyms_cmds \ + allow_undefined_flag \ + no_undefined_flag \ + export_symbols_cmds \ + hardcode_libdir_flag_spec \ + hardcode_libdir_flag_spec_ld \ + hardcode_libdir_separator \ + hardcode_automatic \ + module_cmds \ + module_expsym_cmds \ + lt_cv_prog_compiler_c_o \ + exclude_expsyms \ + include_expsyms; do + + case $var in + old_archive_cmds | \ + old_archive_from_new_cmds | \ + archive_cmds | \ + archive_expsym_cmds | \ + module_cmds | \ + module_expsym_cmds | \ + old_archive_from_expsyms_cmds | \ + export_symbols_cmds | \ + extract_expsyms_cmds | reload_cmds | finish_cmds | \ + postinstall_cmds | postuninstall_cmds | \ + old_postinstall_cmds | old_postuninstall_cmds | \ + sys_lib_search_path_spec | sys_lib_dlsearch_path_spec) + # Double-quote double-evaled strings. + eval "lt_$var=\\\"\`\$echo \"X\$$var\" | \$Xsed -e \"\$double_quote_subst\" -e \"\$sed_quote_subst\" -e \"\$delay_variable_subst\"\`\\\"" + ;; + *) + eval "lt_$var=\\\"\`\$echo \"X\$$var\" | \$Xsed -e \"\$sed_quote_subst\"\`\\\"" + ;; + esac + done + + case $lt_echo in + *'\$0 --fallback-echo"') + lt_echo=`$echo "X$lt_echo" | $Xsed -e 's/\\\\\\\$0 --fallback-echo"$/$0 --fallback-echo"/'` + ;; + esac + +cfgfile="${ofile}T" + trap "$rm \"$cfgfile\"; exit 1" 1 2 15 + $rm -f "$cfgfile" + { echo "$as_me:$LINENO: creating $ofile" >&5 +echo "$as_me: creating $ofile" >&6;} + + cat <<__EOF__ >> "$cfgfile" +#! $SHELL + +# `$echo "$cfgfile" | sed 's%^.*/%%'` - Provide generalized library-building support services. +# Generated automatically by $PROGRAM (GNU $PACKAGE $VERSION$TIMESTAMP) +# NOTE: Changes made to this file will be lost: look at ltmain.sh. +# +# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001 +# Free Software Foundation, Inc. +# +# This file is part of GNU Libtool: +# Originally by Gordon Matzigkeit <gord@gnu.ai.mit.edu>, 1996 +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, but +# WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +# General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +# As a special exception to the GNU General Public License, if you +# distribute this file as part of a program that contains a +# configuration script generated by Autoconf, you may include it under +# the same distribution terms that you use for the rest of that program. + +# A sed program that does not truncate output. +SED=$lt_SED + +# Sed that helps us avoid accidentally triggering echo(1) options like -n. +Xsed="$SED -e 1s/^X//" + +# The HP-UX ksh and POSIX shell print the target directory to stdout +# if CDPATH is set. +(unset CDPATH) >/dev/null 2>&1 && unset CDPATH + +# The names of the tagged configurations supported by this script. +available_tags= + +# ### BEGIN LIBTOOL CONFIG + +# Libtool was configured on host `(hostname || uname -n) 2>/dev/null | sed 1q`: + +# Shell to use when invoking shell scripts. +SHELL=$lt_SHELL + +# Whether or not to build shared libraries. +build_libtool_libs=$enable_shared + +# Whether or not to build static libraries. +build_old_libs=$enable_static + +# Whether or not to add -lc for building shared libraries. +build_libtool_need_lc=$archive_cmds_need_lc + +# Whether or not to disallow shared libs when runtime libs are static +allow_libtool_libs_with_static_runtimes=$enable_shared_with_static_runtimes + +# Whether or not to optimize for fast installation. +fast_install=$enable_fast_install + +# The host system. +host_alias=$host_alias +host=$host +host_os=$host_os + +# The build system. +build_alias=$build_alias +build=$build +build_os=$build_os + +# An echo program that does not interpret backslashes. +echo=$lt_echo + +# The archiver. +AR=$lt_AR +AR_FLAGS=$lt_AR_FLAGS + +# A C compiler. +LTCC=$lt_LTCC + +# LTCC compiler flags. +LTCFLAGS=$lt_LTCFLAGS + +# A language-specific compiler. +CC=$lt_compiler + +# Is the compiler the GNU C compiler? +with_gcc=$GCC + +gcc_dir=\`gcc -print-file-name=. | $SED 's,/\.$,,'\` +gcc_ver=\`gcc -dumpversion\` + +# An ERE matcher. +EGREP=$lt_EGREP + +# The linker used to build libraries. +LD=$lt_LD + +# Whether we need hard or soft links. +LN_S=$lt_LN_S + +# A BSD-compatible nm program. +NM=$lt_NM + +# A symbol stripping program +STRIP=$lt_STRIP + +# Used to examine libraries when file_magic_cmd begins "file" +MAGIC_CMD=$MAGIC_CMD + +# Used on cygwin: DLL creation program. +DLLTOOL="$DLLTOOL" + +# Used on cygwin: object dumper. +OBJDUMP="$OBJDUMP" + +# Used on cygwin: assembler. +AS="$AS" + +# The name of the directory that contains temporary libtool files. +objdir=$objdir + +# How to create reloadable object files. +reload_flag=$lt_reload_flag +reload_cmds=$lt_reload_cmds + +# How to pass a linker flag through the compiler. +wl=$lt_lt_prog_compiler_wl + +# Object file suffix (normally "o"). +objext="$ac_objext" + +# Old archive suffix (normally "a"). +libext="$libext" + +# Shared library suffix (normally ".so"). +shrext_cmds='$shrext_cmds' + +# Executable file suffix (normally ""). +exeext="$exeext" + +# Additional compiler flags for building library objects. +pic_flag=$lt_lt_prog_compiler_pic +pic_mode=$pic_mode + +# What is the maximum length of a command? +max_cmd_len=$lt_cv_sys_max_cmd_len + +# Does compiler simultaneously support -c and -o options? +compiler_c_o=$lt_lt_cv_prog_compiler_c_o + +# Must we lock files when doing compilation? +need_locks=$lt_need_locks + +# Do we need the lib prefix for modules? +need_lib_prefix=$need_lib_prefix + +# Do we need a version for libraries? +need_version=$need_version + +# Whether dlopen is supported. +dlopen_support=$enable_dlopen + +# Whether dlopen of programs is supported. +dlopen_self=$enable_dlopen_self + +# Whether dlopen of statically linked programs is supported. +dlopen_self_static=$enable_dlopen_self_static + +# Compiler flag to prevent dynamic linking. +link_static_flag=$lt_lt_prog_compiler_static + +# Compiler flag to turn off builtin functions. +no_builtin_flag=$lt_lt_prog_compiler_no_builtin_flag + +# Compiler flag to allow reflexive dlopens. +export_dynamic_flag_spec=$lt_export_dynamic_flag_spec + +# Compiler flag to generate shared objects directly from archives. +whole_archive_flag_spec=$lt_whole_archive_flag_spec + +# Compiler flag to generate thread-safe objects. +thread_safe_flag_spec=$lt_thread_safe_flag_spec + +# Library versioning type. +version_type=$version_type + +# Format of library name prefix. +libname_spec=$lt_libname_spec + +# List of archive names. First name is the real one, the rest are links. +# The last name is the one that the linker finds with -lNAME. +library_names_spec=$lt_library_names_spec + +# The coded name of the library, if different from the real name. +soname_spec=$lt_soname_spec + +# Commands used to build and install an old-style archive. +RANLIB=$lt_RANLIB +old_archive_cmds=$lt_old_archive_cmds +old_postinstall_cmds=$lt_old_postinstall_cmds +old_postuninstall_cmds=$lt_old_postuninstall_cmds + +# Create an old-style archive from a shared archive. +old_archive_from_new_cmds=$lt_old_archive_from_new_cmds + +# Create a temporary old-style archive to link instead of a shared archive. +old_archive_from_expsyms_cmds=$lt_old_archive_from_expsyms_cmds + +# Commands used to build and install a shared archive. +archive_cmds=$lt_archive_cmds +archive_expsym_cmds=$lt_archive_expsym_cmds +postinstall_cmds=$lt_postinstall_cmds +postuninstall_cmds=$lt_postuninstall_cmds + +# Commands used to build a loadable module (assumed same as above if empty) +module_cmds=$lt_module_cmds +module_expsym_cmds=$lt_module_expsym_cmds + +# Commands to strip libraries. +old_striplib=$lt_old_striplib +striplib=$lt_striplib + +# Dependencies to place before the objects being linked to create a +# shared library. +predep_objects=\`echo $lt_predep_objects | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\` + +# Dependencies to place after the objects being linked to create a +# shared library. +postdep_objects=\`echo $lt_postdep_objects | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\` + +# Dependencies to place before the objects being linked to create a +# shared library. +predeps=$lt_predeps + +# Dependencies to place after the objects being linked to create a +# shared library. +postdeps=$lt_postdeps + +# The library search path used internally by the compiler when linking +# a shared library. +compiler_lib_search_path=\`echo $lt_compiler_lib_search_path | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\` + +# Method to check whether dependent libraries are shared objects. +deplibs_check_method=$lt_deplibs_check_method + +# Command to use when deplibs_check_method == file_magic. +file_magic_cmd=$lt_file_magic_cmd + +# Flag that allows shared libraries with undefined symbols to be built. +allow_undefined_flag=$lt_allow_undefined_flag + +# Flag that forces no undefined symbols. +no_undefined_flag=$lt_no_undefined_flag + +# Commands used to finish a libtool library installation in a directory. +finish_cmds=$lt_finish_cmds + +# Same as above, but a single script fragment to be evaled but not shown. +finish_eval=$lt_finish_eval + +# Take the output of nm and produce a listing of raw symbols and C names. +global_symbol_pipe=$lt_lt_cv_sys_global_symbol_pipe + +# Transform the output of nm in a proper C declaration +global_symbol_to_cdecl=$lt_lt_cv_sys_global_symbol_to_cdecl + +# Transform the output of nm in a C name address pair +global_symbol_to_c_name_address=$lt_lt_cv_sys_global_symbol_to_c_name_address + +# This is the shared library runtime path variable. +runpath_var=$runpath_var + +# This is the shared library path variable. +shlibpath_var=$shlibpath_var + +# Is shlibpath searched before the hard-coded library search path? +shlibpath_overrides_runpath=$shlibpath_overrides_runpath + +# How to hardcode a shared library path into an executable. +hardcode_action=$hardcode_action + +# Whether we should hardcode library paths into libraries. +hardcode_into_libs=$hardcode_into_libs + +# Flag to hardcode \$libdir into a binary during linking. +# This must work even if \$libdir does not exist. +hardcode_libdir_flag_spec=$lt_hardcode_libdir_flag_spec + +# If ld is used when linking, flag to hardcode \$libdir into +# a binary during linking. This must work even if \$libdir does +# not exist. +hardcode_libdir_flag_spec_ld=$lt_hardcode_libdir_flag_spec_ld + +# Whether we need a single -rpath flag with a separated argument. +hardcode_libdir_separator=$lt_hardcode_libdir_separator + +# Set to yes if using DIR/libNAME${shared_ext} during linking hardcodes DIR into the +# resulting binary. +hardcode_direct=$hardcode_direct + +# Set to yes if using the -LDIR flag during linking hardcodes DIR into the +# resulting binary. +hardcode_minus_L=$hardcode_minus_L + +# Set to yes if using SHLIBPATH_VAR=DIR during linking hardcodes DIR into +# the resulting binary. +hardcode_shlibpath_var=$hardcode_shlibpath_var + +# Set to yes if building a shared library automatically hardcodes DIR into the library +# and all subsequent libraries and executables linked against it. +hardcode_automatic=$hardcode_automatic + +# Variables whose values should be saved in libtool wrapper scripts and +# restored at relink time. +variables_saved_for_relink="$variables_saved_for_relink" + +# Whether libtool must link a program against all its dependency libraries. +link_all_deplibs=$link_all_deplibs + +# Compile-time system search path for libraries +sys_lib_search_path_spec=\`echo $lt_sys_lib_search_path_spec | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\` + +# Run-time system search path for libraries +sys_lib_dlsearch_path_spec=$lt_sys_lib_dlsearch_path_spec + +# Fix the shell variable \$srcfile for the compiler. +fix_srcfile_path="$fix_srcfile_path" + +# Set to yes if exported symbols are required. +always_export_symbols=$always_export_symbols + +# The commands to list exported symbols. +export_symbols_cmds=$lt_export_symbols_cmds + +# The commands to extract the exported symbol list from a shared archive. +extract_expsyms_cmds=$lt_extract_expsyms_cmds + +# Symbols that should not be listed in the preloaded symbols. +exclude_expsyms=$lt_exclude_expsyms + +# Symbols that must always be exported. +include_expsyms=$lt_include_expsyms + +# ### END LIBTOOL CONFIG + +__EOF__ + + + case $host_os in + aix3*) + cat <<\EOF >> "$cfgfile" + +# AIX sometimes has problems with the GCC collect2 program. For some +# reason, if we set the COLLECT_NAMES environment variable, the problems +# vanish in a puff of smoke. +if test "X${COLLECT_NAMES+set}" != Xset; then + COLLECT_NAMES= + export COLLECT_NAMES +fi +EOF + ;; + esac + + # We use sed instead of cat because bash on DJGPP gets confused if + # if finds mixed CR/LF and LF-only lines. Since sed operates in + # text mode, it properly converts lines to CR/LF. This bash problem + # is reportedly fixed, but why not run on old versions too? + sed '$q' "$ltmain" >> "$cfgfile" || (rm -f "$cfgfile"; exit 1) + + mv -f "$cfgfile" "$ofile" || \ + (rm -f "$ofile" && cp "$cfgfile" "$ofile" && rm -f "$cfgfile") + chmod +x "$ofile" + +else + # If there is no Makefile yet, we rely on a make rule to execute + # `config.status --recheck' to rerun these tests and create the + # libtool script then. + ltmain_in=`echo $ltmain | sed -e 's/\.sh$/.in/'` + if test -f "$ltmain_in"; then + test -f Makefile && make "$ltmain" + fi +fi + + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + +CC="$lt_save_CC" + + +# Check whether --with-tags or --without-tags was given. +if test "${with_tags+set}" = set; then + withval="$with_tags" + tagnames="$withval" +fi; + +if test -f "$ltmain" && test -n "$tagnames"; then + if test ! -f "${ofile}"; then + { echo "$as_me:$LINENO: WARNING: output file \`$ofile' does not exist" >&5 +echo "$as_me: WARNING: output file \`$ofile' does not exist" >&2;} + fi + + if test -z "$LTCC"; then + eval "`$SHELL ${ofile} --config | grep '^LTCC='`" + if test -z "$LTCC"; then + { echo "$as_me:$LINENO: WARNING: output file \`$ofile' does not look like a libtool script" >&5 +echo "$as_me: WARNING: output file \`$ofile' does not look like a libtool script" >&2;} + else + { echo "$as_me:$LINENO: WARNING: using \`LTCC=$LTCC', extracted from \`$ofile'" >&5 +echo "$as_me: WARNING: using \`LTCC=$LTCC', extracted from \`$ofile'" >&2;} + fi + fi + if test -z "$LTCFLAGS"; then + eval "`$SHELL ${ofile} --config | grep '^LTCFLAGS='`" + fi + + # Extract list of available tagged configurations in $ofile. + # Note that this assumes the entire list is on one line. + available_tags=`grep "^available_tags=" "${ofile}" | $SED -e 's/available_tags=\(.*$\)/\1/' -e 's/\"//g'` + + lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR," + for tagname in $tagnames; do + IFS="$lt_save_ifs" + # Check whether tagname contains only valid characters + case `$echo "X$tagname" | $Xsed -e 's:[-_ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz1234567890,/]::g'` in + "") ;; + *) { { echo "$as_me:$LINENO: error: invalid tag name: $tagname" >&5 +echo "$as_me: error: invalid tag name: $tagname" >&2;} + { (exit 1); exit 1; }; } + ;; + esac + + if grep "^# ### BEGIN LIBTOOL TAG CONFIG: $tagname$" < "${ofile}" > /dev/null + then + { { echo "$as_me:$LINENO: error: tag name \"$tagname\" already exists" >&5 +echo "$as_me: error: tag name \"$tagname\" already exists" >&2;} + { (exit 1); exit 1; }; } + fi + + # Update the list of available tags. + if test -n "$tagname"; then + echo appending configuration tag \"$tagname\" to $ofile + + case $tagname in + CXX) + if test -n "$CXX" && ( test "X$CXX" != "Xno" && + ( (test "X$CXX" = "Xg++" && `g++ -v >/dev/null 2>&1` ) || + (test "X$CXX" != "Xg++"))) ; then + ac_ext=cc +ac_cpp='$CXXCPP $CPPFLAGS' +ac_compile='$CXX -c $CXXFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CXX -o conftest$ac_exeext $CXXFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_cxx_compiler_gnu + + + + +archive_cmds_need_lc_CXX=no +allow_undefined_flag_CXX= +always_export_symbols_CXX=no +archive_expsym_cmds_CXX= +export_dynamic_flag_spec_CXX= +hardcode_direct_CXX=no +hardcode_libdir_flag_spec_CXX= +hardcode_libdir_flag_spec_ld_CXX= +hardcode_libdir_separator_CXX= +hardcode_minus_L_CXX=no +hardcode_shlibpath_var_CXX=unsupported +hardcode_automatic_CXX=no +module_cmds_CXX= +module_expsym_cmds_CXX= +link_all_deplibs_CXX=unknown +old_archive_cmds_CXX=$old_archive_cmds +no_undefined_flag_CXX= +whole_archive_flag_spec_CXX= +enable_shared_with_static_runtimes_CXX=no + +# Dependencies to place before and after the object being linked: +predep_objects_CXX= +postdep_objects_CXX= +predeps_CXX= +postdeps_CXX= +compiler_lib_search_path_CXX= + +# Source file extension for C++ test sources. +ac_ext=cpp + +# Object file extension for compiled C++ test sources. +objext=o +objext_CXX=$objext + +# Code to be used in simple compile tests +lt_simple_compile_test_code="int some_variable = 0;\n" + +# Code to be used in simple link tests +lt_simple_link_test_code='int main(int, char *[]) { return(0); }\n' + +# ltmain only uses $CC for tagged configurations so make sure $CC is set. + +# If no C compiler was specified, use CC. +LTCC=${LTCC-"$CC"} + +# If no C compiler flags were specified, use CFLAGS. +LTCFLAGS=${LTCFLAGS-"$CFLAGS"} + +# Allow CC to be a program name with arguments. +compiler=$CC + + +# save warnings/boilerplate of simple test code +ac_outfile=conftest.$ac_objext +printf "$lt_simple_compile_test_code" >conftest.$ac_ext +eval "$ac_compile" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err +_lt_compiler_boilerplate=`cat conftest.err` +$rm conftest* + +ac_outfile=conftest.$ac_objext +printf "$lt_simple_link_test_code" >conftest.$ac_ext +eval "$ac_link" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err +_lt_linker_boilerplate=`cat conftest.err` +$rm conftest* + + +# Allow CC to be a program name with arguments. +lt_save_CC=$CC +lt_save_LD=$LD +lt_save_GCC=$GCC +GCC=$GXX +lt_save_with_gnu_ld=$with_gnu_ld +lt_save_path_LD=$lt_cv_path_LD +if test -n "${lt_cv_prog_gnu_ldcxx+set}"; then + lt_cv_prog_gnu_ld=$lt_cv_prog_gnu_ldcxx +else + $as_unset lt_cv_prog_gnu_ld +fi +if test -n "${lt_cv_path_LDCXX+set}"; then + lt_cv_path_LD=$lt_cv_path_LDCXX +else + $as_unset lt_cv_path_LD +fi +test -z "${LDCXX+set}" || LD=$LDCXX +CC=${CXX-"c++"} +compiler=$CC +compiler_CXX=$CC +for cc_temp in $compiler""; do + case $cc_temp in + compile | *[\\/]compile | ccache | *[\\/]ccache ) ;; + distcc | *[\\/]distcc | purify | *[\\/]purify ) ;; + \-*) ;; + *) break;; + esac +done +cc_basename=`$echo "X$cc_temp" | $Xsed -e 's%.*/%%' -e "s%^$host_alias-%%"` + + +# We don't want -fno-exception wen compiling C++ code, so set the +# no_builtin_flag separately +if test "$GXX" = yes; then + lt_prog_compiler_no_builtin_flag_CXX=' -fno-builtin' +else + lt_prog_compiler_no_builtin_flag_CXX= +fi + +if test "$GXX" = yes; then + # Set up default GNU C++ configuration + + +# Check whether --with-gnu-ld or --without-gnu-ld was given. +if test "${with_gnu_ld+set}" = set; then + withval="$with_gnu_ld" + test "$withval" = no || with_gnu_ld=yes +else + with_gnu_ld=no +fi; +ac_prog=ld +if test "$GCC" = yes; then + # Check if gcc -print-prog-name=ld gives a path. + echo "$as_me:$LINENO: checking for ld used by $CC" >&5 +echo $ECHO_N "checking for ld used by $CC... $ECHO_C" >&6 + case $host in + *-*-mingw*) + # gcc leaves a trailing carriage return which upsets mingw + ac_prog=`($CC -print-prog-name=ld) 2>&5 | tr -d '\015'` ;; + *) + ac_prog=`($CC -print-prog-name=ld) 2>&5` ;; + esac + case $ac_prog in + # Accept absolute paths. + [\\/]* | ?:[\\/]*) + re_direlt='/[^/][^/]*/\.\./' + # Canonicalize the pathname of ld + ac_prog=`echo $ac_prog| $SED 's%\\\\%/%g'` + while echo $ac_prog | grep "$re_direlt" > /dev/null 2>&1; do + ac_prog=`echo $ac_prog| $SED "s%$re_direlt%/%"` + done + test -z "$LD" && LD="$ac_prog" + ;; + "") + # If it fails, then pretend we aren't using GCC. + ac_prog=ld + ;; + *) + # If it is relative, then search for the first ld in PATH. + with_gnu_ld=unknown + ;; + esac +elif test "$with_gnu_ld" = yes; then + echo "$as_me:$LINENO: checking for GNU ld" >&5 +echo $ECHO_N "checking for GNU ld... $ECHO_C" >&6 +else + echo "$as_me:$LINENO: checking for non-GNU ld" >&5 +echo $ECHO_N "checking for non-GNU ld... $ECHO_C" >&6 +fi +if test "${lt_cv_path_LD+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -z "$LD"; then + lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR + for ac_dir in $PATH; do + IFS="$lt_save_ifs" + test -z "$ac_dir" && ac_dir=. + if test -f "$ac_dir/$ac_prog" || test -f "$ac_dir/$ac_prog$ac_exeext"; then + lt_cv_path_LD="$ac_dir/$ac_prog" + # Check to see if the program is GNU ld. I'd rather use --version, + # but apparently some variants of GNU ld only accept -v. + # Break only if it was the GNU/non-GNU ld that we prefer. + case `"$lt_cv_path_LD" -v 2>&1 </dev/null` in + *GNU* | *'with BFD'*) + test "$with_gnu_ld" != no && break + ;; + *) + test "$with_gnu_ld" != yes && break + ;; + esac + fi + done + IFS="$lt_save_ifs" +else + lt_cv_path_LD="$LD" # Let the user override the test with a path. +fi +fi + +LD="$lt_cv_path_LD" +if test -n "$LD"; then + echo "$as_me:$LINENO: result: $LD" >&5 +echo "${ECHO_T}$LD" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi +test -z "$LD" && { { echo "$as_me:$LINENO: error: no acceptable ld found in \$PATH" >&5 +echo "$as_me: error: no acceptable ld found in \$PATH" >&2;} + { (exit 1); exit 1; }; } +echo "$as_me:$LINENO: checking if the linker ($LD) is GNU ld" >&5 +echo $ECHO_N "checking if the linker ($LD) is GNU ld... $ECHO_C" >&6 +if test "${lt_cv_prog_gnu_ld+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + # I'd rather use --version here, but apparently some GNU lds only accept -v. +case `$LD -v 2>&1 </dev/null` in +*GNU* | *'with BFD'*) + lt_cv_prog_gnu_ld=yes + ;; +*) + lt_cv_prog_gnu_ld=no + ;; +esac +fi +echo "$as_me:$LINENO: result: $lt_cv_prog_gnu_ld" >&5 +echo "${ECHO_T}$lt_cv_prog_gnu_ld" >&6 +with_gnu_ld=$lt_cv_prog_gnu_ld + + + + # Check if GNU C++ uses GNU ld as the underlying linker, since the + # archiving commands below assume that GNU ld is being used. + if test "$with_gnu_ld" = yes; then + archive_cmds_CXX='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib' + archive_expsym_cmds_CXX='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + + hardcode_libdir_flag_spec_CXX='${wl}--rpath ${wl}$libdir' + export_dynamic_flag_spec_CXX='${wl}--export-dynamic' + + # If archive_cmds runs LD, not CC, wlarc should be empty + # XXX I think wlarc can be eliminated in ltcf-cxx, but I need to + # investigate it a little bit more. (MM) + wlarc='${wl}' + + # ancient GNU ld didn't support --whole-archive et. al. + if eval "`$CC -print-prog-name=ld` --help 2>&1" | \ + grep 'no-whole-archive' > /dev/null; then + whole_archive_flag_spec_CXX="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive' + else + whole_archive_flag_spec_CXX= + fi + else + with_gnu_ld=no + wlarc= + + # A generic and very simple default shared library creation + # command for GNU C++ for the case where it uses the native + # linker, instead of GNU ld. If possible, this setting should + # overridden to take advantage of the native linker features on + # the platform it is being used on. + archive_cmds_CXX='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $lib' + fi + + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep "\-L"' + +else + GXX=no + with_gnu_ld=no + wlarc= +fi + +# PORTME: fill in a description of your system's C++ link characteristics +echo "$as_me:$LINENO: checking whether the $compiler linker ($LD) supports shared libraries" >&5 +echo $ECHO_N "checking whether the $compiler linker ($LD) supports shared libraries... $ECHO_C" >&6 +ld_shlibs_CXX=yes +case $host_os in + aix3*) + # FIXME: insert proper C++ library support + ld_shlibs_CXX=no + ;; + aix4* | aix5*) + if test "$host_cpu" = ia64; then + # On IA64, the linker does run time linking by default, so we don't + # have to do anything special. + aix_use_runtimelinking=no + exp_sym_flag='-Bexport' + no_entry_flag="" + else + aix_use_runtimelinking=no + + # Test if we are trying to use run time linking or normal + # AIX style linking. If -brtl is somewhere in LDFLAGS, we + # need to do runtime linking. + case $host_os in aix4.[23]|aix4.[23].*|aix5*) + for ld_flag in $LDFLAGS; do + case $ld_flag in + *-brtl*) + aix_use_runtimelinking=yes + break + ;; + esac + done + ;; + esac + + exp_sym_flag='-bexport' + no_entry_flag='-bnoentry' + fi + + # When large executables or shared objects are built, AIX ld can + # have problems creating the table of contents. If linking a library + # or program results in "error TOC overflow" add -mminimal-toc to + # CXXFLAGS/CFLAGS for g++/gcc. In the cases where that is not + # enough to fix the problem, add -Wl,-bbigtoc to LDFLAGS. + + archive_cmds_CXX='' + hardcode_direct_CXX=yes + hardcode_libdir_separator_CXX=':' + link_all_deplibs_CXX=yes + + if test "$GXX" = yes; then + case $host_os in aix4.[012]|aix4.[012].*) + # We only want to do this on AIX 4.2 and lower, the check + # below for broken collect2 doesn't work under 4.3+ + collect2name=`${CC} -print-prog-name=collect2` + if test -f "$collect2name" && \ + strings "$collect2name" | grep resolve_lib_name >/dev/null + then + # We have reworked collect2 + hardcode_direct_CXX=yes + else + # We have old collect2 + hardcode_direct_CXX=unsupported + # It fails to find uninstalled libraries when the uninstalled + # path is not listed in the libpath. Setting hardcode_minus_L + # to unsupported forces relinking + hardcode_minus_L_CXX=yes + hardcode_libdir_flag_spec_CXX='-L$libdir' + hardcode_libdir_separator_CXX= + fi + ;; + esac + shared_flag='-shared' + if test "$aix_use_runtimelinking" = yes; then + shared_flag="$shared_flag "'${wl}-G' + fi + else + # not using gcc + if test "$host_cpu" = ia64; then + # VisualAge C++, Version 5.5 for AIX 5L for IA-64, Beta 3 Release + # chokes on -Wl,-G. The following line is correct: + shared_flag='-G' + else + if test "$aix_use_runtimelinking" = yes; then + shared_flag='${wl}-G' + else + shared_flag='${wl}-bM:SRE' + fi + fi + fi + + # It seems that -bexpall does not export symbols beginning with + # underscore (_), so it is better to generate a list of symbols to export. + always_export_symbols_CXX=yes + if test "$aix_use_runtimelinking" = yes; then + # Warning - without using the other runtime loading flags (-brtl), + # -berok will link without error, but may produce a broken library. + allow_undefined_flag_CXX='-berok' + # Determine the default libpath from the value encoded in an empty executable. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_cxx_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + +aix_libpath=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; } +}'` +# Check for a 64-bit object if we didn't find anything. +if test -z "$aix_libpath"; then aix_libpath=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; } +}'`; fi +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +fi +rm -f conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext +if test -z "$aix_libpath"; then aix_libpath="/usr/lib:/lib"; fi + + hardcode_libdir_flag_spec_CXX='${wl}-blibpath:$libdir:'"$aix_libpath" + + archive_expsym_cmds_CXX="\$CC"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags `if test "x${allow_undefined_flag}" != "x"; then echo "${wl}${allow_undefined_flag}"; else :; fi` '"\${wl}$exp_sym_flag:\$export_symbols $shared_flag" + else + if test "$host_cpu" = ia64; then + hardcode_libdir_flag_spec_CXX='${wl}-R $libdir:/usr/lib:/lib' + allow_undefined_flag_CXX="-z nodefs" + archive_expsym_cmds_CXX="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags ${wl}${allow_undefined_flag} '"\${wl}$exp_sym_flag:\$export_symbols" + else + # Determine the default libpath from the value encoded in an empty executable. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_cxx_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + +aix_libpath=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; } +}'` +# Check for a 64-bit object if we didn't find anything. +if test -z "$aix_libpath"; then aix_libpath=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; } +}'`; fi +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +fi +rm -f conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext +if test -z "$aix_libpath"; then aix_libpath="/usr/lib:/lib"; fi + + hardcode_libdir_flag_spec_CXX='${wl}-blibpath:$libdir:'"$aix_libpath" + # Warning - without using the other run time loading flags, + # -berok will link without error, but may produce a broken library. + no_undefined_flag_CXX=' ${wl}-bernotok' + allow_undefined_flag_CXX=' ${wl}-berok' + # Exported symbols can be pulled into shared objects from archives + whole_archive_flag_spec_CXX='$convenience' + archive_cmds_need_lc_CXX=yes + # This is similar to how AIX traditionally builds its shared libraries. + archive_expsym_cmds_CXX="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs ${wl}-bnoentry $compiler_flags ${wl}-bE:$export_symbols${allow_undefined_flag}~$AR $AR_FLAGS $output_objdir/$libname$release.a $output_objdir/$soname' + fi + fi + ;; + + beos*) + if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then + allow_undefined_flag_CXX=unsupported + # Joseph Beckenbach <jrb3@best.com> says some releases of gcc + # support --undefined. This deserves some investigation. FIXME + archive_cmds_CXX='$CC -nostart $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + else + ld_shlibs_CXX=no + fi + ;; + + chorus*) + case $cc_basename in + *) + # FIXME: insert proper C++ library support + ld_shlibs_CXX=no + ;; + esac + ;; + + cygwin* | mingw* | pw32*) + # _LT_AC_TAGVAR(hardcode_libdir_flag_spec, CXX) is actually meaningless, + # as there is no search path for DLLs. + hardcode_libdir_flag_spec_CXX='-L$libdir' + allow_undefined_flag_CXX=unsupported + always_export_symbols_CXX=no + enable_shared_with_static_runtimes_CXX=yes + + if $LD --help 2>&1 | grep 'auto-import' > /dev/null; then + archive_cmds_CXX='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib' + # If the export-symbols file already is a .def file (1st line + # is EXPORTS), use it as is; otherwise, prepend... + archive_expsym_cmds_CXX='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then + cp $export_symbols $output_objdir/$soname.def; + else + echo EXPORTS > $output_objdir/$soname.def; + cat $export_symbols >> $output_objdir/$soname.def; + fi~ + $CC -shared -nostdlib $output_objdir/$soname.def $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib' + else + ld_shlibs_CXX=no + fi + ;; + darwin* | rhapsody*) + case $host_os in + rhapsody* | darwin1.[012]) + allow_undefined_flag_CXX='${wl}-undefined ${wl}suppress' + ;; + *) # Darwin 1.3 on + if test -z ${MACOSX_DEPLOYMENT_TARGET} ; then + allow_undefined_flag_CXX='${wl}-flat_namespace ${wl}-undefined ${wl}suppress' + else + case ${MACOSX_DEPLOYMENT_TARGET} in + 10.[012]) + allow_undefined_flag_CXX='${wl}-flat_namespace ${wl}-undefined ${wl}suppress' + ;; + 10.*) + allow_undefined_flag_CXX='${wl}-undefined ${wl}dynamic_lookup' + ;; + esac + fi + ;; + esac + archive_cmds_need_lc_CXX=no + hardcode_direct_CXX=no + hardcode_automatic_CXX=yes + hardcode_shlibpath_var_CXX=unsupported + whole_archive_flag_spec_CXX='' + link_all_deplibs_CXX=yes + + if test "$GXX" = yes ; then + lt_int_apple_cc_single_mod=no + output_verbose_link_cmd='echo' + if $CC -dumpspecs 2>&1 | $EGREP 'single_module' >/dev/null ; then + lt_int_apple_cc_single_mod=yes + fi + if test "X$lt_int_apple_cc_single_mod" = Xyes ; then + archive_cmds_CXX='$CC -dynamiclib -single_module $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags -install_name $rpath/$soname $verstring' + else + archive_cmds_CXX='$CC -r -keep_private_externs -nostdlib -o ${lib}-master.o $libobjs~$CC -dynamiclib $allow_undefined_flag -o $lib ${lib}-master.o $deplibs $compiler_flags -install_name $rpath/$soname $verstring' + fi + module_cmds_CXX='$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags' + # Don't fix this by using the ld -exported_symbols_list flag, it doesn't exist in older darwin lds + if test "X$lt_int_apple_cc_single_mod" = Xyes ; then + archive_expsym_cmds_CXX='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -dynamiclib -single_module $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags -install_name $rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}' + else + archive_expsym_cmds_CXX='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -r -keep_private_externs -nostdlib -o ${lib}-master.o $libobjs~$CC -dynamiclib $allow_undefined_flag -o $lib ${lib}-master.o $deplibs $compiler_flags -install_name $rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}' + fi + module_expsym_cmds_CXX='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}' + else + case $cc_basename in + xlc*) + output_verbose_link_cmd='echo' + archive_cmds_CXX='$CC -qmkshrobj ${wl}-single_module $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-install_name ${wl}`echo $rpath/$soname` $verstring' + module_cmds_CXX='$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags' + # Don't fix this by using the ld -exported_symbols_list flag, it doesn't exist in older darwin lds + archive_expsym_cmds_CXX='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -qmkshrobj ${wl}-single_module $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-install_name ${wl}$rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}' + module_expsym_cmds_CXX='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}' + ;; + *) + ld_shlibs_CXX=no + ;; + esac + fi + ;; + + dgux*) + case $cc_basename in + ec++*) + # FIXME: insert proper C++ library support + ld_shlibs_CXX=no + ;; + ghcx*) + # Green Hills C++ Compiler + # FIXME: insert proper C++ library support + ld_shlibs_CXX=no + ;; + *) + # FIXME: insert proper C++ library support + ld_shlibs_CXX=no + ;; + esac + ;; + freebsd[12]*) + # C++ shared libraries reported to be fairly broken before switch to ELF + ld_shlibs_CXX=no + ;; + freebsd-elf*) + archive_cmds_need_lc_CXX=no + ;; + freebsd* | kfreebsd*-gnu | dragonfly*) + # FreeBSD 3 and later use GNU C++ and GNU ld with standard ELF + # conventions + ld_shlibs_CXX=yes + ;; + gnu*) + ;; + hpux9*) + hardcode_libdir_flag_spec_CXX='${wl}+b ${wl}$libdir' + hardcode_libdir_separator_CXX=: + export_dynamic_flag_spec_CXX='${wl}-E' + hardcode_direct_CXX=yes + hardcode_minus_L_CXX=yes # Not in the search PATH, + # but as the default + # location of the library. + + case $cc_basename in + CC*) + # FIXME: insert proper C++ library support + ld_shlibs_CXX=no + ;; + aCC*) + archive_cmds_CXX='$rm $output_objdir/$soname~$CC -b ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib' + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + # + # There doesn't appear to be a way to prevent this compiler from + # explicitly linking system object files so we need to strip them + # from the output so that they don't get included in the library + # dependencies. + output_verbose_link_cmd='templist=`($CC -b $CFLAGS -v conftest.$objext 2>&1) | grep "[-]L"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; echo $list' + ;; + *) + if test "$GXX" = yes; then + archive_cmds_CXX='$rm $output_objdir/$soname~$CC -shared -nostdlib -fPIC ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib' + else + # FIXME: insert proper C++ library support + ld_shlibs_CXX=no + fi + ;; + esac + ;; + hpux10*|hpux11*) + if test $with_gnu_ld = no; then + hardcode_libdir_flag_spec_CXX='${wl}+b ${wl}$libdir' + hardcode_libdir_separator_CXX=: + + case $host_cpu in + hppa*64*|ia64*) + hardcode_libdir_flag_spec_ld_CXX='+b $libdir' + ;; + *) + export_dynamic_flag_spec_CXX='${wl}-E' + ;; + esac + fi + case $host_cpu in + hppa*64*|ia64*) + hardcode_direct_CXX=no + hardcode_shlibpath_var_CXX=no + ;; + *) + hardcode_direct_CXX=yes + hardcode_minus_L_CXX=yes # Not in the search PATH, + # but as the default + # location of the library. + ;; + esac + + case $cc_basename in + CC*) + # FIXME: insert proper C++ library support + ld_shlibs_CXX=no + ;; + aCC*) + case $host_cpu in + hppa*64*) + archive_cmds_CXX='$CC -b ${wl}+h ${wl}$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags' + ;; + ia64*) + archive_cmds_CXX='$CC -b ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags' + ;; + *) + archive_cmds_CXX='$CC -b ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags' + ;; + esac + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + # + # There doesn't appear to be a way to prevent this compiler from + # explicitly linking system object files so we need to strip them + # from the output so that they don't get included in the library + # dependencies. + output_verbose_link_cmd='templist=`($CC -b $CFLAGS -v conftest.$objext 2>&1) | grep "\-L"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; echo $list' + ;; + *) + if test "$GXX" = yes; then + if test $with_gnu_ld = no; then + case $host_cpu in + hppa*64*) + archive_cmds_CXX='$CC -shared -nostdlib -fPIC ${wl}+h ${wl}$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags' + ;; + ia64*) + archive_cmds_CXX='$CC -shared -nostdlib -fPIC ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags' + ;; + *) + archive_cmds_CXX='$CC -shared -nostdlib -fPIC ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags' + ;; + esac + fi + else + # FIXME: insert proper C++ library support + ld_shlibs_CXX=no + fi + ;; + esac + ;; + interix3*) + hardcode_direct_CXX=no + hardcode_shlibpath_var_CXX=no + hardcode_libdir_flag_spec_CXX='${wl}-rpath,$libdir' + export_dynamic_flag_spec_CXX='${wl}-E' + # Hack: On Interix 3.x, we cannot compile PIC because of a broken gcc. + # Instead, shared libraries are loaded at an image base (0x10000000 by + # default) and relocated if they conflict, which is a slow very memory + # consuming and fragmenting process. To avoid this, we pick a random, + # 256 KiB-aligned image base between 0x50000000 and 0x6FFC0000 at link + # time. Moving up from 0x10000000 also allows more sbrk(2) space. + archive_cmds_CXX='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib' + archive_expsym_cmds_CXX='sed "s,^,_," $export_symbols >$output_objdir/$soname.expsym~$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--retain-symbols-file,$output_objdir/$soname.expsym ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib' + ;; + irix5* | irix6*) + case $cc_basename in + CC*) + # SGI C++ + archive_cmds_CXX='$CC -shared -all -multigot $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib' + + # Archives containing C++ object files must be created using + # "CC -ar", where "CC" is the IRIX C++ compiler. This is + # necessary to make sure instantiated templates are included + # in the archive. + old_archive_cmds_CXX='$CC -ar -WR,-u -o $oldlib $oldobjs' + ;; + *) + if test "$GXX" = yes; then + if test "$with_gnu_ld" = no; then + archive_cmds_CXX='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + else + archive_cmds_CXX='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` -o $lib' + fi + fi + link_all_deplibs_CXX=yes + ;; + esac + hardcode_libdir_flag_spec_CXX='${wl}-rpath ${wl}$libdir' + hardcode_libdir_separator_CXX=: + ;; + linux*) + case $cc_basename in + KCC*) + # Kuck and Associates, Inc. (KAI) C++ Compiler + + # KCC will only create a shared library if the output file + # ends with ".so" (or ".sl" for HP-UX), so rename the library + # to its proper name (with version) after linking. + archive_cmds_CXX='tempext=`echo $shared_ext | $SED -e '\''s/\([^()0-9A-Za-z{}]\)/\\\\\1/g'\''`; templib=`echo $lib | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib; mv \$templib $lib' + archive_expsym_cmds_CXX='tempext=`echo $shared_ext | $SED -e '\''s/\([^()0-9A-Za-z{}]\)/\\\\\1/g'\''`; templib=`echo $lib | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib ${wl}-retain-symbols-file,$export_symbols; mv \$templib $lib' + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + # + # There doesn't appear to be a way to prevent this compiler from + # explicitly linking system object files so we need to strip them + # from the output so that they don't get included in the library + # dependencies. + output_verbose_link_cmd='templist=`$CC $CFLAGS -v conftest.$objext -o libconftest$shared_ext 2>&1 | grep "ld"`; rm -f libconftest$shared_ext; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; echo $list' + + hardcode_libdir_flag_spec_CXX='${wl}--rpath,$libdir' + export_dynamic_flag_spec_CXX='${wl}--export-dynamic' + + # Archives containing C++ object files must be created using + # "CC -Bstatic", where "CC" is the KAI C++ compiler. + old_archive_cmds_CXX='$CC -Bstatic -o $oldlib $oldobjs' + ;; + icpc*) + # Intel C++ + with_gnu_ld=yes + # version 8.0 and above of icpc choke on multiply defined symbols + # if we add $predep_objects and $postdep_objects, however 7.1 and + # earlier do not add the objects themselves. + case `$CC -V 2>&1` in + *"Version 7."*) + archive_cmds_CXX='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib' + archive_expsym_cmds_CXX='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + ;; + *) # Version 8.0 or newer + tmp_idyn= + case $host_cpu in + ia64*) tmp_idyn=' -i_dynamic';; + esac + archive_cmds_CXX='$CC -shared'"$tmp_idyn"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + archive_expsym_cmds_CXX='$CC -shared'"$tmp_idyn"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + ;; + esac + archive_cmds_need_lc_CXX=no + hardcode_libdir_flag_spec_CXX='${wl}-rpath,$libdir' + export_dynamic_flag_spec_CXX='${wl}--export-dynamic' + whole_archive_flag_spec_CXX='${wl}--whole-archive$convenience ${wl}--no-whole-archive' + ;; + pgCC*) + # Portland Group C++ compiler + archive_cmds_CXX='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname -o $lib' + archive_expsym_cmds_CXX='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname ${wl}-retain-symbols-file ${wl}$export_symbols -o $lib' + + hardcode_libdir_flag_spec_CXX='${wl}--rpath ${wl}$libdir' + export_dynamic_flag_spec_CXX='${wl}--export-dynamic' + whole_archive_flag_spec_CXX='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}--no-whole-archive' + ;; + cxx*) + # Compaq C++ + archive_cmds_CXX='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib' + archive_expsym_cmds_CXX='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib ${wl}-retain-symbols-file $wl$export_symbols' + + runpath_var=LD_RUN_PATH + hardcode_libdir_flag_spec_CXX='-rpath $libdir' + hardcode_libdir_separator_CXX=: + + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + # + # There doesn't appear to be a way to prevent this compiler from + # explicitly linking system object files so we need to strip them + # from the output so that they don't get included in the library + # dependencies. + output_verbose_link_cmd='templist=`$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep "ld"`; templist=`echo $templist | $SED "s/\(^.*ld.*\)\( .*ld .*$\)/\1/"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; echo $list' + ;; + esac + ;; + lynxos*) + # FIXME: insert proper C++ library support + ld_shlibs_CXX=no + ;; + m88k*) + # FIXME: insert proper C++ library support + ld_shlibs_CXX=no + ;; + mvs*) + case $cc_basename in + cxx*) + # FIXME: insert proper C++ library support + ld_shlibs_CXX=no + ;; + *) + # FIXME: insert proper C++ library support + ld_shlibs_CXX=no + ;; + esac + ;; + netbsd*) + if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then + archive_cmds_CXX='$LD -Bshareable -o $lib $predep_objects $libobjs $deplibs $postdep_objects $linker_flags' + wlarc= + hardcode_libdir_flag_spec_CXX='-R$libdir' + hardcode_direct_CXX=yes + hardcode_shlibpath_var_CXX=no + fi + # Workaround some broken pre-1.5 toolchains + output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep conftest.$objext | $SED -e "s:-lgcc -lc -lgcc::"' + ;; + openbsd2*) + # C++ shared libraries are fairly broken + ld_shlibs_CXX=no + ;; + openbsd*) + hardcode_direct_CXX=yes + hardcode_shlibpath_var_CXX=no + archive_cmds_CXX='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $lib' + hardcode_libdir_flag_spec_CXX='${wl}-rpath,$libdir' + if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then + archive_expsym_cmds_CXX='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-retain-symbols-file,$export_symbols -o $lib' + export_dynamic_flag_spec_CXX='${wl}-E' + whole_archive_flag_spec_CXX="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive' + fi + output_verbose_link_cmd='echo' + ;; + osf3*) + case $cc_basename in + KCC*) + # Kuck and Associates, Inc. (KAI) C++ Compiler + + # KCC will only create a shared library if the output file + # ends with ".so" (or ".sl" for HP-UX), so rename the library + # to its proper name (with version) after linking. + archive_cmds_CXX='tempext=`echo $shared_ext | $SED -e '\''s/\([^()0-9A-Za-z{}]\)/\\\\\1/g'\''`; templib=`echo $lib | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib; mv \$templib $lib' + + hardcode_libdir_flag_spec_CXX='${wl}-rpath,$libdir' + hardcode_libdir_separator_CXX=: + + # Archives containing C++ object files must be created using + # "CC -Bstatic", where "CC" is the KAI C++ compiler. + old_archive_cmds_CXX='$CC -Bstatic -o $oldlib $oldobjs' + + ;; + RCC*) + # Rational C++ 2.4.1 + # FIXME: insert proper C++ library support + ld_shlibs_CXX=no + ;; + cxx*) + allow_undefined_flag_CXX=' ${wl}-expect_unresolved ${wl}\*' + archive_cmds_CXX='$CC -shared${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $soname `test -n "$verstring" && echo ${wl}-set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib' + + hardcode_libdir_flag_spec_CXX='${wl}-rpath ${wl}$libdir' + hardcode_libdir_separator_CXX=: + + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + # + # There doesn't appear to be a way to prevent this compiler from + # explicitly linking system object files so we need to strip them + # from the output so that they don't get included in the library + # dependencies. + output_verbose_link_cmd='templist=`$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep "ld" | grep -v "ld:"`; templist=`echo $templist | $SED "s/\(^.*ld.*\)\( .*ld.*$\)/\1/"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; echo $list' + ;; + *) + if test "$GXX" = yes && test "$with_gnu_ld" = no; then + allow_undefined_flag_CXX=' ${wl}-expect_unresolved ${wl}\*' + archive_cmds_CXX='$CC -shared -nostdlib ${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + + hardcode_libdir_flag_spec_CXX='${wl}-rpath ${wl}$libdir' + hardcode_libdir_separator_CXX=: + + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep "\-L"' + + else + # FIXME: insert proper C++ library support + ld_shlibs_CXX=no + fi + ;; + esac + ;; + osf4* | osf5*) + case $cc_basename in + KCC*) + # Kuck and Associates, Inc. (KAI) C++ Compiler + + # KCC will only create a shared library if the output file + # ends with ".so" (or ".sl" for HP-UX), so rename the library + # to its proper name (with version) after linking. + archive_cmds_CXX='tempext=`echo $shared_ext | $SED -e '\''s/\([^()0-9A-Za-z{}]\)/\\\\\1/g'\''`; templib=`echo $lib | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib; mv \$templib $lib' + + hardcode_libdir_flag_spec_CXX='${wl}-rpath,$libdir' + hardcode_libdir_separator_CXX=: + + # Archives containing C++ object files must be created using + # the KAI C++ compiler. + old_archive_cmds_CXX='$CC -o $oldlib $oldobjs' + ;; + RCC*) + # Rational C++ 2.4.1 + # FIXME: insert proper C++ library support + ld_shlibs_CXX=no + ;; + cxx*) + allow_undefined_flag_CXX=' -expect_unresolved \*' + archive_cmds_CXX='$CC -shared${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -msym -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib' + archive_expsym_cmds_CXX='for i in `cat $export_symbols`; do printf "%s %s\\n" -exported_symbol "\$i" >> $lib.exp; done~ + echo "-hidden">> $lib.exp~ + $CC -shared$allow_undefined_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -msym -soname $soname -Wl,-input -Wl,$lib.exp `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib~ + $rm $lib.exp' + + hardcode_libdir_flag_spec_CXX='-rpath $libdir' + hardcode_libdir_separator_CXX=: + + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + # + # There doesn't appear to be a way to prevent this compiler from + # explicitly linking system object files so we need to strip them + # from the output so that they don't get included in the library + # dependencies. + output_verbose_link_cmd='templist=`$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep "ld" | grep -v "ld:"`; templist=`echo $templist | $SED "s/\(^.*ld.*\)\( .*ld.*$\)/\1/"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; echo $list' + ;; + *) + if test "$GXX" = yes && test "$with_gnu_ld" = no; then + allow_undefined_flag_CXX=' ${wl}-expect_unresolved ${wl}\*' + archive_cmds_CXX='$CC -shared -nostdlib ${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-msym ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + + hardcode_libdir_flag_spec_CXX='${wl}-rpath ${wl}$libdir' + hardcode_libdir_separator_CXX=: + + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep "\-L"' + + else + # FIXME: insert proper C++ library support + ld_shlibs_CXX=no + fi + ;; + esac + ;; + psos*) + # FIXME: insert proper C++ library support + ld_shlibs_CXX=no + ;; + sunos4*) + case $cc_basename in + CC*) + # Sun C++ 4.x + # FIXME: insert proper C++ library support + ld_shlibs_CXX=no + ;; + lcc*) + # Lucid + # FIXME: insert proper C++ library support + ld_shlibs_CXX=no + ;; + *) + # FIXME: insert proper C++ library support + ld_shlibs_CXX=no + ;; + esac + ;; + solaris*) + case $cc_basename in + CC*) + # Sun C++ 4.2, 5.x and Centerline C++ + archive_cmds_need_lc_CXX=yes + no_undefined_flag_CXX=' -zdefs' + archive_cmds_CXX='$CC -G${allow_undefined_flag} -h$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags' + archive_expsym_cmds_CXX='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~ + $CC -G${allow_undefined_flag} ${wl}-M ${wl}$lib.exp -h$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~$rm $lib.exp' + + hardcode_libdir_flag_spec_CXX='-R$libdir' + hardcode_shlibpath_var_CXX=no + case $host_os in + solaris2.[0-5] | solaris2.[0-5].*) ;; + *) + # The C++ compiler is used as linker so we must use $wl + # flag to pass the commands to the underlying system + # linker. We must also pass each convience library through + # to the system linker between allextract/defaultextract. + # The C++ compiler will combine linker options so we + # cannot just pass the convience library names through + # without $wl. + # Supported since Solaris 2.6 (maybe 2.5.1?) + whole_archive_flag_spec_CXX='${wl}-z ${wl}allextract`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}-z ${wl}defaultextract' + ;; + esac + link_all_deplibs_CXX=yes + + output_verbose_link_cmd='echo' + + # Archives containing C++ object files must be created using + # "CC -xar", where "CC" is the Sun C++ compiler. This is + # necessary to make sure instantiated templates are included + # in the archive. + old_archive_cmds_CXX='$CC -xar -o $oldlib $oldobjs' + ;; + gcx*) + # Green Hills C++ Compiler + archive_cmds_CXX='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-h $wl$soname -o $lib' + + # The C++ compiler must be used to create the archive. + old_archive_cmds_CXX='$CC $LDFLAGS -archive -o $oldlib $oldobjs' + ;; + *) + # GNU C++ compiler with Solaris linker + if test "$GXX" = yes && test "$with_gnu_ld" = no; then + no_undefined_flag_CXX=' ${wl}-z ${wl}defs' + if $CC --version | grep -v '^2\.7' > /dev/null; then + archive_cmds_CXX='$CC -shared -nostdlib $LDFLAGS $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-h $wl$soname -o $lib' + archive_expsym_cmds_CXX='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~ + $CC -shared -nostdlib ${wl}-M $wl$lib.exp -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~$rm $lib.exp' + + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + output_verbose_link_cmd="$CC -shared $CFLAGS -v conftest.$objext 2>&1 | grep \"\-L\"" + else + # g++ 2.7 appears to require `-G' NOT `-shared' on this + # platform. + archive_cmds_CXX='$CC -G -nostdlib $LDFLAGS $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-h $wl$soname -o $lib' + archive_expsym_cmds_CXX='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~ + $CC -G -nostdlib ${wl}-M $wl$lib.exp -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~$rm $lib.exp' + + # Commands to make compiler produce verbose output that lists + # what "hidden" libraries, object files and flags are used when + # linking a shared library. + output_verbose_link_cmd="$CC -G $CFLAGS -v conftest.$objext 2>&1 | grep \"\-L\"" + fi + + hardcode_libdir_flag_spec_CXX='${wl}-R $wl$libdir' + fi + ;; + esac + ;; + sysv4*uw2* | sysv5OpenUNIX* | sysv5UnixWare7.[01].[10]* | unixware7* | sco3.2v5.0.[024]*) + no_undefined_flag_CXX='${wl}-z,text' + archive_cmds_need_lc_CXX=no + hardcode_shlibpath_var_CXX=no + runpath_var='LD_RUN_PATH' + + case $cc_basename in + CC*) + archive_cmds_CXX='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds_CXX='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + ;; + *) + archive_cmds_CXX='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds_CXX='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + ;; + esac + ;; + sysv5* | sco3.2v5* | sco5v6*) + # Note: We can NOT use -z defs as we might desire, because we do not + # link with -lc, and that would cause any symbols used from libc to + # always be unresolved, which means just about no library would + # ever link correctly. If we're not using GNU ld we use -z text + # though, which does catch some bad symbols but isn't as heavy-handed + # as -z defs. + # For security reasons, it is highly recommended that you always + # use absolute paths for naming shared libraries, and exclude the + # DT_RUNPATH tag from executables and libraries. But doing so + # requires that you compile everything twice, which is a pain. + # So that behaviour is only enabled if SCOABSPATH is set to a + # non-empty value in the environment. Most likely only useful for + # creating official distributions of packages. + # This is a hack until libtool officially supports absolute path + # names for shared libraries. + no_undefined_flag_CXX='${wl}-z,text' + allow_undefined_flag_CXX='${wl}-z,nodefs' + archive_cmds_need_lc_CXX=no + hardcode_shlibpath_var_CXX=no + hardcode_libdir_flag_spec_CXX='`test -z "$SCOABSPATH" && echo ${wl}-R,$libdir`' + hardcode_libdir_separator_CXX=':' + link_all_deplibs_CXX=yes + export_dynamic_flag_spec_CXX='${wl}-Bexport' + runpath_var='LD_RUN_PATH' + + case $cc_basename in + CC*) + archive_cmds_CXX='$CC -G ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds_CXX='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags' + ;; + *) + archive_cmds_CXX='$CC -shared ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds_CXX='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags' + ;; + esac + ;; + tandem*) + case $cc_basename in + NCC*) + # NonStop-UX NCC 3.20 + # FIXME: insert proper C++ library support + ld_shlibs_CXX=no + ;; + *) + # FIXME: insert proper C++ library support + ld_shlibs_CXX=no + ;; + esac + ;; + vxworks*) + # FIXME: insert proper C++ library support + ld_shlibs_CXX=no + ;; + *) + # FIXME: insert proper C++ library support + ld_shlibs_CXX=no + ;; +esac +echo "$as_me:$LINENO: result: $ld_shlibs_CXX" >&5 +echo "${ECHO_T}$ld_shlibs_CXX" >&6 +test "$ld_shlibs_CXX" = no && can_build_shared=no + +GCC_CXX="$GXX" +LD_CXX="$LD" + + +cat > conftest.$ac_ext <<EOF +class Foo +{ +public: + Foo (void) { a = 0; } +private: + int a; +}; +EOF + +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + # Parse the compiler output and extract the necessary + # objects, libraries and library flags. + + # Sentinel used to keep track of whether or not we are before + # the conftest object file. + pre_test_object_deps_done=no + + # The `*' in the case matches for architectures that use `case' in + # $output_verbose_cmd can trigger glob expansion during the loop + # eval without this substitution. + output_verbose_link_cmd=`$echo "X$output_verbose_link_cmd" | $Xsed -e "$no_glob_subst"` + + for p in `eval $output_verbose_link_cmd`; do + case $p in + + -L* | -R* | -l*) + # Some compilers place space between "-{L,R}" and the path. + # Remove the space. + if test $p = "-L" \ + || test $p = "-R"; then + prev=$p + continue + else + prev= + fi + + if test "$pre_test_object_deps_done" = no; then + case $p in + -L* | -R*) + # Internal compiler library paths should come after those + # provided the user. The postdeps already come after the + # user supplied libs so there is no need to process them. + if test -z "$compiler_lib_search_path_CXX"; then + compiler_lib_search_path_CXX="${prev}${p}" + else + compiler_lib_search_path_CXX="${compiler_lib_search_path_CXX} ${prev}${p}" + fi + ;; + # The "-l" case would never come before the object being + # linked, so don't bother handling this case. + esac + else + if test -z "$postdeps_CXX"; then + postdeps_CXX="${prev}${p}" + else + postdeps_CXX="${postdeps_CXX} ${prev}${p}" + fi + fi + ;; + + *.$objext) + # This assumes that the test object file only shows up + # once in the compiler output. + if test "$p" = "conftest.$objext"; then + pre_test_object_deps_done=yes + continue + fi + + if test "$pre_test_object_deps_done" = no; then + if test -z "$predep_objects_CXX"; then + predep_objects_CXX="$p" + else + predep_objects_CXX="$predep_objects_CXX $p" + fi + else + if test -z "$postdep_objects_CXX"; then + postdep_objects_CXX="$p" + else + postdep_objects_CXX="$postdep_objects_CXX $p" + fi + fi + ;; + + *) ;; # Ignore the rest. + + esac + done + + # Clean up. + rm -f a.out a.exe +else + echo "libtool.m4: error: problem compiling CXX test program" +fi + +$rm -f confest.$objext + +# PORTME: override above test on systems where it is broken +case $host_os in +interix3*) + # Interix 3.5 installs completely hosed .la files for C++, so rather than + # hack all around it, let's just trust "g++" to DTRT. + predep_objects_CXX= + postdep_objects_CXX= + postdeps_CXX= + ;; + +solaris*) + case $cc_basename in + CC*) + # Adding this requires a known-good setup of shared libraries for + # Sun compiler versions before 5.6, else PIC objects from an old + # archive will be linked into the output, leading to subtle bugs. + postdeps_CXX='-lCstd -lCrun' + ;; + esac + ;; +esac + + +case " $postdeps_CXX " in +*" -lc "*) archive_cmds_need_lc_CXX=no ;; +esac + +lt_prog_compiler_wl_CXX= +lt_prog_compiler_pic_CXX= +lt_prog_compiler_static_CXX= + +echo "$as_me:$LINENO: checking for $compiler option to produce PIC" >&5 +echo $ECHO_N "checking for $compiler option to produce PIC... $ECHO_C" >&6 + + # C++ specific cases for pic, static, wl, etc. + if test "$GXX" = yes; then + lt_prog_compiler_wl_CXX='-Wl,' + lt_prog_compiler_static_CXX='-static' + + case $host_os in + aix*) + # All AIX code is PIC. + if test "$host_cpu" = ia64; then + # AIX 5 now supports IA64 processor + lt_prog_compiler_static_CXX='-Bstatic' + fi + ;; + amigaos*) + # FIXME: we need at least 68020 code to build shared libraries, but + # adding the `-m68020' flag to GCC prevents building anything better, + # like `-m68040'. + lt_prog_compiler_pic_CXX='-m68020 -resident32 -malways-restore-a4' + ;; + beos* | cygwin* | irix5* | irix6* | nonstopux* | osf3* | osf4* | osf5*) + # PIC is the default for these OSes. + ;; + mingw* | os2* | pw32*) + # This hack is so that the source file can tell whether it is being + # built for inclusion in a dll (and should export symbols for example). + lt_prog_compiler_pic_CXX='-DDLL_EXPORT' + ;; + darwin* | rhapsody*) + # PIC is the default on this platform + # Common symbols not allowed in MH_DYLIB files + lt_prog_compiler_pic_CXX='-fno-common' + ;; + *djgpp*) + # DJGPP does not support shared libraries at all + lt_prog_compiler_pic_CXX= + ;; + interix3*) + # Interix 3.x gcc -fpic/-fPIC options generate broken code. + # Instead, we relocate shared libraries at runtime. + ;; + sysv4*MP*) + if test -d /usr/nec; then + lt_prog_compiler_pic_CXX=-Kconform_pic + fi + ;; + hpux*) + # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but + # not for PA HP-UX. + case $host_cpu in + hppa*64*|ia64*) + ;; + *) + lt_prog_compiler_pic_CXX='-fPIC' + ;; + esac + ;; + *) + lt_prog_compiler_pic_CXX='-fPIC' + ;; + esac + else + case $host_os in + aix4* | aix5*) + # All AIX code is PIC. + if test "$host_cpu" = ia64; then + # AIX 5 now supports IA64 processor + lt_prog_compiler_static_CXX='-Bstatic' + else + lt_prog_compiler_static_CXX='-bnso -bI:/lib/syscalls.exp' + fi + ;; + chorus*) + case $cc_basename in + cxch68*) + # Green Hills C++ Compiler + # _LT_AC_TAGVAR(lt_prog_compiler_static, CXX)="--no_auto_instantiation -u __main -u __premain -u _abort -r $COOL_DIR/lib/libOrb.a $MVME_DIR/lib/CC/libC.a $MVME_DIR/lib/classix/libcx.s.a" + ;; + esac + ;; + darwin*) + # PIC is the default on this platform + # Common symbols not allowed in MH_DYLIB files + case $cc_basename in + xlc*) + lt_prog_compiler_pic_CXX='-qnocommon' + lt_prog_compiler_wl_CXX='-Wl,' + ;; + esac + ;; + dgux*) + case $cc_basename in + ec++*) + lt_prog_compiler_pic_CXX='-KPIC' + ;; + ghcx*) + # Green Hills C++ Compiler + lt_prog_compiler_pic_CXX='-pic' + ;; + *) + ;; + esac + ;; + freebsd* | kfreebsd*-gnu | dragonfly*) + # FreeBSD uses GNU C++ + ;; + hpux9* | hpux10* | hpux11*) + case $cc_basename in + CC*) + lt_prog_compiler_wl_CXX='-Wl,' + lt_prog_compiler_static_CXX='${wl}-a ${wl}archive' + if test "$host_cpu" != ia64; then + lt_prog_compiler_pic_CXX='+Z' + fi + ;; + aCC*) + lt_prog_compiler_wl_CXX='-Wl,' + lt_prog_compiler_static_CXX='${wl}-a ${wl}archive' + case $host_cpu in + hppa*64*|ia64*) + # +Z the default + ;; + *) + lt_prog_compiler_pic_CXX='+Z' + ;; + esac + ;; + *) + ;; + esac + ;; + interix*) + # This is c89, which is MS Visual C++ (no shared libs) + # Anyone wants to do a port? + ;; + irix5* | irix6* | nonstopux*) + case $cc_basename in + CC*) + lt_prog_compiler_wl_CXX='-Wl,' + lt_prog_compiler_static_CXX='-non_shared' + # CC pic flag -KPIC is the default. + ;; + *) + ;; + esac + ;; + linux*) + case $cc_basename in + KCC*) + # KAI C++ Compiler + lt_prog_compiler_wl_CXX='--backend -Wl,' + lt_prog_compiler_pic_CXX='-fPIC' + ;; + icpc* | ecpc*) + # Intel C++ + lt_prog_compiler_wl_CXX='-Wl,' + lt_prog_compiler_pic_CXX='-KPIC' + lt_prog_compiler_static_CXX='-static' + ;; + pgCC*) + # Portland Group C++ compiler. + lt_prog_compiler_wl_CXX='-Wl,' + lt_prog_compiler_pic_CXX='-fpic' + lt_prog_compiler_static_CXX='-Bstatic' + ;; + cxx*) + # Compaq C++ + # Make sure the PIC flag is empty. It appears that all Alpha + # Linux and Compaq Tru64 Unix objects are PIC. + lt_prog_compiler_pic_CXX= + lt_prog_compiler_static_CXX='-non_shared' + ;; + *) + ;; + esac + ;; + lynxos*) + ;; + m88k*) + ;; + mvs*) + case $cc_basename in + cxx*) + lt_prog_compiler_pic_CXX='-W c,exportall' + ;; + *) + ;; + esac + ;; + netbsd*) + ;; + osf3* | osf4* | osf5*) + case $cc_basename in + KCC*) + lt_prog_compiler_wl_CXX='--backend -Wl,' + ;; + RCC*) + # Rational C++ 2.4.1 + lt_prog_compiler_pic_CXX='-pic' + ;; + cxx*) + # Digital/Compaq C++ + lt_prog_compiler_wl_CXX='-Wl,' + # Make sure the PIC flag is empty. It appears that all Alpha + # Linux and Compaq Tru64 Unix objects are PIC. + lt_prog_compiler_pic_CXX= + lt_prog_compiler_static_CXX='-non_shared' + ;; + *) + ;; + esac + ;; + psos*) + ;; + solaris*) + case $cc_basename in + CC*) + # Sun C++ 4.2, 5.x and Centerline C++ + lt_prog_compiler_pic_CXX='-KPIC' + lt_prog_compiler_static_CXX='-Bstatic' + lt_prog_compiler_wl_CXX='-Qoption ld ' + ;; + gcx*) + # Green Hills C++ Compiler + lt_prog_compiler_pic_CXX='-PIC' + ;; + *) + ;; + esac + ;; + sunos4*) + case $cc_basename in + CC*) + # Sun C++ 4.x + lt_prog_compiler_pic_CXX='-pic' + lt_prog_compiler_static_CXX='-Bstatic' + ;; + lcc*) + # Lucid + lt_prog_compiler_pic_CXX='-pic' + ;; + *) + ;; + esac + ;; + tandem*) + case $cc_basename in + NCC*) + # NonStop-UX NCC 3.20 + lt_prog_compiler_pic_CXX='-KPIC' + ;; + *) + ;; + esac + ;; + sysv5* | unixware* | sco3.2v5* | sco5v6* | OpenUNIX*) + case $cc_basename in + CC*) + lt_prog_compiler_wl_CXX='-Wl,' + lt_prog_compiler_pic_CXX='-KPIC' + lt_prog_compiler_static_CXX='-Bstatic' + ;; + esac + ;; + vxworks*) + ;; + *) + lt_prog_compiler_can_build_shared_CXX=no + ;; + esac + fi + +echo "$as_me:$LINENO: result: $lt_prog_compiler_pic_CXX" >&5 +echo "${ECHO_T}$lt_prog_compiler_pic_CXX" >&6 + +# +# Check to make sure the PIC flag actually works. +# +if test -n "$lt_prog_compiler_pic_CXX"; then + +echo "$as_me:$LINENO: checking if $compiler PIC flag $lt_prog_compiler_pic_CXX works" >&5 +echo $ECHO_N "checking if $compiler PIC flag $lt_prog_compiler_pic_CXX works... $ECHO_C" >&6 +if test "${lt_prog_compiler_pic_works_CXX+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_prog_compiler_pic_works_CXX=no + ac_outfile=conftest.$ac_objext + printf "$lt_simple_compile_test_code" > conftest.$ac_ext + lt_compiler_flag="$lt_prog_compiler_pic_CXX -DPIC" + # Insert the option either (1) after the last *FLAGS variable, or + # (2) before a word containing "conftest.", or (3) at the end. + # Note that $ac_compile itself does not contain backslashes and begins + # with a dollar sign (not a hyphen), so the echo should work correctly. + # The option is referenced via a variable to avoid confusing sed. + lt_compile=`echo "$ac_compile" | $SED \ + -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \ + -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \ + -e 's:$: $lt_compiler_flag:'` + (eval echo "\"\$as_me:11576: $lt_compile\"" >&5) + (eval "$lt_compile" 2>conftest.err) + ac_status=$? + cat conftest.err >&5 + echo "$as_me:11580: \$? = $ac_status" >&5 + if (exit $ac_status) && test -s "$ac_outfile"; then + # The compiler can only warn and ignore the option if not recognized + # So say no if there are warnings other than the usual output. + $echo "X$_lt_compiler_boilerplate" | $Xsed -e '/^$/d' >conftest.exp + $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2 + if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then + lt_prog_compiler_pic_works_CXX=yes + fi + fi + $rm conftest* + +fi +echo "$as_me:$LINENO: result: $lt_prog_compiler_pic_works_CXX" >&5 +echo "${ECHO_T}$lt_prog_compiler_pic_works_CXX" >&6 + +if test x"$lt_prog_compiler_pic_works_CXX" = xyes; then + case $lt_prog_compiler_pic_CXX in + "" | " "*) ;; + *) lt_prog_compiler_pic_CXX=" $lt_prog_compiler_pic_CXX" ;; + esac +else + lt_prog_compiler_pic_CXX= + lt_prog_compiler_can_build_shared_CXX=no +fi + +fi +case $host_os in + # For platforms which do not support PIC, -DPIC is meaningless: + *djgpp*) + lt_prog_compiler_pic_CXX= + ;; + *) + lt_prog_compiler_pic_CXX="$lt_prog_compiler_pic_CXX -DPIC" + ;; +esac + +# +# Check to make sure the static flag actually works. +# +wl=$lt_prog_compiler_wl_CXX eval lt_tmp_static_flag=\"$lt_prog_compiler_static_CXX\" +echo "$as_me:$LINENO: checking if $compiler static flag $lt_tmp_static_flag works" >&5 +echo $ECHO_N "checking if $compiler static flag $lt_tmp_static_flag works... $ECHO_C" >&6 +if test "${lt_prog_compiler_static_works_CXX+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_prog_compiler_static_works_CXX=no + save_LDFLAGS="$LDFLAGS" + LDFLAGS="$LDFLAGS $lt_tmp_static_flag" + printf "$lt_simple_link_test_code" > conftest.$ac_ext + if (eval $ac_link 2>conftest.err) && test -s conftest$ac_exeext; then + # The linker can only warn and ignore the option if not recognized + # So say no if there are warnings + if test -s conftest.err; then + # Append any errors to the config.log. + cat conftest.err 1>&5 + $echo "X$_lt_linker_boilerplate" | $Xsed -e '/^$/d' > conftest.exp + $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2 + if diff conftest.exp conftest.er2 >/dev/null; then + lt_prog_compiler_static_works_CXX=yes + fi + else + lt_prog_compiler_static_works_CXX=yes + fi + fi + $rm conftest* + LDFLAGS="$save_LDFLAGS" + +fi +echo "$as_me:$LINENO: result: $lt_prog_compiler_static_works_CXX" >&5 +echo "${ECHO_T}$lt_prog_compiler_static_works_CXX" >&6 + +if test x"$lt_prog_compiler_static_works_CXX" = xyes; then + : +else + lt_prog_compiler_static_CXX= +fi + + +echo "$as_me:$LINENO: checking if $compiler supports -c -o file.$ac_objext" >&5 +echo $ECHO_N "checking if $compiler supports -c -o file.$ac_objext... $ECHO_C" >&6 +if test "${lt_cv_prog_compiler_c_o_CXX+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_prog_compiler_c_o_CXX=no + $rm -r conftest 2>/dev/null + mkdir conftest + cd conftest + mkdir out + printf "$lt_simple_compile_test_code" > conftest.$ac_ext + + lt_compiler_flag="-o out/conftest2.$ac_objext" + # Insert the option either (1) after the last *FLAGS variable, or + # (2) before a word containing "conftest.", or (3) at the end. + # Note that $ac_compile itself does not contain backslashes and begins + # with a dollar sign (not a hyphen), so the echo should work correctly. + lt_compile=`echo "$ac_compile" | $SED \ + -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \ + -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \ + -e 's:$: $lt_compiler_flag:'` + (eval echo "\"\$as_me:11680: $lt_compile\"" >&5) + (eval "$lt_compile" 2>out/conftest.err) + ac_status=$? + cat out/conftest.err >&5 + echo "$as_me:11684: \$? = $ac_status" >&5 + if (exit $ac_status) && test -s out/conftest2.$ac_objext + then + # The compiler can only warn and ignore the option if not recognized + # So say no if there are warnings + $echo "X$_lt_compiler_boilerplate" | $Xsed -e '/^$/d' > out/conftest.exp + $SED '/^$/d; /^ *+/d' out/conftest.err >out/conftest.er2 + if test ! -s out/conftest.er2 || diff out/conftest.exp out/conftest.er2 >/dev/null; then + lt_cv_prog_compiler_c_o_CXX=yes + fi + fi + chmod u+w . 2>&5 + $rm conftest* + # SGI C++ compiler will create directory out/ii_files/ for + # template instantiation + test -d out/ii_files && $rm out/ii_files/* && rmdir out/ii_files + $rm out/* && rmdir out + cd .. + rmdir conftest + $rm conftest* + +fi +echo "$as_me:$LINENO: result: $lt_cv_prog_compiler_c_o_CXX" >&5 +echo "${ECHO_T}$lt_cv_prog_compiler_c_o_CXX" >&6 + + +hard_links="nottested" +if test "$lt_cv_prog_compiler_c_o_CXX" = no && test "$need_locks" != no; then + # do not overwrite the value of need_locks provided by the user + echo "$as_me:$LINENO: checking if we can lock with hard links" >&5 +echo $ECHO_N "checking if we can lock with hard links... $ECHO_C" >&6 + hard_links=yes + $rm conftest* + ln conftest.a conftest.b 2>/dev/null && hard_links=no + touch conftest.a + ln conftest.a conftest.b 2>&5 || hard_links=no + ln conftest.a conftest.b 2>/dev/null && hard_links=no + echo "$as_me:$LINENO: result: $hard_links" >&5 +echo "${ECHO_T}$hard_links" >&6 + if test "$hard_links" = no; then + { echo "$as_me:$LINENO: WARNING: \`$CC' does not support \`-c -o', so \`make -j' may be unsafe" >&5 +echo "$as_me: WARNING: \`$CC' does not support \`-c -o', so \`make -j' may be unsafe" >&2;} + need_locks=warn + fi +else + need_locks=no +fi + +echo "$as_me:$LINENO: checking whether the $compiler linker ($LD) supports shared libraries" >&5 +echo $ECHO_N "checking whether the $compiler linker ($LD) supports shared libraries... $ECHO_C" >&6 + + export_symbols_cmds_CXX='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols' + case $host_os in + aix4* | aix5*) + # If we're using GNU nm, then we don't want the "-C" option. + # -C means demangle to AIX nm, but means don't demangle with GNU nm + if $NM -V 2>&1 | grep 'GNU' > /dev/null; then + export_symbols_cmds_CXX='$NM -Bpg $libobjs $convenience | awk '\''{ if (((\$2 == "T") || (\$2 == "D") || (\$2 == "B")) && (substr(\$3,1,1) != ".")) { print \$3 } }'\'' | sort -u > $export_symbols' + else + export_symbols_cmds_CXX='$NM -BCpg $libobjs $convenience | awk '\''{ if (((\$2 == "T") || (\$2 == "D") || (\$2 == "B")) && (substr(\$3,1,1) != ".")) { print \$3 } }'\'' | sort -u > $export_symbols' + fi + ;; + pw32*) + export_symbols_cmds_CXX="$ltdll_cmds" + ;; + cygwin* | mingw*) + export_symbols_cmds_CXX='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[BCDGRS] /s/.* \([^ ]*\)/\1 DATA/;/^.* __nm__/s/^.* __nm__\([^ ]*\) [^ ]*/\1 DATA/;/^I /d;/^[AITW] /s/.* //'\'' | sort | uniq > $export_symbols' + ;; + *) + export_symbols_cmds_CXX='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols' + ;; + esac + +echo "$as_me:$LINENO: result: $ld_shlibs_CXX" >&5 +echo "${ECHO_T}$ld_shlibs_CXX" >&6 +test "$ld_shlibs_CXX" = no && can_build_shared=no + +# +# Do we need to explicitly link libc? +# +case "x$archive_cmds_need_lc_CXX" in +x|xyes) + # Assume -lc should be added + archive_cmds_need_lc_CXX=yes + + if test "$enable_shared" = yes && test "$GCC" = yes; then + case $archive_cmds_CXX in + *'~'*) + # FIXME: we may have to deal with multi-command sequences. + ;; + '$CC '*) + # Test whether the compiler implicitly links with -lc since on some + # systems, -lgcc has to come before -lc. If gcc already passes -lc + # to ld, don't add -lc before -lgcc. + echo "$as_me:$LINENO: checking whether -lc should be explicitly linked in" >&5 +echo $ECHO_N "checking whether -lc should be explicitly linked in... $ECHO_C" >&6 + $rm conftest* + printf "$lt_simple_compile_test_code" > conftest.$ac_ext + + if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } 2>conftest.err; then + soname=conftest + lib=conftest + libobjs=conftest.$ac_objext + deplibs= + wl=$lt_prog_compiler_wl_CXX + pic_flag=$lt_prog_compiler_pic_CXX + compiler_flags=-v + linker_flags=-v + verstring= + output_objdir=. + libname=conftest + lt_save_allow_undefined_flag=$allow_undefined_flag_CXX + allow_undefined_flag_CXX= + if { (eval echo "$as_me:$LINENO: \"$archive_cmds_CXX 2\>\&1 \| grep \" -lc \" \>/dev/null 2\>\&1\"") >&5 + (eval $archive_cmds_CXX 2\>\&1 \| grep \" -lc \" \>/dev/null 2\>\&1) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } + then + archive_cmds_need_lc_CXX=no + else + archive_cmds_need_lc_CXX=yes + fi + allow_undefined_flag_CXX=$lt_save_allow_undefined_flag + else + cat conftest.err 1>&5 + fi + $rm conftest* + echo "$as_me:$LINENO: result: $archive_cmds_need_lc_CXX" >&5 +echo "${ECHO_T}$archive_cmds_need_lc_CXX" >&6 + ;; + esac + fi + ;; +esac + +echo "$as_me:$LINENO: checking dynamic linker characteristics" >&5 +echo $ECHO_N "checking dynamic linker characteristics... $ECHO_C" >&6 +library_names_spec= +libname_spec='lib$name' +soname_spec= +shrext_cmds=".so" +postinstall_cmds= +postuninstall_cmds= +finish_cmds= +finish_eval= +shlibpath_var= +shlibpath_overrides_runpath=unknown +version_type=none +dynamic_linker="$host_os ld.so" +sys_lib_dlsearch_path_spec="/lib /usr/lib" +if test "$GCC" = yes; then + sys_lib_search_path_spec=`$CC -print-search-dirs | grep "^libraries:" | $SED -e "s/^libraries://" -e "s,=/,/,g"` + if echo "$sys_lib_search_path_spec" | grep ';' >/dev/null ; then + # if the path contains ";" then we assume it to be the separator + # otherwise default to the standard path separator (i.e. ":") - it is + # assumed that no part of a normal pathname contains ";" but that should + # okay in the real world where ";" in dirpaths is itself problematic. + sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'` + else + sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"` + fi +else + sys_lib_search_path_spec="/lib /usr/lib /usr/local/lib" +fi +need_lib_prefix=unknown +hardcode_into_libs=no + +# when you set need_version to no, make sure it does not cause -set_version +# flags to be left without arguments +need_version=unknown + +case $host_os in +aix3*) + version_type=linux + library_names_spec='${libname}${release}${shared_ext}$versuffix $libname.a' + shlibpath_var=LIBPATH + + # AIX 3 has no versioning support, so we append a major version to the name. + soname_spec='${libname}${release}${shared_ext}$major' + ;; + +aix4* | aix5*) + version_type=linux + need_lib_prefix=no + need_version=no + hardcode_into_libs=yes + if test "$host_cpu" = ia64; then + # AIX 5 supports IA64 + library_names_spec='${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext}$versuffix $libname${shared_ext}' + shlibpath_var=LD_LIBRARY_PATH + else + # With GCC up to 2.95.x, collect2 would create an import file + # for dependence libraries. The import file would start with + # the line `#! .'. This would cause the generated library to + # depend on `.', always an invalid library. This was fixed in + # development snapshots of GCC prior to 3.0. + case $host_os in + aix4 | aix4.[01] | aix4.[01].*) + if { echo '#if __GNUC__ > 2 || (__GNUC__ == 2 && __GNUC_MINOR__ >= 97)' + echo ' yes ' + echo '#endif'; } | ${CC} -E - | grep yes > /dev/null; then + : + else + can_build_shared=no + fi + ;; + esac + # AIX (on Power*) has no versioning support, so currently we can not hardcode correct + # soname into executable. Probably we can add versioning support to + # collect2, so additional links can be useful in future. + if test "$aix_use_runtimelinking" = yes; then + # If using run time linking (on AIX 4.2 or later) use lib<name>.so + # instead of lib<name>.a to let people know that these are not + # typical AIX shared libraries. + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + else + # We preserve .a as extension for shared libraries through AIX4.2 + # and later when we are not doing run time linking. + library_names_spec='${libname}${release}.a $libname.a' + soname_spec='${libname}${release}${shared_ext}$major' + fi + shlibpath_var=LIBPATH + fi + ;; + +amigaos*) + library_names_spec='$libname.ixlibrary $libname.a' + # Create ${libname}_ixlibrary.a entries in /sys/libs. + finish_eval='for lib in `ls $libdir/*.ixlibrary 2>/dev/null`; do libname=`$echo "X$lib" | $Xsed -e '\''s%^.*/\([^/]*\)\.ixlibrary$%\1%'\''`; test $rm /sys/libs/${libname}_ixlibrary.a; $show "cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a"; cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a || exit 1; done' + ;; + +beos*) + library_names_spec='${libname}${shared_ext}' + dynamic_linker="$host_os ld.so" + shlibpath_var=LIBRARY_PATH + ;; + +bsdi[45]*) + version_type=linux + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + finish_cmds='PATH="\$PATH:/sbin" ldconfig $libdir' + shlibpath_var=LD_LIBRARY_PATH + sys_lib_search_path_spec="/shlib /usr/lib /usr/X11/lib /usr/contrib/lib /lib /usr/local/lib" + sys_lib_dlsearch_path_spec="/shlib /usr/lib /usr/local/lib" + # the default ld.so.conf also contains /usr/contrib/lib and + # /usr/X11R6/lib (/usr/X11 is a link to /usr/X11R6), but let us allow + # libtool to hard-code these into programs + ;; + +cygwin* | mingw* | pw32*) + version_type=windows + shrext_cmds=".dll" + need_version=no + need_lib_prefix=no + + case $GCC,$host_os in + yes,cygwin* | yes,mingw* | yes,pw32*) + library_names_spec='$libname.dll.a' + # DLL is installed to $(libdir)/../bin by postinstall_cmds + postinstall_cmds='base_file=`basename \${file}`~ + dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\${base_file}'\''i;echo \$dlname'\''`~ + dldir=$destdir/`dirname \$dlpath`~ + test -d \$dldir || mkdir -p \$dldir~ + $install_prog $dir/$dlname \$dldir/$dlname~ + chmod a+x \$dldir/$dlname' + postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~ + dlpath=$dir/\$dldll~ + $rm \$dlpath' + shlibpath_overrides_runpath=yes + + case $host_os in + cygwin*) + # Cygwin DLLs use 'cyg' prefix rather than 'lib' + soname_spec='`echo ${libname} | sed -e 's/^lib/cyg/'``echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}' + sys_lib_search_path_spec="/usr/lib /lib/w32api /lib /usr/local/lib" + ;; + mingw*) + # MinGW DLLs use traditional 'lib' prefix + soname_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}' + sys_lib_search_path_spec=`$CC -print-search-dirs | grep "^libraries:" | $SED -e "s/^libraries://" -e "s,=/,/,g"` + if echo "$sys_lib_search_path_spec" | grep ';[c-zC-Z]:/' >/dev/null; then + # It is most probably a Windows format PATH printed by + # mingw gcc, but we are running on Cygwin. Gcc prints its search + # path with ; separators, and with drive letters. We can handle the + # drive letters (cygwin fileutils understands them), so leave them, + # especially as we might pass files found there to a mingw objdump, + # which wouldn't understand a cygwinified path. Ahh. + sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'` + else + sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"` + fi + ;; + pw32*) + # pw32 DLLs use 'pw' prefix rather than 'lib' + library_names_spec='`echo ${libname} | sed -e 's/^lib/pw/'``echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}' + ;; + esac + ;; + + *) + library_names_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext} $libname.lib' + ;; + esac + dynamic_linker='Win32 ld.exe' + # FIXME: first we should search . and the directory the executable is in + shlibpath_var=PATH + ;; + +darwin* | rhapsody*) + dynamic_linker="$host_os dyld" + version_type=darwin + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${versuffix}$shared_ext ${libname}${release}${major}$shared_ext ${libname}$shared_ext' + soname_spec='${libname}${release}${major}$shared_ext' + shlibpath_overrides_runpath=yes + shlibpath_var=DYLD_LIBRARY_PATH + shrext_cmds='`test .$module = .yes && echo .so || echo .dylib`' + # Apple's gcc prints 'gcc -print-search-dirs' doesn't operate the same. + if test "$GCC" = yes; then + sys_lib_search_path_spec=`$CC -print-search-dirs | tr "\n" "$PATH_SEPARATOR" | sed -e 's/libraries:/@libraries:/' | tr "@" "\n" | grep "^libraries:" | sed -e "s/^libraries://" -e "s,=/,/,g" -e "s,$PATH_SEPARATOR, ,g" -e "s,.*,& /lib /usr/lib /usr/local/lib,g"` + else + sys_lib_search_path_spec='/lib /usr/lib /usr/local/lib' + fi + sys_lib_dlsearch_path_spec='/usr/local/lib /lib /usr/lib' + ;; + +dgux*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname$shared_ext' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + ;; + +freebsd1*) + dynamic_linker=no + ;; + +kfreebsd*-gnu) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + dynamic_linker='GNU ld.so' + ;; + +freebsd* | dragonfly*) + # DragonFly does not have aout. When/if they implement a new + # versioning mechanism, adjust this. + if test -x /usr/bin/objformat; then + objformat=`/usr/bin/objformat` + else + case $host_os in + freebsd[123]*) objformat=aout ;; + *) objformat=elf ;; + esac + fi + version_type=freebsd-$objformat + case $version_type in + freebsd-elf*) + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}' + need_version=no + need_lib_prefix=no + ;; + freebsd-*) + library_names_spec='${libname}${release}${shared_ext}$versuffix $libname${shared_ext}$versuffix' + need_version=yes + ;; + esac + shlibpath_var=LD_LIBRARY_PATH + case $host_os in + freebsd2*) + shlibpath_overrides_runpath=yes + ;; + freebsd3.[01]* | freebsdelf3.[01]*) + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + ;; + freebsd3.[2-9]* | freebsdelf3.[2-9]* | \ + freebsd4.[0-5] | freebsdelf4.[0-5] | freebsd4.1.1 | freebsdelf4.1.1) + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + ;; + freebsd*) # from 4.6 on + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + ;; + esac + ;; + +gnu*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}${major} ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + hardcode_into_libs=yes + ;; + +hpux9* | hpux10* | hpux11*) + # Give a soname corresponding to the major version so that dld.sl refuses to + # link against other versions. + version_type=sunos + need_lib_prefix=no + need_version=no + case $host_cpu in + ia64*) + shrext_cmds='.so' + hardcode_into_libs=yes + dynamic_linker="$host_os dld.so" + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes # Unless +noenvvar is specified. + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + if test "X$HPUX_IA64_MODE" = X32; then + sys_lib_search_path_spec="/usr/lib/hpux32 /usr/local/lib/hpux32 /usr/local/lib" + else + sys_lib_search_path_spec="/usr/lib/hpux64 /usr/local/lib/hpux64" + fi + sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec + ;; + hppa*64*) + shrext_cmds='.sl' + hardcode_into_libs=yes + dynamic_linker="$host_os dld.sl" + shlibpath_var=LD_LIBRARY_PATH # How should we handle SHLIB_PATH + shlibpath_overrides_runpath=yes # Unless +noenvvar is specified. + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + sys_lib_search_path_spec="/usr/lib/pa20_64 /usr/ccs/lib/pa20_64" + sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec + ;; + *) + shrext_cmds='.sl' + dynamic_linker="$host_os dld.sl" + shlibpath_var=SHLIB_PATH + shlibpath_overrides_runpath=no # +s is required to enable SHLIB_PATH + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + ;; + esac + # HP-UX runs *really* slowly unless shared libraries are mode 555. + postinstall_cmds='chmod 555 $lib' + ;; + +interix3*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + dynamic_linker='Interix 3.x ld.so.1 (PE, like ELF)' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + ;; + +irix5* | irix6* | nonstopux*) + case $host_os in + nonstopux*) version_type=nonstopux ;; + *) + if test "$lt_cv_prog_gnu_ld" = yes; then + version_type=linux + else + version_type=irix + fi ;; + esac + need_lib_prefix=no + need_version=no + soname_spec='${libname}${release}${shared_ext}$major' + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext} $libname${shared_ext}' + case $host_os in + irix5* | nonstopux*) + libsuff= shlibsuff= + ;; + *) + case $LD in # libtool.m4 will add one of these switches to LD + *-32|*"-32 "|*-melf32bsmip|*"-melf32bsmip ") + libsuff= shlibsuff= libmagic=32-bit;; + *-n32|*"-n32 "|*-melf32bmipn32|*"-melf32bmipn32 ") + libsuff=32 shlibsuff=N32 libmagic=N32;; + *-64|*"-64 "|*-melf64bmip|*"-melf64bmip ") + libsuff=64 shlibsuff=64 libmagic=64-bit;; + *) libsuff= shlibsuff= libmagic=never-match;; + esac + ;; + esac + shlibpath_var=LD_LIBRARY${shlibsuff}_PATH + shlibpath_overrides_runpath=no + sys_lib_search_path_spec="/usr/lib${libsuff} /lib${libsuff} /usr/local/lib${libsuff}" + sys_lib_dlsearch_path_spec="/usr/lib${libsuff} /lib${libsuff}" + hardcode_into_libs=yes + ;; + +# No shared lib support for Linux oldld, aout, or coff. +linux*oldld* | linux*aout* | linux*coff*) + dynamic_linker=no + ;; + +# This must be Linux ELF. +linux*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -n $libdir' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + # This implies no fast_install, which is unacceptable. + # Some rework will be needed to allow for fast_install + # before this can be enabled. + hardcode_into_libs=yes + + # find out which ABI we are using + libsuff= + case "$host_cpu" in + x86_64*|s390x*|powerpc64*) + echo '#line 12216 "configure"' > conftest.$ac_ext + if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + case `/usr/bin/file conftest.$ac_objext` in + *64-bit*) + libsuff=64 + sys_lib_search_path_spec="/lib${libsuff} /usr/lib${libsuff} /usr/local/lib${libsuff}" + ;; + esac + fi + rm -rf conftest* + ;; + esac + + # Append ld.so.conf contents to the search path + if test -f /etc/ld.so.conf; then + lt_ld_extra=`awk '/^include / { system(sprintf("cd /etc; cat %s 2>/dev/null", \$2)); skip = 1; } { if (!skip) print \$0; skip = 0; }' < /etc/ld.so.conf | $SED -e 's/#.*//;s/[:, ]/ /g;s/=[^=]*$//;s/=[^= ]* / /g;/^$/d' | tr '\n' ' '` + sys_lib_dlsearch_path_spec="/lib${libsuff} /usr/lib${libsuff} $lt_ld_extra" + fi + + # We used to test for /lib/ld.so.1 and disable shared libraries on + # powerpc, because MkLinux only supported shared libraries with the + # GNU dynamic linker. Since this was broken with cross compilers, + # most powerpc-linux boxes support dynamic linking these days and + # people can always --disable-shared, the test was removed, and we + # assume the GNU/Linux dynamic linker is in use. + dynamic_linker='GNU/Linux ld.so' + ;; + +knetbsd*-gnu) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + dynamic_linker='GNU ld.so' + ;; + +netbsd*) + version_type=sunos + need_lib_prefix=no + need_version=no + if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir' + dynamic_linker='NetBSD (a.out) ld.so' + else + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + dynamic_linker='NetBSD ld.elf_so' + fi + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + ;; + +newsos6) + version_type=linux + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + ;; + +nto-qnx*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + ;; + +openbsd*) + version_type=sunos + sys_lib_dlsearch_path_spec="/usr/lib" + need_lib_prefix=no + # Some older versions of OpenBSD (3.3 at least) *do* need versioned libs. + case $host_os in + openbsd3.3 | openbsd3.3.*) need_version=yes ;; + *) need_version=no ;; + esac + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir' + shlibpath_var=LD_LIBRARY_PATH + if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then + case $host_os in + openbsd2.[89] | openbsd2.[89].*) + shlibpath_overrides_runpath=no + ;; + *) + shlibpath_overrides_runpath=yes + ;; + esac + else + shlibpath_overrides_runpath=yes + fi + ;; + +os2*) + libname_spec='$name' + shrext_cmds=".dll" + need_lib_prefix=no + library_names_spec='$libname${shared_ext} $libname.a' + dynamic_linker='OS/2 ld.exe' + shlibpath_var=LIBPATH + ;; + +osf3* | osf4* | osf5*) + version_type=osf + need_lib_prefix=no + need_version=no + soname_spec='${libname}${release}${shared_ext}$major' + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + shlibpath_var=LD_LIBRARY_PATH + sys_lib_search_path_spec="/usr/shlib /usr/ccs/lib /usr/lib/cmplrs/cc /usr/lib /usr/local/lib /var/shlib" + sys_lib_dlsearch_path_spec="$sys_lib_search_path_spec" + ;; + +solaris*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + # ldd complains unless libraries are executable + postinstall_cmds='chmod +x $lib' + ;; + +sunos4*) + version_type=sunos + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix' + finish_cmds='PATH="\$PATH:/usr/etc" ldconfig $libdir' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + if test "$with_gnu_ld" = yes; then + need_lib_prefix=no + fi + need_version=yes + ;; + +sysv4 | sysv4.3*) + version_type=linux + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + case $host_vendor in + sni) + shlibpath_overrides_runpath=no + need_lib_prefix=no + export_dynamic_flag_spec='${wl}-Blargedynsym' + runpath_var=LD_RUN_PATH + ;; + siemens) + need_lib_prefix=no + ;; + motorola) + need_lib_prefix=no + need_version=no + shlibpath_overrides_runpath=no + sys_lib_search_path_spec='/lib /usr/lib /usr/ccs/lib' + ;; + esac + ;; + +sysv4*MP*) + if test -d /usr/nec ;then + version_type=linux + library_names_spec='$libname${shared_ext}.$versuffix $libname${shared_ext}.$major $libname${shared_ext}' + soname_spec='$libname${shared_ext}.$major' + shlibpath_var=LD_LIBRARY_PATH + fi + ;; + +sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*) + version_type=freebsd-elf + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + hardcode_into_libs=yes + if test "$with_gnu_ld" = yes; then + sys_lib_search_path_spec='/usr/local/lib /usr/gnu/lib /usr/ccs/lib /usr/lib /lib' + shlibpath_overrides_runpath=no + else + sys_lib_search_path_spec='/usr/ccs/lib /usr/lib' + shlibpath_overrides_runpath=yes + case $host_os in + sco3.2v5*) + sys_lib_search_path_spec="$sys_lib_search_path_spec /lib" + ;; + esac + fi + sys_lib_dlsearch_path_spec='/usr/lib' + ;; + +uts4*) + version_type=linux + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + ;; + +*) + dynamic_linker=no + ;; +esac +echo "$as_me:$LINENO: result: $dynamic_linker" >&5 +echo "${ECHO_T}$dynamic_linker" >&6 +test "$dynamic_linker" = no && can_build_shared=no + +variables_saved_for_relink="PATH $shlibpath_var $runpath_var" +if test "$GCC" = yes; then + variables_saved_for_relink="$variables_saved_for_relink GCC_EXEC_PREFIX COMPILER_PATH LIBRARY_PATH" +fi + +echo "$as_me:$LINENO: checking how to hardcode library paths into programs" >&5 +echo $ECHO_N "checking how to hardcode library paths into programs... $ECHO_C" >&6 +hardcode_action_CXX= +if test -n "$hardcode_libdir_flag_spec_CXX" || \ + test -n "$runpath_var_CXX" || \ + test "X$hardcode_automatic_CXX" = "Xyes" ; then + + # We can hardcode non-existant directories. + if test "$hardcode_direct_CXX" != no && + # If the only mechanism to avoid hardcoding is shlibpath_var, we + # have to relink, otherwise we might link with an installed library + # when we should be linking with a yet-to-be-installed one + ## test "$_LT_AC_TAGVAR(hardcode_shlibpath_var, CXX)" != no && + test "$hardcode_minus_L_CXX" != no; then + # Linking always hardcodes the temporary library directory. + hardcode_action_CXX=relink + else + # We can link without hardcoding, and we can hardcode nonexisting dirs. + hardcode_action_CXX=immediate + fi +else + # We cannot hardcode anything, or else we can only hardcode existing + # directories. + hardcode_action_CXX=unsupported +fi +echo "$as_me:$LINENO: result: $hardcode_action_CXX" >&5 +echo "${ECHO_T}$hardcode_action_CXX" >&6 + +if test "$hardcode_action_CXX" = relink; then + # Fast installation is not supported + enable_fast_install=no +elif test "$shlibpath_overrides_runpath" = yes || + test "$enable_shared" = no; then + # Fast installation is not necessary + enable_fast_install=needless +fi + + +# The else clause should only fire when bootstrapping the +# libtool distribution, otherwise you forgot to ship ltmain.sh +# with your package, and you will get complaints that there are +# no rules to generate ltmain.sh. +if test -f "$ltmain"; then + # See if we are running on zsh, and set the options which allow our commands through + # without removal of \ escapes. + if test -n "${ZSH_VERSION+set}" ; then + setopt NO_GLOB_SUBST + fi + # Now quote all the things that may contain metacharacters while being + # careful not to overquote the AC_SUBSTed values. We take copies of the + # variables and quote the copies for generation of the libtool script. + for var in echo old_CC old_CFLAGS AR AR_FLAGS EGREP RANLIB LN_S LTCC LTCFLAGS NM \ + SED SHELL STRIP \ + libname_spec library_names_spec soname_spec extract_expsyms_cmds \ + old_striplib striplib file_magic_cmd finish_cmds finish_eval \ + deplibs_check_method reload_flag reload_cmds need_locks \ + lt_cv_sys_global_symbol_pipe lt_cv_sys_global_symbol_to_cdecl \ + lt_cv_sys_global_symbol_to_c_name_address \ + sys_lib_search_path_spec sys_lib_dlsearch_path_spec \ + old_postinstall_cmds old_postuninstall_cmds \ + compiler_CXX \ + CC_CXX \ + LD_CXX \ + lt_prog_compiler_wl_CXX \ + lt_prog_compiler_pic_CXX \ + lt_prog_compiler_static_CXX \ + lt_prog_compiler_no_builtin_flag_CXX \ + export_dynamic_flag_spec_CXX \ + thread_safe_flag_spec_CXX \ + whole_archive_flag_spec_CXX \ + enable_shared_with_static_runtimes_CXX \ + old_archive_cmds_CXX \ + old_archive_from_new_cmds_CXX \ + predep_objects_CXX \ + postdep_objects_CXX \ + predeps_CXX \ + postdeps_CXX \ + compiler_lib_search_path_CXX \ + archive_cmds_CXX \ + archive_expsym_cmds_CXX \ + postinstall_cmds_CXX \ + postuninstall_cmds_CXX \ + old_archive_from_expsyms_cmds_CXX \ + allow_undefined_flag_CXX \ + no_undefined_flag_CXX \ + export_symbols_cmds_CXX \ + hardcode_libdir_flag_spec_CXX \ + hardcode_libdir_flag_spec_ld_CXX \ + hardcode_libdir_separator_CXX \ + hardcode_automatic_CXX \ + module_cmds_CXX \ + module_expsym_cmds_CXX \ + lt_cv_prog_compiler_c_o_CXX \ + exclude_expsyms_CXX \ + include_expsyms_CXX; do + + case $var in + old_archive_cmds_CXX | \ + old_archive_from_new_cmds_CXX | \ + archive_cmds_CXX | \ + archive_expsym_cmds_CXX | \ + module_cmds_CXX | \ + module_expsym_cmds_CXX | \ + old_archive_from_expsyms_cmds_CXX | \ + export_symbols_cmds_CXX | \ + extract_expsyms_cmds | reload_cmds | finish_cmds | \ + postinstall_cmds | postuninstall_cmds | \ + old_postinstall_cmds | old_postuninstall_cmds | \ + sys_lib_search_path_spec | sys_lib_dlsearch_path_spec) + # Double-quote double-evaled strings. + eval "lt_$var=\\\"\`\$echo \"X\$$var\" | \$Xsed -e \"\$double_quote_subst\" -e \"\$sed_quote_subst\" -e \"\$delay_variable_subst\"\`\\\"" + ;; + *) + eval "lt_$var=\\\"\`\$echo \"X\$$var\" | \$Xsed -e \"\$sed_quote_subst\"\`\\\"" + ;; + esac + done + + case $lt_echo in + *'\$0 --fallback-echo"') + lt_echo=`$echo "X$lt_echo" | $Xsed -e 's/\\\\\\\$0 --fallback-echo"$/$0 --fallback-echo"/'` + ;; + esac + +cfgfile="$ofile" + + cat <<__EOF__ >> "$cfgfile" +# ### BEGIN LIBTOOL TAG CONFIG: $tagname + +# Libtool was configured on host `(hostname || uname -n) 2>/dev/null | sed 1q`: + +# Shell to use when invoking shell scripts. +SHELL=$lt_SHELL + +# Whether or not to build shared libraries. +build_libtool_libs=$enable_shared + +# Whether or not to build static libraries. +build_old_libs=$enable_static + +# Whether or not to add -lc for building shared libraries. +build_libtool_need_lc=$archive_cmds_need_lc_CXX + +# Whether or not to disallow shared libs when runtime libs are static +allow_libtool_libs_with_static_runtimes=$enable_shared_with_static_runtimes_CXX + +# Whether or not to optimize for fast installation. +fast_install=$enable_fast_install + +# The host system. +host_alias=$host_alias +host=$host +host_os=$host_os + +# The build system. +build_alias=$build_alias +build=$build +build_os=$build_os + +# An echo program that does not interpret backslashes. +echo=$lt_echo + +# The archiver. +AR=$lt_AR +AR_FLAGS=$lt_AR_FLAGS + +# A C compiler. +LTCC=$lt_LTCC + +# LTCC compiler flags. +LTCFLAGS=$lt_LTCFLAGS + +# A language-specific compiler. +CC=$lt_compiler_CXX + +# Is the compiler the GNU C compiler? +with_gcc=$GCC_CXX + +gcc_dir=\`gcc -print-file-name=. | $SED 's,/\.$,,'\` +gcc_ver=\`gcc -dumpversion\` + +# An ERE matcher. +EGREP=$lt_EGREP + +# The linker used to build libraries. +LD=$lt_LD_CXX + +# Whether we need hard or soft links. +LN_S=$lt_LN_S + +# A BSD-compatible nm program. +NM=$lt_NM + +# A symbol stripping program +STRIP=$lt_STRIP + +# Used to examine libraries when file_magic_cmd begins "file" +MAGIC_CMD=$MAGIC_CMD + +# Used on cygwin: DLL creation program. +DLLTOOL="$DLLTOOL" + +# Used on cygwin: object dumper. +OBJDUMP="$OBJDUMP" + +# Used on cygwin: assembler. +AS="$AS" + +# The name of the directory that contains temporary libtool files. +objdir=$objdir + +# How to create reloadable object files. +reload_flag=$lt_reload_flag +reload_cmds=$lt_reload_cmds + +# How to pass a linker flag through the compiler. +wl=$lt_lt_prog_compiler_wl_CXX + +# Object file suffix (normally "o"). +objext="$ac_objext" + +# Old archive suffix (normally "a"). +libext="$libext" + +# Shared library suffix (normally ".so"). +shrext_cmds='$shrext_cmds' + +# Executable file suffix (normally ""). +exeext="$exeext" + +# Additional compiler flags for building library objects. +pic_flag=$lt_lt_prog_compiler_pic_CXX +pic_mode=$pic_mode + +# What is the maximum length of a command? +max_cmd_len=$lt_cv_sys_max_cmd_len + +# Does compiler simultaneously support -c and -o options? +compiler_c_o=$lt_lt_cv_prog_compiler_c_o_CXX + +# Must we lock files when doing compilation? +need_locks=$lt_need_locks + +# Do we need the lib prefix for modules? +need_lib_prefix=$need_lib_prefix + +# Do we need a version for libraries? +need_version=$need_version + +# Whether dlopen is supported. +dlopen_support=$enable_dlopen + +# Whether dlopen of programs is supported. +dlopen_self=$enable_dlopen_self + +# Whether dlopen of statically linked programs is supported. +dlopen_self_static=$enable_dlopen_self_static + +# Compiler flag to prevent dynamic linking. +link_static_flag=$lt_lt_prog_compiler_static_CXX + +# Compiler flag to turn off builtin functions. +no_builtin_flag=$lt_lt_prog_compiler_no_builtin_flag_CXX + +# Compiler flag to allow reflexive dlopens. +export_dynamic_flag_spec=$lt_export_dynamic_flag_spec_CXX + +# Compiler flag to generate shared objects directly from archives. +whole_archive_flag_spec=$lt_whole_archive_flag_spec_CXX + +# Compiler flag to generate thread-safe objects. +thread_safe_flag_spec=$lt_thread_safe_flag_spec_CXX + +# Library versioning type. +version_type=$version_type + +# Format of library name prefix. +libname_spec=$lt_libname_spec + +# List of archive names. First name is the real one, the rest are links. +# The last name is the one that the linker finds with -lNAME. +library_names_spec=$lt_library_names_spec + +# The coded name of the library, if different from the real name. +soname_spec=$lt_soname_spec + +# Commands used to build and install an old-style archive. +RANLIB=$lt_RANLIB +old_archive_cmds=$lt_old_archive_cmds_CXX +old_postinstall_cmds=$lt_old_postinstall_cmds +old_postuninstall_cmds=$lt_old_postuninstall_cmds + +# Create an old-style archive from a shared archive. +old_archive_from_new_cmds=$lt_old_archive_from_new_cmds_CXX + +# Create a temporary old-style archive to link instead of a shared archive. +old_archive_from_expsyms_cmds=$lt_old_archive_from_expsyms_cmds_CXX + +# Commands used to build and install a shared archive. +archive_cmds=$lt_archive_cmds_CXX +archive_expsym_cmds=$lt_archive_expsym_cmds_CXX +postinstall_cmds=$lt_postinstall_cmds +postuninstall_cmds=$lt_postuninstall_cmds + +# Commands used to build a loadable module (assumed same as above if empty) +module_cmds=$lt_module_cmds_CXX +module_expsym_cmds=$lt_module_expsym_cmds_CXX + +# Commands to strip libraries. +old_striplib=$lt_old_striplib +striplib=$lt_striplib + +# Dependencies to place before the objects being linked to create a +# shared library. +predep_objects=\`echo $lt_predep_objects_CXX | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\` + +# Dependencies to place after the objects being linked to create a +# shared library. +postdep_objects=\`echo $lt_postdep_objects_CXX | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\` + +# Dependencies to place before the objects being linked to create a +# shared library. +predeps=$lt_predeps_CXX + +# Dependencies to place after the objects being linked to create a +# shared library. +postdeps=$lt_postdeps_CXX + +# The library search path used internally by the compiler when linking +# a shared library. +compiler_lib_search_path=\`echo $lt_compiler_lib_search_path_CXX | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\` + +# Method to check whether dependent libraries are shared objects. +deplibs_check_method=$lt_deplibs_check_method + +# Command to use when deplibs_check_method == file_magic. +file_magic_cmd=$lt_file_magic_cmd + +# Flag that allows shared libraries with undefined symbols to be built. +allow_undefined_flag=$lt_allow_undefined_flag_CXX + +# Flag that forces no undefined symbols. +no_undefined_flag=$lt_no_undefined_flag_CXX + +# Commands used to finish a libtool library installation in a directory. +finish_cmds=$lt_finish_cmds + +# Same as above, but a single script fragment to be evaled but not shown. +finish_eval=$lt_finish_eval + +# Take the output of nm and produce a listing of raw symbols and C names. +global_symbol_pipe=$lt_lt_cv_sys_global_symbol_pipe + +# Transform the output of nm in a proper C declaration +global_symbol_to_cdecl=$lt_lt_cv_sys_global_symbol_to_cdecl + +# Transform the output of nm in a C name address pair +global_symbol_to_c_name_address=$lt_lt_cv_sys_global_symbol_to_c_name_address + +# This is the shared library runtime path variable. +runpath_var=$runpath_var + +# This is the shared library path variable. +shlibpath_var=$shlibpath_var + +# Is shlibpath searched before the hard-coded library search path? +shlibpath_overrides_runpath=$shlibpath_overrides_runpath + +# How to hardcode a shared library path into an executable. +hardcode_action=$hardcode_action_CXX + +# Whether we should hardcode library paths into libraries. +hardcode_into_libs=$hardcode_into_libs + +# Flag to hardcode \$libdir into a binary during linking. +# This must work even if \$libdir does not exist. +hardcode_libdir_flag_spec=$lt_hardcode_libdir_flag_spec_CXX + +# If ld is used when linking, flag to hardcode \$libdir into +# a binary during linking. This must work even if \$libdir does +# not exist. +hardcode_libdir_flag_spec_ld=$lt_hardcode_libdir_flag_spec_ld_CXX + +# Whether we need a single -rpath flag with a separated argument. +hardcode_libdir_separator=$lt_hardcode_libdir_separator_CXX + +# Set to yes if using DIR/libNAME${shared_ext} during linking hardcodes DIR into the +# resulting binary. +hardcode_direct=$hardcode_direct_CXX + +# Set to yes if using the -LDIR flag during linking hardcodes DIR into the +# resulting binary. +hardcode_minus_L=$hardcode_minus_L_CXX + +# Set to yes if using SHLIBPATH_VAR=DIR during linking hardcodes DIR into +# the resulting binary. +hardcode_shlibpath_var=$hardcode_shlibpath_var_CXX + +# Set to yes if building a shared library automatically hardcodes DIR into the library +# and all subsequent libraries and executables linked against it. +hardcode_automatic=$hardcode_automatic_CXX + +# Variables whose values should be saved in libtool wrapper scripts and +# restored at relink time. +variables_saved_for_relink="$variables_saved_for_relink" + +# Whether libtool must link a program against all its dependency libraries. +link_all_deplibs=$link_all_deplibs_CXX + +# Compile-time system search path for libraries +sys_lib_search_path_spec=\`echo $lt_sys_lib_search_path_spec | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\` + +# Run-time system search path for libraries +sys_lib_dlsearch_path_spec=$lt_sys_lib_dlsearch_path_spec + +# Fix the shell variable \$srcfile for the compiler. +fix_srcfile_path="$fix_srcfile_path_CXX" + +# Set to yes if exported symbols are required. +always_export_symbols=$always_export_symbols_CXX + +# The commands to list exported symbols. +export_symbols_cmds=$lt_export_symbols_cmds_CXX + +# The commands to extract the exported symbol list from a shared archive. +extract_expsyms_cmds=$lt_extract_expsyms_cmds + +# Symbols that should not be listed in the preloaded symbols. +exclude_expsyms=$lt_exclude_expsyms_CXX + +# Symbols that must always be exported. +include_expsyms=$lt_include_expsyms_CXX + +# ### END LIBTOOL TAG CONFIG: $tagname + +__EOF__ + + +else + # If there is no Makefile yet, we rely on a make rule to execute + # `config.status --recheck' to rerun these tests and create the + # libtool script then. + ltmain_in=`echo $ltmain | sed -e 's/\.sh$/.in/'` + if test -f "$ltmain_in"; then + test -f Makefile && make "$ltmain" + fi +fi + + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + +CC=$lt_save_CC +LDCXX=$LD +LD=$lt_save_LD +GCC=$lt_save_GCC +with_gnu_ldcxx=$with_gnu_ld +with_gnu_ld=$lt_save_with_gnu_ld +lt_cv_path_LDCXX=$lt_cv_path_LD +lt_cv_path_LD=$lt_save_path_LD +lt_cv_prog_gnu_ldcxx=$lt_cv_prog_gnu_ld +lt_cv_prog_gnu_ld=$lt_save_with_gnu_ld + + else + tagname="" + fi + ;; + + F77) + if test -n "$F77" && test "X$F77" != "Xno"; then + +ac_ext=f +ac_compile='$F77 -c $FFLAGS conftest.$ac_ext >&5' +ac_link='$F77 -o conftest$ac_exeext $FFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_f77_compiler_gnu + + +archive_cmds_need_lc_F77=no +allow_undefined_flag_F77= +always_export_symbols_F77=no +archive_expsym_cmds_F77= +export_dynamic_flag_spec_F77= +hardcode_direct_F77=no +hardcode_libdir_flag_spec_F77= +hardcode_libdir_flag_spec_ld_F77= +hardcode_libdir_separator_F77= +hardcode_minus_L_F77=no +hardcode_automatic_F77=no +module_cmds_F77= +module_expsym_cmds_F77= +link_all_deplibs_F77=unknown +old_archive_cmds_F77=$old_archive_cmds +no_undefined_flag_F77= +whole_archive_flag_spec_F77= +enable_shared_with_static_runtimes_F77=no + +# Source file extension for f77 test sources. +ac_ext=f + +# Object file extension for compiled f77 test sources. +objext=o +objext_F77=$objext + +# Code to be used in simple compile tests +lt_simple_compile_test_code=" subroutine t\n return\n end\n" + +# Code to be used in simple link tests +lt_simple_link_test_code=" program t\n end\n" + +# ltmain only uses $CC for tagged configurations so make sure $CC is set. + +# If no C compiler was specified, use CC. +LTCC=${LTCC-"$CC"} + +# If no C compiler flags were specified, use CFLAGS. +LTCFLAGS=${LTCFLAGS-"$CFLAGS"} + +# Allow CC to be a program name with arguments. +compiler=$CC + + +# save warnings/boilerplate of simple test code +ac_outfile=conftest.$ac_objext +printf "$lt_simple_compile_test_code" >conftest.$ac_ext +eval "$ac_compile" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err +_lt_compiler_boilerplate=`cat conftest.err` +$rm conftest* + +ac_outfile=conftest.$ac_objext +printf "$lt_simple_link_test_code" >conftest.$ac_ext +eval "$ac_link" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err +_lt_linker_boilerplate=`cat conftest.err` +$rm conftest* + + +# Allow CC to be a program name with arguments. +lt_save_CC="$CC" +CC=${F77-"f77"} +compiler=$CC +compiler_F77=$CC +for cc_temp in $compiler""; do + case $cc_temp in + compile | *[\\/]compile | ccache | *[\\/]ccache ) ;; + distcc | *[\\/]distcc | purify | *[\\/]purify ) ;; + \-*) ;; + *) break;; + esac +done +cc_basename=`$echo "X$cc_temp" | $Xsed -e 's%.*/%%' -e "s%^$host_alias-%%"` + + +echo "$as_me:$LINENO: checking if libtool supports shared libraries" >&5 +echo $ECHO_N "checking if libtool supports shared libraries... $ECHO_C" >&6 +echo "$as_me:$LINENO: result: $can_build_shared" >&5 +echo "${ECHO_T}$can_build_shared" >&6 + +echo "$as_me:$LINENO: checking whether to build shared libraries" >&5 +echo $ECHO_N "checking whether to build shared libraries... $ECHO_C" >&6 +test "$can_build_shared" = "no" && enable_shared=no + +# On AIX, shared libraries and static libraries use the same namespace, and +# are all built from PIC. +case $host_os in +aix3*) + test "$enable_shared" = yes && enable_static=no + if test -n "$RANLIB"; then + archive_cmds="$archive_cmds~\$RANLIB \$lib" + postinstall_cmds='$RANLIB $lib' + fi + ;; +aix4* | aix5*) + if test "$host_cpu" != ia64 && test "$aix_use_runtimelinking" = no ; then + test "$enable_shared" = yes && enable_static=no + fi + ;; +esac +echo "$as_me:$LINENO: result: $enable_shared" >&5 +echo "${ECHO_T}$enable_shared" >&6 + +echo "$as_me:$LINENO: checking whether to build static libraries" >&5 +echo $ECHO_N "checking whether to build static libraries... $ECHO_C" >&6 +# Make sure either enable_shared or enable_static is yes. +test "$enable_shared" = yes || enable_static=yes +echo "$as_me:$LINENO: result: $enable_static" >&5 +echo "${ECHO_T}$enable_static" >&6 + +GCC_F77="$G77" +LD_F77="$LD" + +lt_prog_compiler_wl_F77= +lt_prog_compiler_pic_F77= +lt_prog_compiler_static_F77= + +echo "$as_me:$LINENO: checking for $compiler option to produce PIC" >&5 +echo $ECHO_N "checking for $compiler option to produce PIC... $ECHO_C" >&6 + + if test "$GCC" = yes; then + lt_prog_compiler_wl_F77='-Wl,' + lt_prog_compiler_static_F77='-static' + + case $host_os in + aix*) + # All AIX code is PIC. + if test "$host_cpu" = ia64; then + # AIX 5 now supports IA64 processor + lt_prog_compiler_static_F77='-Bstatic' + fi + ;; + + amigaos*) + # FIXME: we need at least 68020 code to build shared libraries, but + # adding the `-m68020' flag to GCC prevents building anything better, + # like `-m68040'. + lt_prog_compiler_pic_F77='-m68020 -resident32 -malways-restore-a4' + ;; + + beos* | cygwin* | irix5* | irix6* | nonstopux* | osf3* | osf4* | osf5*) + # PIC is the default for these OSes. + ;; + + mingw* | pw32* | os2*) + # This hack is so that the source file can tell whether it is being + # built for inclusion in a dll (and should export symbols for example). + lt_prog_compiler_pic_F77='-DDLL_EXPORT' + ;; + + darwin* | rhapsody*) + # PIC is the default on this platform + # Common symbols not allowed in MH_DYLIB files + lt_prog_compiler_pic_F77='-fno-common' + ;; + + interix3*) + # Interix 3.x gcc -fpic/-fPIC options generate broken code. + # Instead, we relocate shared libraries at runtime. + ;; + + msdosdjgpp*) + # Just because we use GCC doesn't mean we suddenly get shared libraries + # on systems that don't support them. + lt_prog_compiler_can_build_shared_F77=no + enable_shared=no + ;; + + sysv4*MP*) + if test -d /usr/nec; then + lt_prog_compiler_pic_F77=-Kconform_pic + fi + ;; + + hpux*) + # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but + # not for PA HP-UX. + case $host_cpu in + hppa*64*|ia64*) + # +Z the default + ;; + *) + lt_prog_compiler_pic_F77='-fPIC' + ;; + esac + ;; + + *) + lt_prog_compiler_pic_F77='-fPIC' + ;; + esac + else + # PORTME Check for flag to pass linker flags through the system compiler. + case $host_os in + aix*) + lt_prog_compiler_wl_F77='-Wl,' + if test "$host_cpu" = ia64; then + # AIX 5 now supports IA64 processor + lt_prog_compiler_static_F77='-Bstatic' + else + lt_prog_compiler_static_F77='-bnso -bI:/lib/syscalls.exp' + fi + ;; + darwin*) + # PIC is the default on this platform + # Common symbols not allowed in MH_DYLIB files + case $cc_basename in + xlc*) + lt_prog_compiler_pic_F77='-qnocommon' + lt_prog_compiler_wl_F77='-Wl,' + ;; + esac + ;; + + mingw* | pw32* | os2*) + # This hack is so that the source file can tell whether it is being + # built for inclusion in a dll (and should export symbols for example). + lt_prog_compiler_pic_F77='-DDLL_EXPORT' + ;; + + hpux9* | hpux10* | hpux11*) + lt_prog_compiler_wl_F77='-Wl,' + # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but + # not for PA HP-UX. + case $host_cpu in + hppa*64*|ia64*) + # +Z the default + ;; + *) + lt_prog_compiler_pic_F77='+Z' + ;; + esac + # Is there a better lt_prog_compiler_static that works with the bundled CC? + lt_prog_compiler_static_F77='${wl}-a ${wl}archive' + ;; + + irix5* | irix6* | nonstopux*) + lt_prog_compiler_wl_F77='-Wl,' + # PIC (with -KPIC) is the default. + lt_prog_compiler_static_F77='-non_shared' + ;; + + newsos6) + lt_prog_compiler_pic_F77='-KPIC' + lt_prog_compiler_static_F77='-Bstatic' + ;; + + linux*) + case $cc_basename in + icc* | ecc*) + lt_prog_compiler_wl_F77='-Wl,' + lt_prog_compiler_pic_F77='-KPIC' + lt_prog_compiler_static_F77='-static' + ;; + pgcc* | pgf77* | pgf90* | pgf95*) + # Portland Group compilers (*not* the Pentium gcc compiler, + # which looks to be a dead project) + lt_prog_compiler_wl_F77='-Wl,' + lt_prog_compiler_pic_F77='-fpic' + lt_prog_compiler_static_F77='-Bstatic' + ;; + ccc*) + lt_prog_compiler_wl_F77='-Wl,' + # All Alpha code is PIC. + lt_prog_compiler_static_F77='-non_shared' + ;; + esac + ;; + + osf3* | osf4* | osf5*) + lt_prog_compiler_wl_F77='-Wl,' + # All OSF/1 code is PIC. + lt_prog_compiler_static_F77='-non_shared' + ;; + + solaris*) + lt_prog_compiler_pic_F77='-KPIC' + lt_prog_compiler_static_F77='-Bstatic' + case $cc_basename in + f77* | f90* | f95*) + lt_prog_compiler_wl_F77='-Qoption ld ';; + *) + lt_prog_compiler_wl_F77='-Wl,';; + esac + ;; + + sunos4*) + lt_prog_compiler_wl_F77='-Qoption ld ' + lt_prog_compiler_pic_F77='-PIC' + lt_prog_compiler_static_F77='-Bstatic' + ;; + + sysv4 | sysv4.2uw2* | sysv4.3*) + lt_prog_compiler_wl_F77='-Wl,' + lt_prog_compiler_pic_F77='-KPIC' + lt_prog_compiler_static_F77='-Bstatic' + ;; + + sysv4*MP*) + if test -d /usr/nec ;then + lt_prog_compiler_pic_F77='-Kconform_pic' + lt_prog_compiler_static_F77='-Bstatic' + fi + ;; + + sysv5* | unixware* | sco3.2v5* | sco5v6* | OpenUNIX*) + lt_prog_compiler_wl_F77='-Wl,' + lt_prog_compiler_pic_F77='-KPIC' + lt_prog_compiler_static_F77='-Bstatic' + ;; + + unicos*) + lt_prog_compiler_wl_F77='-Wl,' + lt_prog_compiler_can_build_shared_F77=no + ;; + + uts4*) + lt_prog_compiler_pic_F77='-pic' + lt_prog_compiler_static_F77='-Bstatic' + ;; + + *) + lt_prog_compiler_can_build_shared_F77=no + ;; + esac + fi + +echo "$as_me:$LINENO: result: $lt_prog_compiler_pic_F77" >&5 +echo "${ECHO_T}$lt_prog_compiler_pic_F77" >&6 + +# +# Check to make sure the PIC flag actually works. +# +if test -n "$lt_prog_compiler_pic_F77"; then + +echo "$as_me:$LINENO: checking if $compiler PIC flag $lt_prog_compiler_pic_F77 works" >&5 +echo $ECHO_N "checking if $compiler PIC flag $lt_prog_compiler_pic_F77 works... $ECHO_C" >&6 +if test "${lt_prog_compiler_pic_works_F77+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_prog_compiler_pic_works_F77=no + ac_outfile=conftest.$ac_objext + printf "$lt_simple_compile_test_code" > conftest.$ac_ext + lt_compiler_flag="$lt_prog_compiler_pic_F77" + # Insert the option either (1) after the last *FLAGS variable, or + # (2) before a word containing "conftest.", or (3) at the end. + # Note that $ac_compile itself does not contain backslashes and begins + # with a dollar sign (not a hyphen), so the echo should work correctly. + # The option is referenced via a variable to avoid confusing sed. + lt_compile=`echo "$ac_compile" | $SED \ + -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \ + -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \ + -e 's:$: $lt_compiler_flag:'` + (eval echo "\"\$as_me:13274: $lt_compile\"" >&5) + (eval "$lt_compile" 2>conftest.err) + ac_status=$? + cat conftest.err >&5 + echo "$as_me:13278: \$? = $ac_status" >&5 + if (exit $ac_status) && test -s "$ac_outfile"; then + # The compiler can only warn and ignore the option if not recognized + # So say no if there are warnings other than the usual output. + $echo "X$_lt_compiler_boilerplate" | $Xsed -e '/^$/d' >conftest.exp + $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2 + if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then + lt_prog_compiler_pic_works_F77=yes + fi + fi + $rm conftest* + +fi +echo "$as_me:$LINENO: result: $lt_prog_compiler_pic_works_F77" >&5 +echo "${ECHO_T}$lt_prog_compiler_pic_works_F77" >&6 + +if test x"$lt_prog_compiler_pic_works_F77" = xyes; then + case $lt_prog_compiler_pic_F77 in + "" | " "*) ;; + *) lt_prog_compiler_pic_F77=" $lt_prog_compiler_pic_F77" ;; + esac +else + lt_prog_compiler_pic_F77= + lt_prog_compiler_can_build_shared_F77=no +fi + +fi +case $host_os in + # For platforms which do not support PIC, -DPIC is meaningless: + *djgpp*) + lt_prog_compiler_pic_F77= + ;; + *) + lt_prog_compiler_pic_F77="$lt_prog_compiler_pic_F77" + ;; +esac + +# +# Check to make sure the static flag actually works. +# +wl=$lt_prog_compiler_wl_F77 eval lt_tmp_static_flag=\"$lt_prog_compiler_static_F77\" +echo "$as_me:$LINENO: checking if $compiler static flag $lt_tmp_static_flag works" >&5 +echo $ECHO_N "checking if $compiler static flag $lt_tmp_static_flag works... $ECHO_C" >&6 +if test "${lt_prog_compiler_static_works_F77+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_prog_compiler_static_works_F77=no + save_LDFLAGS="$LDFLAGS" + LDFLAGS="$LDFLAGS $lt_tmp_static_flag" + printf "$lt_simple_link_test_code" > conftest.$ac_ext + if (eval $ac_link 2>conftest.err) && test -s conftest$ac_exeext; then + # The linker can only warn and ignore the option if not recognized + # So say no if there are warnings + if test -s conftest.err; then + # Append any errors to the config.log. + cat conftest.err 1>&5 + $echo "X$_lt_linker_boilerplate" | $Xsed -e '/^$/d' > conftest.exp + $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2 + if diff conftest.exp conftest.er2 >/dev/null; then + lt_prog_compiler_static_works_F77=yes + fi + else + lt_prog_compiler_static_works_F77=yes + fi + fi + $rm conftest* + LDFLAGS="$save_LDFLAGS" + +fi +echo "$as_me:$LINENO: result: $lt_prog_compiler_static_works_F77" >&5 +echo "${ECHO_T}$lt_prog_compiler_static_works_F77" >&6 + +if test x"$lt_prog_compiler_static_works_F77" = xyes; then + : +else + lt_prog_compiler_static_F77= +fi + + +echo "$as_me:$LINENO: checking if $compiler supports -c -o file.$ac_objext" >&5 +echo $ECHO_N "checking if $compiler supports -c -o file.$ac_objext... $ECHO_C" >&6 +if test "${lt_cv_prog_compiler_c_o_F77+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_prog_compiler_c_o_F77=no + $rm -r conftest 2>/dev/null + mkdir conftest + cd conftest + mkdir out + printf "$lt_simple_compile_test_code" > conftest.$ac_ext + + lt_compiler_flag="-o out/conftest2.$ac_objext" + # Insert the option either (1) after the last *FLAGS variable, or + # (2) before a word containing "conftest.", or (3) at the end. + # Note that $ac_compile itself does not contain backslashes and begins + # with a dollar sign (not a hyphen), so the echo should work correctly. + lt_compile=`echo "$ac_compile" | $SED \ + -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \ + -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \ + -e 's:$: $lt_compiler_flag:'` + (eval echo "\"\$as_me:13378: $lt_compile\"" >&5) + (eval "$lt_compile" 2>out/conftest.err) + ac_status=$? + cat out/conftest.err >&5 + echo "$as_me:13382: \$? = $ac_status" >&5 + if (exit $ac_status) && test -s out/conftest2.$ac_objext + then + # The compiler can only warn and ignore the option if not recognized + # So say no if there are warnings + $echo "X$_lt_compiler_boilerplate" | $Xsed -e '/^$/d' > out/conftest.exp + $SED '/^$/d; /^ *+/d' out/conftest.err >out/conftest.er2 + if test ! -s out/conftest.er2 || diff out/conftest.exp out/conftest.er2 >/dev/null; then + lt_cv_prog_compiler_c_o_F77=yes + fi + fi + chmod u+w . 2>&5 + $rm conftest* + # SGI C++ compiler will create directory out/ii_files/ for + # template instantiation + test -d out/ii_files && $rm out/ii_files/* && rmdir out/ii_files + $rm out/* && rmdir out + cd .. + rmdir conftest + $rm conftest* + +fi +echo "$as_me:$LINENO: result: $lt_cv_prog_compiler_c_o_F77" >&5 +echo "${ECHO_T}$lt_cv_prog_compiler_c_o_F77" >&6 + + +hard_links="nottested" +if test "$lt_cv_prog_compiler_c_o_F77" = no && test "$need_locks" != no; then + # do not overwrite the value of need_locks provided by the user + echo "$as_me:$LINENO: checking if we can lock with hard links" >&5 +echo $ECHO_N "checking if we can lock with hard links... $ECHO_C" >&6 + hard_links=yes + $rm conftest* + ln conftest.a conftest.b 2>/dev/null && hard_links=no + touch conftest.a + ln conftest.a conftest.b 2>&5 || hard_links=no + ln conftest.a conftest.b 2>/dev/null && hard_links=no + echo "$as_me:$LINENO: result: $hard_links" >&5 +echo "${ECHO_T}$hard_links" >&6 + if test "$hard_links" = no; then + { echo "$as_me:$LINENO: WARNING: \`$CC' does not support \`-c -o', so \`make -j' may be unsafe" >&5 +echo "$as_me: WARNING: \`$CC' does not support \`-c -o', so \`make -j' may be unsafe" >&2;} + need_locks=warn + fi +else + need_locks=no +fi + +echo "$as_me:$LINENO: checking whether the $compiler linker ($LD) supports shared libraries" >&5 +echo $ECHO_N "checking whether the $compiler linker ($LD) supports shared libraries... $ECHO_C" >&6 + + runpath_var= + allow_undefined_flag_F77= + enable_shared_with_static_runtimes_F77=no + archive_cmds_F77= + archive_expsym_cmds_F77= + old_archive_From_new_cmds_F77= + old_archive_from_expsyms_cmds_F77= + export_dynamic_flag_spec_F77= + whole_archive_flag_spec_F77= + thread_safe_flag_spec_F77= + hardcode_libdir_flag_spec_F77= + hardcode_libdir_flag_spec_ld_F77= + hardcode_libdir_separator_F77= + hardcode_direct_F77=no + hardcode_minus_L_F77=no + hardcode_shlibpath_var_F77=unsupported + link_all_deplibs_F77=unknown + hardcode_automatic_F77=no + module_cmds_F77= + module_expsym_cmds_F77= + always_export_symbols_F77=no + export_symbols_cmds_F77='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols' + # include_expsyms should be a list of space-separated symbols to be *always* + # included in the symbol list + include_expsyms_F77= + # exclude_expsyms can be an extended regexp of symbols to exclude + # it will be wrapped by ` (' and `)$', so one must not match beginning or + # end of line. Example: `a|bc|.*d.*' will exclude the symbols `a' and `bc', + # as well as any symbol that contains `d'. + exclude_expsyms_F77="_GLOBAL_OFFSET_TABLE_" + # Although _GLOBAL_OFFSET_TABLE_ is a valid symbol C name, most a.out + # platforms (ab)use it in PIC code, but their linkers get confused if + # the symbol is explicitly referenced. Since portable code cannot + # rely on this symbol name, it's probably fine to never include it in + # preloaded symbol tables. + extract_expsyms_cmds= + # Just being paranoid about ensuring that cc_basename is set. + for cc_temp in $compiler""; do + case $cc_temp in + compile | *[\\/]compile | ccache | *[\\/]ccache ) ;; + distcc | *[\\/]distcc | purify | *[\\/]purify ) ;; + \-*) ;; + *) break;; + esac +done +cc_basename=`$echo "X$cc_temp" | $Xsed -e 's%.*/%%' -e "s%^$host_alias-%%"` + + case $host_os in + cygwin* | mingw* | pw32*) + # FIXME: the MSVC++ port hasn't been tested in a loooong time + # When not using gcc, we currently assume that we are using + # Microsoft Visual C++. + if test "$GCC" != yes; then + with_gnu_ld=no + fi + ;; + interix*) + # we just hope/assume this is gcc and not c89 (= MSVC++) + with_gnu_ld=yes + ;; + openbsd*) + with_gnu_ld=no + ;; + esac + + ld_shlibs_F77=yes + if test "$with_gnu_ld" = yes; then + # If archive_cmds runs LD, not CC, wlarc should be empty + wlarc='${wl}' + + # Set some defaults for GNU ld with shared library support. These + # are reset later if shared libraries are not supported. Putting them + # here allows them to be overridden if necessary. + runpath_var=LD_RUN_PATH + hardcode_libdir_flag_spec_F77='${wl}--rpath ${wl}$libdir' + export_dynamic_flag_spec_F77='${wl}--export-dynamic' + # ancient GNU ld didn't support --whole-archive et. al. + if $LD --help 2>&1 | grep 'no-whole-archive' > /dev/null; then + whole_archive_flag_spec_F77="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive' + else + whole_archive_flag_spec_F77= + fi + supports_anon_versioning=no + case `$LD -v 2>/dev/null` in + *\ [01].* | *\ 2.[0-9].* | *\ 2.10.*) ;; # catch versions < 2.11 + *\ 2.11.93.0.2\ *) supports_anon_versioning=yes ;; # RH7.3 ... + *\ 2.11.92.0.12\ *) supports_anon_versioning=yes ;; # Mandrake 8.2 ... + *\ 2.11.*) ;; # other 2.11 versions + *) supports_anon_versioning=yes ;; + esac + + # See if GNU ld supports shared libraries. + case $host_os in + aix3* | aix4* | aix5*) + # On AIX/PPC, the GNU linker is very broken + if test "$host_cpu" != ia64; then + ld_shlibs_F77=no + cat <<EOF 1>&2 + +*** Warning: the GNU linker, at least up to release 2.9.1, is reported +*** to be unable to reliably create shared libraries on AIX. +*** Therefore, libtool is disabling shared libraries support. If you +*** really care for shared libraries, you may want to modify your PATH +*** so that a non-GNU linker is found, and then restart. + +EOF + fi + ;; + + amigaos*) + archive_cmds_F77='$rm $output_objdir/a2ixlibrary.data~$echo "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$echo "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$echo "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$echo "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)' + hardcode_libdir_flag_spec_F77='-L$libdir' + hardcode_minus_L_F77=yes + + # Samuel A. Falvo II <kc5tja@dolphin.openprojects.net> reports + # that the semantics of dynamic libraries on AmigaOS, at least up + # to version 4, is to share data among multiple programs linked + # with the same dynamic library. Since this doesn't match the + # behavior of shared libraries on other platforms, we can't use + # them. + ld_shlibs_F77=no + ;; + + beos*) + if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then + allow_undefined_flag_F77=unsupported + # Joseph Beckenbach <jrb3@best.com> says some releases of gcc + # support --undefined. This deserves some investigation. FIXME + archive_cmds_F77='$CC -nostart $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + else + ld_shlibs_F77=no + fi + ;; + + cygwin* | mingw* | pw32*) + # _LT_AC_TAGVAR(hardcode_libdir_flag_spec, F77) is actually meaningless, + # as there is no search path for DLLs. + hardcode_libdir_flag_spec_F77='-L$libdir' + allow_undefined_flag_F77=unsupported + always_export_symbols_F77=no + enable_shared_with_static_runtimes_F77=yes + export_symbols_cmds_F77='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[BCDGRS] /s/.* \([^ ]*\)/\1 DATA/'\'' | $SED -e '\''/^[AITW] /s/.* //'\'' | sort | uniq > $export_symbols' + + if $LD --help 2>&1 | grep 'auto-import' > /dev/null; then + archive_cmds_F77='$CC -shared $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib' + # If the export-symbols file already is a .def file (1st line + # is EXPORTS), use it as is; otherwise, prepend... + archive_expsym_cmds_F77='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then + cp $export_symbols $output_objdir/$soname.def; + else + echo EXPORTS > $output_objdir/$soname.def; + cat $export_symbols >> $output_objdir/$soname.def; + fi~ + $CC -shared $output_objdir/$soname.def $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib' + else + ld_shlibs_F77=no + fi + ;; + + interix3*) + hardcode_direct_F77=no + hardcode_shlibpath_var_F77=no + hardcode_libdir_flag_spec_F77='${wl}-rpath,$libdir' + export_dynamic_flag_spec_F77='${wl}-E' + # Hack: On Interix 3.x, we cannot compile PIC because of a broken gcc. + # Instead, shared libraries are loaded at an image base (0x10000000 by + # default) and relocated if they conflict, which is a slow very memory + # consuming and fragmenting process. To avoid this, we pick a random, + # 256 KiB-aligned image base between 0x50000000 and 0x6FFC0000 at link + # time. Moving up from 0x10000000 also allows more sbrk(2) space. + archive_cmds_F77='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib' + archive_expsym_cmds_F77='sed "s,^,_," $export_symbols >$output_objdir/$soname.expsym~$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--retain-symbols-file,$output_objdir/$soname.expsym ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib' + ;; + + linux*) + if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then + tmp_addflag= + case $cc_basename,$host_cpu in + pgcc*) # Portland Group C compiler + whole_archive_flag_spec_F77='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}--no-whole-archive' + tmp_addflag=' $pic_flag' + ;; + pgf77* | pgf90* | pgf95*) # Portland Group f77 and f90 compilers + whole_archive_flag_spec_F77='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}--no-whole-archive' + tmp_addflag=' $pic_flag -Mnomain' ;; + ecc*,ia64* | icc*,ia64*) # Intel C compiler on ia64 + tmp_addflag=' -i_dynamic' ;; + efc*,ia64* | ifort*,ia64*) # Intel Fortran compiler on ia64 + tmp_addflag=' -i_dynamic -nofor_main' ;; + ifc* | ifort*) # Intel Fortran compiler + tmp_addflag=' -nofor_main' ;; + esac + archive_cmds_F77='$CC -shared'"$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + + if test $supports_anon_versioning = yes; then + archive_expsym_cmds_F77='$echo "{ global:" > $output_objdir/$libname.ver~ + cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~ + $echo "local: *; };" >> $output_objdir/$libname.ver~ + $CC -shared'"$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-version-script ${wl}$output_objdir/$libname.ver -o $lib' + fi + else + ld_shlibs_F77=no + fi + ;; + + netbsd*) + if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then + archive_cmds_F77='$LD -Bshareable $libobjs $deplibs $linker_flags -o $lib' + wlarc= + else + archive_cmds_F77='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + archive_expsym_cmds_F77='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + fi + ;; + + solaris*) + if $LD -v 2>&1 | grep 'BFD 2\.8' > /dev/null; then + ld_shlibs_F77=no + cat <<EOF 1>&2 + +*** Warning: The releases 2.8.* of the GNU linker cannot reliably +*** create shared libraries on Solaris systems. Therefore, libtool +*** is disabling shared libraries support. We urge you to upgrade GNU +*** binutils to release 2.9.1 or newer. Another option is to modify +*** your PATH or compiler configuration so that the native linker is +*** used, and then restart. + +EOF + elif $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then + archive_cmds_F77='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + archive_expsym_cmds_F77='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + else + ld_shlibs_F77=no + fi + ;; + + sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX*) + case `$LD -v 2>&1` in + *\ [01].* | *\ 2.[0-9].* | *\ 2.1[0-5].*) + ld_shlibs_F77=no + cat <<_LT_EOF 1>&2 + +*** Warning: Releases of the GNU linker prior to 2.16.91.0.3 can not +*** reliably create shared libraries on SCO systems. Therefore, libtool +*** is disabling shared libraries support. We urge you to upgrade GNU +*** binutils to release 2.16.91.0.3 or newer. Another option is to modify +*** your PATH or compiler configuration so that the native linker is +*** used, and then restart. + +_LT_EOF + ;; + *) + if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then + hardcode_libdir_flag_spec_F77='`test -z "$SCOABSPATH" && echo ${wl}-rpath,$libdir`' + archive_cmds_F77='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib' + archive_expsym_cmds_F77='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname,\${SCOABSPATH:+${install_libdir}/}$soname,-retain-symbols-file,$export_symbols -o $lib' + else + ld_shlibs_F77=no + fi + ;; + esac + ;; + + sunos4*) + archive_cmds_F77='$LD -assert pure-text -Bshareable -o $lib $libobjs $deplibs $linker_flags' + wlarc= + hardcode_direct_F77=yes + hardcode_shlibpath_var_F77=no + ;; + + *) + if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then + archive_cmds_F77='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + archive_expsym_cmds_F77='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + else + ld_shlibs_F77=no + fi + ;; + esac + + if test "$ld_shlibs_F77" = no; then + runpath_var= + hardcode_libdir_flag_spec_F77= + export_dynamic_flag_spec_F77= + whole_archive_flag_spec_F77= + fi + else + # PORTME fill in a description of your system's linker (not GNU ld) + case $host_os in + aix3*) + allow_undefined_flag_F77=unsupported + always_export_symbols_F77=yes + archive_expsym_cmds_F77='$LD -o $output_objdir/$soname $libobjs $deplibs $linker_flags -bE:$export_symbols -T512 -H512 -bM:SRE~$AR $AR_FLAGS $lib $output_objdir/$soname' + # Note: this linker hardcodes the directories in LIBPATH if there + # are no directories specified by -L. + hardcode_minus_L_F77=yes + if test "$GCC" = yes && test -z "$lt_prog_compiler_static"; then + # Neither direct hardcoding nor static linking is supported with a + # broken collect2. + hardcode_direct_F77=unsupported + fi + ;; + + aix4* | aix5*) + if test "$host_cpu" = ia64; then + # On IA64, the linker does run time linking by default, so we don't + # have to do anything special. + aix_use_runtimelinking=no + exp_sym_flag='-Bexport' + no_entry_flag="" + else + # If we're using GNU nm, then we don't want the "-C" option. + # -C means demangle to AIX nm, but means don't demangle with GNU nm + if $NM -V 2>&1 | grep 'GNU' > /dev/null; then + export_symbols_cmds_F77='$NM -Bpg $libobjs $convenience | awk '\''{ if (((\$2 == "T") || (\$2 == "D") || (\$2 == "B")) && (substr(\$3,1,1) != ".")) { print \$3 } }'\'' | sort -u > $export_symbols' + else + export_symbols_cmds_F77='$NM -BCpg $libobjs $convenience | awk '\''{ if (((\$2 == "T") || (\$2 == "D") || (\$2 == "B")) && (substr(\$3,1,1) != ".")) { print \$3 } }'\'' | sort -u > $export_symbols' + fi + aix_use_runtimelinking=no + + # Test if we are trying to use run time linking or normal + # AIX style linking. If -brtl is somewhere in LDFLAGS, we + # need to do runtime linking. + case $host_os in aix4.[23]|aix4.[23].*|aix5*) + for ld_flag in $LDFLAGS; do + if (test $ld_flag = "-brtl" || test $ld_flag = "-Wl,-brtl"); then + aix_use_runtimelinking=yes + break + fi + done + ;; + esac + + exp_sym_flag='-bexport' + no_entry_flag='-bnoentry' + fi + + # When large executables or shared objects are built, AIX ld can + # have problems creating the table of contents. If linking a library + # or program results in "error TOC overflow" add -mminimal-toc to + # CXXFLAGS/CFLAGS for g++/gcc. In the cases where that is not + # enough to fix the problem, add -Wl,-bbigtoc to LDFLAGS. + + archive_cmds_F77='' + hardcode_direct_F77=yes + hardcode_libdir_separator_F77=':' + link_all_deplibs_F77=yes + + if test "$GCC" = yes; then + case $host_os in aix4.[012]|aix4.[012].*) + # We only want to do this on AIX 4.2 and lower, the check + # below for broken collect2 doesn't work under 4.3+ + collect2name=`${CC} -print-prog-name=collect2` + if test -f "$collect2name" && \ + strings "$collect2name" | grep resolve_lib_name >/dev/null + then + # We have reworked collect2 + hardcode_direct_F77=yes + else + # We have old collect2 + hardcode_direct_F77=unsupported + # It fails to find uninstalled libraries when the uninstalled + # path is not listed in the libpath. Setting hardcode_minus_L + # to unsupported forces relinking + hardcode_minus_L_F77=yes + hardcode_libdir_flag_spec_F77='-L$libdir' + hardcode_libdir_separator_F77= + fi + ;; + esac + shared_flag='-shared' + if test "$aix_use_runtimelinking" = yes; then + shared_flag="$shared_flag "'${wl}-G' + fi + else + # not using gcc + if test "$host_cpu" = ia64; then + # VisualAge C++, Version 5.5 for AIX 5L for IA-64, Beta 3 Release + # chokes on -Wl,-G. The following line is correct: + shared_flag='-G' + else + if test "$aix_use_runtimelinking" = yes; then + shared_flag='${wl}-G' + else + shared_flag='${wl}-bM:SRE' + fi + fi + fi + + # It seems that -bexpall does not export symbols beginning with + # underscore (_), so it is better to generate a list of symbols to export. + always_export_symbols_F77=yes + if test "$aix_use_runtimelinking" = yes; then + # Warning - without using the other runtime loading flags (-brtl), + # -berok will link without error, but may produce a broken library. + allow_undefined_flag_F77='-berok' + # Determine the default libpath from the value encoded in an empty executable. + cat >conftest.$ac_ext <<_ACEOF + program main + + end +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_f77_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + +aix_libpath=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; } +}'` +# Check for a 64-bit object if we didn't find anything. +if test -z "$aix_libpath"; then aix_libpath=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; } +}'`; fi +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +fi +rm -f conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext +if test -z "$aix_libpath"; then aix_libpath="/usr/lib:/lib"; fi + + hardcode_libdir_flag_spec_F77='${wl}-blibpath:$libdir:'"$aix_libpath" + archive_expsym_cmds_F77="\$CC"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags `if test "x${allow_undefined_flag}" != "x"; then echo "${wl}${allow_undefined_flag}"; else :; fi` '"\${wl}$exp_sym_flag:\$export_symbols $shared_flag" + else + if test "$host_cpu" = ia64; then + hardcode_libdir_flag_spec_F77='${wl}-R $libdir:/usr/lib:/lib' + allow_undefined_flag_F77="-z nodefs" + archive_expsym_cmds_F77="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags ${wl}${allow_undefined_flag} '"\${wl}$exp_sym_flag:\$export_symbols" + else + # Determine the default libpath from the value encoded in an empty executable. + cat >conftest.$ac_ext <<_ACEOF + program main + + end +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_f77_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + +aix_libpath=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; } +}'` +# Check for a 64-bit object if we didn't find anything. +if test -z "$aix_libpath"; then aix_libpath=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; } +}'`; fi +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +fi +rm -f conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext +if test -z "$aix_libpath"; then aix_libpath="/usr/lib:/lib"; fi + + hardcode_libdir_flag_spec_F77='${wl}-blibpath:$libdir:'"$aix_libpath" + # Warning - without using the other run time loading flags, + # -berok will link without error, but may produce a broken library. + no_undefined_flag_F77=' ${wl}-bernotok' + allow_undefined_flag_F77=' ${wl}-berok' + # Exported symbols can be pulled into shared objects from archives + whole_archive_flag_spec_F77='$convenience' + archive_cmds_need_lc_F77=yes + # This is similar to how AIX traditionally builds its shared libraries. + archive_expsym_cmds_F77="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs ${wl}-bnoentry $compiler_flags ${wl}-bE:$export_symbols${allow_undefined_flag}~$AR $AR_FLAGS $output_objdir/$libname$release.a $output_objdir/$soname' + fi + fi + ;; + + amigaos*) + archive_cmds_F77='$rm $output_objdir/a2ixlibrary.data~$echo "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$echo "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$echo "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$echo "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)' + hardcode_libdir_flag_spec_F77='-L$libdir' + hardcode_minus_L_F77=yes + # see comment about different semantics on the GNU ld section + ld_shlibs_F77=no + ;; + + bsdi[45]*) + export_dynamic_flag_spec_F77=-rdynamic + ;; + + cygwin* | mingw* | pw32*) + # When not using gcc, we currently assume that we are using + # Microsoft Visual C++. + # hardcode_libdir_flag_spec is actually meaningless, as there is + # no search path for DLLs. + hardcode_libdir_flag_spec_F77=' ' + allow_undefined_flag_F77=unsupported + # Tell ltmain to make .lib files, not .a files. + libext=lib + # Tell ltmain to make .dll files, not .so files. + shrext_cmds=".dll" + # FIXME: Setting linknames here is a bad hack. + archive_cmds_F77='$CC -o $lib $libobjs $compiler_flags `echo "$deplibs" | $SED -e '\''s/ -lc$//'\''` -link -dll~linknames=' + # The linker will automatically build a .lib file if we build a DLL. + old_archive_From_new_cmds_F77='true' + # FIXME: Should let the user specify the lib program. + old_archive_cmds_F77='lib /OUT:$oldlib$oldobjs$old_deplibs' + fix_srcfile_path_F77='`cygpath -w "$srcfile"`' + enable_shared_with_static_runtimes_F77=yes + ;; + + darwin* | rhapsody*) + case $host_os in + rhapsody* | darwin1.[012]) + allow_undefined_flag_F77='${wl}-undefined ${wl}suppress' + ;; + *) # Darwin 1.3 on + if test -z ${MACOSX_DEPLOYMENT_TARGET} ; then + allow_undefined_flag_F77='${wl}-flat_namespace ${wl}-undefined ${wl}suppress' + else + case ${MACOSX_DEPLOYMENT_TARGET} in + 10.[012]) + allow_undefined_flag_F77='${wl}-flat_namespace ${wl}-undefined ${wl}suppress' + ;; + 10.*) + allow_undefined_flag_F77='${wl}-undefined ${wl}dynamic_lookup' + ;; + esac + fi + ;; + esac + archive_cmds_need_lc_F77=no + hardcode_direct_F77=no + hardcode_automatic_F77=yes + hardcode_shlibpath_var_F77=unsupported + whole_archive_flag_spec_F77='' + link_all_deplibs_F77=yes + if test "$GCC" = yes ; then + output_verbose_link_cmd='echo' + archive_cmds_F77='$CC -dynamiclib $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags -install_name $rpath/$soname $verstring' + module_cmds_F77='$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags' + # Don't fix this by using the ld -exported_symbols_list flag, it doesn't exist in older darwin lds + archive_expsym_cmds_F77='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -dynamiclib $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags -install_name $rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}' + module_expsym_cmds_F77='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}' + else + case $cc_basename in + xlc*) + output_verbose_link_cmd='echo' + archive_cmds_F77='$CC -qmkshrobj $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-install_name ${wl}`echo $rpath/$soname` $verstring' + module_cmds_F77='$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags' + # Don't fix this by using the ld -exported_symbols_list flag, it doesn't exist in older darwin lds + archive_expsym_cmds_F77='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -qmkshrobj $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-install_name ${wl}$rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}' + module_expsym_cmds_F77='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}' + ;; + *) + ld_shlibs_F77=no + ;; + esac + fi + ;; + + dgux*) + archive_cmds_F77='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_libdir_flag_spec_F77='-L$libdir' + hardcode_shlibpath_var_F77=no + ;; + + freebsd1*) + ld_shlibs_F77=no + ;; + + # FreeBSD 2.2.[012] allows us to include c++rt0.o to get C++ constructor + # support. Future versions do this automatically, but an explicit c++rt0.o + # does not break anything, and helps significantly (at the cost of a little + # extra space). + freebsd2.2*) + archive_cmds_F77='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags /usr/lib/c++rt0.o' + hardcode_libdir_flag_spec_F77='-R$libdir' + hardcode_direct_F77=yes + hardcode_shlibpath_var_F77=no + ;; + + # Unfortunately, older versions of FreeBSD 2 do not have this feature. + freebsd2*) + archive_cmds_F77='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' + hardcode_direct_F77=yes + hardcode_minus_L_F77=yes + hardcode_shlibpath_var_F77=no + ;; + + # FreeBSD 3 and greater uses gcc -shared to do shared libraries. + freebsd* | kfreebsd*-gnu | dragonfly*) + archive_cmds_F77='$CC -shared -o $lib $libobjs $deplibs $compiler_flags' + hardcode_libdir_flag_spec_F77='-R$libdir' + hardcode_direct_F77=yes + hardcode_shlibpath_var_F77=no + ;; + + hpux9*) + if test "$GCC" = yes; then + archive_cmds_F77='$rm $output_objdir/$soname~$CC -shared -fPIC ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $libobjs $deplibs $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib' + else + archive_cmds_F77='$rm $output_objdir/$soname~$LD -b +b $install_libdir -o $output_objdir/$soname $libobjs $deplibs $linker_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib' + fi + hardcode_libdir_flag_spec_F77='${wl}+b ${wl}$libdir' + hardcode_libdir_separator_F77=: + hardcode_direct_F77=yes + + # hardcode_minus_L: Not really in the search PATH, + # but as the default location of the library. + hardcode_minus_L_F77=yes + export_dynamic_flag_spec_F77='${wl}-E' + ;; + + hpux10*) + if test "$GCC" = yes -a "$with_gnu_ld" = no; then + archive_cmds_F77='$CC -shared -fPIC ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags' + else + archive_cmds_F77='$LD -b +h $soname +b $install_libdir -o $lib $libobjs $deplibs $linker_flags' + fi + if test "$with_gnu_ld" = no; then + hardcode_libdir_flag_spec_F77='${wl}+b ${wl}$libdir' + hardcode_libdir_separator_F77=: + + hardcode_direct_F77=yes + export_dynamic_flag_spec_F77='${wl}-E' + + # hardcode_minus_L: Not really in the search PATH, + # but as the default location of the library. + hardcode_minus_L_F77=yes + fi + ;; + + hpux11*) + if test "$GCC" = yes -a "$with_gnu_ld" = no; then + case $host_cpu in + hppa*64*) + archive_cmds_F77='$CC -shared ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags' + ;; + ia64*) + archive_cmds_F77='$CC -shared ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags' + ;; + *) + archive_cmds_F77='$CC -shared -fPIC ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags' + ;; + esac + else + case $host_cpu in + hppa*64*) + archive_cmds_F77='$CC -b ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags' + ;; + ia64*) + archive_cmds_F77='$CC -b ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags' + ;; + *) + archive_cmds_F77='$CC -b ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags' + ;; + esac + fi + if test "$with_gnu_ld" = no; then + hardcode_libdir_flag_spec_F77='${wl}+b ${wl}$libdir' + hardcode_libdir_separator_F77=: + + case $host_cpu in + hppa*64*|ia64*) + hardcode_libdir_flag_spec_ld_F77='+b $libdir' + hardcode_direct_F77=no + hardcode_shlibpath_var_F77=no + ;; + *) + hardcode_direct_F77=yes + export_dynamic_flag_spec_F77='${wl}-E' + + # hardcode_minus_L: Not really in the search PATH, + # but as the default location of the library. + hardcode_minus_L_F77=yes + ;; + esac + fi + ;; + + irix5* | irix6* | nonstopux*) + if test "$GCC" = yes; then + archive_cmds_F77='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + else + archive_cmds_F77='$LD -shared $libobjs $deplibs $linker_flags -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib' + hardcode_libdir_flag_spec_ld_F77='-rpath $libdir' + fi + hardcode_libdir_flag_spec_F77='${wl}-rpath ${wl}$libdir' + hardcode_libdir_separator_F77=: + link_all_deplibs_F77=yes + ;; + + netbsd*) + if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then + archive_cmds_F77='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' # a.out + else + archive_cmds_F77='$LD -shared -o $lib $libobjs $deplibs $linker_flags' # ELF + fi + hardcode_libdir_flag_spec_F77='-R$libdir' + hardcode_direct_F77=yes + hardcode_shlibpath_var_F77=no + ;; + + newsos6) + archive_cmds_F77='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_direct_F77=yes + hardcode_libdir_flag_spec_F77='${wl}-rpath ${wl}$libdir' + hardcode_libdir_separator_F77=: + hardcode_shlibpath_var_F77=no + ;; + + openbsd*) + hardcode_direct_F77=yes + hardcode_shlibpath_var_F77=no + if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then + archive_cmds_F77='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds_F77='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-retain-symbols-file,$export_symbols' + hardcode_libdir_flag_spec_F77='${wl}-rpath,$libdir' + export_dynamic_flag_spec_F77='${wl}-E' + else + case $host_os in + openbsd[01].* | openbsd2.[0-7] | openbsd2.[0-7].*) + archive_cmds_F77='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' + hardcode_libdir_flag_spec_F77='-R$libdir' + ;; + *) + archive_cmds_F77='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags' + hardcode_libdir_flag_spec_F77='${wl}-rpath,$libdir' + ;; + esac + fi + ;; + + os2*) + hardcode_libdir_flag_spec_F77='-L$libdir' + hardcode_minus_L_F77=yes + allow_undefined_flag_F77=unsupported + archive_cmds_F77='$echo "LIBRARY $libname INITINSTANCE" > $output_objdir/$libname.def~$echo "DESCRIPTION \"$libname\"" >> $output_objdir/$libname.def~$echo DATA >> $output_objdir/$libname.def~$echo " SINGLE NONSHARED" >> $output_objdir/$libname.def~$echo EXPORTS >> $output_objdir/$libname.def~emxexp $libobjs >> $output_objdir/$libname.def~$CC -Zdll -Zcrtdll -o $lib $libobjs $deplibs $compiler_flags $output_objdir/$libname.def' + old_archive_From_new_cmds_F77='emximp -o $output_objdir/$libname.a $output_objdir/$libname.def' + ;; + + osf3*) + if test "$GCC" = yes; then + allow_undefined_flag_F77=' ${wl}-expect_unresolved ${wl}\*' + archive_cmds_F77='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + else + allow_undefined_flag_F77=' -expect_unresolved \*' + archive_cmds_F77='$LD -shared${allow_undefined_flag} $libobjs $deplibs $linker_flags -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib' + fi + hardcode_libdir_flag_spec_F77='${wl}-rpath ${wl}$libdir' + hardcode_libdir_separator_F77=: + ;; + + osf4* | osf5*) # as osf3* with the addition of -msym flag + if test "$GCC" = yes; then + allow_undefined_flag_F77=' ${wl}-expect_unresolved ${wl}\*' + archive_cmds_F77='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags ${wl}-msym ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + hardcode_libdir_flag_spec_F77='${wl}-rpath ${wl}$libdir' + else + allow_undefined_flag_F77=' -expect_unresolved \*' + archive_cmds_F77='$LD -shared${allow_undefined_flag} $libobjs $deplibs $linker_flags -msym -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib' + archive_expsym_cmds_F77='for i in `cat $export_symbols`; do printf "%s %s\\n" -exported_symbol "\$i" >> $lib.exp; done; echo "-hidden">> $lib.exp~ + $LD -shared${allow_undefined_flag} -input $lib.exp $linker_flags $libobjs $deplibs -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib~$rm $lib.exp' + + # Both c and cxx compiler support -rpath directly + hardcode_libdir_flag_spec_F77='-rpath $libdir' + fi + hardcode_libdir_separator_F77=: + ;; + + solaris*) + no_undefined_flag_F77=' -z text' + if test "$GCC" = yes; then + wlarc='${wl}' + archive_cmds_F77='$CC -shared ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds_F77='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~ + $CC -shared ${wl}-M ${wl}$lib.exp ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags~$rm $lib.exp' + else + wlarc='' + archive_cmds_F77='$LD -G${allow_undefined_flag} -h $soname -o $lib $libobjs $deplibs $linker_flags' + archive_expsym_cmds_F77='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~ + $LD -G${allow_undefined_flag} -M $lib.exp -h $soname -o $lib $libobjs $deplibs $linker_flags~$rm $lib.exp' + fi + hardcode_libdir_flag_spec_F77='-R$libdir' + hardcode_shlibpath_var_F77=no + case $host_os in + solaris2.[0-5] | solaris2.[0-5].*) ;; + *) + # The compiler driver will combine linker options so we + # cannot just pass the convience library names through + # without $wl, iff we do not link with $LD. + # Luckily, gcc supports the same syntax we need for Sun Studio. + # Supported since Solaris 2.6 (maybe 2.5.1?) + case $wlarc in + '') + whole_archive_flag_spec_F77='-z allextract$convenience -z defaultextract' ;; + *) + whole_archive_flag_spec_F77='${wl}-z ${wl}allextract`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}-z ${wl}defaultextract' ;; + esac ;; + esac + link_all_deplibs_F77=yes + ;; + + sunos4*) + if test "x$host_vendor" = xsequent; then + # Use $CC to link under sequent, because it throws in some extra .o + # files that make .init and .fini sections work. + archive_cmds_F77='$CC -G ${wl}-h $soname -o $lib $libobjs $deplibs $compiler_flags' + else + archive_cmds_F77='$LD -assert pure-text -Bstatic -o $lib $libobjs $deplibs $linker_flags' + fi + hardcode_libdir_flag_spec_F77='-L$libdir' + hardcode_direct_F77=yes + hardcode_minus_L_F77=yes + hardcode_shlibpath_var_F77=no + ;; + + sysv4) + case $host_vendor in + sni) + archive_cmds_F77='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_direct_F77=yes # is this really true??? + ;; + siemens) + ## LD is ld it makes a PLAMLIB + ## CC just makes a GrossModule. + archive_cmds_F77='$LD -G -o $lib $libobjs $deplibs $linker_flags' + reload_cmds_F77='$CC -r -o $output$reload_objs' + hardcode_direct_F77=no + ;; + motorola) + archive_cmds_F77='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_direct_F77=no #Motorola manual says yes, but my tests say they lie + ;; + esac + runpath_var='LD_RUN_PATH' + hardcode_shlibpath_var_F77=no + ;; + + sysv4.3*) + archive_cmds_F77='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_shlibpath_var_F77=no + export_dynamic_flag_spec_F77='-Bexport' + ;; + + sysv4*MP*) + if test -d /usr/nec; then + archive_cmds_F77='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_shlibpath_var_F77=no + runpath_var=LD_RUN_PATH + hardcode_runpath_var=yes + ld_shlibs_F77=yes + fi + ;; + + sysv4*uw2* | sysv5OpenUNIX* | sysv5UnixWare7.[01].[10]* | unixware7*) + no_undefined_flag_F77='${wl}-z,text' + archive_cmds_need_lc_F77=no + hardcode_shlibpath_var_F77=no + runpath_var='LD_RUN_PATH' + + if test "$GCC" = yes; then + archive_cmds_F77='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds_F77='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + else + archive_cmds_F77='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds_F77='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + fi + ;; + + sysv5* | sco3.2v5* | sco5v6*) + # Note: We can NOT use -z defs as we might desire, because we do not + # link with -lc, and that would cause any symbols used from libc to + # always be unresolved, which means just about no library would + # ever link correctly. If we're not using GNU ld we use -z text + # though, which does catch some bad symbols but isn't as heavy-handed + # as -z defs. + no_undefined_flag_F77='${wl}-z,text' + allow_undefined_flag_F77='${wl}-z,nodefs' + archive_cmds_need_lc_F77=no + hardcode_shlibpath_var_F77=no + hardcode_libdir_flag_spec_F77='`test -z "$SCOABSPATH" && echo ${wl}-R,$libdir`' + hardcode_libdir_separator_F77=':' + link_all_deplibs_F77=yes + export_dynamic_flag_spec_F77='${wl}-Bexport' + runpath_var='LD_RUN_PATH' + + if test "$GCC" = yes; then + archive_cmds_F77='$CC -shared ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds_F77='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags' + else + archive_cmds_F77='$CC -G ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds_F77='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags' + fi + ;; + + uts4*) + archive_cmds_F77='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_libdir_flag_spec_F77='-L$libdir' + hardcode_shlibpath_var_F77=no + ;; + + *) + ld_shlibs_F77=no + ;; + esac + fi + +echo "$as_me:$LINENO: result: $ld_shlibs_F77" >&5 +echo "${ECHO_T}$ld_shlibs_F77" >&6 +test "$ld_shlibs_F77" = no && can_build_shared=no + +# +# Do we need to explicitly link libc? +# +case "x$archive_cmds_need_lc_F77" in +x|xyes) + # Assume -lc should be added + archive_cmds_need_lc_F77=yes + + if test "$enable_shared" = yes && test "$GCC" = yes; then + case $archive_cmds_F77 in + *'~'*) + # FIXME: we may have to deal with multi-command sequences. + ;; + '$CC '*) + # Test whether the compiler implicitly links with -lc since on some + # systems, -lgcc has to come before -lc. If gcc already passes -lc + # to ld, don't add -lc before -lgcc. + echo "$as_me:$LINENO: checking whether -lc should be explicitly linked in" >&5 +echo $ECHO_N "checking whether -lc should be explicitly linked in... $ECHO_C" >&6 + $rm conftest* + printf "$lt_simple_compile_test_code" > conftest.$ac_ext + + if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } 2>conftest.err; then + soname=conftest + lib=conftest + libobjs=conftest.$ac_objext + deplibs= + wl=$lt_prog_compiler_wl_F77 + pic_flag=$lt_prog_compiler_pic_F77 + compiler_flags=-v + linker_flags=-v + verstring= + output_objdir=. + libname=conftest + lt_save_allow_undefined_flag=$allow_undefined_flag_F77 + allow_undefined_flag_F77= + if { (eval echo "$as_me:$LINENO: \"$archive_cmds_F77 2\>\&1 \| grep \" -lc \" \>/dev/null 2\>\&1\"") >&5 + (eval $archive_cmds_F77 2\>\&1 \| grep \" -lc \" \>/dev/null 2\>\&1) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } + then + archive_cmds_need_lc_F77=no + else + archive_cmds_need_lc_F77=yes + fi + allow_undefined_flag_F77=$lt_save_allow_undefined_flag + else + cat conftest.err 1>&5 + fi + $rm conftest* + echo "$as_me:$LINENO: result: $archive_cmds_need_lc_F77" >&5 +echo "${ECHO_T}$archive_cmds_need_lc_F77" >&6 + ;; + esac + fi + ;; +esac + +echo "$as_me:$LINENO: checking dynamic linker characteristics" >&5 +echo $ECHO_N "checking dynamic linker characteristics... $ECHO_C" >&6 +library_names_spec= +libname_spec='lib$name' +soname_spec= +shrext_cmds=".so" +postinstall_cmds= +postuninstall_cmds= +finish_cmds= +finish_eval= +shlibpath_var= +shlibpath_overrides_runpath=unknown +version_type=none +dynamic_linker="$host_os ld.so" +sys_lib_dlsearch_path_spec="/lib /usr/lib" +if test "$GCC" = yes; then + sys_lib_search_path_spec=`$CC -print-search-dirs | grep "^libraries:" | $SED -e "s/^libraries://" -e "s,=/,/,g"` + if echo "$sys_lib_search_path_spec" | grep ';' >/dev/null ; then + # if the path contains ";" then we assume it to be the separator + # otherwise default to the standard path separator (i.e. ":") - it is + # assumed that no part of a normal pathname contains ";" but that should + # okay in the real world where ";" in dirpaths is itself problematic. + sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'` + else + sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"` + fi +else + sys_lib_search_path_spec="/lib /usr/lib /usr/local/lib" +fi +need_lib_prefix=unknown +hardcode_into_libs=no + +# when you set need_version to no, make sure it does not cause -set_version +# flags to be left without arguments +need_version=unknown + +case $host_os in +aix3*) + version_type=linux + library_names_spec='${libname}${release}${shared_ext}$versuffix $libname.a' + shlibpath_var=LIBPATH + + # AIX 3 has no versioning support, so we append a major version to the name. + soname_spec='${libname}${release}${shared_ext}$major' + ;; + +aix4* | aix5*) + version_type=linux + need_lib_prefix=no + need_version=no + hardcode_into_libs=yes + if test "$host_cpu" = ia64; then + # AIX 5 supports IA64 + library_names_spec='${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext}$versuffix $libname${shared_ext}' + shlibpath_var=LD_LIBRARY_PATH + else + # With GCC up to 2.95.x, collect2 would create an import file + # for dependence libraries. The import file would start with + # the line `#! .'. This would cause the generated library to + # depend on `.', always an invalid library. This was fixed in + # development snapshots of GCC prior to 3.0. + case $host_os in + aix4 | aix4.[01] | aix4.[01].*) + if { echo '#if __GNUC__ > 2 || (__GNUC__ == 2 && __GNUC_MINOR__ >= 97)' + echo ' yes ' + echo '#endif'; } | ${CC} -E - | grep yes > /dev/null; then + : + else + can_build_shared=no + fi + ;; + esac + # AIX (on Power*) has no versioning support, so currently we can not hardcode correct + # soname into executable. Probably we can add versioning support to + # collect2, so additional links can be useful in future. + if test "$aix_use_runtimelinking" = yes; then + # If using run time linking (on AIX 4.2 or later) use lib<name>.so + # instead of lib<name>.a to let people know that these are not + # typical AIX shared libraries. + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + else + # We preserve .a as extension for shared libraries through AIX4.2 + # and later when we are not doing run time linking. + library_names_spec='${libname}${release}.a $libname.a' + soname_spec='${libname}${release}${shared_ext}$major' + fi + shlibpath_var=LIBPATH + fi + ;; + +amigaos*) + library_names_spec='$libname.ixlibrary $libname.a' + # Create ${libname}_ixlibrary.a entries in /sys/libs. + finish_eval='for lib in `ls $libdir/*.ixlibrary 2>/dev/null`; do libname=`$echo "X$lib" | $Xsed -e '\''s%^.*/\([^/]*\)\.ixlibrary$%\1%'\''`; test $rm /sys/libs/${libname}_ixlibrary.a; $show "cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a"; cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a || exit 1; done' + ;; + +beos*) + library_names_spec='${libname}${shared_ext}' + dynamic_linker="$host_os ld.so" + shlibpath_var=LIBRARY_PATH + ;; + +bsdi[45]*) + version_type=linux + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + finish_cmds='PATH="\$PATH:/sbin" ldconfig $libdir' + shlibpath_var=LD_LIBRARY_PATH + sys_lib_search_path_spec="/shlib /usr/lib /usr/X11/lib /usr/contrib/lib /lib /usr/local/lib" + sys_lib_dlsearch_path_spec="/shlib /usr/lib /usr/local/lib" + # the default ld.so.conf also contains /usr/contrib/lib and + # /usr/X11R6/lib (/usr/X11 is a link to /usr/X11R6), but let us allow + # libtool to hard-code these into programs + ;; + +cygwin* | mingw* | pw32*) + version_type=windows + shrext_cmds=".dll" + need_version=no + need_lib_prefix=no + + case $GCC,$host_os in + yes,cygwin* | yes,mingw* | yes,pw32*) + library_names_spec='$libname.dll.a' + # DLL is installed to $(libdir)/../bin by postinstall_cmds + postinstall_cmds='base_file=`basename \${file}`~ + dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\${base_file}'\''i;echo \$dlname'\''`~ + dldir=$destdir/`dirname \$dlpath`~ + test -d \$dldir || mkdir -p \$dldir~ + $install_prog $dir/$dlname \$dldir/$dlname~ + chmod a+x \$dldir/$dlname' + postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~ + dlpath=$dir/\$dldll~ + $rm \$dlpath' + shlibpath_overrides_runpath=yes + + case $host_os in + cygwin*) + # Cygwin DLLs use 'cyg' prefix rather than 'lib' + soname_spec='`echo ${libname} | sed -e 's/^lib/cyg/'``echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}' + sys_lib_search_path_spec="/usr/lib /lib/w32api /lib /usr/local/lib" + ;; + mingw*) + # MinGW DLLs use traditional 'lib' prefix + soname_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}' + sys_lib_search_path_spec=`$CC -print-search-dirs | grep "^libraries:" | $SED -e "s/^libraries://" -e "s,=/,/,g"` + if echo "$sys_lib_search_path_spec" | grep ';[c-zC-Z]:/' >/dev/null; then + # It is most probably a Windows format PATH printed by + # mingw gcc, but we are running on Cygwin. Gcc prints its search + # path with ; separators, and with drive letters. We can handle the + # drive letters (cygwin fileutils understands them), so leave them, + # especially as we might pass files found there to a mingw objdump, + # which wouldn't understand a cygwinified path. Ahh. + sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'` + else + sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"` + fi + ;; + pw32*) + # pw32 DLLs use 'pw' prefix rather than 'lib' + library_names_spec='`echo ${libname} | sed -e 's/^lib/pw/'``echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}' + ;; + esac + ;; + + *) + library_names_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext} $libname.lib' + ;; + esac + dynamic_linker='Win32 ld.exe' + # FIXME: first we should search . and the directory the executable is in + shlibpath_var=PATH + ;; + +darwin* | rhapsody*) + dynamic_linker="$host_os dyld" + version_type=darwin + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${versuffix}$shared_ext ${libname}${release}${major}$shared_ext ${libname}$shared_ext' + soname_spec='${libname}${release}${major}$shared_ext' + shlibpath_overrides_runpath=yes + shlibpath_var=DYLD_LIBRARY_PATH + shrext_cmds='`test .$module = .yes && echo .so || echo .dylib`' + # Apple's gcc prints 'gcc -print-search-dirs' doesn't operate the same. + if test "$GCC" = yes; then + sys_lib_search_path_spec=`$CC -print-search-dirs | tr "\n" "$PATH_SEPARATOR" | sed -e 's/libraries:/@libraries:/' | tr "@" "\n" | grep "^libraries:" | sed -e "s/^libraries://" -e "s,=/,/,g" -e "s,$PATH_SEPARATOR, ,g" -e "s,.*,& /lib /usr/lib /usr/local/lib,g"` + else + sys_lib_search_path_spec='/lib /usr/lib /usr/local/lib' + fi + sys_lib_dlsearch_path_spec='/usr/local/lib /lib /usr/lib' + ;; + +dgux*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname$shared_ext' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + ;; + +freebsd1*) + dynamic_linker=no + ;; + +kfreebsd*-gnu) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + dynamic_linker='GNU ld.so' + ;; + +freebsd* | dragonfly*) + # DragonFly does not have aout. When/if they implement a new + # versioning mechanism, adjust this. + if test -x /usr/bin/objformat; then + objformat=`/usr/bin/objformat` + else + case $host_os in + freebsd[123]*) objformat=aout ;; + *) objformat=elf ;; + esac + fi + version_type=freebsd-$objformat + case $version_type in + freebsd-elf*) + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}' + need_version=no + need_lib_prefix=no + ;; + freebsd-*) + library_names_spec='${libname}${release}${shared_ext}$versuffix $libname${shared_ext}$versuffix' + need_version=yes + ;; + esac + shlibpath_var=LD_LIBRARY_PATH + case $host_os in + freebsd2*) + shlibpath_overrides_runpath=yes + ;; + freebsd3.[01]* | freebsdelf3.[01]*) + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + ;; + freebsd3.[2-9]* | freebsdelf3.[2-9]* | \ + freebsd4.[0-5] | freebsdelf4.[0-5] | freebsd4.1.1 | freebsdelf4.1.1) + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + ;; + freebsd*) # from 4.6 on + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + ;; + esac + ;; + +gnu*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}${major} ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + hardcode_into_libs=yes + ;; + +hpux9* | hpux10* | hpux11*) + # Give a soname corresponding to the major version so that dld.sl refuses to + # link against other versions. + version_type=sunos + need_lib_prefix=no + need_version=no + case $host_cpu in + ia64*) + shrext_cmds='.so' + hardcode_into_libs=yes + dynamic_linker="$host_os dld.so" + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes # Unless +noenvvar is specified. + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + if test "X$HPUX_IA64_MODE" = X32; then + sys_lib_search_path_spec="/usr/lib/hpux32 /usr/local/lib/hpux32 /usr/local/lib" + else + sys_lib_search_path_spec="/usr/lib/hpux64 /usr/local/lib/hpux64" + fi + sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec + ;; + hppa*64*) + shrext_cmds='.sl' + hardcode_into_libs=yes + dynamic_linker="$host_os dld.sl" + shlibpath_var=LD_LIBRARY_PATH # How should we handle SHLIB_PATH + shlibpath_overrides_runpath=yes # Unless +noenvvar is specified. + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + sys_lib_search_path_spec="/usr/lib/pa20_64 /usr/ccs/lib/pa20_64" + sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec + ;; + *) + shrext_cmds='.sl' + dynamic_linker="$host_os dld.sl" + shlibpath_var=SHLIB_PATH + shlibpath_overrides_runpath=no # +s is required to enable SHLIB_PATH + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + ;; + esac + # HP-UX runs *really* slowly unless shared libraries are mode 555. + postinstall_cmds='chmod 555 $lib' + ;; + +interix3*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + dynamic_linker='Interix 3.x ld.so.1 (PE, like ELF)' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + ;; + +irix5* | irix6* | nonstopux*) + case $host_os in + nonstopux*) version_type=nonstopux ;; + *) + if test "$lt_cv_prog_gnu_ld" = yes; then + version_type=linux + else + version_type=irix + fi ;; + esac + need_lib_prefix=no + need_version=no + soname_spec='${libname}${release}${shared_ext}$major' + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext} $libname${shared_ext}' + case $host_os in + irix5* | nonstopux*) + libsuff= shlibsuff= + ;; + *) + case $LD in # libtool.m4 will add one of these switches to LD + *-32|*"-32 "|*-melf32bsmip|*"-melf32bsmip ") + libsuff= shlibsuff= libmagic=32-bit;; + *-n32|*"-n32 "|*-melf32bmipn32|*"-melf32bmipn32 ") + libsuff=32 shlibsuff=N32 libmagic=N32;; + *-64|*"-64 "|*-melf64bmip|*"-melf64bmip ") + libsuff=64 shlibsuff=64 libmagic=64-bit;; + *) libsuff= shlibsuff= libmagic=never-match;; + esac + ;; + esac + shlibpath_var=LD_LIBRARY${shlibsuff}_PATH + shlibpath_overrides_runpath=no + sys_lib_search_path_spec="/usr/lib${libsuff} /lib${libsuff} /usr/local/lib${libsuff}" + sys_lib_dlsearch_path_spec="/usr/lib${libsuff} /lib${libsuff}" + hardcode_into_libs=yes + ;; + +# No shared lib support for Linux oldld, aout, or coff. +linux*oldld* | linux*aout* | linux*coff*) + dynamic_linker=no + ;; + +# This must be Linux ELF. +linux*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -n $libdir' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + # This implies no fast_install, which is unacceptable. + # Some rework will be needed to allow for fast_install + # before this can be enabled. + hardcode_into_libs=yes + + # find out which ABI we are using + libsuff= + case "$host_cpu" in + x86_64*|s390x*|powerpc64*) + echo '#line 14827 "configure"' > conftest.$ac_ext + if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + case `/usr/bin/file conftest.$ac_objext` in + *64-bit*) + libsuff=64 + sys_lib_search_path_spec="/lib${libsuff} /usr/lib${libsuff} /usr/local/lib${libsuff}" + ;; + esac + fi + rm -rf conftest* + ;; + esac + + # Append ld.so.conf contents to the search path + if test -f /etc/ld.so.conf; then + lt_ld_extra=`awk '/^include / { system(sprintf("cd /etc; cat %s 2>/dev/null", \$2)); skip = 1; } { if (!skip) print \$0; skip = 0; }' < /etc/ld.so.conf | $SED -e 's/#.*//;s/[:, ]/ /g;s/=[^=]*$//;s/=[^= ]* / /g;/^$/d' | tr '\n' ' '` + sys_lib_dlsearch_path_spec="/lib${libsuff} /usr/lib${libsuff} $lt_ld_extra" + fi + + # We used to test for /lib/ld.so.1 and disable shared libraries on + # powerpc, because MkLinux only supported shared libraries with the + # GNU dynamic linker. Since this was broken with cross compilers, + # most powerpc-linux boxes support dynamic linking these days and + # people can always --disable-shared, the test was removed, and we + # assume the GNU/Linux dynamic linker is in use. + dynamic_linker='GNU/Linux ld.so' + ;; + +knetbsd*-gnu) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + dynamic_linker='GNU ld.so' + ;; + +netbsd*) + version_type=sunos + need_lib_prefix=no + need_version=no + if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir' + dynamic_linker='NetBSD (a.out) ld.so' + else + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + dynamic_linker='NetBSD ld.elf_so' + fi + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + ;; + +newsos6) + version_type=linux + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + ;; + +nto-qnx*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + ;; + +openbsd*) + version_type=sunos + sys_lib_dlsearch_path_spec="/usr/lib" + need_lib_prefix=no + # Some older versions of OpenBSD (3.3 at least) *do* need versioned libs. + case $host_os in + openbsd3.3 | openbsd3.3.*) need_version=yes ;; + *) need_version=no ;; + esac + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir' + shlibpath_var=LD_LIBRARY_PATH + if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then + case $host_os in + openbsd2.[89] | openbsd2.[89].*) + shlibpath_overrides_runpath=no + ;; + *) + shlibpath_overrides_runpath=yes + ;; + esac + else + shlibpath_overrides_runpath=yes + fi + ;; + +os2*) + libname_spec='$name' + shrext_cmds=".dll" + need_lib_prefix=no + library_names_spec='$libname${shared_ext} $libname.a' + dynamic_linker='OS/2 ld.exe' + shlibpath_var=LIBPATH + ;; + +osf3* | osf4* | osf5*) + version_type=osf + need_lib_prefix=no + need_version=no + soname_spec='${libname}${release}${shared_ext}$major' + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + shlibpath_var=LD_LIBRARY_PATH + sys_lib_search_path_spec="/usr/shlib /usr/ccs/lib /usr/lib/cmplrs/cc /usr/lib /usr/local/lib /var/shlib" + sys_lib_dlsearch_path_spec="$sys_lib_search_path_spec" + ;; + +solaris*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + # ldd complains unless libraries are executable + postinstall_cmds='chmod +x $lib' + ;; + +sunos4*) + version_type=sunos + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix' + finish_cmds='PATH="\$PATH:/usr/etc" ldconfig $libdir' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + if test "$with_gnu_ld" = yes; then + need_lib_prefix=no + fi + need_version=yes + ;; + +sysv4 | sysv4.3*) + version_type=linux + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + case $host_vendor in + sni) + shlibpath_overrides_runpath=no + need_lib_prefix=no + export_dynamic_flag_spec='${wl}-Blargedynsym' + runpath_var=LD_RUN_PATH + ;; + siemens) + need_lib_prefix=no + ;; + motorola) + need_lib_prefix=no + need_version=no + shlibpath_overrides_runpath=no + sys_lib_search_path_spec='/lib /usr/lib /usr/ccs/lib' + ;; + esac + ;; + +sysv4*MP*) + if test -d /usr/nec ;then + version_type=linux + library_names_spec='$libname${shared_ext}.$versuffix $libname${shared_ext}.$major $libname${shared_ext}' + soname_spec='$libname${shared_ext}.$major' + shlibpath_var=LD_LIBRARY_PATH + fi + ;; + +sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*) + version_type=freebsd-elf + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + hardcode_into_libs=yes + if test "$with_gnu_ld" = yes; then + sys_lib_search_path_spec='/usr/local/lib /usr/gnu/lib /usr/ccs/lib /usr/lib /lib' + shlibpath_overrides_runpath=no + else + sys_lib_search_path_spec='/usr/ccs/lib /usr/lib' + shlibpath_overrides_runpath=yes + case $host_os in + sco3.2v5*) + sys_lib_search_path_spec="$sys_lib_search_path_spec /lib" + ;; + esac + fi + sys_lib_dlsearch_path_spec='/usr/lib' + ;; + +uts4*) + version_type=linux + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + ;; + +*) + dynamic_linker=no + ;; +esac +echo "$as_me:$LINENO: result: $dynamic_linker" >&5 +echo "${ECHO_T}$dynamic_linker" >&6 +test "$dynamic_linker" = no && can_build_shared=no + +variables_saved_for_relink="PATH $shlibpath_var $runpath_var" +if test "$GCC" = yes; then + variables_saved_for_relink="$variables_saved_for_relink GCC_EXEC_PREFIX COMPILER_PATH LIBRARY_PATH" +fi + +echo "$as_me:$LINENO: checking how to hardcode library paths into programs" >&5 +echo $ECHO_N "checking how to hardcode library paths into programs... $ECHO_C" >&6 +hardcode_action_F77= +if test -n "$hardcode_libdir_flag_spec_F77" || \ + test -n "$runpath_var_F77" || \ + test "X$hardcode_automatic_F77" = "Xyes" ; then + + # We can hardcode non-existant directories. + if test "$hardcode_direct_F77" != no && + # If the only mechanism to avoid hardcoding is shlibpath_var, we + # have to relink, otherwise we might link with an installed library + # when we should be linking with a yet-to-be-installed one + ## test "$_LT_AC_TAGVAR(hardcode_shlibpath_var, F77)" != no && + test "$hardcode_minus_L_F77" != no; then + # Linking always hardcodes the temporary library directory. + hardcode_action_F77=relink + else + # We can link without hardcoding, and we can hardcode nonexisting dirs. + hardcode_action_F77=immediate + fi +else + # We cannot hardcode anything, or else we can only hardcode existing + # directories. + hardcode_action_F77=unsupported +fi +echo "$as_me:$LINENO: result: $hardcode_action_F77" >&5 +echo "${ECHO_T}$hardcode_action_F77" >&6 + +if test "$hardcode_action_F77" = relink; then + # Fast installation is not supported + enable_fast_install=no +elif test "$shlibpath_overrides_runpath" = yes || + test "$enable_shared" = no; then + # Fast installation is not necessary + enable_fast_install=needless +fi + + +# The else clause should only fire when bootstrapping the +# libtool distribution, otherwise you forgot to ship ltmain.sh +# with your package, and you will get complaints that there are +# no rules to generate ltmain.sh. +if test -f "$ltmain"; then + # See if we are running on zsh, and set the options which allow our commands through + # without removal of \ escapes. + if test -n "${ZSH_VERSION+set}" ; then + setopt NO_GLOB_SUBST + fi + # Now quote all the things that may contain metacharacters while being + # careful not to overquote the AC_SUBSTed values. We take copies of the + # variables and quote the copies for generation of the libtool script. + for var in echo old_CC old_CFLAGS AR AR_FLAGS EGREP RANLIB LN_S LTCC LTCFLAGS NM \ + SED SHELL STRIP \ + libname_spec library_names_spec soname_spec extract_expsyms_cmds \ + old_striplib striplib file_magic_cmd finish_cmds finish_eval \ + deplibs_check_method reload_flag reload_cmds need_locks \ + lt_cv_sys_global_symbol_pipe lt_cv_sys_global_symbol_to_cdecl \ + lt_cv_sys_global_symbol_to_c_name_address \ + sys_lib_search_path_spec sys_lib_dlsearch_path_spec \ + old_postinstall_cmds old_postuninstall_cmds \ + compiler_F77 \ + CC_F77 \ + LD_F77 \ + lt_prog_compiler_wl_F77 \ + lt_prog_compiler_pic_F77 \ + lt_prog_compiler_static_F77 \ + lt_prog_compiler_no_builtin_flag_F77 \ + export_dynamic_flag_spec_F77 \ + thread_safe_flag_spec_F77 \ + whole_archive_flag_spec_F77 \ + enable_shared_with_static_runtimes_F77 \ + old_archive_cmds_F77 \ + old_archive_from_new_cmds_F77 \ + predep_objects_F77 \ + postdep_objects_F77 \ + predeps_F77 \ + postdeps_F77 \ + compiler_lib_search_path_F77 \ + archive_cmds_F77 \ + archive_expsym_cmds_F77 \ + postinstall_cmds_F77 \ + postuninstall_cmds_F77 \ + old_archive_from_expsyms_cmds_F77 \ + allow_undefined_flag_F77 \ + no_undefined_flag_F77 \ + export_symbols_cmds_F77 \ + hardcode_libdir_flag_spec_F77 \ + hardcode_libdir_flag_spec_ld_F77 \ + hardcode_libdir_separator_F77 \ + hardcode_automatic_F77 \ + module_cmds_F77 \ + module_expsym_cmds_F77 \ + lt_cv_prog_compiler_c_o_F77 \ + exclude_expsyms_F77 \ + include_expsyms_F77; do + + case $var in + old_archive_cmds_F77 | \ + old_archive_from_new_cmds_F77 | \ + archive_cmds_F77 | \ + archive_expsym_cmds_F77 | \ + module_cmds_F77 | \ + module_expsym_cmds_F77 | \ + old_archive_from_expsyms_cmds_F77 | \ + export_symbols_cmds_F77 | \ + extract_expsyms_cmds | reload_cmds | finish_cmds | \ + postinstall_cmds | postuninstall_cmds | \ + old_postinstall_cmds | old_postuninstall_cmds | \ + sys_lib_search_path_spec | sys_lib_dlsearch_path_spec) + # Double-quote double-evaled strings. + eval "lt_$var=\\\"\`\$echo \"X\$$var\" | \$Xsed -e \"\$double_quote_subst\" -e \"\$sed_quote_subst\" -e \"\$delay_variable_subst\"\`\\\"" + ;; + *) + eval "lt_$var=\\\"\`\$echo \"X\$$var\" | \$Xsed -e \"\$sed_quote_subst\"\`\\\"" + ;; + esac + done + + case $lt_echo in + *'\$0 --fallback-echo"') + lt_echo=`$echo "X$lt_echo" | $Xsed -e 's/\\\\\\\$0 --fallback-echo"$/$0 --fallback-echo"/'` + ;; + esac + +cfgfile="$ofile" + + cat <<__EOF__ >> "$cfgfile" +# ### BEGIN LIBTOOL TAG CONFIG: $tagname + +# Libtool was configured on host `(hostname || uname -n) 2>/dev/null | sed 1q`: + +# Shell to use when invoking shell scripts. +SHELL=$lt_SHELL + +# Whether or not to build shared libraries. +build_libtool_libs=$enable_shared + +# Whether or not to build static libraries. +build_old_libs=$enable_static + +# Whether or not to add -lc for building shared libraries. +build_libtool_need_lc=$archive_cmds_need_lc_F77 + +# Whether or not to disallow shared libs when runtime libs are static +allow_libtool_libs_with_static_runtimes=$enable_shared_with_static_runtimes_F77 + +# Whether or not to optimize for fast installation. +fast_install=$enable_fast_install + +# The host system. +host_alias=$host_alias +host=$host +host_os=$host_os + +# The build system. +build_alias=$build_alias +build=$build +build_os=$build_os + +# An echo program that does not interpret backslashes. +echo=$lt_echo + +# The archiver. +AR=$lt_AR +AR_FLAGS=$lt_AR_FLAGS + +# A C compiler. +LTCC=$lt_LTCC + +# LTCC compiler flags. +LTCFLAGS=$lt_LTCFLAGS + +# A language-specific compiler. +CC=$lt_compiler_F77 + +# Is the compiler the GNU C compiler? +with_gcc=$GCC_F77 + +gcc_dir=\`gcc -print-file-name=. | $SED 's,/\.$,,'\` +gcc_ver=\`gcc -dumpversion\` + +# An ERE matcher. +EGREP=$lt_EGREP + +# The linker used to build libraries. +LD=$lt_LD_F77 + +# Whether we need hard or soft links. +LN_S=$lt_LN_S + +# A BSD-compatible nm program. +NM=$lt_NM + +# A symbol stripping program +STRIP=$lt_STRIP + +# Used to examine libraries when file_magic_cmd begins "file" +MAGIC_CMD=$MAGIC_CMD + +# Used on cygwin: DLL creation program. +DLLTOOL="$DLLTOOL" + +# Used on cygwin: object dumper. +OBJDUMP="$OBJDUMP" + +# Used on cygwin: assembler. +AS="$AS" + +# The name of the directory that contains temporary libtool files. +objdir=$objdir + +# How to create reloadable object files. +reload_flag=$lt_reload_flag +reload_cmds=$lt_reload_cmds + +# How to pass a linker flag through the compiler. +wl=$lt_lt_prog_compiler_wl_F77 + +# Object file suffix (normally "o"). +objext="$ac_objext" + +# Old archive suffix (normally "a"). +libext="$libext" + +# Shared library suffix (normally ".so"). +shrext_cmds='$shrext_cmds' + +# Executable file suffix (normally ""). +exeext="$exeext" + +# Additional compiler flags for building library objects. +pic_flag=$lt_lt_prog_compiler_pic_F77 +pic_mode=$pic_mode + +# What is the maximum length of a command? +max_cmd_len=$lt_cv_sys_max_cmd_len + +# Does compiler simultaneously support -c and -o options? +compiler_c_o=$lt_lt_cv_prog_compiler_c_o_F77 + +# Must we lock files when doing compilation? +need_locks=$lt_need_locks + +# Do we need the lib prefix for modules? +need_lib_prefix=$need_lib_prefix + +# Do we need a version for libraries? +need_version=$need_version + +# Whether dlopen is supported. +dlopen_support=$enable_dlopen + +# Whether dlopen of programs is supported. +dlopen_self=$enable_dlopen_self + +# Whether dlopen of statically linked programs is supported. +dlopen_self_static=$enable_dlopen_self_static + +# Compiler flag to prevent dynamic linking. +link_static_flag=$lt_lt_prog_compiler_static_F77 + +# Compiler flag to turn off builtin functions. +no_builtin_flag=$lt_lt_prog_compiler_no_builtin_flag_F77 + +# Compiler flag to allow reflexive dlopens. +export_dynamic_flag_spec=$lt_export_dynamic_flag_spec_F77 + +# Compiler flag to generate shared objects directly from archives. +whole_archive_flag_spec=$lt_whole_archive_flag_spec_F77 + +# Compiler flag to generate thread-safe objects. +thread_safe_flag_spec=$lt_thread_safe_flag_spec_F77 + +# Library versioning type. +version_type=$version_type + +# Format of library name prefix. +libname_spec=$lt_libname_spec + +# List of archive names. First name is the real one, the rest are links. +# The last name is the one that the linker finds with -lNAME. +library_names_spec=$lt_library_names_spec + +# The coded name of the library, if different from the real name. +soname_spec=$lt_soname_spec + +# Commands used to build and install an old-style archive. +RANLIB=$lt_RANLIB +old_archive_cmds=$lt_old_archive_cmds_F77 +old_postinstall_cmds=$lt_old_postinstall_cmds +old_postuninstall_cmds=$lt_old_postuninstall_cmds + +# Create an old-style archive from a shared archive. +old_archive_from_new_cmds=$lt_old_archive_from_new_cmds_F77 + +# Create a temporary old-style archive to link instead of a shared archive. +old_archive_from_expsyms_cmds=$lt_old_archive_from_expsyms_cmds_F77 + +# Commands used to build and install a shared archive. +archive_cmds=$lt_archive_cmds_F77 +archive_expsym_cmds=$lt_archive_expsym_cmds_F77 +postinstall_cmds=$lt_postinstall_cmds +postuninstall_cmds=$lt_postuninstall_cmds + +# Commands used to build a loadable module (assumed same as above if empty) +module_cmds=$lt_module_cmds_F77 +module_expsym_cmds=$lt_module_expsym_cmds_F77 + +# Commands to strip libraries. +old_striplib=$lt_old_striplib +striplib=$lt_striplib + +# Dependencies to place before the objects being linked to create a +# shared library. +predep_objects=\`echo $lt_predep_objects_F77 | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\` + +# Dependencies to place after the objects being linked to create a +# shared library. +postdep_objects=\`echo $lt_postdep_objects_F77 | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\` + +# Dependencies to place before the objects being linked to create a +# shared library. +predeps=$lt_predeps_F77 + +# Dependencies to place after the objects being linked to create a +# shared library. +postdeps=$lt_postdeps_F77 + +# The library search path used internally by the compiler when linking +# a shared library. +compiler_lib_search_path=\`echo $lt_compiler_lib_search_path_F77 | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\` + +# Method to check whether dependent libraries are shared objects. +deplibs_check_method=$lt_deplibs_check_method + +# Command to use when deplibs_check_method == file_magic. +file_magic_cmd=$lt_file_magic_cmd + +# Flag that allows shared libraries with undefined symbols to be built. +allow_undefined_flag=$lt_allow_undefined_flag_F77 + +# Flag that forces no undefined symbols. +no_undefined_flag=$lt_no_undefined_flag_F77 + +# Commands used to finish a libtool library installation in a directory. +finish_cmds=$lt_finish_cmds + +# Same as above, but a single script fragment to be evaled but not shown. +finish_eval=$lt_finish_eval + +# Take the output of nm and produce a listing of raw symbols and C names. +global_symbol_pipe=$lt_lt_cv_sys_global_symbol_pipe + +# Transform the output of nm in a proper C declaration +global_symbol_to_cdecl=$lt_lt_cv_sys_global_symbol_to_cdecl + +# Transform the output of nm in a C name address pair +global_symbol_to_c_name_address=$lt_lt_cv_sys_global_symbol_to_c_name_address + +# This is the shared library runtime path variable. +runpath_var=$runpath_var + +# This is the shared library path variable. +shlibpath_var=$shlibpath_var + +# Is shlibpath searched before the hard-coded library search path? +shlibpath_overrides_runpath=$shlibpath_overrides_runpath + +# How to hardcode a shared library path into an executable. +hardcode_action=$hardcode_action_F77 + +# Whether we should hardcode library paths into libraries. +hardcode_into_libs=$hardcode_into_libs + +# Flag to hardcode \$libdir into a binary during linking. +# This must work even if \$libdir does not exist. +hardcode_libdir_flag_spec=$lt_hardcode_libdir_flag_spec_F77 + +# If ld is used when linking, flag to hardcode \$libdir into +# a binary during linking. This must work even if \$libdir does +# not exist. +hardcode_libdir_flag_spec_ld=$lt_hardcode_libdir_flag_spec_ld_F77 + +# Whether we need a single -rpath flag with a separated argument. +hardcode_libdir_separator=$lt_hardcode_libdir_separator_F77 + +# Set to yes if using DIR/libNAME${shared_ext} during linking hardcodes DIR into the +# resulting binary. +hardcode_direct=$hardcode_direct_F77 + +# Set to yes if using the -LDIR flag during linking hardcodes DIR into the +# resulting binary. +hardcode_minus_L=$hardcode_minus_L_F77 + +# Set to yes if using SHLIBPATH_VAR=DIR during linking hardcodes DIR into +# the resulting binary. +hardcode_shlibpath_var=$hardcode_shlibpath_var_F77 + +# Set to yes if building a shared library automatically hardcodes DIR into the library +# and all subsequent libraries and executables linked against it. +hardcode_automatic=$hardcode_automatic_F77 + +# Variables whose values should be saved in libtool wrapper scripts and +# restored at relink time. +variables_saved_for_relink="$variables_saved_for_relink" + +# Whether libtool must link a program against all its dependency libraries. +link_all_deplibs=$link_all_deplibs_F77 + +# Compile-time system search path for libraries +sys_lib_search_path_spec=\`echo $lt_sys_lib_search_path_spec | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\` + +# Run-time system search path for libraries +sys_lib_dlsearch_path_spec=$lt_sys_lib_dlsearch_path_spec + +# Fix the shell variable \$srcfile for the compiler. +fix_srcfile_path="$fix_srcfile_path_F77" + +# Set to yes if exported symbols are required. +always_export_symbols=$always_export_symbols_F77 + +# The commands to list exported symbols. +export_symbols_cmds=$lt_export_symbols_cmds_F77 + +# The commands to extract the exported symbol list from a shared archive. +extract_expsyms_cmds=$lt_extract_expsyms_cmds + +# Symbols that should not be listed in the preloaded symbols. +exclude_expsyms=$lt_exclude_expsyms_F77 + +# Symbols that must always be exported. +include_expsyms=$lt_include_expsyms_F77 + +# ### END LIBTOOL TAG CONFIG: $tagname + +__EOF__ + + +else + # If there is no Makefile yet, we rely on a make rule to execute + # `config.status --recheck' to rerun these tests and create the + # libtool script then. + ltmain_in=`echo $ltmain | sed -e 's/\.sh$/.in/'` + if test -f "$ltmain_in"; then + test -f Makefile && make "$ltmain" + fi +fi + + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + +CC="$lt_save_CC" + + else + tagname="" + fi + ;; + + GCJ) + if test -n "$GCJ" && test "X$GCJ" != "Xno"; then + + + +# Source file extension for Java test sources. +ac_ext=java + +# Object file extension for compiled Java test sources. +objext=o +objext_GCJ=$objext + +# Code to be used in simple compile tests +lt_simple_compile_test_code="class foo {}\n" + +# Code to be used in simple link tests +lt_simple_link_test_code='public class conftest { public static void main(String[] argv) {}; }\n' + +# ltmain only uses $CC for tagged configurations so make sure $CC is set. + +# If no C compiler was specified, use CC. +LTCC=${LTCC-"$CC"} + +# If no C compiler flags were specified, use CFLAGS. +LTCFLAGS=${LTCFLAGS-"$CFLAGS"} + +# Allow CC to be a program name with arguments. +compiler=$CC + + +# save warnings/boilerplate of simple test code +ac_outfile=conftest.$ac_objext +printf "$lt_simple_compile_test_code" >conftest.$ac_ext +eval "$ac_compile" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err +_lt_compiler_boilerplate=`cat conftest.err` +$rm conftest* + +ac_outfile=conftest.$ac_objext +printf "$lt_simple_link_test_code" >conftest.$ac_ext +eval "$ac_link" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err +_lt_linker_boilerplate=`cat conftest.err` +$rm conftest* + + +# Allow CC to be a program name with arguments. +lt_save_CC="$CC" +CC=${GCJ-"gcj"} +compiler=$CC +compiler_GCJ=$CC +for cc_temp in $compiler""; do + case $cc_temp in + compile | *[\\/]compile | ccache | *[\\/]ccache ) ;; + distcc | *[\\/]distcc | purify | *[\\/]purify ) ;; + \-*) ;; + *) break;; + esac +done +cc_basename=`$echo "X$cc_temp" | $Xsed -e 's%.*/%%' -e "s%^$host_alias-%%"` + + +# GCJ did not exist at the time GCC didn't implicitly link libc in. +archive_cmds_need_lc_GCJ=no + +old_archive_cmds_GCJ=$old_archive_cmds + + +lt_prog_compiler_no_builtin_flag_GCJ= + +if test "$GCC" = yes; then + lt_prog_compiler_no_builtin_flag_GCJ=' -fno-builtin' + + +echo "$as_me:$LINENO: checking if $compiler supports -fno-rtti -fno-exceptions" >&5 +echo $ECHO_N "checking if $compiler supports -fno-rtti -fno-exceptions... $ECHO_C" >&6 +if test "${lt_cv_prog_compiler_rtti_exceptions+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_prog_compiler_rtti_exceptions=no + ac_outfile=conftest.$ac_objext + printf "$lt_simple_compile_test_code" > conftest.$ac_ext + lt_compiler_flag="-fno-rtti -fno-exceptions" + # Insert the option either (1) after the last *FLAGS variable, or + # (2) before a word containing "conftest.", or (3) at the end. + # Note that $ac_compile itself does not contain backslashes and begins + # with a dollar sign (not a hyphen), so the echo should work correctly. + # The option is referenced via a variable to avoid confusing sed. + lt_compile=`echo "$ac_compile" | $SED \ + -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \ + -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \ + -e 's:$: $lt_compiler_flag:'` + (eval echo "\"\$as_me:15605: $lt_compile\"" >&5) + (eval "$lt_compile" 2>conftest.err) + ac_status=$? + cat conftest.err >&5 + echo "$as_me:15609: \$? = $ac_status" >&5 + if (exit $ac_status) && test -s "$ac_outfile"; then + # The compiler can only warn and ignore the option if not recognized + # So say no if there are warnings other than the usual output. + $echo "X$_lt_compiler_boilerplate" | $Xsed -e '/^$/d' >conftest.exp + $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2 + if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then + lt_cv_prog_compiler_rtti_exceptions=yes + fi + fi + $rm conftest* + +fi +echo "$as_me:$LINENO: result: $lt_cv_prog_compiler_rtti_exceptions" >&5 +echo "${ECHO_T}$lt_cv_prog_compiler_rtti_exceptions" >&6 + +if test x"$lt_cv_prog_compiler_rtti_exceptions" = xyes; then + lt_prog_compiler_no_builtin_flag_GCJ="$lt_prog_compiler_no_builtin_flag_GCJ -fno-rtti -fno-exceptions" +else + : +fi + +fi + +lt_prog_compiler_wl_GCJ= +lt_prog_compiler_pic_GCJ= +lt_prog_compiler_static_GCJ= + +echo "$as_me:$LINENO: checking for $compiler option to produce PIC" >&5 +echo $ECHO_N "checking for $compiler option to produce PIC... $ECHO_C" >&6 + + if test "$GCC" = yes; then + lt_prog_compiler_wl_GCJ='-Wl,' + lt_prog_compiler_static_GCJ='-static' + + case $host_os in + aix*) + # All AIX code is PIC. + if test "$host_cpu" = ia64; then + # AIX 5 now supports IA64 processor + lt_prog_compiler_static_GCJ='-Bstatic' + fi + ;; + + amigaos*) + # FIXME: we need at least 68020 code to build shared libraries, but + # adding the `-m68020' flag to GCC prevents building anything better, + # like `-m68040'. + lt_prog_compiler_pic_GCJ='-m68020 -resident32 -malways-restore-a4' + ;; + + beos* | cygwin* | irix5* | irix6* | nonstopux* | osf3* | osf4* | osf5*) + # PIC is the default for these OSes. + ;; + + mingw* | pw32* | os2*) + # This hack is so that the source file can tell whether it is being + # built for inclusion in a dll (and should export symbols for example). + lt_prog_compiler_pic_GCJ='-DDLL_EXPORT' + ;; + + darwin* | rhapsody*) + # PIC is the default on this platform + # Common symbols not allowed in MH_DYLIB files + lt_prog_compiler_pic_GCJ='-fno-common' + ;; + + interix3*) + # Interix 3.x gcc -fpic/-fPIC options generate broken code. + # Instead, we relocate shared libraries at runtime. + ;; + + msdosdjgpp*) + # Just because we use GCC doesn't mean we suddenly get shared libraries + # on systems that don't support them. + lt_prog_compiler_can_build_shared_GCJ=no + enable_shared=no + ;; + + sysv4*MP*) + if test -d /usr/nec; then + lt_prog_compiler_pic_GCJ=-Kconform_pic + fi + ;; + + hpux*) + # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but + # not for PA HP-UX. + case $host_cpu in + hppa*64*|ia64*) + # +Z the default + ;; + *) + lt_prog_compiler_pic_GCJ='-fPIC' + ;; + esac + ;; + + *) + lt_prog_compiler_pic_GCJ='-fPIC' + ;; + esac + else + # PORTME Check for flag to pass linker flags through the system compiler. + case $host_os in + aix*) + lt_prog_compiler_wl_GCJ='-Wl,' + if test "$host_cpu" = ia64; then + # AIX 5 now supports IA64 processor + lt_prog_compiler_static_GCJ='-Bstatic' + else + lt_prog_compiler_static_GCJ='-bnso -bI:/lib/syscalls.exp' + fi + ;; + darwin*) + # PIC is the default on this platform + # Common symbols not allowed in MH_DYLIB files + case $cc_basename in + xlc*) + lt_prog_compiler_pic_GCJ='-qnocommon' + lt_prog_compiler_wl_GCJ='-Wl,' + ;; + esac + ;; + + mingw* | pw32* | os2*) + # This hack is so that the source file can tell whether it is being + # built for inclusion in a dll (and should export symbols for example). + lt_prog_compiler_pic_GCJ='-DDLL_EXPORT' + ;; + + hpux9* | hpux10* | hpux11*) + lt_prog_compiler_wl_GCJ='-Wl,' + # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but + # not for PA HP-UX. + case $host_cpu in + hppa*64*|ia64*) + # +Z the default + ;; + *) + lt_prog_compiler_pic_GCJ='+Z' + ;; + esac + # Is there a better lt_prog_compiler_static that works with the bundled CC? + lt_prog_compiler_static_GCJ='${wl}-a ${wl}archive' + ;; + + irix5* | irix6* | nonstopux*) + lt_prog_compiler_wl_GCJ='-Wl,' + # PIC (with -KPIC) is the default. + lt_prog_compiler_static_GCJ='-non_shared' + ;; + + newsos6) + lt_prog_compiler_pic_GCJ='-KPIC' + lt_prog_compiler_static_GCJ='-Bstatic' + ;; + + linux*) + case $cc_basename in + icc* | ecc*) + lt_prog_compiler_wl_GCJ='-Wl,' + lt_prog_compiler_pic_GCJ='-KPIC' + lt_prog_compiler_static_GCJ='-static' + ;; + pgcc* | pgf77* | pgf90* | pgf95*) + # Portland Group compilers (*not* the Pentium gcc compiler, + # which looks to be a dead project) + lt_prog_compiler_wl_GCJ='-Wl,' + lt_prog_compiler_pic_GCJ='-fpic' + lt_prog_compiler_static_GCJ='-Bstatic' + ;; + ccc*) + lt_prog_compiler_wl_GCJ='-Wl,' + # All Alpha code is PIC. + lt_prog_compiler_static_GCJ='-non_shared' + ;; + esac + ;; + + osf3* | osf4* | osf5*) + lt_prog_compiler_wl_GCJ='-Wl,' + # All OSF/1 code is PIC. + lt_prog_compiler_static_GCJ='-non_shared' + ;; + + solaris*) + lt_prog_compiler_pic_GCJ='-KPIC' + lt_prog_compiler_static_GCJ='-Bstatic' + case $cc_basename in + f77* | f90* | f95*) + lt_prog_compiler_wl_GCJ='-Qoption ld ';; + *) + lt_prog_compiler_wl_GCJ='-Wl,';; + esac + ;; + + sunos4*) + lt_prog_compiler_wl_GCJ='-Qoption ld ' + lt_prog_compiler_pic_GCJ='-PIC' + lt_prog_compiler_static_GCJ='-Bstatic' + ;; + + sysv4 | sysv4.2uw2* | sysv4.3*) + lt_prog_compiler_wl_GCJ='-Wl,' + lt_prog_compiler_pic_GCJ='-KPIC' + lt_prog_compiler_static_GCJ='-Bstatic' + ;; + + sysv4*MP*) + if test -d /usr/nec ;then + lt_prog_compiler_pic_GCJ='-Kconform_pic' + lt_prog_compiler_static_GCJ='-Bstatic' + fi + ;; + + sysv5* | unixware* | sco3.2v5* | sco5v6* | OpenUNIX*) + lt_prog_compiler_wl_GCJ='-Wl,' + lt_prog_compiler_pic_GCJ='-KPIC' + lt_prog_compiler_static_GCJ='-Bstatic' + ;; + + unicos*) + lt_prog_compiler_wl_GCJ='-Wl,' + lt_prog_compiler_can_build_shared_GCJ=no + ;; + + uts4*) + lt_prog_compiler_pic_GCJ='-pic' + lt_prog_compiler_static_GCJ='-Bstatic' + ;; + + *) + lt_prog_compiler_can_build_shared_GCJ=no + ;; + esac + fi + +echo "$as_me:$LINENO: result: $lt_prog_compiler_pic_GCJ" >&5 +echo "${ECHO_T}$lt_prog_compiler_pic_GCJ" >&6 + +# +# Check to make sure the PIC flag actually works. +# +if test -n "$lt_prog_compiler_pic_GCJ"; then + +echo "$as_me:$LINENO: checking if $compiler PIC flag $lt_prog_compiler_pic_GCJ works" >&5 +echo $ECHO_N "checking if $compiler PIC flag $lt_prog_compiler_pic_GCJ works... $ECHO_C" >&6 +if test "${lt_prog_compiler_pic_works_GCJ+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_prog_compiler_pic_works_GCJ=no + ac_outfile=conftest.$ac_objext + printf "$lt_simple_compile_test_code" > conftest.$ac_ext + lt_compiler_flag="$lt_prog_compiler_pic_GCJ" + # Insert the option either (1) after the last *FLAGS variable, or + # (2) before a word containing "conftest.", or (3) at the end. + # Note that $ac_compile itself does not contain backslashes and begins + # with a dollar sign (not a hyphen), so the echo should work correctly. + # The option is referenced via a variable to avoid confusing sed. + lt_compile=`echo "$ac_compile" | $SED \ + -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \ + -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \ + -e 's:$: $lt_compiler_flag:'` + (eval echo "\"\$as_me:15873: $lt_compile\"" >&5) + (eval "$lt_compile" 2>conftest.err) + ac_status=$? + cat conftest.err >&5 + echo "$as_me:15877: \$? = $ac_status" >&5 + if (exit $ac_status) && test -s "$ac_outfile"; then + # The compiler can only warn and ignore the option if not recognized + # So say no if there are warnings other than the usual output. + $echo "X$_lt_compiler_boilerplate" | $Xsed -e '/^$/d' >conftest.exp + $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2 + if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then + lt_prog_compiler_pic_works_GCJ=yes + fi + fi + $rm conftest* + +fi +echo "$as_me:$LINENO: result: $lt_prog_compiler_pic_works_GCJ" >&5 +echo "${ECHO_T}$lt_prog_compiler_pic_works_GCJ" >&6 + +if test x"$lt_prog_compiler_pic_works_GCJ" = xyes; then + case $lt_prog_compiler_pic_GCJ in + "" | " "*) ;; + *) lt_prog_compiler_pic_GCJ=" $lt_prog_compiler_pic_GCJ" ;; + esac +else + lt_prog_compiler_pic_GCJ= + lt_prog_compiler_can_build_shared_GCJ=no +fi + +fi +case $host_os in + # For platforms which do not support PIC, -DPIC is meaningless: + *djgpp*) + lt_prog_compiler_pic_GCJ= + ;; + *) + lt_prog_compiler_pic_GCJ="$lt_prog_compiler_pic_GCJ" + ;; +esac + +# +# Check to make sure the static flag actually works. +# +wl=$lt_prog_compiler_wl_GCJ eval lt_tmp_static_flag=\"$lt_prog_compiler_static_GCJ\" +echo "$as_me:$LINENO: checking if $compiler static flag $lt_tmp_static_flag works" >&5 +echo $ECHO_N "checking if $compiler static flag $lt_tmp_static_flag works... $ECHO_C" >&6 +if test "${lt_prog_compiler_static_works_GCJ+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_prog_compiler_static_works_GCJ=no + save_LDFLAGS="$LDFLAGS" + LDFLAGS="$LDFLAGS $lt_tmp_static_flag" + printf "$lt_simple_link_test_code" > conftest.$ac_ext + if (eval $ac_link 2>conftest.err) && test -s conftest$ac_exeext; then + # The linker can only warn and ignore the option if not recognized + # So say no if there are warnings + if test -s conftest.err; then + # Append any errors to the config.log. + cat conftest.err 1>&5 + $echo "X$_lt_linker_boilerplate" | $Xsed -e '/^$/d' > conftest.exp + $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2 + if diff conftest.exp conftest.er2 >/dev/null; then + lt_prog_compiler_static_works_GCJ=yes + fi + else + lt_prog_compiler_static_works_GCJ=yes + fi + fi + $rm conftest* + LDFLAGS="$save_LDFLAGS" + +fi +echo "$as_me:$LINENO: result: $lt_prog_compiler_static_works_GCJ" >&5 +echo "${ECHO_T}$lt_prog_compiler_static_works_GCJ" >&6 + +if test x"$lt_prog_compiler_static_works_GCJ" = xyes; then + : +else + lt_prog_compiler_static_GCJ= +fi + + +echo "$as_me:$LINENO: checking if $compiler supports -c -o file.$ac_objext" >&5 +echo $ECHO_N "checking if $compiler supports -c -o file.$ac_objext... $ECHO_C" >&6 +if test "${lt_cv_prog_compiler_c_o_GCJ+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_prog_compiler_c_o_GCJ=no + $rm -r conftest 2>/dev/null + mkdir conftest + cd conftest + mkdir out + printf "$lt_simple_compile_test_code" > conftest.$ac_ext + + lt_compiler_flag="-o out/conftest2.$ac_objext" + # Insert the option either (1) after the last *FLAGS variable, or + # (2) before a word containing "conftest.", or (3) at the end. + # Note that $ac_compile itself does not contain backslashes and begins + # with a dollar sign (not a hyphen), so the echo should work correctly. + lt_compile=`echo "$ac_compile" | $SED \ + -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \ + -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \ + -e 's:$: $lt_compiler_flag:'` + (eval echo "\"\$as_me:15977: $lt_compile\"" >&5) + (eval "$lt_compile" 2>out/conftest.err) + ac_status=$? + cat out/conftest.err >&5 + echo "$as_me:15981: \$? = $ac_status" >&5 + if (exit $ac_status) && test -s out/conftest2.$ac_objext + then + # The compiler can only warn and ignore the option if not recognized + # So say no if there are warnings + $echo "X$_lt_compiler_boilerplate" | $Xsed -e '/^$/d' > out/conftest.exp + $SED '/^$/d; /^ *+/d' out/conftest.err >out/conftest.er2 + if test ! -s out/conftest.er2 || diff out/conftest.exp out/conftest.er2 >/dev/null; then + lt_cv_prog_compiler_c_o_GCJ=yes + fi + fi + chmod u+w . 2>&5 + $rm conftest* + # SGI C++ compiler will create directory out/ii_files/ for + # template instantiation + test -d out/ii_files && $rm out/ii_files/* && rmdir out/ii_files + $rm out/* && rmdir out + cd .. + rmdir conftest + $rm conftest* + +fi +echo "$as_me:$LINENO: result: $lt_cv_prog_compiler_c_o_GCJ" >&5 +echo "${ECHO_T}$lt_cv_prog_compiler_c_o_GCJ" >&6 + + +hard_links="nottested" +if test "$lt_cv_prog_compiler_c_o_GCJ" = no && test "$need_locks" != no; then + # do not overwrite the value of need_locks provided by the user + echo "$as_me:$LINENO: checking if we can lock with hard links" >&5 +echo $ECHO_N "checking if we can lock with hard links... $ECHO_C" >&6 + hard_links=yes + $rm conftest* + ln conftest.a conftest.b 2>/dev/null && hard_links=no + touch conftest.a + ln conftest.a conftest.b 2>&5 || hard_links=no + ln conftest.a conftest.b 2>/dev/null && hard_links=no + echo "$as_me:$LINENO: result: $hard_links" >&5 +echo "${ECHO_T}$hard_links" >&6 + if test "$hard_links" = no; then + { echo "$as_me:$LINENO: WARNING: \`$CC' does not support \`-c -o', so \`make -j' may be unsafe" >&5 +echo "$as_me: WARNING: \`$CC' does not support \`-c -o', so \`make -j' may be unsafe" >&2;} + need_locks=warn + fi +else + need_locks=no +fi + +echo "$as_me:$LINENO: checking whether the $compiler linker ($LD) supports shared libraries" >&5 +echo $ECHO_N "checking whether the $compiler linker ($LD) supports shared libraries... $ECHO_C" >&6 + + runpath_var= + allow_undefined_flag_GCJ= + enable_shared_with_static_runtimes_GCJ=no + archive_cmds_GCJ= + archive_expsym_cmds_GCJ= + old_archive_From_new_cmds_GCJ= + old_archive_from_expsyms_cmds_GCJ= + export_dynamic_flag_spec_GCJ= + whole_archive_flag_spec_GCJ= + thread_safe_flag_spec_GCJ= + hardcode_libdir_flag_spec_GCJ= + hardcode_libdir_flag_spec_ld_GCJ= + hardcode_libdir_separator_GCJ= + hardcode_direct_GCJ=no + hardcode_minus_L_GCJ=no + hardcode_shlibpath_var_GCJ=unsupported + link_all_deplibs_GCJ=unknown + hardcode_automatic_GCJ=no + module_cmds_GCJ= + module_expsym_cmds_GCJ= + always_export_symbols_GCJ=no + export_symbols_cmds_GCJ='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols' + # include_expsyms should be a list of space-separated symbols to be *always* + # included in the symbol list + include_expsyms_GCJ= + # exclude_expsyms can be an extended regexp of symbols to exclude + # it will be wrapped by ` (' and `)$', so one must not match beginning or + # end of line. Example: `a|bc|.*d.*' will exclude the symbols `a' and `bc', + # as well as any symbol that contains `d'. + exclude_expsyms_GCJ="_GLOBAL_OFFSET_TABLE_" + # Although _GLOBAL_OFFSET_TABLE_ is a valid symbol C name, most a.out + # platforms (ab)use it in PIC code, but their linkers get confused if + # the symbol is explicitly referenced. Since portable code cannot + # rely on this symbol name, it's probably fine to never include it in + # preloaded symbol tables. + extract_expsyms_cmds= + # Just being paranoid about ensuring that cc_basename is set. + for cc_temp in $compiler""; do + case $cc_temp in + compile | *[\\/]compile | ccache | *[\\/]ccache ) ;; + distcc | *[\\/]distcc | purify | *[\\/]purify ) ;; + \-*) ;; + *) break;; + esac +done +cc_basename=`$echo "X$cc_temp" | $Xsed -e 's%.*/%%' -e "s%^$host_alias-%%"` + + case $host_os in + cygwin* | mingw* | pw32*) + # FIXME: the MSVC++ port hasn't been tested in a loooong time + # When not using gcc, we currently assume that we are using + # Microsoft Visual C++. + if test "$GCC" != yes; then + with_gnu_ld=no + fi + ;; + interix*) + # we just hope/assume this is gcc and not c89 (= MSVC++) + with_gnu_ld=yes + ;; + openbsd*) + with_gnu_ld=no + ;; + esac + + ld_shlibs_GCJ=yes + if test "$with_gnu_ld" = yes; then + # If archive_cmds runs LD, not CC, wlarc should be empty + wlarc='${wl}' + + # Set some defaults for GNU ld with shared library support. These + # are reset later if shared libraries are not supported. Putting them + # here allows them to be overridden if necessary. + runpath_var=LD_RUN_PATH + hardcode_libdir_flag_spec_GCJ='${wl}--rpath ${wl}$libdir' + export_dynamic_flag_spec_GCJ='${wl}--export-dynamic' + # ancient GNU ld didn't support --whole-archive et. al. + if $LD --help 2>&1 | grep 'no-whole-archive' > /dev/null; then + whole_archive_flag_spec_GCJ="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive' + else + whole_archive_flag_spec_GCJ= + fi + supports_anon_versioning=no + case `$LD -v 2>/dev/null` in + *\ [01].* | *\ 2.[0-9].* | *\ 2.10.*) ;; # catch versions < 2.11 + *\ 2.11.93.0.2\ *) supports_anon_versioning=yes ;; # RH7.3 ... + *\ 2.11.92.0.12\ *) supports_anon_versioning=yes ;; # Mandrake 8.2 ... + *\ 2.11.*) ;; # other 2.11 versions + *) supports_anon_versioning=yes ;; + esac + + # See if GNU ld supports shared libraries. + case $host_os in + aix3* | aix4* | aix5*) + # On AIX/PPC, the GNU linker is very broken + if test "$host_cpu" != ia64; then + ld_shlibs_GCJ=no + cat <<EOF 1>&2 + +*** Warning: the GNU linker, at least up to release 2.9.1, is reported +*** to be unable to reliably create shared libraries on AIX. +*** Therefore, libtool is disabling shared libraries support. If you +*** really care for shared libraries, you may want to modify your PATH +*** so that a non-GNU linker is found, and then restart. + +EOF + fi + ;; + + amigaos*) + archive_cmds_GCJ='$rm $output_objdir/a2ixlibrary.data~$echo "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$echo "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$echo "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$echo "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)' + hardcode_libdir_flag_spec_GCJ='-L$libdir' + hardcode_minus_L_GCJ=yes + + # Samuel A. Falvo II <kc5tja@dolphin.openprojects.net> reports + # that the semantics of dynamic libraries on AmigaOS, at least up + # to version 4, is to share data among multiple programs linked + # with the same dynamic library. Since this doesn't match the + # behavior of shared libraries on other platforms, we can't use + # them. + ld_shlibs_GCJ=no + ;; + + beos*) + if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then + allow_undefined_flag_GCJ=unsupported + # Joseph Beckenbach <jrb3@best.com> says some releases of gcc + # support --undefined. This deserves some investigation. FIXME + archive_cmds_GCJ='$CC -nostart $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + else + ld_shlibs_GCJ=no + fi + ;; + + cygwin* | mingw* | pw32*) + # _LT_AC_TAGVAR(hardcode_libdir_flag_spec, GCJ) is actually meaningless, + # as there is no search path for DLLs. + hardcode_libdir_flag_spec_GCJ='-L$libdir' + allow_undefined_flag_GCJ=unsupported + always_export_symbols_GCJ=no + enable_shared_with_static_runtimes_GCJ=yes + export_symbols_cmds_GCJ='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[BCDGRS] /s/.* \([^ ]*\)/\1 DATA/'\'' | $SED -e '\''/^[AITW] /s/.* //'\'' | sort | uniq > $export_symbols' + + if $LD --help 2>&1 | grep 'auto-import' > /dev/null; then + archive_cmds_GCJ='$CC -shared $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib' + # If the export-symbols file already is a .def file (1st line + # is EXPORTS), use it as is; otherwise, prepend... + archive_expsym_cmds_GCJ='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then + cp $export_symbols $output_objdir/$soname.def; + else + echo EXPORTS > $output_objdir/$soname.def; + cat $export_symbols >> $output_objdir/$soname.def; + fi~ + $CC -shared $output_objdir/$soname.def $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib' + else + ld_shlibs_GCJ=no + fi + ;; + + interix3*) + hardcode_direct_GCJ=no + hardcode_shlibpath_var_GCJ=no + hardcode_libdir_flag_spec_GCJ='${wl}-rpath,$libdir' + export_dynamic_flag_spec_GCJ='${wl}-E' + # Hack: On Interix 3.x, we cannot compile PIC because of a broken gcc. + # Instead, shared libraries are loaded at an image base (0x10000000 by + # default) and relocated if they conflict, which is a slow very memory + # consuming and fragmenting process. To avoid this, we pick a random, + # 256 KiB-aligned image base between 0x50000000 and 0x6FFC0000 at link + # time. Moving up from 0x10000000 also allows more sbrk(2) space. + archive_cmds_GCJ='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib' + archive_expsym_cmds_GCJ='sed "s,^,_," $export_symbols >$output_objdir/$soname.expsym~$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--retain-symbols-file,$output_objdir/$soname.expsym ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib' + ;; + + linux*) + if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then + tmp_addflag= + case $cc_basename,$host_cpu in + pgcc*) # Portland Group C compiler + whole_archive_flag_spec_GCJ='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}--no-whole-archive' + tmp_addflag=' $pic_flag' + ;; + pgf77* | pgf90* | pgf95*) # Portland Group f77 and f90 compilers + whole_archive_flag_spec_GCJ='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}--no-whole-archive' + tmp_addflag=' $pic_flag -Mnomain' ;; + ecc*,ia64* | icc*,ia64*) # Intel C compiler on ia64 + tmp_addflag=' -i_dynamic' ;; + efc*,ia64* | ifort*,ia64*) # Intel Fortran compiler on ia64 + tmp_addflag=' -i_dynamic -nofor_main' ;; + ifc* | ifort*) # Intel Fortran compiler + tmp_addflag=' -nofor_main' ;; + esac + archive_cmds_GCJ='$CC -shared'"$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + + if test $supports_anon_versioning = yes; then + archive_expsym_cmds_GCJ='$echo "{ global:" > $output_objdir/$libname.ver~ + cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~ + $echo "local: *; };" >> $output_objdir/$libname.ver~ + $CC -shared'"$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-version-script ${wl}$output_objdir/$libname.ver -o $lib' + fi + else + ld_shlibs_GCJ=no + fi + ;; + + netbsd*) + if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then + archive_cmds_GCJ='$LD -Bshareable $libobjs $deplibs $linker_flags -o $lib' + wlarc= + else + archive_cmds_GCJ='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + archive_expsym_cmds_GCJ='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + fi + ;; + + solaris*) + if $LD -v 2>&1 | grep 'BFD 2\.8' > /dev/null; then + ld_shlibs_GCJ=no + cat <<EOF 1>&2 + +*** Warning: The releases 2.8.* of the GNU linker cannot reliably +*** create shared libraries on Solaris systems. Therefore, libtool +*** is disabling shared libraries support. We urge you to upgrade GNU +*** binutils to release 2.9.1 or newer. Another option is to modify +*** your PATH or compiler configuration so that the native linker is +*** used, and then restart. + +EOF + elif $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then + archive_cmds_GCJ='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + archive_expsym_cmds_GCJ='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + else + ld_shlibs_GCJ=no + fi + ;; + + sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX*) + case `$LD -v 2>&1` in + *\ [01].* | *\ 2.[0-9].* | *\ 2.1[0-5].*) + ld_shlibs_GCJ=no + cat <<_LT_EOF 1>&2 + +*** Warning: Releases of the GNU linker prior to 2.16.91.0.3 can not +*** reliably create shared libraries on SCO systems. Therefore, libtool +*** is disabling shared libraries support. We urge you to upgrade GNU +*** binutils to release 2.16.91.0.3 or newer. Another option is to modify +*** your PATH or compiler configuration so that the native linker is +*** used, and then restart. + +_LT_EOF + ;; + *) + if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then + hardcode_libdir_flag_spec_GCJ='`test -z "$SCOABSPATH" && echo ${wl}-rpath,$libdir`' + archive_cmds_GCJ='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib' + archive_expsym_cmds_GCJ='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname,\${SCOABSPATH:+${install_libdir}/}$soname,-retain-symbols-file,$export_symbols -o $lib' + else + ld_shlibs_GCJ=no + fi + ;; + esac + ;; + + sunos4*) + archive_cmds_GCJ='$LD -assert pure-text -Bshareable -o $lib $libobjs $deplibs $linker_flags' + wlarc= + hardcode_direct_GCJ=yes + hardcode_shlibpath_var_GCJ=no + ;; + + *) + if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then + archive_cmds_GCJ='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib' + archive_expsym_cmds_GCJ='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib' + else + ld_shlibs_GCJ=no + fi + ;; + esac + + if test "$ld_shlibs_GCJ" = no; then + runpath_var= + hardcode_libdir_flag_spec_GCJ= + export_dynamic_flag_spec_GCJ= + whole_archive_flag_spec_GCJ= + fi + else + # PORTME fill in a description of your system's linker (not GNU ld) + case $host_os in + aix3*) + allow_undefined_flag_GCJ=unsupported + always_export_symbols_GCJ=yes + archive_expsym_cmds_GCJ='$LD -o $output_objdir/$soname $libobjs $deplibs $linker_flags -bE:$export_symbols -T512 -H512 -bM:SRE~$AR $AR_FLAGS $lib $output_objdir/$soname' + # Note: this linker hardcodes the directories in LIBPATH if there + # are no directories specified by -L. + hardcode_minus_L_GCJ=yes + if test "$GCC" = yes && test -z "$lt_prog_compiler_static"; then + # Neither direct hardcoding nor static linking is supported with a + # broken collect2. + hardcode_direct_GCJ=unsupported + fi + ;; + + aix4* | aix5*) + if test "$host_cpu" = ia64; then + # On IA64, the linker does run time linking by default, so we don't + # have to do anything special. + aix_use_runtimelinking=no + exp_sym_flag='-Bexport' + no_entry_flag="" + else + # If we're using GNU nm, then we don't want the "-C" option. + # -C means demangle to AIX nm, but means don't demangle with GNU nm + if $NM -V 2>&1 | grep 'GNU' > /dev/null; then + export_symbols_cmds_GCJ='$NM -Bpg $libobjs $convenience | awk '\''{ if (((\$2 == "T") || (\$2 == "D") || (\$2 == "B")) && (substr(\$3,1,1) != ".")) { print \$3 } }'\'' | sort -u > $export_symbols' + else + export_symbols_cmds_GCJ='$NM -BCpg $libobjs $convenience | awk '\''{ if (((\$2 == "T") || (\$2 == "D") || (\$2 == "B")) && (substr(\$3,1,1) != ".")) { print \$3 } }'\'' | sort -u > $export_symbols' + fi + aix_use_runtimelinking=no + + # Test if we are trying to use run time linking or normal + # AIX style linking. If -brtl is somewhere in LDFLAGS, we + # need to do runtime linking. + case $host_os in aix4.[23]|aix4.[23].*|aix5*) + for ld_flag in $LDFLAGS; do + if (test $ld_flag = "-brtl" || test $ld_flag = "-Wl,-brtl"); then + aix_use_runtimelinking=yes + break + fi + done + ;; + esac + + exp_sym_flag='-bexport' + no_entry_flag='-bnoentry' + fi + + # When large executables or shared objects are built, AIX ld can + # have problems creating the table of contents. If linking a library + # or program results in "error TOC overflow" add -mminimal-toc to + # CXXFLAGS/CFLAGS for g++/gcc. In the cases where that is not + # enough to fix the problem, add -Wl,-bbigtoc to LDFLAGS. + + archive_cmds_GCJ='' + hardcode_direct_GCJ=yes + hardcode_libdir_separator_GCJ=':' + link_all_deplibs_GCJ=yes + + if test "$GCC" = yes; then + case $host_os in aix4.[012]|aix4.[012].*) + # We only want to do this on AIX 4.2 and lower, the check + # below for broken collect2 doesn't work under 4.3+ + collect2name=`${CC} -print-prog-name=collect2` + if test -f "$collect2name" && \ + strings "$collect2name" | grep resolve_lib_name >/dev/null + then + # We have reworked collect2 + hardcode_direct_GCJ=yes + else + # We have old collect2 + hardcode_direct_GCJ=unsupported + # It fails to find uninstalled libraries when the uninstalled + # path is not listed in the libpath. Setting hardcode_minus_L + # to unsupported forces relinking + hardcode_minus_L_GCJ=yes + hardcode_libdir_flag_spec_GCJ='-L$libdir' + hardcode_libdir_separator_GCJ= + fi + ;; + esac + shared_flag='-shared' + if test "$aix_use_runtimelinking" = yes; then + shared_flag="$shared_flag "'${wl}-G' + fi + else + # not using gcc + if test "$host_cpu" = ia64; then + # VisualAge C++, Version 5.5 for AIX 5L for IA-64, Beta 3 Release + # chokes on -Wl,-G. The following line is correct: + shared_flag='-G' + else + if test "$aix_use_runtimelinking" = yes; then + shared_flag='${wl}-G' + else + shared_flag='${wl}-bM:SRE' + fi + fi + fi + + # It seems that -bexpall does not export symbols beginning with + # underscore (_), so it is better to generate a list of symbols to export. + always_export_symbols_GCJ=yes + if test "$aix_use_runtimelinking" = yes; then + # Warning - without using the other runtime loading flags (-brtl), + # -berok will link without error, but may produce a broken library. + allow_undefined_flag_GCJ='-berok' + # Determine the default libpath from the value encoded in an empty executable. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + +aix_libpath=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; } +}'` +# Check for a 64-bit object if we didn't find anything. +if test -z "$aix_libpath"; then aix_libpath=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; } +}'`; fi +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +fi +rm -f conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext +if test -z "$aix_libpath"; then aix_libpath="/usr/lib:/lib"; fi + + hardcode_libdir_flag_spec_GCJ='${wl}-blibpath:$libdir:'"$aix_libpath" + archive_expsym_cmds_GCJ="\$CC"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags `if test "x${allow_undefined_flag}" != "x"; then echo "${wl}${allow_undefined_flag}"; else :; fi` '"\${wl}$exp_sym_flag:\$export_symbols $shared_flag" + else + if test "$host_cpu" = ia64; then + hardcode_libdir_flag_spec_GCJ='${wl}-R $libdir:/usr/lib:/lib' + allow_undefined_flag_GCJ="-z nodefs" + archive_expsym_cmds_GCJ="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags ${wl}${allow_undefined_flag} '"\${wl}$exp_sym_flag:\$export_symbols" + else + # Determine the default libpath from the value encoded in an empty executable. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + +aix_libpath=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; } +}'` +# Check for a 64-bit object if we didn't find anything. +if test -z "$aix_libpath"; then aix_libpath=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; } +}'`; fi +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +fi +rm -f conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext +if test -z "$aix_libpath"; then aix_libpath="/usr/lib:/lib"; fi + + hardcode_libdir_flag_spec_GCJ='${wl}-blibpath:$libdir:'"$aix_libpath" + # Warning - without using the other run time loading flags, + # -berok will link without error, but may produce a broken library. + no_undefined_flag_GCJ=' ${wl}-bernotok' + allow_undefined_flag_GCJ=' ${wl}-berok' + # Exported symbols can be pulled into shared objects from archives + whole_archive_flag_spec_GCJ='$convenience' + archive_cmds_need_lc_GCJ=yes + # This is similar to how AIX traditionally builds its shared libraries. + archive_expsym_cmds_GCJ="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs ${wl}-bnoentry $compiler_flags ${wl}-bE:$export_symbols${allow_undefined_flag}~$AR $AR_FLAGS $output_objdir/$libname$release.a $output_objdir/$soname' + fi + fi + ;; + + amigaos*) + archive_cmds_GCJ='$rm $output_objdir/a2ixlibrary.data~$echo "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$echo "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$echo "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$echo "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)' + hardcode_libdir_flag_spec_GCJ='-L$libdir' + hardcode_minus_L_GCJ=yes + # see comment about different semantics on the GNU ld section + ld_shlibs_GCJ=no + ;; + + bsdi[45]*) + export_dynamic_flag_spec_GCJ=-rdynamic + ;; + + cygwin* | mingw* | pw32*) + # When not using gcc, we currently assume that we are using + # Microsoft Visual C++. + # hardcode_libdir_flag_spec is actually meaningless, as there is + # no search path for DLLs. + hardcode_libdir_flag_spec_GCJ=' ' + allow_undefined_flag_GCJ=unsupported + # Tell ltmain to make .lib files, not .a files. + libext=lib + # Tell ltmain to make .dll files, not .so files. + shrext_cmds=".dll" + # FIXME: Setting linknames here is a bad hack. + archive_cmds_GCJ='$CC -o $lib $libobjs $compiler_flags `echo "$deplibs" | $SED -e '\''s/ -lc$//'\''` -link -dll~linknames=' + # The linker will automatically build a .lib file if we build a DLL. + old_archive_From_new_cmds_GCJ='true' + # FIXME: Should let the user specify the lib program. + old_archive_cmds_GCJ='lib /OUT:$oldlib$oldobjs$old_deplibs' + fix_srcfile_path_GCJ='`cygpath -w "$srcfile"`' + enable_shared_with_static_runtimes_GCJ=yes + ;; + + darwin* | rhapsody*) + case $host_os in + rhapsody* | darwin1.[012]) + allow_undefined_flag_GCJ='${wl}-undefined ${wl}suppress' + ;; + *) # Darwin 1.3 on + if test -z ${MACOSX_DEPLOYMENT_TARGET} ; then + allow_undefined_flag_GCJ='${wl}-flat_namespace ${wl}-undefined ${wl}suppress' + else + case ${MACOSX_DEPLOYMENT_TARGET} in + 10.[012]) + allow_undefined_flag_GCJ='${wl}-flat_namespace ${wl}-undefined ${wl}suppress' + ;; + 10.*) + allow_undefined_flag_GCJ='${wl}-undefined ${wl}dynamic_lookup' + ;; + esac + fi + ;; + esac + archive_cmds_need_lc_GCJ=no + hardcode_direct_GCJ=no + hardcode_automatic_GCJ=yes + hardcode_shlibpath_var_GCJ=unsupported + whole_archive_flag_spec_GCJ='' + link_all_deplibs_GCJ=yes + if test "$GCC" = yes ; then + output_verbose_link_cmd='echo' + archive_cmds_GCJ='$CC -dynamiclib $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags -install_name $rpath/$soname $verstring' + module_cmds_GCJ='$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags' + # Don't fix this by using the ld -exported_symbols_list flag, it doesn't exist in older darwin lds + archive_expsym_cmds_GCJ='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -dynamiclib $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags -install_name $rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}' + module_expsym_cmds_GCJ='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}' + else + case $cc_basename in + xlc*) + output_verbose_link_cmd='echo' + archive_cmds_GCJ='$CC -qmkshrobj $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-install_name ${wl}`echo $rpath/$soname` $verstring' + module_cmds_GCJ='$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags' + # Don't fix this by using the ld -exported_symbols_list flag, it doesn't exist in older darwin lds + archive_expsym_cmds_GCJ='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC -qmkshrobj $allow_undefined_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-install_name ${wl}$rpath/$soname $verstring~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}' + module_expsym_cmds_GCJ='sed -e "s,#.*,," -e "s,^[ ]*,," -e "s,^\(..*\),_&," < $export_symbols > $output_objdir/${libname}-symbols.expsym~$CC $allow_undefined_flag -o $lib -bundle $libobjs $deplibs$compiler_flags~nmedit -s $output_objdir/${libname}-symbols.expsym ${lib}' + ;; + *) + ld_shlibs_GCJ=no + ;; + esac + fi + ;; + + dgux*) + archive_cmds_GCJ='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_libdir_flag_spec_GCJ='-L$libdir' + hardcode_shlibpath_var_GCJ=no + ;; + + freebsd1*) + ld_shlibs_GCJ=no + ;; + + # FreeBSD 2.2.[012] allows us to include c++rt0.o to get C++ constructor + # support. Future versions do this automatically, but an explicit c++rt0.o + # does not break anything, and helps significantly (at the cost of a little + # extra space). + freebsd2.2*) + archive_cmds_GCJ='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags /usr/lib/c++rt0.o' + hardcode_libdir_flag_spec_GCJ='-R$libdir' + hardcode_direct_GCJ=yes + hardcode_shlibpath_var_GCJ=no + ;; + + # Unfortunately, older versions of FreeBSD 2 do not have this feature. + freebsd2*) + archive_cmds_GCJ='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' + hardcode_direct_GCJ=yes + hardcode_minus_L_GCJ=yes + hardcode_shlibpath_var_GCJ=no + ;; + + # FreeBSD 3 and greater uses gcc -shared to do shared libraries. + freebsd* | kfreebsd*-gnu | dragonfly*) + archive_cmds_GCJ='$CC -shared -o $lib $libobjs $deplibs $compiler_flags' + hardcode_libdir_flag_spec_GCJ='-R$libdir' + hardcode_direct_GCJ=yes + hardcode_shlibpath_var_GCJ=no + ;; + + hpux9*) + if test "$GCC" = yes; then + archive_cmds_GCJ='$rm $output_objdir/$soname~$CC -shared -fPIC ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $libobjs $deplibs $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib' + else + archive_cmds_GCJ='$rm $output_objdir/$soname~$LD -b +b $install_libdir -o $output_objdir/$soname $libobjs $deplibs $linker_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib' + fi + hardcode_libdir_flag_spec_GCJ='${wl}+b ${wl}$libdir' + hardcode_libdir_separator_GCJ=: + hardcode_direct_GCJ=yes + + # hardcode_minus_L: Not really in the search PATH, + # but as the default location of the library. + hardcode_minus_L_GCJ=yes + export_dynamic_flag_spec_GCJ='${wl}-E' + ;; + + hpux10*) + if test "$GCC" = yes -a "$with_gnu_ld" = no; then + archive_cmds_GCJ='$CC -shared -fPIC ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags' + else + archive_cmds_GCJ='$LD -b +h $soname +b $install_libdir -o $lib $libobjs $deplibs $linker_flags' + fi + if test "$with_gnu_ld" = no; then + hardcode_libdir_flag_spec_GCJ='${wl}+b ${wl}$libdir' + hardcode_libdir_separator_GCJ=: + + hardcode_direct_GCJ=yes + export_dynamic_flag_spec_GCJ='${wl}-E' + + # hardcode_minus_L: Not really in the search PATH, + # but as the default location of the library. + hardcode_minus_L_GCJ=yes + fi + ;; + + hpux11*) + if test "$GCC" = yes -a "$with_gnu_ld" = no; then + case $host_cpu in + hppa*64*) + archive_cmds_GCJ='$CC -shared ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags' + ;; + ia64*) + archive_cmds_GCJ='$CC -shared ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags' + ;; + *) + archive_cmds_GCJ='$CC -shared -fPIC ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags' + ;; + esac + else + case $host_cpu in + hppa*64*) + archive_cmds_GCJ='$CC -b ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags' + ;; + ia64*) + archive_cmds_GCJ='$CC -b ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags' + ;; + *) + archive_cmds_GCJ='$CC -b ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags' + ;; + esac + fi + if test "$with_gnu_ld" = no; then + hardcode_libdir_flag_spec_GCJ='${wl}+b ${wl}$libdir' + hardcode_libdir_separator_GCJ=: + + case $host_cpu in + hppa*64*|ia64*) + hardcode_libdir_flag_spec_ld_GCJ='+b $libdir' + hardcode_direct_GCJ=no + hardcode_shlibpath_var_GCJ=no + ;; + *) + hardcode_direct_GCJ=yes + export_dynamic_flag_spec_GCJ='${wl}-E' + + # hardcode_minus_L: Not really in the search PATH, + # but as the default location of the library. + hardcode_minus_L_GCJ=yes + ;; + esac + fi + ;; + + irix5* | irix6* | nonstopux*) + if test "$GCC" = yes; then + archive_cmds_GCJ='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + else + archive_cmds_GCJ='$LD -shared $libobjs $deplibs $linker_flags -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib' + hardcode_libdir_flag_spec_ld_GCJ='-rpath $libdir' + fi + hardcode_libdir_flag_spec_GCJ='${wl}-rpath ${wl}$libdir' + hardcode_libdir_separator_GCJ=: + link_all_deplibs_GCJ=yes + ;; + + netbsd*) + if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then + archive_cmds_GCJ='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' # a.out + else + archive_cmds_GCJ='$LD -shared -o $lib $libobjs $deplibs $linker_flags' # ELF + fi + hardcode_libdir_flag_spec_GCJ='-R$libdir' + hardcode_direct_GCJ=yes + hardcode_shlibpath_var_GCJ=no + ;; + + newsos6) + archive_cmds_GCJ='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_direct_GCJ=yes + hardcode_libdir_flag_spec_GCJ='${wl}-rpath ${wl}$libdir' + hardcode_libdir_separator_GCJ=: + hardcode_shlibpath_var_GCJ=no + ;; + + openbsd*) + hardcode_direct_GCJ=yes + hardcode_shlibpath_var_GCJ=no + if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then + archive_cmds_GCJ='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds_GCJ='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-retain-symbols-file,$export_symbols' + hardcode_libdir_flag_spec_GCJ='${wl}-rpath,$libdir' + export_dynamic_flag_spec_GCJ='${wl}-E' + else + case $host_os in + openbsd[01].* | openbsd2.[0-7] | openbsd2.[0-7].*) + archive_cmds_GCJ='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' + hardcode_libdir_flag_spec_GCJ='-R$libdir' + ;; + *) + archive_cmds_GCJ='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags' + hardcode_libdir_flag_spec_GCJ='${wl}-rpath,$libdir' + ;; + esac + fi + ;; + + os2*) + hardcode_libdir_flag_spec_GCJ='-L$libdir' + hardcode_minus_L_GCJ=yes + allow_undefined_flag_GCJ=unsupported + archive_cmds_GCJ='$echo "LIBRARY $libname INITINSTANCE" > $output_objdir/$libname.def~$echo "DESCRIPTION \"$libname\"" >> $output_objdir/$libname.def~$echo DATA >> $output_objdir/$libname.def~$echo " SINGLE NONSHARED" >> $output_objdir/$libname.def~$echo EXPORTS >> $output_objdir/$libname.def~emxexp $libobjs >> $output_objdir/$libname.def~$CC -Zdll -Zcrtdll -o $lib $libobjs $deplibs $compiler_flags $output_objdir/$libname.def' + old_archive_From_new_cmds_GCJ='emximp -o $output_objdir/$libname.a $output_objdir/$libname.def' + ;; + + osf3*) + if test "$GCC" = yes; then + allow_undefined_flag_GCJ=' ${wl}-expect_unresolved ${wl}\*' + archive_cmds_GCJ='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + else + allow_undefined_flag_GCJ=' -expect_unresolved \*' + archive_cmds_GCJ='$LD -shared${allow_undefined_flag} $libobjs $deplibs $linker_flags -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib' + fi + hardcode_libdir_flag_spec_GCJ='${wl}-rpath ${wl}$libdir' + hardcode_libdir_separator_GCJ=: + ;; + + osf4* | osf5*) # as osf3* with the addition of -msym flag + if test "$GCC" = yes; then + allow_undefined_flag_GCJ=' ${wl}-expect_unresolved ${wl}\*' + archive_cmds_GCJ='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags ${wl}-msym ${wl}-soname ${wl}$soname `test -n "$verstring" && echo ${wl}-set_version ${wl}$verstring` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib' + hardcode_libdir_flag_spec_GCJ='${wl}-rpath ${wl}$libdir' + else + allow_undefined_flag_GCJ=' -expect_unresolved \*' + archive_cmds_GCJ='$LD -shared${allow_undefined_flag} $libobjs $deplibs $linker_flags -msym -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib' + archive_expsym_cmds_GCJ='for i in `cat $export_symbols`; do printf "%s %s\\n" -exported_symbol "\$i" >> $lib.exp; done; echo "-hidden">> $lib.exp~ + $LD -shared${allow_undefined_flag} -input $lib.exp $linker_flags $libobjs $deplibs -soname $soname `test -n "$verstring" && echo -set_version $verstring` -update_registry ${output_objdir}/so_locations -o $lib~$rm $lib.exp' + + # Both c and cxx compiler support -rpath directly + hardcode_libdir_flag_spec_GCJ='-rpath $libdir' + fi + hardcode_libdir_separator_GCJ=: + ;; + + solaris*) + no_undefined_flag_GCJ=' -z text' + if test "$GCC" = yes; then + wlarc='${wl}' + archive_cmds_GCJ='$CC -shared ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds_GCJ='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~ + $CC -shared ${wl}-M ${wl}$lib.exp ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags~$rm $lib.exp' + else + wlarc='' + archive_cmds_GCJ='$LD -G${allow_undefined_flag} -h $soname -o $lib $libobjs $deplibs $linker_flags' + archive_expsym_cmds_GCJ='$echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~$echo "local: *; };" >> $lib.exp~ + $LD -G${allow_undefined_flag} -M $lib.exp -h $soname -o $lib $libobjs $deplibs $linker_flags~$rm $lib.exp' + fi + hardcode_libdir_flag_spec_GCJ='-R$libdir' + hardcode_shlibpath_var_GCJ=no + case $host_os in + solaris2.[0-5] | solaris2.[0-5].*) ;; + *) + # The compiler driver will combine linker options so we + # cannot just pass the convience library names through + # without $wl, iff we do not link with $LD. + # Luckily, gcc supports the same syntax we need for Sun Studio. + # Supported since Solaris 2.6 (maybe 2.5.1?) + case $wlarc in + '') + whole_archive_flag_spec_GCJ='-z allextract$convenience -z defaultextract' ;; + *) + whole_archive_flag_spec_GCJ='${wl}-z ${wl}allextract`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; $echo \"$new_convenience\"` ${wl}-z ${wl}defaultextract' ;; + esac ;; + esac + link_all_deplibs_GCJ=yes + ;; + + sunos4*) + if test "x$host_vendor" = xsequent; then + # Use $CC to link under sequent, because it throws in some extra .o + # files that make .init and .fini sections work. + archive_cmds_GCJ='$CC -G ${wl}-h $soname -o $lib $libobjs $deplibs $compiler_flags' + else + archive_cmds_GCJ='$LD -assert pure-text -Bstatic -o $lib $libobjs $deplibs $linker_flags' + fi + hardcode_libdir_flag_spec_GCJ='-L$libdir' + hardcode_direct_GCJ=yes + hardcode_minus_L_GCJ=yes + hardcode_shlibpath_var_GCJ=no + ;; + + sysv4) + case $host_vendor in + sni) + archive_cmds_GCJ='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_direct_GCJ=yes # is this really true??? + ;; + siemens) + ## LD is ld it makes a PLAMLIB + ## CC just makes a GrossModule. + archive_cmds_GCJ='$LD -G -o $lib $libobjs $deplibs $linker_flags' + reload_cmds_GCJ='$CC -r -o $output$reload_objs' + hardcode_direct_GCJ=no + ;; + motorola) + archive_cmds_GCJ='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_direct_GCJ=no #Motorola manual says yes, but my tests say they lie + ;; + esac + runpath_var='LD_RUN_PATH' + hardcode_shlibpath_var_GCJ=no + ;; + + sysv4.3*) + archive_cmds_GCJ='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_shlibpath_var_GCJ=no + export_dynamic_flag_spec_GCJ='-Bexport' + ;; + + sysv4*MP*) + if test -d /usr/nec; then + archive_cmds_GCJ='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_shlibpath_var_GCJ=no + runpath_var=LD_RUN_PATH + hardcode_runpath_var=yes + ld_shlibs_GCJ=yes + fi + ;; + + sysv4*uw2* | sysv5OpenUNIX* | sysv5UnixWare7.[01].[10]* | unixware7*) + no_undefined_flag_GCJ='${wl}-z,text' + archive_cmds_need_lc_GCJ=no + hardcode_shlibpath_var_GCJ=no + runpath_var='LD_RUN_PATH' + + if test "$GCC" = yes; then + archive_cmds_GCJ='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds_GCJ='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + else + archive_cmds_GCJ='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds_GCJ='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags' + fi + ;; + + sysv5* | sco3.2v5* | sco5v6*) + # Note: We can NOT use -z defs as we might desire, because we do not + # link with -lc, and that would cause any symbols used from libc to + # always be unresolved, which means just about no library would + # ever link correctly. If we're not using GNU ld we use -z text + # though, which does catch some bad symbols but isn't as heavy-handed + # as -z defs. + no_undefined_flag_GCJ='${wl}-z,text' + allow_undefined_flag_GCJ='${wl}-z,nodefs' + archive_cmds_need_lc_GCJ=no + hardcode_shlibpath_var_GCJ=no + hardcode_libdir_flag_spec_GCJ='`test -z "$SCOABSPATH" && echo ${wl}-R,$libdir`' + hardcode_libdir_separator_GCJ=':' + link_all_deplibs_GCJ=yes + export_dynamic_flag_spec_GCJ='${wl}-Bexport' + runpath_var='LD_RUN_PATH' + + if test "$GCC" = yes; then + archive_cmds_GCJ='$CC -shared ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds_GCJ='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags' + else + archive_cmds_GCJ='$CC -G ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags' + archive_expsym_cmds_GCJ='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,\${SCOABSPATH:+${install_libdir}/}$soname -o $lib $libobjs $deplibs $compiler_flags' + fi + ;; + + uts4*) + archive_cmds_GCJ='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags' + hardcode_libdir_flag_spec_GCJ='-L$libdir' + hardcode_shlibpath_var_GCJ=no + ;; + + *) + ld_shlibs_GCJ=no + ;; + esac + fi + +echo "$as_me:$LINENO: result: $ld_shlibs_GCJ" >&5 +echo "${ECHO_T}$ld_shlibs_GCJ" >&6 +test "$ld_shlibs_GCJ" = no && can_build_shared=no + +# +# Do we need to explicitly link libc? +# +case "x$archive_cmds_need_lc_GCJ" in +x|xyes) + # Assume -lc should be added + archive_cmds_need_lc_GCJ=yes + + if test "$enable_shared" = yes && test "$GCC" = yes; then + case $archive_cmds_GCJ in + *'~'*) + # FIXME: we may have to deal with multi-command sequences. + ;; + '$CC '*) + # Test whether the compiler implicitly links with -lc since on some + # systems, -lgcc has to come before -lc. If gcc already passes -lc + # to ld, don't add -lc before -lgcc. + echo "$as_me:$LINENO: checking whether -lc should be explicitly linked in" >&5 +echo $ECHO_N "checking whether -lc should be explicitly linked in... $ECHO_C" >&6 + $rm conftest* + printf "$lt_simple_compile_test_code" > conftest.$ac_ext + + if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } 2>conftest.err; then + soname=conftest + lib=conftest + libobjs=conftest.$ac_objext + deplibs= + wl=$lt_prog_compiler_wl_GCJ + pic_flag=$lt_prog_compiler_pic_GCJ + compiler_flags=-v + linker_flags=-v + verstring= + output_objdir=. + libname=conftest + lt_save_allow_undefined_flag=$allow_undefined_flag_GCJ + allow_undefined_flag_GCJ= + if { (eval echo "$as_me:$LINENO: \"$archive_cmds_GCJ 2\>\&1 \| grep \" -lc \" \>/dev/null 2\>\&1\"") >&5 + (eval $archive_cmds_GCJ 2\>\&1 \| grep \" -lc \" \>/dev/null 2\>\&1) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } + then + archive_cmds_need_lc_GCJ=no + else + archive_cmds_need_lc_GCJ=yes + fi + allow_undefined_flag_GCJ=$lt_save_allow_undefined_flag + else + cat conftest.err 1>&5 + fi + $rm conftest* + echo "$as_me:$LINENO: result: $archive_cmds_need_lc_GCJ" >&5 +echo "${ECHO_T}$archive_cmds_need_lc_GCJ" >&6 + ;; + esac + fi + ;; +esac + +echo "$as_me:$LINENO: checking dynamic linker characteristics" >&5 +echo $ECHO_N "checking dynamic linker characteristics... $ECHO_C" >&6 +library_names_spec= +libname_spec='lib$name' +soname_spec= +shrext_cmds=".so" +postinstall_cmds= +postuninstall_cmds= +finish_cmds= +finish_eval= +shlibpath_var= +shlibpath_overrides_runpath=unknown +version_type=none +dynamic_linker="$host_os ld.so" +sys_lib_dlsearch_path_spec="/lib /usr/lib" +if test "$GCC" = yes; then + sys_lib_search_path_spec=`$CC -print-search-dirs | grep "^libraries:" | $SED -e "s/^libraries://" -e "s,=/,/,g"` + if echo "$sys_lib_search_path_spec" | grep ';' >/dev/null ; then + # if the path contains ";" then we assume it to be the separator + # otherwise default to the standard path separator (i.e. ":") - it is + # assumed that no part of a normal pathname contains ";" but that should + # okay in the real world where ";" in dirpaths is itself problematic. + sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'` + else + sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"` + fi +else + sys_lib_search_path_spec="/lib /usr/lib /usr/local/lib" +fi +need_lib_prefix=unknown +hardcode_into_libs=no + +# when you set need_version to no, make sure it does not cause -set_version +# flags to be left without arguments +need_version=unknown + +case $host_os in +aix3*) + version_type=linux + library_names_spec='${libname}${release}${shared_ext}$versuffix $libname.a' + shlibpath_var=LIBPATH + + # AIX 3 has no versioning support, so we append a major version to the name. + soname_spec='${libname}${release}${shared_ext}$major' + ;; + +aix4* | aix5*) + version_type=linux + need_lib_prefix=no + need_version=no + hardcode_into_libs=yes + if test "$host_cpu" = ia64; then + # AIX 5 supports IA64 + library_names_spec='${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext}$versuffix $libname${shared_ext}' + shlibpath_var=LD_LIBRARY_PATH + else + # With GCC up to 2.95.x, collect2 would create an import file + # for dependence libraries. The import file would start with + # the line `#! .'. This would cause the generated library to + # depend on `.', always an invalid library. This was fixed in + # development snapshots of GCC prior to 3.0. + case $host_os in + aix4 | aix4.[01] | aix4.[01].*) + if { echo '#if __GNUC__ > 2 || (__GNUC__ == 2 && __GNUC_MINOR__ >= 97)' + echo ' yes ' + echo '#endif'; } | ${CC} -E - | grep yes > /dev/null; then + : + else + can_build_shared=no + fi + ;; + esac + # AIX (on Power*) has no versioning support, so currently we can not hardcode correct + # soname into executable. Probably we can add versioning support to + # collect2, so additional links can be useful in future. + if test "$aix_use_runtimelinking" = yes; then + # If using run time linking (on AIX 4.2 or later) use lib<name>.so + # instead of lib<name>.a to let people know that these are not + # typical AIX shared libraries. + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + else + # We preserve .a as extension for shared libraries through AIX4.2 + # and later when we are not doing run time linking. + library_names_spec='${libname}${release}.a $libname.a' + soname_spec='${libname}${release}${shared_ext}$major' + fi + shlibpath_var=LIBPATH + fi + ;; + +amigaos*) + library_names_spec='$libname.ixlibrary $libname.a' + # Create ${libname}_ixlibrary.a entries in /sys/libs. + finish_eval='for lib in `ls $libdir/*.ixlibrary 2>/dev/null`; do libname=`$echo "X$lib" | $Xsed -e '\''s%^.*/\([^/]*\)\.ixlibrary$%\1%'\''`; test $rm /sys/libs/${libname}_ixlibrary.a; $show "cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a"; cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a || exit 1; done' + ;; + +beos*) + library_names_spec='${libname}${shared_ext}' + dynamic_linker="$host_os ld.so" + shlibpath_var=LIBRARY_PATH + ;; + +bsdi[45]*) + version_type=linux + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + finish_cmds='PATH="\$PATH:/sbin" ldconfig $libdir' + shlibpath_var=LD_LIBRARY_PATH + sys_lib_search_path_spec="/shlib /usr/lib /usr/X11/lib /usr/contrib/lib /lib /usr/local/lib" + sys_lib_dlsearch_path_spec="/shlib /usr/lib /usr/local/lib" + # the default ld.so.conf also contains /usr/contrib/lib and + # /usr/X11R6/lib (/usr/X11 is a link to /usr/X11R6), but let us allow + # libtool to hard-code these into programs + ;; + +cygwin* | mingw* | pw32*) + version_type=windows + shrext_cmds=".dll" + need_version=no + need_lib_prefix=no + + case $GCC,$host_os in + yes,cygwin* | yes,mingw* | yes,pw32*) + library_names_spec='$libname.dll.a' + # DLL is installed to $(libdir)/../bin by postinstall_cmds + postinstall_cmds='base_file=`basename \${file}`~ + dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\${base_file}'\''i;echo \$dlname'\''`~ + dldir=$destdir/`dirname \$dlpath`~ + test -d \$dldir || mkdir -p \$dldir~ + $install_prog $dir/$dlname \$dldir/$dlname~ + chmod a+x \$dldir/$dlname' + postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~ + dlpath=$dir/\$dldll~ + $rm \$dlpath' + shlibpath_overrides_runpath=yes + + case $host_os in + cygwin*) + # Cygwin DLLs use 'cyg' prefix rather than 'lib' + soname_spec='`echo ${libname} | sed -e 's/^lib/cyg/'``echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}' + sys_lib_search_path_spec="/usr/lib /lib/w32api /lib /usr/local/lib" + ;; + mingw*) + # MinGW DLLs use traditional 'lib' prefix + soname_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}' + sys_lib_search_path_spec=`$CC -print-search-dirs | grep "^libraries:" | $SED -e "s/^libraries://" -e "s,=/,/,g"` + if echo "$sys_lib_search_path_spec" | grep ';[c-zC-Z]:/' >/dev/null; then + # It is most probably a Windows format PATH printed by + # mingw gcc, but we are running on Cygwin. Gcc prints its search + # path with ; separators, and with drive letters. We can handle the + # drive letters (cygwin fileutils understands them), so leave them, + # especially as we might pass files found there to a mingw objdump, + # which wouldn't understand a cygwinified path. Ahh. + sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'` + else + sys_lib_search_path_spec=`echo "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"` + fi + ;; + pw32*) + # pw32 DLLs use 'pw' prefix rather than 'lib' + library_names_spec='`echo ${libname} | sed -e 's/^lib/pw/'``echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}' + ;; + esac + ;; + + *) + library_names_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext} $libname.lib' + ;; + esac + dynamic_linker='Win32 ld.exe' + # FIXME: first we should search . and the directory the executable is in + shlibpath_var=PATH + ;; + +darwin* | rhapsody*) + dynamic_linker="$host_os dyld" + version_type=darwin + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${versuffix}$shared_ext ${libname}${release}${major}$shared_ext ${libname}$shared_ext' + soname_spec='${libname}${release}${major}$shared_ext' + shlibpath_overrides_runpath=yes + shlibpath_var=DYLD_LIBRARY_PATH + shrext_cmds='`test .$module = .yes && echo .so || echo .dylib`' + # Apple's gcc prints 'gcc -print-search-dirs' doesn't operate the same. + if test "$GCC" = yes; then + sys_lib_search_path_spec=`$CC -print-search-dirs | tr "\n" "$PATH_SEPARATOR" | sed -e 's/libraries:/@libraries:/' | tr "@" "\n" | grep "^libraries:" | sed -e "s/^libraries://" -e "s,=/,/,g" -e "s,$PATH_SEPARATOR, ,g" -e "s,.*,& /lib /usr/lib /usr/local/lib,g"` + else + sys_lib_search_path_spec='/lib /usr/lib /usr/local/lib' + fi + sys_lib_dlsearch_path_spec='/usr/local/lib /lib /usr/lib' + ;; + +dgux*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname$shared_ext' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + ;; + +freebsd1*) + dynamic_linker=no + ;; + +kfreebsd*-gnu) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + dynamic_linker='GNU ld.so' + ;; + +freebsd* | dragonfly*) + # DragonFly does not have aout. When/if they implement a new + # versioning mechanism, adjust this. + if test -x /usr/bin/objformat; then + objformat=`/usr/bin/objformat` + else + case $host_os in + freebsd[123]*) objformat=aout ;; + *) objformat=elf ;; + esac + fi + version_type=freebsd-$objformat + case $version_type in + freebsd-elf*) + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}' + need_version=no + need_lib_prefix=no + ;; + freebsd-*) + library_names_spec='${libname}${release}${shared_ext}$versuffix $libname${shared_ext}$versuffix' + need_version=yes + ;; + esac + shlibpath_var=LD_LIBRARY_PATH + case $host_os in + freebsd2*) + shlibpath_overrides_runpath=yes + ;; + freebsd3.[01]* | freebsdelf3.[01]*) + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + ;; + freebsd3.[2-9]* | freebsdelf3.[2-9]* | \ + freebsd4.[0-5] | freebsdelf4.[0-5] | freebsd4.1.1 | freebsdelf4.1.1) + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + ;; + freebsd*) # from 4.6 on + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + ;; + esac + ;; + +gnu*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}${major} ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + hardcode_into_libs=yes + ;; + +hpux9* | hpux10* | hpux11*) + # Give a soname corresponding to the major version so that dld.sl refuses to + # link against other versions. + version_type=sunos + need_lib_prefix=no + need_version=no + case $host_cpu in + ia64*) + shrext_cmds='.so' + hardcode_into_libs=yes + dynamic_linker="$host_os dld.so" + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes # Unless +noenvvar is specified. + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + if test "X$HPUX_IA64_MODE" = X32; then + sys_lib_search_path_spec="/usr/lib/hpux32 /usr/local/lib/hpux32 /usr/local/lib" + else + sys_lib_search_path_spec="/usr/lib/hpux64 /usr/local/lib/hpux64" + fi + sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec + ;; + hppa*64*) + shrext_cmds='.sl' + hardcode_into_libs=yes + dynamic_linker="$host_os dld.sl" + shlibpath_var=LD_LIBRARY_PATH # How should we handle SHLIB_PATH + shlibpath_overrides_runpath=yes # Unless +noenvvar is specified. + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + sys_lib_search_path_spec="/usr/lib/pa20_64 /usr/ccs/lib/pa20_64" + sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec + ;; + *) + shrext_cmds='.sl' + dynamic_linker="$host_os dld.sl" + shlibpath_var=SHLIB_PATH + shlibpath_overrides_runpath=no # +s is required to enable SHLIB_PATH + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + ;; + esac + # HP-UX runs *really* slowly unless shared libraries are mode 555. + postinstall_cmds='chmod 555 $lib' + ;; + +interix3*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + dynamic_linker='Interix 3.x ld.so.1 (PE, like ELF)' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + ;; + +irix5* | irix6* | nonstopux*) + case $host_os in + nonstopux*) version_type=nonstopux ;; + *) + if test "$lt_cv_prog_gnu_ld" = yes; then + version_type=linux + else + version_type=irix + fi ;; + esac + need_lib_prefix=no + need_version=no + soname_spec='${libname}${release}${shared_ext}$major' + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext} $libname${shared_ext}' + case $host_os in + irix5* | nonstopux*) + libsuff= shlibsuff= + ;; + *) + case $LD in # libtool.m4 will add one of these switches to LD + *-32|*"-32 "|*-melf32bsmip|*"-melf32bsmip ") + libsuff= shlibsuff= libmagic=32-bit;; + *-n32|*"-n32 "|*-melf32bmipn32|*"-melf32bmipn32 ") + libsuff=32 shlibsuff=N32 libmagic=N32;; + *-64|*"-64 "|*-melf64bmip|*"-melf64bmip ") + libsuff=64 shlibsuff=64 libmagic=64-bit;; + *) libsuff= shlibsuff= libmagic=never-match;; + esac + ;; + esac + shlibpath_var=LD_LIBRARY${shlibsuff}_PATH + shlibpath_overrides_runpath=no + sys_lib_search_path_spec="/usr/lib${libsuff} /lib${libsuff} /usr/local/lib${libsuff}" + sys_lib_dlsearch_path_spec="/usr/lib${libsuff} /lib${libsuff}" + hardcode_into_libs=yes + ;; + +# No shared lib support for Linux oldld, aout, or coff. +linux*oldld* | linux*aout* | linux*coff*) + dynamic_linker=no + ;; + +# This must be Linux ELF. +linux*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -n $libdir' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + # This implies no fast_install, which is unacceptable. + # Some rework will be needed to allow for fast_install + # before this can be enabled. + hardcode_into_libs=yes + + # find out which ABI we are using + libsuff= + case "$host_cpu" in + x86_64*|s390x*|powerpc64*) + echo '#line 17446 "configure"' > conftest.$ac_ext + if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + case `/usr/bin/file conftest.$ac_objext` in + *64-bit*) + libsuff=64 + sys_lib_search_path_spec="/lib${libsuff} /usr/lib${libsuff} /usr/local/lib${libsuff}" + ;; + esac + fi + rm -rf conftest* + ;; + esac + + # Append ld.so.conf contents to the search path + if test -f /etc/ld.so.conf; then + lt_ld_extra=`awk '/^include / { system(sprintf("cd /etc; cat %s 2>/dev/null", \$2)); skip = 1; } { if (!skip) print \$0; skip = 0; }' < /etc/ld.so.conf | $SED -e 's/#.*//;s/[:, ]/ /g;s/=[^=]*$//;s/=[^= ]* / /g;/^$/d' | tr '\n' ' '` + sys_lib_dlsearch_path_spec="/lib${libsuff} /usr/lib${libsuff} $lt_ld_extra" + fi + + # We used to test for /lib/ld.so.1 and disable shared libraries on + # powerpc, because MkLinux only supported shared libraries with the + # GNU dynamic linker. Since this was broken with cross compilers, + # most powerpc-linux boxes support dynamic linking these days and + # people can always --disable-shared, the test was removed, and we + # assume the GNU/Linux dynamic linker is in use. + dynamic_linker='GNU/Linux ld.so' + ;; + +knetbsd*-gnu) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=no + hardcode_into_libs=yes + dynamic_linker='GNU ld.so' + ;; + +netbsd*) + version_type=sunos + need_lib_prefix=no + need_version=no + if echo __ELF__ | $CC -E - | grep __ELF__ >/dev/null; then + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir' + dynamic_linker='NetBSD (a.out) ld.so' + else + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + dynamic_linker='NetBSD ld.elf_so' + fi + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + ;; + +newsos6) + version_type=linux + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + ;; + +nto-qnx*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + ;; + +openbsd*) + version_type=sunos + sys_lib_dlsearch_path_spec="/usr/lib" + need_lib_prefix=no + # Some older versions of OpenBSD (3.3 at least) *do* need versioned libs. + case $host_os in + openbsd3.3 | openbsd3.3.*) need_version=yes ;; + *) need_version=no ;; + esac + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir' + shlibpath_var=LD_LIBRARY_PATH + if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then + case $host_os in + openbsd2.[89] | openbsd2.[89].*) + shlibpath_overrides_runpath=no + ;; + *) + shlibpath_overrides_runpath=yes + ;; + esac + else + shlibpath_overrides_runpath=yes + fi + ;; + +os2*) + libname_spec='$name' + shrext_cmds=".dll" + need_lib_prefix=no + library_names_spec='$libname${shared_ext} $libname.a' + dynamic_linker='OS/2 ld.exe' + shlibpath_var=LIBPATH + ;; + +osf3* | osf4* | osf5*) + version_type=osf + need_lib_prefix=no + need_version=no + soname_spec='${libname}${release}${shared_ext}$major' + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + shlibpath_var=LD_LIBRARY_PATH + sys_lib_search_path_spec="/usr/shlib /usr/ccs/lib /usr/lib/cmplrs/cc /usr/lib /usr/local/lib /var/shlib" + sys_lib_dlsearch_path_spec="$sys_lib_search_path_spec" + ;; + +solaris*) + version_type=linux + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + hardcode_into_libs=yes + # ldd complains unless libraries are executable + postinstall_cmds='chmod +x $lib' + ;; + +sunos4*) + version_type=sunos + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix' + finish_cmds='PATH="\$PATH:/usr/etc" ldconfig $libdir' + shlibpath_var=LD_LIBRARY_PATH + shlibpath_overrides_runpath=yes + if test "$with_gnu_ld" = yes; then + need_lib_prefix=no + fi + need_version=yes + ;; + +sysv4 | sysv4.3*) + version_type=linux + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + case $host_vendor in + sni) + shlibpath_overrides_runpath=no + need_lib_prefix=no + export_dynamic_flag_spec='${wl}-Blargedynsym' + runpath_var=LD_RUN_PATH + ;; + siemens) + need_lib_prefix=no + ;; + motorola) + need_lib_prefix=no + need_version=no + shlibpath_overrides_runpath=no + sys_lib_search_path_spec='/lib /usr/lib /usr/ccs/lib' + ;; + esac + ;; + +sysv4*MP*) + if test -d /usr/nec ;then + version_type=linux + library_names_spec='$libname${shared_ext}.$versuffix $libname${shared_ext}.$major $libname${shared_ext}' + soname_spec='$libname${shared_ext}.$major' + shlibpath_var=LD_LIBRARY_PATH + fi + ;; + +sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*) + version_type=freebsd-elf + need_lib_prefix=no + need_version=no + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + hardcode_into_libs=yes + if test "$with_gnu_ld" = yes; then + sys_lib_search_path_spec='/usr/local/lib /usr/gnu/lib /usr/ccs/lib /usr/lib /lib' + shlibpath_overrides_runpath=no + else + sys_lib_search_path_spec='/usr/ccs/lib /usr/lib' + shlibpath_overrides_runpath=yes + case $host_os in + sco3.2v5*) + sys_lib_search_path_spec="$sys_lib_search_path_spec /lib" + ;; + esac + fi + sys_lib_dlsearch_path_spec='/usr/lib' + ;; + +uts4*) + version_type=linux + library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}' + soname_spec='${libname}${release}${shared_ext}$major' + shlibpath_var=LD_LIBRARY_PATH + ;; + +*) + dynamic_linker=no + ;; +esac +echo "$as_me:$LINENO: result: $dynamic_linker" >&5 +echo "${ECHO_T}$dynamic_linker" >&6 +test "$dynamic_linker" = no && can_build_shared=no + +variables_saved_for_relink="PATH $shlibpath_var $runpath_var" +if test "$GCC" = yes; then + variables_saved_for_relink="$variables_saved_for_relink GCC_EXEC_PREFIX COMPILER_PATH LIBRARY_PATH" +fi + +echo "$as_me:$LINENO: checking how to hardcode library paths into programs" >&5 +echo $ECHO_N "checking how to hardcode library paths into programs... $ECHO_C" >&6 +hardcode_action_GCJ= +if test -n "$hardcode_libdir_flag_spec_GCJ" || \ + test -n "$runpath_var_GCJ" || \ + test "X$hardcode_automatic_GCJ" = "Xyes" ; then + + # We can hardcode non-existant directories. + if test "$hardcode_direct_GCJ" != no && + # If the only mechanism to avoid hardcoding is shlibpath_var, we + # have to relink, otherwise we might link with an installed library + # when we should be linking with a yet-to-be-installed one + ## test "$_LT_AC_TAGVAR(hardcode_shlibpath_var, GCJ)" != no && + test "$hardcode_minus_L_GCJ" != no; then + # Linking always hardcodes the temporary library directory. + hardcode_action_GCJ=relink + else + # We can link without hardcoding, and we can hardcode nonexisting dirs. + hardcode_action_GCJ=immediate + fi +else + # We cannot hardcode anything, or else we can only hardcode existing + # directories. + hardcode_action_GCJ=unsupported +fi +echo "$as_me:$LINENO: result: $hardcode_action_GCJ" >&5 +echo "${ECHO_T}$hardcode_action_GCJ" >&6 + +if test "$hardcode_action_GCJ" = relink; then + # Fast installation is not supported + enable_fast_install=no +elif test "$shlibpath_overrides_runpath" = yes || + test "$enable_shared" = no; then + # Fast installation is not necessary + enable_fast_install=needless +fi + + +# The else clause should only fire when bootstrapping the +# libtool distribution, otherwise you forgot to ship ltmain.sh +# with your package, and you will get complaints that there are +# no rules to generate ltmain.sh. +if test -f "$ltmain"; then + # See if we are running on zsh, and set the options which allow our commands through + # without removal of \ escapes. + if test -n "${ZSH_VERSION+set}" ; then + setopt NO_GLOB_SUBST + fi + # Now quote all the things that may contain metacharacters while being + # careful not to overquote the AC_SUBSTed values. We take copies of the + # variables and quote the copies for generation of the libtool script. + for var in echo old_CC old_CFLAGS AR AR_FLAGS EGREP RANLIB LN_S LTCC LTCFLAGS NM \ + SED SHELL STRIP \ + libname_spec library_names_spec soname_spec extract_expsyms_cmds \ + old_striplib striplib file_magic_cmd finish_cmds finish_eval \ + deplibs_check_method reload_flag reload_cmds need_locks \ + lt_cv_sys_global_symbol_pipe lt_cv_sys_global_symbol_to_cdecl \ + lt_cv_sys_global_symbol_to_c_name_address \ + sys_lib_search_path_spec sys_lib_dlsearch_path_spec \ + old_postinstall_cmds old_postuninstall_cmds \ + compiler_GCJ \ + CC_GCJ \ + LD_GCJ \ + lt_prog_compiler_wl_GCJ \ + lt_prog_compiler_pic_GCJ \ + lt_prog_compiler_static_GCJ \ + lt_prog_compiler_no_builtin_flag_GCJ \ + export_dynamic_flag_spec_GCJ \ + thread_safe_flag_spec_GCJ \ + whole_archive_flag_spec_GCJ \ + enable_shared_with_static_runtimes_GCJ \ + old_archive_cmds_GCJ \ + old_archive_from_new_cmds_GCJ \ + predep_objects_GCJ \ + postdep_objects_GCJ \ + predeps_GCJ \ + postdeps_GCJ \ + compiler_lib_search_path_GCJ \ + archive_cmds_GCJ \ + archive_expsym_cmds_GCJ \ + postinstall_cmds_GCJ \ + postuninstall_cmds_GCJ \ + old_archive_from_expsyms_cmds_GCJ \ + allow_undefined_flag_GCJ \ + no_undefined_flag_GCJ \ + export_symbols_cmds_GCJ \ + hardcode_libdir_flag_spec_GCJ \ + hardcode_libdir_flag_spec_ld_GCJ \ + hardcode_libdir_separator_GCJ \ + hardcode_automatic_GCJ \ + module_cmds_GCJ \ + module_expsym_cmds_GCJ \ + lt_cv_prog_compiler_c_o_GCJ \ + exclude_expsyms_GCJ \ + include_expsyms_GCJ; do + + case $var in + old_archive_cmds_GCJ | \ + old_archive_from_new_cmds_GCJ | \ + archive_cmds_GCJ | \ + archive_expsym_cmds_GCJ | \ + module_cmds_GCJ | \ + module_expsym_cmds_GCJ | \ + old_archive_from_expsyms_cmds_GCJ | \ + export_symbols_cmds_GCJ | \ + extract_expsyms_cmds | reload_cmds | finish_cmds | \ + postinstall_cmds | postuninstall_cmds | \ + old_postinstall_cmds | old_postuninstall_cmds | \ + sys_lib_search_path_spec | sys_lib_dlsearch_path_spec) + # Double-quote double-evaled strings. + eval "lt_$var=\\\"\`\$echo \"X\$$var\" | \$Xsed -e \"\$double_quote_subst\" -e \"\$sed_quote_subst\" -e \"\$delay_variable_subst\"\`\\\"" + ;; + *) + eval "lt_$var=\\\"\`\$echo \"X\$$var\" | \$Xsed -e \"\$sed_quote_subst\"\`\\\"" + ;; + esac + done + + case $lt_echo in + *'\$0 --fallback-echo"') + lt_echo=`$echo "X$lt_echo" | $Xsed -e 's/\\\\\\\$0 --fallback-echo"$/$0 --fallback-echo"/'` + ;; + esac + +cfgfile="$ofile" + + cat <<__EOF__ >> "$cfgfile" +# ### BEGIN LIBTOOL TAG CONFIG: $tagname + +# Libtool was configured on host `(hostname || uname -n) 2>/dev/null | sed 1q`: + +# Shell to use when invoking shell scripts. +SHELL=$lt_SHELL + +# Whether or not to build shared libraries. +build_libtool_libs=$enable_shared + +# Whether or not to build static libraries. +build_old_libs=$enable_static + +# Whether or not to add -lc for building shared libraries. +build_libtool_need_lc=$archive_cmds_need_lc_GCJ + +# Whether or not to disallow shared libs when runtime libs are static +allow_libtool_libs_with_static_runtimes=$enable_shared_with_static_runtimes_GCJ + +# Whether or not to optimize for fast installation. +fast_install=$enable_fast_install + +# The host system. +host_alias=$host_alias +host=$host +host_os=$host_os + +# The build system. +build_alias=$build_alias +build=$build +build_os=$build_os + +# An echo program that does not interpret backslashes. +echo=$lt_echo + +# The archiver. +AR=$lt_AR +AR_FLAGS=$lt_AR_FLAGS + +# A C compiler. +LTCC=$lt_LTCC + +# LTCC compiler flags. +LTCFLAGS=$lt_LTCFLAGS + +# A language-specific compiler. +CC=$lt_compiler_GCJ + +# Is the compiler the GNU C compiler? +with_gcc=$GCC_GCJ + +gcc_dir=\`gcc -print-file-name=. | $SED 's,/\.$,,'\` +gcc_ver=\`gcc -dumpversion\` + +# An ERE matcher. +EGREP=$lt_EGREP + +# The linker used to build libraries. +LD=$lt_LD_GCJ + +# Whether we need hard or soft links. +LN_S=$lt_LN_S + +# A BSD-compatible nm program. +NM=$lt_NM + +# A symbol stripping program +STRIP=$lt_STRIP + +# Used to examine libraries when file_magic_cmd begins "file" +MAGIC_CMD=$MAGIC_CMD + +# Used on cygwin: DLL creation program. +DLLTOOL="$DLLTOOL" + +# Used on cygwin: object dumper. +OBJDUMP="$OBJDUMP" + +# Used on cygwin: assembler. +AS="$AS" + +# The name of the directory that contains temporary libtool files. +objdir=$objdir + +# How to create reloadable object files. +reload_flag=$lt_reload_flag +reload_cmds=$lt_reload_cmds + +# How to pass a linker flag through the compiler. +wl=$lt_lt_prog_compiler_wl_GCJ + +# Object file suffix (normally "o"). +objext="$ac_objext" + +# Old archive suffix (normally "a"). +libext="$libext" + +# Shared library suffix (normally ".so"). +shrext_cmds='$shrext_cmds' + +# Executable file suffix (normally ""). +exeext="$exeext" + +# Additional compiler flags for building library objects. +pic_flag=$lt_lt_prog_compiler_pic_GCJ +pic_mode=$pic_mode + +# What is the maximum length of a command? +max_cmd_len=$lt_cv_sys_max_cmd_len + +# Does compiler simultaneously support -c and -o options? +compiler_c_o=$lt_lt_cv_prog_compiler_c_o_GCJ + +# Must we lock files when doing compilation? +need_locks=$lt_need_locks + +# Do we need the lib prefix for modules? +need_lib_prefix=$need_lib_prefix + +# Do we need a version for libraries? +need_version=$need_version + +# Whether dlopen is supported. +dlopen_support=$enable_dlopen + +# Whether dlopen of programs is supported. +dlopen_self=$enable_dlopen_self + +# Whether dlopen of statically linked programs is supported. +dlopen_self_static=$enable_dlopen_self_static + +# Compiler flag to prevent dynamic linking. +link_static_flag=$lt_lt_prog_compiler_static_GCJ + +# Compiler flag to turn off builtin functions. +no_builtin_flag=$lt_lt_prog_compiler_no_builtin_flag_GCJ + +# Compiler flag to allow reflexive dlopens. +export_dynamic_flag_spec=$lt_export_dynamic_flag_spec_GCJ + +# Compiler flag to generate shared objects directly from archives. +whole_archive_flag_spec=$lt_whole_archive_flag_spec_GCJ + +# Compiler flag to generate thread-safe objects. +thread_safe_flag_spec=$lt_thread_safe_flag_spec_GCJ + +# Library versioning type. +version_type=$version_type + +# Format of library name prefix. +libname_spec=$lt_libname_spec + +# List of archive names. First name is the real one, the rest are links. +# The last name is the one that the linker finds with -lNAME. +library_names_spec=$lt_library_names_spec + +# The coded name of the library, if different from the real name. +soname_spec=$lt_soname_spec + +# Commands used to build and install an old-style archive. +RANLIB=$lt_RANLIB +old_archive_cmds=$lt_old_archive_cmds_GCJ +old_postinstall_cmds=$lt_old_postinstall_cmds +old_postuninstall_cmds=$lt_old_postuninstall_cmds + +# Create an old-style archive from a shared archive. +old_archive_from_new_cmds=$lt_old_archive_from_new_cmds_GCJ + +# Create a temporary old-style archive to link instead of a shared archive. +old_archive_from_expsyms_cmds=$lt_old_archive_from_expsyms_cmds_GCJ + +# Commands used to build and install a shared archive. +archive_cmds=$lt_archive_cmds_GCJ +archive_expsym_cmds=$lt_archive_expsym_cmds_GCJ +postinstall_cmds=$lt_postinstall_cmds +postuninstall_cmds=$lt_postuninstall_cmds + +# Commands used to build a loadable module (assumed same as above if empty) +module_cmds=$lt_module_cmds_GCJ +module_expsym_cmds=$lt_module_expsym_cmds_GCJ + +# Commands to strip libraries. +old_striplib=$lt_old_striplib +striplib=$lt_striplib + +# Dependencies to place before the objects being linked to create a +# shared library. +predep_objects=\`echo $lt_predep_objects_GCJ | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\` + +# Dependencies to place after the objects being linked to create a +# shared library. +postdep_objects=\`echo $lt_postdep_objects_GCJ | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\` + +# Dependencies to place before the objects being linked to create a +# shared library. +predeps=$lt_predeps_GCJ + +# Dependencies to place after the objects being linked to create a +# shared library. +postdeps=$lt_postdeps_GCJ + +# The library search path used internally by the compiler when linking +# a shared library. +compiler_lib_search_path=\`echo $lt_compiler_lib_search_path_GCJ | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\` + +# Method to check whether dependent libraries are shared objects. +deplibs_check_method=$lt_deplibs_check_method + +# Command to use when deplibs_check_method == file_magic. +file_magic_cmd=$lt_file_magic_cmd + +# Flag that allows shared libraries with undefined symbols to be built. +allow_undefined_flag=$lt_allow_undefined_flag_GCJ + +# Flag that forces no undefined symbols. +no_undefined_flag=$lt_no_undefined_flag_GCJ + +# Commands used to finish a libtool library installation in a directory. +finish_cmds=$lt_finish_cmds + +# Same as above, but a single script fragment to be evaled but not shown. +finish_eval=$lt_finish_eval + +# Take the output of nm and produce a listing of raw symbols and C names. +global_symbol_pipe=$lt_lt_cv_sys_global_symbol_pipe + +# Transform the output of nm in a proper C declaration +global_symbol_to_cdecl=$lt_lt_cv_sys_global_symbol_to_cdecl + +# Transform the output of nm in a C name address pair +global_symbol_to_c_name_address=$lt_lt_cv_sys_global_symbol_to_c_name_address + +# This is the shared library runtime path variable. +runpath_var=$runpath_var + +# This is the shared library path variable. +shlibpath_var=$shlibpath_var + +# Is shlibpath searched before the hard-coded library search path? +shlibpath_overrides_runpath=$shlibpath_overrides_runpath + +# How to hardcode a shared library path into an executable. +hardcode_action=$hardcode_action_GCJ + +# Whether we should hardcode library paths into libraries. +hardcode_into_libs=$hardcode_into_libs + +# Flag to hardcode \$libdir into a binary during linking. +# This must work even if \$libdir does not exist. +hardcode_libdir_flag_spec=$lt_hardcode_libdir_flag_spec_GCJ + +# If ld is used when linking, flag to hardcode \$libdir into +# a binary during linking. This must work even if \$libdir does +# not exist. +hardcode_libdir_flag_spec_ld=$lt_hardcode_libdir_flag_spec_ld_GCJ + +# Whether we need a single -rpath flag with a separated argument. +hardcode_libdir_separator=$lt_hardcode_libdir_separator_GCJ + +# Set to yes if using DIR/libNAME${shared_ext} during linking hardcodes DIR into the +# resulting binary. +hardcode_direct=$hardcode_direct_GCJ + +# Set to yes if using the -LDIR flag during linking hardcodes DIR into the +# resulting binary. +hardcode_minus_L=$hardcode_minus_L_GCJ + +# Set to yes if using SHLIBPATH_VAR=DIR during linking hardcodes DIR into +# the resulting binary. +hardcode_shlibpath_var=$hardcode_shlibpath_var_GCJ + +# Set to yes if building a shared library automatically hardcodes DIR into the library +# and all subsequent libraries and executables linked against it. +hardcode_automatic=$hardcode_automatic_GCJ + +# Variables whose values should be saved in libtool wrapper scripts and +# restored at relink time. +variables_saved_for_relink="$variables_saved_for_relink" + +# Whether libtool must link a program against all its dependency libraries. +link_all_deplibs=$link_all_deplibs_GCJ + +# Compile-time system search path for libraries +sys_lib_search_path_spec=\`echo $lt_sys_lib_search_path_spec | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\` + +# Run-time system search path for libraries +sys_lib_dlsearch_path_spec=$lt_sys_lib_dlsearch_path_spec + +# Fix the shell variable \$srcfile for the compiler. +fix_srcfile_path="$fix_srcfile_path_GCJ" + +# Set to yes if exported symbols are required. +always_export_symbols=$always_export_symbols_GCJ + +# The commands to list exported symbols. +export_symbols_cmds=$lt_export_symbols_cmds_GCJ + +# The commands to extract the exported symbol list from a shared archive. +extract_expsyms_cmds=$lt_extract_expsyms_cmds + +# Symbols that should not be listed in the preloaded symbols. +exclude_expsyms=$lt_exclude_expsyms_GCJ + +# Symbols that must always be exported. +include_expsyms=$lt_include_expsyms_GCJ + +# ### END LIBTOOL TAG CONFIG: $tagname + +__EOF__ + + +else + # If there is no Makefile yet, we rely on a make rule to execute + # `config.status --recheck' to rerun these tests and create the + # libtool script then. + ltmain_in=`echo $ltmain | sed -e 's/\.sh$/.in/'` + if test -f "$ltmain_in"; then + test -f Makefile && make "$ltmain" + fi +fi + + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + +CC="$lt_save_CC" + + else + tagname="" + fi + ;; + + RC) + + + +# Source file extension for RC test sources. +ac_ext=rc + +# Object file extension for compiled RC test sources. +objext=o +objext_RC=$objext + +# Code to be used in simple compile tests +lt_simple_compile_test_code='sample MENU { MENUITEM "&Soup", 100, CHECKED }\n' + +# Code to be used in simple link tests +lt_simple_link_test_code="$lt_simple_compile_test_code" + +# ltmain only uses $CC for tagged configurations so make sure $CC is set. + +# If no C compiler was specified, use CC. +LTCC=${LTCC-"$CC"} + +# If no C compiler flags were specified, use CFLAGS. +LTCFLAGS=${LTCFLAGS-"$CFLAGS"} + +# Allow CC to be a program name with arguments. +compiler=$CC + + +# save warnings/boilerplate of simple test code +ac_outfile=conftest.$ac_objext +printf "$lt_simple_compile_test_code" >conftest.$ac_ext +eval "$ac_compile" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err +_lt_compiler_boilerplate=`cat conftest.err` +$rm conftest* + +ac_outfile=conftest.$ac_objext +printf "$lt_simple_link_test_code" >conftest.$ac_ext +eval "$ac_link" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err +_lt_linker_boilerplate=`cat conftest.err` +$rm conftest* + + +# Allow CC to be a program name with arguments. +lt_save_CC="$CC" +CC=${RC-"windres"} +compiler=$CC +compiler_RC=$CC +for cc_temp in $compiler""; do + case $cc_temp in + compile | *[\\/]compile | ccache | *[\\/]ccache ) ;; + distcc | *[\\/]distcc | purify | *[\\/]purify ) ;; + \-*) ;; + *) break;; + esac +done +cc_basename=`$echo "X$cc_temp" | $Xsed -e 's%.*/%%' -e "s%^$host_alias-%%"` + +lt_cv_prog_compiler_c_o_RC=yes + +# The else clause should only fire when bootstrapping the +# libtool distribution, otherwise you forgot to ship ltmain.sh +# with your package, and you will get complaints that there are +# no rules to generate ltmain.sh. +if test -f "$ltmain"; then + # See if we are running on zsh, and set the options which allow our commands through + # without removal of \ escapes. + if test -n "${ZSH_VERSION+set}" ; then + setopt NO_GLOB_SUBST + fi + # Now quote all the things that may contain metacharacters while being + # careful not to overquote the AC_SUBSTed values. We take copies of the + # variables and quote the copies for generation of the libtool script. + for var in echo old_CC old_CFLAGS AR AR_FLAGS EGREP RANLIB LN_S LTCC LTCFLAGS NM \ + SED SHELL STRIP \ + libname_spec library_names_spec soname_spec extract_expsyms_cmds \ + old_striplib striplib file_magic_cmd finish_cmds finish_eval \ + deplibs_check_method reload_flag reload_cmds need_locks \ + lt_cv_sys_global_symbol_pipe lt_cv_sys_global_symbol_to_cdecl \ + lt_cv_sys_global_symbol_to_c_name_address \ + sys_lib_search_path_spec sys_lib_dlsearch_path_spec \ + old_postinstall_cmds old_postuninstall_cmds \ + compiler_RC \ + CC_RC \ + LD_RC \ + lt_prog_compiler_wl_RC \ + lt_prog_compiler_pic_RC \ + lt_prog_compiler_static_RC \ + lt_prog_compiler_no_builtin_flag_RC \ + export_dynamic_flag_spec_RC \ + thread_safe_flag_spec_RC \ + whole_archive_flag_spec_RC \ + enable_shared_with_static_runtimes_RC \ + old_archive_cmds_RC \ + old_archive_from_new_cmds_RC \ + predep_objects_RC \ + postdep_objects_RC \ + predeps_RC \ + postdeps_RC \ + compiler_lib_search_path_RC \ + archive_cmds_RC \ + archive_expsym_cmds_RC \ + postinstall_cmds_RC \ + postuninstall_cmds_RC \ + old_archive_from_expsyms_cmds_RC \ + allow_undefined_flag_RC \ + no_undefined_flag_RC \ + export_symbols_cmds_RC \ + hardcode_libdir_flag_spec_RC \ + hardcode_libdir_flag_spec_ld_RC \ + hardcode_libdir_separator_RC \ + hardcode_automatic_RC \ + module_cmds_RC \ + module_expsym_cmds_RC \ + lt_cv_prog_compiler_c_o_RC \ + exclude_expsyms_RC \ + include_expsyms_RC; do + + case $var in + old_archive_cmds_RC | \ + old_archive_from_new_cmds_RC | \ + archive_cmds_RC | \ + archive_expsym_cmds_RC | \ + module_cmds_RC | \ + module_expsym_cmds_RC | \ + old_archive_from_expsyms_cmds_RC | \ + export_symbols_cmds_RC | \ + extract_expsyms_cmds | reload_cmds | finish_cmds | \ + postinstall_cmds | postuninstall_cmds | \ + old_postinstall_cmds | old_postuninstall_cmds | \ + sys_lib_search_path_spec | sys_lib_dlsearch_path_spec) + # Double-quote double-evaled strings. + eval "lt_$var=\\\"\`\$echo \"X\$$var\" | \$Xsed -e \"\$double_quote_subst\" -e \"\$sed_quote_subst\" -e \"\$delay_variable_subst\"\`\\\"" + ;; + *) + eval "lt_$var=\\\"\`\$echo \"X\$$var\" | \$Xsed -e \"\$sed_quote_subst\"\`\\\"" + ;; + esac + done + + case $lt_echo in + *'\$0 --fallback-echo"') + lt_echo=`$echo "X$lt_echo" | $Xsed -e 's/\\\\\\\$0 --fallback-echo"$/$0 --fallback-echo"/'` + ;; + esac + +cfgfile="$ofile" + + cat <<__EOF__ >> "$cfgfile" +# ### BEGIN LIBTOOL TAG CONFIG: $tagname + +# Libtool was configured on host `(hostname || uname -n) 2>/dev/null | sed 1q`: + +# Shell to use when invoking shell scripts. +SHELL=$lt_SHELL + +# Whether or not to build shared libraries. +build_libtool_libs=$enable_shared + +# Whether or not to build static libraries. +build_old_libs=$enable_static + +# Whether or not to add -lc for building shared libraries. +build_libtool_need_lc=$archive_cmds_need_lc_RC + +# Whether or not to disallow shared libs when runtime libs are static +allow_libtool_libs_with_static_runtimes=$enable_shared_with_static_runtimes_RC + +# Whether or not to optimize for fast installation. +fast_install=$enable_fast_install + +# The host system. +host_alias=$host_alias +host=$host +host_os=$host_os + +# The build system. +build_alias=$build_alias +build=$build +build_os=$build_os + +# An echo program that does not interpret backslashes. +echo=$lt_echo + +# The archiver. +AR=$lt_AR +AR_FLAGS=$lt_AR_FLAGS + +# A C compiler. +LTCC=$lt_LTCC + +# LTCC compiler flags. +LTCFLAGS=$lt_LTCFLAGS + +# A language-specific compiler. +CC=$lt_compiler_RC + +# Is the compiler the GNU C compiler? +with_gcc=$GCC_RC + +gcc_dir=\`gcc -print-file-name=. | $SED 's,/\.$,,'\` +gcc_ver=\`gcc -dumpversion\` + +# An ERE matcher. +EGREP=$lt_EGREP + +# The linker used to build libraries. +LD=$lt_LD_RC + +# Whether we need hard or soft links. +LN_S=$lt_LN_S + +# A BSD-compatible nm program. +NM=$lt_NM + +# A symbol stripping program +STRIP=$lt_STRIP + +# Used to examine libraries when file_magic_cmd begins "file" +MAGIC_CMD=$MAGIC_CMD + +# Used on cygwin: DLL creation program. +DLLTOOL="$DLLTOOL" + +# Used on cygwin: object dumper. +OBJDUMP="$OBJDUMP" + +# Used on cygwin: assembler. +AS="$AS" + +# The name of the directory that contains temporary libtool files. +objdir=$objdir + +# How to create reloadable object files. +reload_flag=$lt_reload_flag +reload_cmds=$lt_reload_cmds + +# How to pass a linker flag through the compiler. +wl=$lt_lt_prog_compiler_wl_RC + +# Object file suffix (normally "o"). +objext="$ac_objext" + +# Old archive suffix (normally "a"). +libext="$libext" + +# Shared library suffix (normally ".so"). +shrext_cmds='$shrext_cmds' + +# Executable file suffix (normally ""). +exeext="$exeext" + +# Additional compiler flags for building library objects. +pic_flag=$lt_lt_prog_compiler_pic_RC +pic_mode=$pic_mode + +# What is the maximum length of a command? +max_cmd_len=$lt_cv_sys_max_cmd_len + +# Does compiler simultaneously support -c and -o options? +compiler_c_o=$lt_lt_cv_prog_compiler_c_o_RC + +# Must we lock files when doing compilation? +need_locks=$lt_need_locks + +# Do we need the lib prefix for modules? +need_lib_prefix=$need_lib_prefix + +# Do we need a version for libraries? +need_version=$need_version + +# Whether dlopen is supported. +dlopen_support=$enable_dlopen + +# Whether dlopen of programs is supported. +dlopen_self=$enable_dlopen_self + +# Whether dlopen of statically linked programs is supported. +dlopen_self_static=$enable_dlopen_self_static + +# Compiler flag to prevent dynamic linking. +link_static_flag=$lt_lt_prog_compiler_static_RC + +# Compiler flag to turn off builtin functions. +no_builtin_flag=$lt_lt_prog_compiler_no_builtin_flag_RC + +# Compiler flag to allow reflexive dlopens. +export_dynamic_flag_spec=$lt_export_dynamic_flag_spec_RC + +# Compiler flag to generate shared objects directly from archives. +whole_archive_flag_spec=$lt_whole_archive_flag_spec_RC + +# Compiler flag to generate thread-safe objects. +thread_safe_flag_spec=$lt_thread_safe_flag_spec_RC + +# Library versioning type. +version_type=$version_type + +# Format of library name prefix. +libname_spec=$lt_libname_spec + +# List of archive names. First name is the real one, the rest are links. +# The last name is the one that the linker finds with -lNAME. +library_names_spec=$lt_library_names_spec + +# The coded name of the library, if different from the real name. +soname_spec=$lt_soname_spec + +# Commands used to build and install an old-style archive. +RANLIB=$lt_RANLIB +old_archive_cmds=$lt_old_archive_cmds_RC +old_postinstall_cmds=$lt_old_postinstall_cmds +old_postuninstall_cmds=$lt_old_postuninstall_cmds + +# Create an old-style archive from a shared archive. +old_archive_from_new_cmds=$lt_old_archive_from_new_cmds_RC + +# Create a temporary old-style archive to link instead of a shared archive. +old_archive_from_expsyms_cmds=$lt_old_archive_from_expsyms_cmds_RC + +# Commands used to build and install a shared archive. +archive_cmds=$lt_archive_cmds_RC +archive_expsym_cmds=$lt_archive_expsym_cmds_RC +postinstall_cmds=$lt_postinstall_cmds +postuninstall_cmds=$lt_postuninstall_cmds + +# Commands used to build a loadable module (assumed same as above if empty) +module_cmds=$lt_module_cmds_RC +module_expsym_cmds=$lt_module_expsym_cmds_RC + +# Commands to strip libraries. +old_striplib=$lt_old_striplib +striplib=$lt_striplib + +# Dependencies to place before the objects being linked to create a +# shared library. +predep_objects=\`echo $lt_predep_objects_RC | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\` + +# Dependencies to place after the objects being linked to create a +# shared library. +postdep_objects=\`echo $lt_postdep_objects_RC | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\` + +# Dependencies to place before the objects being linked to create a +# shared library. +predeps=$lt_predeps_RC + +# Dependencies to place after the objects being linked to create a +# shared library. +postdeps=$lt_postdeps_RC + +# The library search path used internally by the compiler when linking +# a shared library. +compiler_lib_search_path=\`echo $lt_compiler_lib_search_path_RC | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\` + +# Method to check whether dependent libraries are shared objects. +deplibs_check_method=$lt_deplibs_check_method + +# Command to use when deplibs_check_method == file_magic. +file_magic_cmd=$lt_file_magic_cmd + +# Flag that allows shared libraries with undefined symbols to be built. +allow_undefined_flag=$lt_allow_undefined_flag_RC + +# Flag that forces no undefined symbols. +no_undefined_flag=$lt_no_undefined_flag_RC + +# Commands used to finish a libtool library installation in a directory. +finish_cmds=$lt_finish_cmds + +# Same as above, but a single script fragment to be evaled but not shown. +finish_eval=$lt_finish_eval + +# Take the output of nm and produce a listing of raw symbols and C names. +global_symbol_pipe=$lt_lt_cv_sys_global_symbol_pipe + +# Transform the output of nm in a proper C declaration +global_symbol_to_cdecl=$lt_lt_cv_sys_global_symbol_to_cdecl + +# Transform the output of nm in a C name address pair +global_symbol_to_c_name_address=$lt_lt_cv_sys_global_symbol_to_c_name_address + +# This is the shared library runtime path variable. +runpath_var=$runpath_var + +# This is the shared library path variable. +shlibpath_var=$shlibpath_var + +# Is shlibpath searched before the hard-coded library search path? +shlibpath_overrides_runpath=$shlibpath_overrides_runpath + +# How to hardcode a shared library path into an executable. +hardcode_action=$hardcode_action_RC + +# Whether we should hardcode library paths into libraries. +hardcode_into_libs=$hardcode_into_libs + +# Flag to hardcode \$libdir into a binary during linking. +# This must work even if \$libdir does not exist. +hardcode_libdir_flag_spec=$lt_hardcode_libdir_flag_spec_RC + +# If ld is used when linking, flag to hardcode \$libdir into +# a binary during linking. This must work even if \$libdir does +# not exist. +hardcode_libdir_flag_spec_ld=$lt_hardcode_libdir_flag_spec_ld_RC + +# Whether we need a single -rpath flag with a separated argument. +hardcode_libdir_separator=$lt_hardcode_libdir_separator_RC + +# Set to yes if using DIR/libNAME${shared_ext} during linking hardcodes DIR into the +# resulting binary. +hardcode_direct=$hardcode_direct_RC + +# Set to yes if using the -LDIR flag during linking hardcodes DIR into the +# resulting binary. +hardcode_minus_L=$hardcode_minus_L_RC + +# Set to yes if using SHLIBPATH_VAR=DIR during linking hardcodes DIR into +# the resulting binary. +hardcode_shlibpath_var=$hardcode_shlibpath_var_RC + +# Set to yes if building a shared library automatically hardcodes DIR into the library +# and all subsequent libraries and executables linked against it. +hardcode_automatic=$hardcode_automatic_RC + +# Variables whose values should be saved in libtool wrapper scripts and +# restored at relink time. +variables_saved_for_relink="$variables_saved_for_relink" + +# Whether libtool must link a program against all its dependency libraries. +link_all_deplibs=$link_all_deplibs_RC + +# Compile-time system search path for libraries +sys_lib_search_path_spec=\`echo $lt_sys_lib_search_path_spec | \$SED -e "s@\${gcc_dir}@\\\${gcc_dir}@g;s@\${gcc_ver}@\\\${gcc_ver}@g"\` + +# Run-time system search path for libraries +sys_lib_dlsearch_path_spec=$lt_sys_lib_dlsearch_path_spec + +# Fix the shell variable \$srcfile for the compiler. +fix_srcfile_path="$fix_srcfile_path_RC" + +# Set to yes if exported symbols are required. +always_export_symbols=$always_export_symbols_RC + +# The commands to list exported symbols. +export_symbols_cmds=$lt_export_symbols_cmds_RC + +# The commands to extract the exported symbol list from a shared archive. +extract_expsyms_cmds=$lt_extract_expsyms_cmds + +# Symbols that should not be listed in the preloaded symbols. +exclude_expsyms=$lt_exclude_expsyms_RC + +# Symbols that must always be exported. +include_expsyms=$lt_include_expsyms_RC + +# ### END LIBTOOL TAG CONFIG: $tagname + +__EOF__ + + +else + # If there is no Makefile yet, we rely on a make rule to execute + # `config.status --recheck' to rerun these tests and create the + # libtool script then. + ltmain_in=`echo $ltmain | sed -e 's/\.sh$/.in/'` + if test -f "$ltmain_in"; then + test -f Makefile && make "$ltmain" + fi +fi + + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + +CC="$lt_save_CC" + + ;; + + *) + { { echo "$as_me:$LINENO: error: Unsupported tag name: $tagname" >&5 +echo "$as_me: error: Unsupported tag name: $tagname" >&2;} + { (exit 1); exit 1; }; } + ;; + esac + + # Append the new tag name to the list of available tags. + if test -n "$tagname" ; then + available_tags="$available_tags $tagname" + fi + fi + done + IFS="$lt_save_ifs" + + # Now substitute the updated list of available tags. + if eval "sed -e 's/^available_tags=.*\$/available_tags=\"$available_tags\"/' \"$ofile\" > \"${ofile}T\""; then + mv "${ofile}T" "$ofile" + chmod +x "$ofile" + else + rm -f "${ofile}T" + { { echo "$as_me:$LINENO: error: unable to update list of available tagged configurations." >&5 +echo "$as_me: error: unable to update list of available tagged configurations." >&2;} + { (exit 1); exit 1; }; } + fi +fi + + + +# This can be used to rebuild libtool when needed +LIBTOOL_DEPS="$ac_aux_dir/ltmain.sh" + +# Always use our own libtool. +LIBTOOL='$(SHELL) $(top_builddir)/libtool' + +# Prevent multiple expansion + + + + + + + + + + + + + + + + + + + + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu +if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}gcc", so it can be a program name with args. +set dummy ${ac_tool_prefix}gcc; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$CC"; then + ac_cv_prog_CC="$CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_CC="${ac_tool_prefix}gcc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +CC=$ac_cv_prog_CC +if test -n "$CC"; then + echo "$as_me:$LINENO: result: $CC" >&5 +echo "${ECHO_T}$CC" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + +fi +if test -z "$ac_cv_prog_CC"; then + ac_ct_CC=$CC + # Extract the first word of "gcc", so it can be a program name with args. +set dummy gcc; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_ac_ct_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_CC"; then + ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_CC="gcc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +ac_ct_CC=$ac_cv_prog_ac_ct_CC +if test -n "$ac_ct_CC"; then + echo "$as_me:$LINENO: result: $ac_ct_CC" >&5 +echo "${ECHO_T}$ac_ct_CC" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + CC=$ac_ct_CC +else + CC="$ac_cv_prog_CC" +fi + +if test -z "$CC"; then + if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}cc", so it can be a program name with args. +set dummy ${ac_tool_prefix}cc; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$CC"; then + ac_cv_prog_CC="$CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_CC="${ac_tool_prefix}cc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +CC=$ac_cv_prog_CC +if test -n "$CC"; then + echo "$as_me:$LINENO: result: $CC" >&5 +echo "${ECHO_T}$CC" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + +fi +if test -z "$ac_cv_prog_CC"; then + ac_ct_CC=$CC + # Extract the first word of "cc", so it can be a program name with args. +set dummy cc; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_ac_ct_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_CC"; then + ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_CC="cc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +ac_ct_CC=$ac_cv_prog_ac_ct_CC +if test -n "$ac_ct_CC"; then + echo "$as_me:$LINENO: result: $ac_ct_CC" >&5 +echo "${ECHO_T}$ac_ct_CC" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + CC=$ac_ct_CC +else + CC="$ac_cv_prog_CC" +fi + +fi +if test -z "$CC"; then + # Extract the first word of "cc", so it can be a program name with args. +set dummy cc; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$CC"; then + ac_cv_prog_CC="$CC" # Let the user override the test. +else + ac_prog_rejected=no +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + if test "$as_dir/$ac_word$ac_exec_ext" = "/usr/ucb/cc"; then + ac_prog_rejected=yes + continue + fi + ac_cv_prog_CC="cc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +if test $ac_prog_rejected = yes; then + # We found a bogon in the path, so make sure we never use it. + set dummy $ac_cv_prog_CC + shift + if test $# != 0; then + # We chose a different compiler from the bogus one. + # However, it has the same basename, so the bogon will be chosen + # first if we set CC to just the basename; use the full file name. + shift + ac_cv_prog_CC="$as_dir/$ac_word${1+' '}$@" + fi +fi +fi +fi +CC=$ac_cv_prog_CC +if test -n "$CC"; then + echo "$as_me:$LINENO: result: $CC" >&5 +echo "${ECHO_T}$CC" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + +fi +if test -z "$CC"; then + if test -n "$ac_tool_prefix"; then + for ac_prog in cl + do + # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args. +set dummy $ac_tool_prefix$ac_prog; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$CC"; then + ac_cv_prog_CC="$CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_CC="$ac_tool_prefix$ac_prog" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +CC=$ac_cv_prog_CC +if test -n "$CC"; then + echo "$as_me:$LINENO: result: $CC" >&5 +echo "${ECHO_T}$CC" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + test -n "$CC" && break + done +fi +if test -z "$CC"; then + ac_ct_CC=$CC + for ac_prog in cl +do + # Extract the first word of "$ac_prog", so it can be a program name with args. +set dummy $ac_prog; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_ac_ct_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_CC"; then + ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_CC="$ac_prog" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +ac_ct_CC=$ac_cv_prog_ac_ct_CC +if test -n "$ac_ct_CC"; then + echo "$as_me:$LINENO: result: $ac_ct_CC" >&5 +echo "${ECHO_T}$ac_ct_CC" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + test -n "$ac_ct_CC" && break +done + + CC=$ac_ct_CC +fi + +fi + + +test -z "$CC" && { { echo "$as_me:$LINENO: error: no acceptable C compiler found in \$PATH +See \`config.log' for more details." >&5 +echo "$as_me: error: no acceptable C compiler found in \$PATH +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } + +# Provide some information about the compiler. +echo "$as_me:$LINENO:" \ + "checking for C compiler version" >&5 +ac_compiler=`set X $ac_compile; echo $2` +{ (eval echo "$as_me:$LINENO: \"$ac_compiler --version </dev/null >&5\"") >&5 + (eval $ac_compiler --version </dev/null >&5) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } +{ (eval echo "$as_me:$LINENO: \"$ac_compiler -v </dev/null >&5\"") >&5 + (eval $ac_compiler -v </dev/null >&5) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } +{ (eval echo "$as_me:$LINENO: \"$ac_compiler -V </dev/null >&5\"") >&5 + (eval $ac_compiler -V </dev/null >&5) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } + +echo "$as_me:$LINENO: checking whether we are using the GNU C compiler" >&5 +echo $ECHO_N "checking whether we are using the GNU C compiler... $ECHO_C" >&6 +if test "${ac_cv_c_compiler_gnu+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ +#ifndef __GNUC__ + choke me +#endif + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_compiler_gnu=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_compiler_gnu=no +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext +ac_cv_c_compiler_gnu=$ac_compiler_gnu + +fi +echo "$as_me:$LINENO: result: $ac_cv_c_compiler_gnu" >&5 +echo "${ECHO_T}$ac_cv_c_compiler_gnu" >&6 +GCC=`test $ac_compiler_gnu = yes && echo yes` +ac_test_CFLAGS=${CFLAGS+set} +ac_save_CFLAGS=$CFLAGS +CFLAGS="-g" +echo "$as_me:$LINENO: checking whether $CC accepts -g" >&5 +echo $ECHO_N "checking whether $CC accepts -g... $ECHO_C" >&6 +if test "${ac_cv_prog_cc_g+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_prog_cc_g=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_prog_cc_g=no +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: $ac_cv_prog_cc_g" >&5 +echo "${ECHO_T}$ac_cv_prog_cc_g" >&6 +if test "$ac_test_CFLAGS" = set; then + CFLAGS=$ac_save_CFLAGS +elif test $ac_cv_prog_cc_g = yes; then + if test "$GCC" = yes; then + CFLAGS="-g -O2" + else + CFLAGS="-g" + fi +else + if test "$GCC" = yes; then + CFLAGS="-O2" + else + CFLAGS= + fi +fi +echo "$as_me:$LINENO: checking for $CC option to accept ANSI C" >&5 +echo $ECHO_N "checking for $CC option to accept ANSI C... $ECHO_C" >&6 +if test "${ac_cv_prog_cc_stdc+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_cv_prog_cc_stdc=no +ac_save_CC=$CC +cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include <stdarg.h> +#include <stdio.h> +#include <sys/types.h> +#include <sys/stat.h> +/* Most of the following tests are stolen from RCS 5.7's src/conf.sh. */ +struct buf { int x; }; +FILE * (*rcsopen) (struct buf *, struct stat *, int); +static char *e (p, i) + char **p; + int i; +{ + return p[i]; +} +static char *f (char * (*g) (char **, int), char **p, ...) +{ + char *s; + va_list v; + va_start (v,p); + s = g (p, va_arg (v,int)); + va_end (v); + return s; +} + +/* OSF 4.0 Compaq cc is some sort of almost-ANSI by default. It has + function prototypes and stuff, but not '\xHH' hex character constants. + These don't provoke an error unfortunately, instead are silently treated + as 'x'. The following induces an error, until -std1 is added to get + proper ANSI mode. Curiously '\x00'!='x' always comes out true, for an + array size at least. It's necessary to write '\x00'==0 to get something + that's true only with -std1. */ +int osf4_cc_array ['\x00' == 0 ? 1 : -1]; + +int test (int i, double x); +struct s1 {int (*f) (int a);}; +struct s2 {int (*f) (double a);}; +int pairnames (int, char **, FILE *(*)(struct buf *, struct stat *, int), int, int); +int argc; +char **argv; +int +main () +{ +return f (e, argv, 0) != argv[0] || f (e, argv, 1) != argv[1]; + ; + return 0; +} +_ACEOF +# Don't try gcc -ansi; that turns off useful extensions and +# breaks some systems' header files. +# AIX -qlanglvl=ansi +# Ultrix and OSF/1 -std1 +# HP-UX 10.20 and later -Ae +# HP-UX older versions -Aa -D_HPUX_SOURCE +# SVR4 -Xc -D__EXTENSIONS__ +for ac_arg in "" -qlanglvl=ansi -std1 -Ae "-Aa -D_HPUX_SOURCE" "-Xc -D__EXTENSIONS__" +do + CC="$ac_save_CC $ac_arg" + rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_prog_cc_stdc=$ac_arg +break +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +fi +rm -f conftest.err conftest.$ac_objext +done +rm -f conftest.$ac_ext conftest.$ac_objext +CC=$ac_save_CC + +fi + +case "x$ac_cv_prog_cc_stdc" in + x|xno) + echo "$as_me:$LINENO: result: none needed" >&5 +echo "${ECHO_T}none needed" >&6 ;; + *) + echo "$as_me:$LINENO: result: $ac_cv_prog_cc_stdc" >&5 +echo "${ECHO_T}$ac_cv_prog_cc_stdc" >&6 + CC="$CC $ac_cv_prog_cc_stdc" ;; +esac + +# Some people use a C++ compiler to compile C. Since we use `exit', +# in C++ we need to declare it. In case someone uses the same compiler +# for both compiling C and C++ we need to have the C++ compiler decide +# the declaration of exit, since it's the most demanding environment. +cat >conftest.$ac_ext <<_ACEOF +#ifndef __cplusplus + choke me +#endif +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + for ac_declaration in \ + '' \ + 'extern "C" void std::exit (int) throw (); using std::exit;' \ + 'extern "C" void std::exit (int); using std::exit;' \ + 'extern "C" void exit (int) throw ();' \ + 'extern "C" void exit (int);' \ + 'void exit (int);' +do + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_declaration +#include <stdlib.h> +int +main () +{ +exit (42); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + : +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +continue +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_declaration +int +main () +{ +exit (42); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + break +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext +done +rm -f conftest* +if test -n "$ac_declaration"; then + echo '#ifdef __cplusplus' >>confdefs.h + echo $ac_declaration >>confdefs.h + echo '#endif' >>confdefs.h +fi + +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + +depcc="$CC" am_compiler_list= + +echo "$as_me:$LINENO: checking dependency style of $depcc" >&5 +echo $ECHO_N "checking dependency style of $depcc... $ECHO_C" >&6 +if test "${am_cv_CC_dependencies_compiler_type+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -z "$AMDEP_TRUE" && test -f "$am_depcomp"; then + # We make a subdir and do the tests there. Otherwise we can end up + # making bogus files that we don't know about and never remove. For + # instance it was reported that on HP-UX the gcc test will end up + # making a dummy file named `D' -- because `-MD' means `put the output + # in D'. + mkdir conftest.dir + # Copy depcomp to subdir because otherwise we won't find it if we're + # using a relative directory. + cp "$am_depcomp" conftest.dir + cd conftest.dir + # We will build objects and dependencies in a subdirectory because + # it helps to detect inapplicable dependency modes. For instance + # both Tru64's cc and ICC support -MD to output dependencies as a + # side effect of compilation, but ICC will put the dependencies in + # the current directory while Tru64 will put them in the object + # directory. + mkdir sub + + am_cv_CC_dependencies_compiler_type=none + if test "$am_compiler_list" = ""; then + am_compiler_list=`sed -n 's/^#*\([a-zA-Z0-9]*\))$/\1/p' < ./depcomp` + fi + for depmode in $am_compiler_list; do + # Setup a source with many dependencies, because some compilers + # like to wrap large dependency lists on column 80 (with \), and + # we should not choose a depcomp mode which is confused by this. + # + # We need to recreate these files for each test, as the compiler may + # overwrite some of them when testing with obscure command lines. + # This happens at least with the AIX C compiler. + : > sub/conftest.c + for i in 1 2 3 4 5 6; do + echo '#include "conftst'$i'.h"' >> sub/conftest.c + # Using `: > sub/conftst$i.h' creates only sub/conftst1.h with + # Solaris 8's {/usr,}/bin/sh. + touch sub/conftst$i.h + done + echo "${am__include} ${am__quote}sub/conftest.Po${am__quote}" > confmf + + case $depmode in + nosideeffect) + # after this tag, mechanisms are not by side-effect, so they'll + # only be used when explicitly requested + if test "x$enable_dependency_tracking" = xyes; then + continue + else + break + fi + ;; + none) break ;; + esac + # We check with `-c' and `-o' for the sake of the "dashmstdout" + # mode. It turns out that the SunPro C++ compiler does not properly + # handle `-M -o', and we need to detect this. + if depmode=$depmode \ + source=sub/conftest.c object=sub/conftest.${OBJEXT-o} \ + depfile=sub/conftest.Po tmpdepfile=sub/conftest.TPo \ + $SHELL ./depcomp $depcc -c -o sub/conftest.${OBJEXT-o} sub/conftest.c \ + >/dev/null 2>conftest.err && + grep sub/conftst6.h sub/conftest.Po > /dev/null 2>&1 && + grep sub/conftest.${OBJEXT-o} sub/conftest.Po > /dev/null 2>&1 && + ${MAKE-make} -s -f confmf > /dev/null 2>&1; then + # icc doesn't choke on unknown options, it will just issue warnings + # or remarks (even with -Werror). So we grep stderr for any message + # that says an option was ignored or not supported. + # When given -MP, icc 7.0 and 7.1 complain thusly: + # icc: Command line warning: ignoring option '-M'; no argument required + # The diagnosis changed in icc 8.0: + # icc: Command line remark: option '-MP' not supported + if (grep 'ignoring option' conftest.err || + grep 'not supported' conftest.err) >/dev/null 2>&1; then :; else + am_cv_CC_dependencies_compiler_type=$depmode + break + fi + fi + done + + cd .. + rm -rf conftest.dir +else + am_cv_CC_dependencies_compiler_type=none +fi + +fi +echo "$as_me:$LINENO: result: $am_cv_CC_dependencies_compiler_type" >&5 +echo "${ECHO_T}$am_cv_CC_dependencies_compiler_type" >&6 +CCDEPMODE=depmode=$am_cv_CC_dependencies_compiler_type + + + +if + test "x$enable_dependency_tracking" != xno \ + && test "$am_cv_CC_dependencies_compiler_type" = gcc3; then + am__fastdepCC_TRUE= + am__fastdepCC_FALSE='#' +else + am__fastdepCC_TRUE='#' + am__fastdepCC_FALSE= +fi + + + + + + +#AC_DEFINE(XFree86LOADER,1,[Stub define for loadable drivers]) +# +#AC_ARG_ENABLE(XINPUT, AS_HELP_STRING([--enable-xinput], +# [Build XInput support (default: yes)]), +# [XINPUT=$enableval],[XINPUT=yes]) +#AM_CONDITIONAL(XINPUT, test "x$XINPUT" = "xyes") +#if test "x$XINPUT" = "xyes" ; then +# AC_DEFINE(XINPUT,1,[Enable XInput support]) +#fi +# +#AC_ARG_ENABLE(XKB, AS_HELP_STRING([--enable-xkb], +# [Build XKB support (default: yes)]), +# [XKB=$enableval],[XKB=yes]) +#AM_CONDITIONAL(XKB, test "x$XKB" = "xyes") +#if test "x$XKB" = "xyes" ; then +# AC_DEFINE(XKB,1,[Enable XKB support]) +#fi + + +# Check whether --with-xorg-module-dir or --without-xorg-module-dir was given. +if test "${with_xorg_module_dir+set}" = set; then + withval="$with_xorg_module_dir" + moduledir="$withval" +else + moduledir="$libdir/xorg/modules" +fi; +inputdir=${moduledir}/input + + +# Checks for extensions + + SAVE_CFLAGS="$CFLAGS" + CFLAGS="$CFLAGS -I`pkg-config --variable=sdkdir xorg-server`" + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +#include "xorg-server.h" +#if !defined RANDR +#error RANDR not defined +#endif + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + _EXT_CHECK=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +_EXT_CHECK=no +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext + CFLAGS="$SAVE_CFLAGS" + echo "$as_me:$LINENO: checking if RANDR is defined" >&5 +echo $ECHO_N "checking if RANDR is defined... $ECHO_C" >&6 + echo "$as_me:$LINENO: result: $_EXT_CHECK" >&5 +echo "${ECHO_T}$_EXT_CHECK" >&6 + if test "$_EXT_CHECK" != no; then + REQUIRED_MODULES="$REQUIRED_MODULES randrproto" + fi + + + SAVE_CFLAGS="$CFLAGS" + CFLAGS="$CFLAGS -I`pkg-config --variable=sdkdir xorg-server`" + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +#include "xorg-server.h" +#if !defined XINPUT +#error XINPUT not defined +#endif + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + _EXT_CHECK=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +_EXT_CHECK=no +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext + CFLAGS="$SAVE_CFLAGS" + echo "$as_me:$LINENO: checking if XINPUT is defined" >&5 +echo $ECHO_N "checking if XINPUT is defined... $ECHO_C" >&6 + echo "$as_me:$LINENO: result: $_EXT_CHECK" >&5 +echo "${ECHO_T}$_EXT_CHECK" >&6 + if test "$_EXT_CHECK" != no; then + REQUIRED_MODULES="$REQUIRED_MODULES inputproto" + fi + + +# Checks for pkg-config packages + + +if test "x$ac_cv_env_PKG_CONFIG_set" != "xset"; then + if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}pkg-config", so it can be a program name with args. +set dummy ${ac_tool_prefix}pkg-config; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_path_PKG_CONFIG+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + case $PKG_CONFIG in + [\\/]* | ?:[\\/]*) + ac_cv_path_PKG_CONFIG="$PKG_CONFIG" # Let the user override the test with a path. + ;; + *) + as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_path_PKG_CONFIG="$as_dir/$ac_word$ac_exec_ext" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + + ;; +esac +fi +PKG_CONFIG=$ac_cv_path_PKG_CONFIG + +if test -n "$PKG_CONFIG"; then + echo "$as_me:$LINENO: result: $PKG_CONFIG" >&5 +echo "${ECHO_T}$PKG_CONFIG" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + +fi +if test -z "$ac_cv_path_PKG_CONFIG"; then + ac_pt_PKG_CONFIG=$PKG_CONFIG + # Extract the first word of "pkg-config", so it can be a program name with args. +set dummy pkg-config; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_path_ac_pt_PKG_CONFIG+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + case $ac_pt_PKG_CONFIG in + [\\/]* | ?:[\\/]*) + ac_cv_path_ac_pt_PKG_CONFIG="$ac_pt_PKG_CONFIG" # Let the user override the test with a path. + ;; + *) + as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_path_ac_pt_PKG_CONFIG="$as_dir/$ac_word$ac_exec_ext" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + + ;; +esac +fi +ac_pt_PKG_CONFIG=$ac_cv_path_ac_pt_PKG_CONFIG + +if test -n "$ac_pt_PKG_CONFIG"; then + echo "$as_me:$LINENO: result: $ac_pt_PKG_CONFIG" >&5 +echo "${ECHO_T}$ac_pt_PKG_CONFIG" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + PKG_CONFIG=$ac_pt_PKG_CONFIG +else + PKG_CONFIG="$ac_cv_path_PKG_CONFIG" +fi + +fi +if test -n "$PKG_CONFIG"; then + _pkg_min_version=0.9.0 + echo "$as_me:$LINENO: checking pkg-config is at least version $_pkg_min_version" >&5 +echo $ECHO_N "checking pkg-config is at least version $_pkg_min_version... $ECHO_C" >&6 + if $PKG_CONFIG --atleast-pkgconfig-version $_pkg_min_version; then + echo "$as_me:$LINENO: result: yes" >&5 +echo "${ECHO_T}yes" >&6 + else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 + PKG_CONFIG="" + fi + +fi + +pkg_failed=no +echo "$as_me:$LINENO: checking for XORG" >&5 +echo $ECHO_N "checking for XORG... $ECHO_C" >&6 + +if test -n "$PKG_CONFIG"; then + if test -n "$XORG_CFLAGS"; then + pkg_cv_XORG_CFLAGS="$XORG_CFLAGS" + else + if test -n "$PKG_CONFIG" && \ + { (echo "$as_me:$LINENO: \$PKG_CONFIG --exists --print-errors \"xorg-server >= 1.0.99.901 xproto \$REQUIRED_MODULES\"") >&5 + ($PKG_CONFIG --exists --print-errors "xorg-server >= 1.0.99.901 xproto $REQUIRED_MODULES") 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + pkg_cv_XORG_CFLAGS=`$PKG_CONFIG --cflags "xorg-server >= 1.0.99.901 xproto $REQUIRED_MODULES" 2>/dev/null` +else + pkg_failed=yes +fi + fi +else + pkg_failed=untried +fi +if test -n "$PKG_CONFIG"; then + if test -n "$XORG_LIBS"; then + pkg_cv_XORG_LIBS="$XORG_LIBS" + else + if test -n "$PKG_CONFIG" && \ + { (echo "$as_me:$LINENO: \$PKG_CONFIG --exists --print-errors \"xorg-server >= 1.0.99.901 xproto \$REQUIRED_MODULES\"") >&5 + ($PKG_CONFIG --exists --print-errors "xorg-server >= 1.0.99.901 xproto $REQUIRED_MODULES") 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + pkg_cv_XORG_LIBS=`$PKG_CONFIG --libs "xorg-server >= 1.0.99.901 xproto $REQUIRED_MODULES" 2>/dev/null` +else + pkg_failed=yes +fi + fi +else + pkg_failed=untried +fi + + + +if test $pkg_failed = yes; then + +if $PKG_CONFIG --atleast-pkgconfig-version 0.20; then + _pkg_short_errors_supported=yes +else + _pkg_short_errors_supported=no +fi + if test $_pkg_short_errors_supported = yes; then + XORG_PKG_ERRORS=`$PKG_CONFIG --short-errors --errors-to-stdout --print-errors "xorg-server >= 1.0.99.901 xproto $REQUIRED_MODULES"` + else + XORG_PKG_ERRORS=`$PKG_CONFIG --errors-to-stdout --print-errors "xorg-server >= 1.0.99.901 xproto $REQUIRED_MODULES"` + fi + # Put the nasty error message in config.log where it belongs + echo "$XORG_PKG_ERRORS" >&5 + + { { echo "$as_me:$LINENO: error: Package requirements (xorg-server >= 1.0.99.901 xproto $REQUIRED_MODULES) were not met: + +$XORG_PKG_ERRORS + +Consider adjusting the PKG_CONFIG_PATH environment variable if you +installed software in a non-standard prefix. + +Alternatively, you may set the environment variables XORG_CFLAGS +and XORG_LIBS to avoid the need to call pkg-config. +See the pkg-config man page for more details. +" >&5 +echo "$as_me: error: Package requirements (xorg-server >= 1.0.99.901 xproto $REQUIRED_MODULES) were not met: + +$XORG_PKG_ERRORS + +Consider adjusting the PKG_CONFIG_PATH environment variable if you +installed software in a non-standard prefix. + +Alternatively, you may set the environment variables XORG_CFLAGS +and XORG_LIBS to avoid the need to call pkg-config. +See the pkg-config man page for more details. +" >&2;} + { (exit 1); exit 1; }; } +elif test $pkg_failed = untried; then + { { echo "$as_me:$LINENO: error: The pkg-config script could not be found or is too old. Make sure it +is in your PATH or set the PKG_CONFIG environment variable to the full +path to pkg-config. + +Alternatively, you may set the environment variables XORG_CFLAGS +and XORG_LIBS to avoid the need to call pkg-config. +See the pkg-config man page for more details. + +To get pkg-config, see <http://www.freedesktop.org/software/pkgconfig>. +See \`config.log' for more details." >&5 +echo "$as_me: error: The pkg-config script could not be found or is too old. Make sure it +is in your PATH or set the PKG_CONFIG environment variable to the full +path to pkg-config. + +Alternatively, you may set the environment variables XORG_CFLAGS +and XORG_LIBS to avoid the need to call pkg-config. +See the pkg-config man page for more details. + +To get pkg-config, see <http://www.freedesktop.org/software/pkgconfig>. +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } +else + XORG_CFLAGS=$pkg_cv_XORG_CFLAGS + XORG_LIBS=$pkg_cv_XORG_LIBS + echo "$as_me:$LINENO: result: yes" >&5 +echo "${ECHO_T}yes" >&6 + : +fi +sdkdir=$(pkg-config --variable=sdkdir xorg-server) + +CFLAGS="$CFLAGS $XORG_CFLAGS "' -I$(top_srcdir)/src' + + +# Checks for libraries. + +# Checks for header files. +echo "$as_me:$LINENO: checking for ANSI C header files" >&5 +echo $ECHO_N "checking for ANSI C header files... $ECHO_C" >&6 +if test "${ac_cv_header_stdc+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include <stdlib.h> +#include <stdarg.h> +#include <string.h> +#include <float.h> + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_header_stdc=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_header_stdc=no +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext + +if test $ac_cv_header_stdc = yes; then + # SunOS 4.x string.h does not declare mem*, contrary to ANSI. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include <string.h> + +_ACEOF +if (eval "$ac_cpp conftest.$ac_ext") 2>&5 | + $EGREP "memchr" >/dev/null 2>&1; then + : +else + ac_cv_header_stdc=no +fi +rm -f conftest* + +fi + +if test $ac_cv_header_stdc = yes; then + # ISC 2.0.2 stdlib.h does not declare free, contrary to ANSI. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include <stdlib.h> + +_ACEOF +if (eval "$ac_cpp conftest.$ac_ext") 2>&5 | + $EGREP "free" >/dev/null 2>&1; then + : +else + ac_cv_header_stdc=no +fi +rm -f conftest* + +fi + +if test $ac_cv_header_stdc = yes; then + # /bin/cc in Irix-4.0.5 gets non-ANSI ctype macros unless using -ansi. + if test "$cross_compiling" = yes; then + : +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include <ctype.h> +#if ((' ' & 0x0FF) == 0x020) +# define ISLOWER(c) ('a' <= (c) && (c) <= 'z') +# define TOUPPER(c) (ISLOWER(c) ? 'A' + ((c) - 'a') : (c)) +#else +# define ISLOWER(c) \ + (('a' <= (c) && (c) <= 'i') \ + || ('j' <= (c) && (c) <= 'r') \ + || ('s' <= (c) && (c) <= 'z')) +# define TOUPPER(c) (ISLOWER(c) ? ((c) | 0x40) : (c)) +#endif + +#define XOR(e, f) (((e) && !(f)) || (!(e) && (f))) +int +main () +{ + int i; + for (i = 0; i < 256; i++) + if (XOR (islower (i), ISLOWER (i)) + || toupper (i) != TOUPPER (i)) + exit(2); + exit (0); +} +_ACEOF +rm -f conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { ac_try='./conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + : +else + echo "$as_me: program exited with status $ac_status" >&5 +echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +( exit $ac_status ) +ac_cv_header_stdc=no +fi +rm -f core *.core gmon.out bb.out conftest$ac_exeext conftest.$ac_objext conftest.$ac_ext +fi +fi +fi +echo "$as_me:$LINENO: result: $ac_cv_header_stdc" >&5 +echo "${ECHO_T}$ac_cv_header_stdc" >&6 +if test $ac_cv_header_stdc = yes; then + +cat >>confdefs.h <<\_ACEOF +#define STDC_HEADERS 1 +_ACEOF + +fi + + + + + +if test x$APP_MAN_SUFFIX = x ; then + APP_MAN_SUFFIX=1 +fi +if test x$APP_MAN_DIR = x ; then + APP_MAN_DIR='$(mandir)/man$(APP_MAN_SUFFIX)' +fi + +if test x$LIB_MAN_SUFFIX = x ; then + LIB_MAN_SUFFIX=3 +fi +if test x$LIB_MAN_DIR = x ; then + LIB_MAN_DIR='$(mandir)/man$(LIB_MAN_SUFFIX)' +fi + +if test x$FILE_MAN_SUFFIX = x ; then + case $host_os in + solaris*) FILE_MAN_SUFFIX=4 ;; + *) FILE_MAN_SUFFIX=5 ;; + esac +fi +if test x$FILE_MAN_DIR = x ; then + FILE_MAN_DIR='$(mandir)/man$(FILE_MAN_SUFFIX)' +fi + +if test x$MISC_MAN_SUFFIX = x ; then + case $host_os in + solaris*) MISC_MAN_SUFFIX=5 ;; + *) MISC_MAN_SUFFIX=7 ;; + esac +fi +if test x$MISC_MAN_DIR = x ; then + MISC_MAN_DIR='$(mandir)/man$(MISC_MAN_SUFFIX)' +fi + +if test x$DRIVER_MAN_SUFFIX = x ; then + case $host_os in + solaris*) DRIVER_MAN_SUFFIX=7 ;; + *) DRIVER_MAN_SUFFIX=4 ;; + esac +fi +if test x$DRIVER_MAN_DIR = x ; then + DRIVER_MAN_DIR='$(mandir)/man$(DRIVER_MAN_SUFFIX)' +fi + +if test x$ADMIN_MAN_SUFFIX = x ; then + case $host_os in + solaris*) ADMIN_MAN_SUFFIX=1m ;; + *) ADMIN_MAN_SUFFIX=8 ;; + esac +fi +if test x$ADMIN_MAN_DIR = x ; then + ADMIN_MAN_DIR='$(mandir)/man$(ADMIN_MAN_SUFFIX)' +fi + + + + + + + + + + + + + + + + + +# Check whether --with-release-version or --without-release-version was given. +if test "${with_release_version+set}" = set; then + withval="$with_release_version" + RELEASE_VERSION="$withval" +else + RELEASE_VERSION="" +fi; + if test "x$RELEASE_VERSION" != "x"; then + PACKAGE="$PACKAGE-$RELEASE_VERSION" + PACKAGE_TARNAME="$PACKAGE_TARNAME-$RELEASE_VERSION" + { echo "$as_me:$LINENO: Building with package name set to $PACKAGE" >&5 +echo "$as_me: Building with package name set to $PACKAGE" >&6;} + fi + + + +as_ac_File=`echo "ac_cv_file_$prefix/share/X11/sgml/defs.ent" | $as_tr_sh` +echo "$as_me:$LINENO: checking for $prefix/share/X11/sgml/defs.ent" >&5 +echo $ECHO_N "checking for $prefix/share/X11/sgml/defs.ent... $ECHO_C" >&6 +if eval "test \"\${$as_ac_File+set}\" = set"; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + test "$cross_compiling" = yes && + { { echo "$as_me:$LINENO: error: cannot check for file existence when cross compiling" >&5 +echo "$as_me: error: cannot check for file existence when cross compiling" >&2;} + { (exit 1); exit 1; }; } +if test -r "$prefix/share/X11/sgml/defs.ent"; then + eval "$as_ac_File=yes" +else + eval "$as_ac_File=no" +fi +fi +echo "$as_me:$LINENO: result: `eval echo '${'$as_ac_File'}'`" >&5 +echo "${ECHO_T}`eval echo '${'$as_ac_File'}'`" >&6 +if test `eval echo '${'$as_ac_File'}'` = yes; then + DEFS_ENT_PATH=$prefix/share/X11/sgml +else + DEFS_ENT_PATH= + +fi + + +# Extract the first word of "linuxdoc", so it can be a program name with args. +set dummy linuxdoc; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_path_LINUXDOC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + case $LINUXDOC in + [\\/]* | ?:[\\/]*) + ac_cv_path_LINUXDOC="$LINUXDOC" # Let the user override the test with a path. + ;; + *) + as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_path_LINUXDOC="$as_dir/$ac_word$ac_exec_ext" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + + ;; +esac +fi +LINUXDOC=$ac_cv_path_LINUXDOC + +if test -n "$LINUXDOC"; then + echo "$as_me:$LINENO: result: $LINUXDOC" >&5 +echo "${ECHO_T}$LINUXDOC" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + +# Extract the first word of "ps2pdf", so it can be a program name with args. +set dummy ps2pdf; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_path_PS2PDF+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + case $PS2PDF in + [\\/]* | ?:[\\/]*) + ac_cv_path_PS2PDF="$PS2PDF" # Let the user override the test with a path. + ;; + *) + as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_path_PS2PDF="$as_dir/$ac_word$ac_exec_ext" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + + ;; +esac +fi +PS2PDF=$ac_cv_path_PS2PDF + +if test -n "$PS2PDF"; then + echo "$as_me:$LINENO: result: $PS2PDF" >&5 +echo "${ECHO_T}$PS2PDF" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + +echo "$as_me:$LINENO: checking Whether to build documentation" >&5 +echo $ECHO_N "checking Whether to build documentation... $ECHO_C" >&6 + +if test x$DEFS_ENT_PATH != x && test x$LINUXDOC != x ; then + BUILDDOC=yes +else + BUILDDOC=no +fi + + + +if test x$BUILDDOC = xyes; then + BUILD_LINUXDOC_TRUE= + BUILD_LINUXDOC_FALSE='#' +else + BUILD_LINUXDOC_TRUE='#' + BUILD_LINUXDOC_FALSE= +fi + + +echo "$as_me:$LINENO: result: $BUILDDOC" >&5 +echo "${ECHO_T}$BUILDDOC" >&6 + +echo "$as_me:$LINENO: checking Whether to build pdf documentation" >&5 +echo $ECHO_N "checking Whether to build pdf documentation... $ECHO_C" >&6 + +if test x$PS2PDF != x ; then + BUILDPDFDOC=yes +else + BUILDPDFDOC=no +fi + + + +if test x$BUILDPDFDOC = xyes; then + BUILD_PDFDOC_TRUE= + BUILD_PDFDOC_FALSE='#' +else + BUILD_PDFDOC_TRUE='#' + BUILD_PDFDOC_FALSE= +fi + + +echo "$as_me:$LINENO: result: $BUILDPDFDOC" >&5 +echo "${ECHO_T}$BUILDPDFDOC" >&6 + +MAKE_TEXT="SGML_SEARCH_PATH=$DEFS_ENT_PATH GROFF_NO_SGR=y $LINUXDOC -B txt" +MAKE_PS="SGML_SEARCH_PATH=$DEFS_ENT_PATH $LINUXDOC -B latex --papersize=letter --output=ps" +MAKE_PDF="$PS2PDF" +MAKE_HTML="SGML_SEARCH_PATH=$DEFS_ENT_PATH $LINUXDOC -B html --split=0" + + + + + + + + ac_config_files="$ac_config_files Makefile src/Makefile man/Makefile" +cat >confcache <<\_ACEOF +# This file is a shell script that caches the results of configure +# tests run on this system so they can be shared between configure +# scripts and configure runs, see configure's option --config-cache. +# It is not useful on other systems. If it contains results you don't +# want to keep, you may remove or edit it. +# +# config.status only pays attention to the cache file if you give it +# the --recheck option to rerun configure. +# +# `ac_cv_env_foo' variables (set or unset) will be overridden when +# loading this file, other *unset* `ac_cv_foo' will be assigned the +# following values. + +_ACEOF + +# The following way of writing the cache mishandles newlines in values, +# but we know of no workaround that is simple, portable, and efficient. +# So, don't put newlines in cache variables' values. +# Ultrix sh set writes to stderr and can't be redirected directly, +# and sets the high bit in the cache file unless we assign to the vars. +{ + (set) 2>&1 | + case `(ac_space=' '; set | grep ac_space) 2>&1` in + *ac_space=\ *) + # `set' does not quote correctly, so add quotes (double-quote + # substitution turns \\\\ into \\, and sed turns \\ into \). + sed -n \ + "s/'/'\\\\''/g; + s/^\\([_$as_cr_alnum]*_cv_[_$as_cr_alnum]*\\)=\\(.*\\)/\\1='\\2'/p" + ;; + *) + # `set' quotes correctly as required by POSIX, so do not add quotes. + sed -n \ + "s/^\\([_$as_cr_alnum]*_cv_[_$as_cr_alnum]*\\)=\\(.*\\)/\\1=\\2/p" + ;; + esac; +} | + sed ' + t clear + : clear + s/^\([^=]*\)=\(.*[{}].*\)$/test "${\1+set}" = set || &/ + t end + /^ac_cv_env/!s/^\([^=]*\)=\(.*\)$/\1=${\1=\2}/ + : end' >>confcache +if diff $cache_file confcache >/dev/null 2>&1; then :; else + if test -w $cache_file; then + test "x$cache_file" != "x/dev/null" && echo "updating cache $cache_file" + cat confcache >$cache_file + else + echo "not updating unwritable cache $cache_file" + fi +fi +rm -f confcache + +test "x$prefix" = xNONE && prefix=$ac_default_prefix +# Let make expand exec_prefix. +test "x$exec_prefix" = xNONE && exec_prefix='${prefix}' + +# VPATH may cause trouble with some makes, so we remove $(srcdir), +# ${srcdir} and @srcdir@ from VPATH if srcdir is ".", strip leading and +# trailing colons and then remove the whole line if VPATH becomes empty +# (actually we leave an empty line to preserve line numbers). +if test "x$srcdir" = x.; then + ac_vpsub='/^[ ]*VPATH[ ]*=/{ +s/:*\$(srcdir):*/:/; +s/:*\${srcdir}:*/:/; +s/:*@srcdir@:*/:/; +s/^\([^=]*=[ ]*\):*/\1/; +s/:*$//; +s/^[^=]*=[ ]*$//; +}' +fi + +DEFS=-DHAVE_CONFIG_H + +ac_libobjs= +ac_ltlibobjs= +for ac_i in : $LIBOBJS; do test "x$ac_i" = x: && continue + # 1. Remove the extension, and $U if already installed. + ac_i=`echo "$ac_i" | + sed 's/\$U\././;s/\.o$//;s/\.obj$//'` + # 2. Add them. + ac_libobjs="$ac_libobjs $ac_i\$U.$ac_objext" + ac_ltlibobjs="$ac_ltlibobjs $ac_i"'$U.lo' +done +LIBOBJS=$ac_libobjs + +LTLIBOBJS=$ac_ltlibobjs + + +if test -z "${MAINTAINER_MODE_TRUE}" && test -z "${MAINTAINER_MODE_FALSE}"; then + { { echo "$as_me:$LINENO: error: conditional \"MAINTAINER_MODE\" was never defined. +Usually this means the macro was only invoked conditionally." >&5 +echo "$as_me: error: conditional \"MAINTAINER_MODE\" was never defined. +Usually this means the macro was only invoked conditionally." >&2;} + { (exit 1); exit 1; }; } +fi +if test -z "${AMDEP_TRUE}" && test -z "${AMDEP_FALSE}"; then + { { echo "$as_me:$LINENO: error: conditional \"AMDEP\" was never defined. +Usually this means the macro was only invoked conditionally." >&5 +echo "$as_me: error: conditional \"AMDEP\" was never defined. +Usually this means the macro was only invoked conditionally." >&2;} + { (exit 1); exit 1; }; } +fi +if test -z "${am__fastdepCC_TRUE}" && test -z "${am__fastdepCC_FALSE}"; then + { { echo "$as_me:$LINENO: error: conditional \"am__fastdepCC\" was never defined. +Usually this means the macro was only invoked conditionally." >&5 +echo "$as_me: error: conditional \"am__fastdepCC\" was never defined. +Usually this means the macro was only invoked conditionally." >&2;} + { (exit 1); exit 1; }; } +fi +if test -z "${am__fastdepCXX_TRUE}" && test -z "${am__fastdepCXX_FALSE}"; then + { { echo "$as_me:$LINENO: error: conditional \"am__fastdepCXX\" was never defined. +Usually this means the macro was only invoked conditionally." >&5 +echo "$as_me: error: conditional \"am__fastdepCXX\" was never defined. +Usually this means the macro was only invoked conditionally." >&2;} + { (exit 1); exit 1; }; } +fi +if test -z "${am__fastdepCC_TRUE}" && test -z "${am__fastdepCC_FALSE}"; then + { { echo "$as_me:$LINENO: error: conditional \"am__fastdepCC\" was never defined. +Usually this means the macro was only invoked conditionally." >&5 +echo "$as_me: error: conditional \"am__fastdepCC\" was never defined. +Usually this means the macro was only invoked conditionally." >&2;} + { (exit 1); exit 1; }; } +fi +if test -z "${BUILD_LINUXDOC_TRUE}" && test -z "${BUILD_LINUXDOC_FALSE}"; then + { { echo "$as_me:$LINENO: error: conditional \"BUILD_LINUXDOC\" was never defined. +Usually this means the macro was only invoked conditionally." >&5 +echo "$as_me: error: conditional \"BUILD_LINUXDOC\" was never defined. +Usually this means the macro was only invoked conditionally." >&2;} + { (exit 1); exit 1; }; } +fi +if test -z "${BUILD_PDFDOC_TRUE}" && test -z "${BUILD_PDFDOC_FALSE}"; then + { { echo "$as_me:$LINENO: error: conditional \"BUILD_PDFDOC\" was never defined. +Usually this means the macro was only invoked conditionally." >&5 +echo "$as_me: error: conditional \"BUILD_PDFDOC\" was never defined. +Usually this means the macro was only invoked conditionally." >&2;} + { (exit 1); exit 1; }; } +fi + +: ${CONFIG_STATUS=./config.status} +ac_clean_files_save=$ac_clean_files +ac_clean_files="$ac_clean_files $CONFIG_STATUS" +{ echo "$as_me:$LINENO: creating $CONFIG_STATUS" >&5 +echo "$as_me: creating $CONFIG_STATUS" >&6;} +cat >$CONFIG_STATUS <<_ACEOF +#! $SHELL +# Generated by $as_me. +# Run this file to recreate the current configuration. +# Compiler output produced by configure, useful for debugging +# configure, is in config.log if it exists. + +debug=false +ac_cs_recheck=false +ac_cs_silent=false +SHELL=\${CONFIG_SHELL-$SHELL} +_ACEOF + +cat >>$CONFIG_STATUS <<\_ACEOF +## --------------------- ## +## M4sh Initialization. ## +## --------------------- ## + +# Be Bourne compatible +if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then + emulate sh + NULLCMD=: + # Zsh 3.x and 4.x performs word splitting on ${1+"$@"}, which + # is contrary to our usage. Disable this feature. + alias -g '${1+"$@"}'='"$@"' +elif test -n "${BASH_VERSION+set}" && (set -o posix) >/dev/null 2>&1; then + set -o posix +fi +DUALCASE=1; export DUALCASE # for MKS sh + +# Support unset when possible. +if ( (MAIL=60; unset MAIL) || exit) >/dev/null 2>&1; then + as_unset=unset +else + as_unset=false +fi + + +# Work around bugs in pre-3.0 UWIN ksh. +$as_unset ENV MAIL MAILPATH +PS1='$ ' +PS2='> ' +PS4='+ ' + +# NLS nuisances. +for as_var in \ + LANG LANGUAGE LC_ADDRESS LC_ALL LC_COLLATE LC_CTYPE LC_IDENTIFICATION \ + LC_MEASUREMENT LC_MESSAGES LC_MONETARY LC_NAME LC_NUMERIC LC_PAPER \ + LC_TELEPHONE LC_TIME +do + if (set +x; test -z "`(eval $as_var=C; export $as_var) 2>&1`"); then + eval $as_var=C; export $as_var + else + $as_unset $as_var + fi +done + +# Required to use basename. +if expr a : '\(a\)' >/dev/null 2>&1; then + as_expr=expr +else + as_expr=false +fi + +if (basename /) >/dev/null 2>&1 && test "X`basename / 2>&1`" = "X/"; then + as_basename=basename +else + as_basename=false +fi + + +# Name of the executable. +as_me=`$as_basename "$0" || +$as_expr X/"$0" : '.*/\([^/][^/]*\)/*$' \| \ + X"$0" : 'X\(//\)$' \| \ + X"$0" : 'X\(/\)$' \| \ + . : '\(.\)' 2>/dev/null || +echo X/"$0" | + sed '/^.*\/\([^/][^/]*\)\/*$/{ s//\1/; q; } + /^X\/\(\/\/\)$/{ s//\1/; q; } + /^X\/\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + + +# PATH needs CR, and LINENO needs CR and PATH. +# Avoid depending upon Character Ranges. +as_cr_letters='abcdefghijklmnopqrstuvwxyz' +as_cr_LETTERS='ABCDEFGHIJKLMNOPQRSTUVWXYZ' +as_cr_Letters=$as_cr_letters$as_cr_LETTERS +as_cr_digits='0123456789' +as_cr_alnum=$as_cr_Letters$as_cr_digits + +# The user is always right. +if test "${PATH_SEPARATOR+set}" != set; then + echo "#! /bin/sh" >conf$$.sh + echo "exit 0" >>conf$$.sh + chmod +x conf$$.sh + if (PATH="/nonexistent;."; conf$$.sh) >/dev/null 2>&1; then + PATH_SEPARATOR=';' + else + PATH_SEPARATOR=: + fi + rm -f conf$$.sh +fi + + + as_lineno_1=$LINENO + as_lineno_2=$LINENO + as_lineno_3=`(expr $as_lineno_1 + 1) 2>/dev/null` + test "x$as_lineno_1" != "x$as_lineno_2" && + test "x$as_lineno_3" = "x$as_lineno_2" || { + # Find who we are. Look in the path if we contain no path at all + # relative or not. + case $0 in + *[\\/]* ) as_myself=$0 ;; + *) as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + test -r "$as_dir/$0" && as_myself=$as_dir/$0 && break +done + + ;; + esac + # We did not find ourselves, most probably we were run as `sh COMMAND' + # in which case we are not to be found in the path. + if test "x$as_myself" = x; then + as_myself=$0 + fi + if test ! -f "$as_myself"; then + { { echo "$as_me:$LINENO: error: cannot find myself; rerun with an absolute path" >&5 +echo "$as_me: error: cannot find myself; rerun with an absolute path" >&2;} + { (exit 1); exit 1; }; } + fi + case $CONFIG_SHELL in + '') + as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in /bin$PATH_SEPARATOR/usr/bin$PATH_SEPARATOR$PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for as_base in sh bash ksh sh5; do + case $as_dir in + /*) + if ("$as_dir/$as_base" -c ' + as_lineno_1=$LINENO + as_lineno_2=$LINENO + as_lineno_3=`(expr $as_lineno_1 + 1) 2>/dev/null` + test "x$as_lineno_1" != "x$as_lineno_2" && + test "x$as_lineno_3" = "x$as_lineno_2" ') 2>/dev/null; then + $as_unset BASH_ENV || test "${BASH_ENV+set}" != set || { BASH_ENV=; export BASH_ENV; } + $as_unset ENV || test "${ENV+set}" != set || { ENV=; export ENV; } + CONFIG_SHELL=$as_dir/$as_base + export CONFIG_SHELL + exec "$CONFIG_SHELL" "$0" ${1+"$@"} + fi;; + esac + done +done +;; + esac + + # Create $as_me.lineno as a copy of $as_myself, but with $LINENO + # uniformly replaced by the line number. The first 'sed' inserts a + # line-number line before each line; the second 'sed' does the real + # work. The second script uses 'N' to pair each line-number line + # with the numbered line, and appends trailing '-' during + # substitution so that $LINENO is not a special case at line end. + # (Raja R Harinath suggested sed '=', and Paul Eggert wrote the + # second 'sed' script. Blame Lee E. McMahon for sed's syntax. :-) + sed '=' <$as_myself | + sed ' + N + s,$,-, + : loop + s,^\(['$as_cr_digits']*\)\(.*\)[$]LINENO\([^'$as_cr_alnum'_]\),\1\2\1\3, + t loop + s,-$,, + s,^['$as_cr_digits']*\n,, + ' >$as_me.lineno && + chmod +x $as_me.lineno || + { { echo "$as_me:$LINENO: error: cannot create $as_me.lineno; rerun with a POSIX shell" >&5 +echo "$as_me: error: cannot create $as_me.lineno; rerun with a POSIX shell" >&2;} + { (exit 1); exit 1; }; } + + # Don't try to exec as it changes $[0], causing all sort of problems + # (the dirname of $[0] is not the place where we might find the + # original and so on. Autoconf is especially sensible to this). + . ./$as_me.lineno + # Exit status is that of the last command. + exit +} + + +case `echo "testing\c"; echo 1,2,3`,`echo -n testing; echo 1,2,3` in + *c*,-n*) ECHO_N= ECHO_C=' +' ECHO_T=' ' ;; + *c*,* ) ECHO_N=-n ECHO_C= ECHO_T= ;; + *) ECHO_N= ECHO_C='\c' ECHO_T= ;; +esac + +if expr a : '\(a\)' >/dev/null 2>&1; then + as_expr=expr +else + as_expr=false +fi + +rm -f conf$$ conf$$.exe conf$$.file +echo >conf$$.file +if ln -s conf$$.file conf$$ 2>/dev/null; then + # We could just check for DJGPP; but this test a) works b) is more generic + # and c) will remain valid once DJGPP supports symlinks (DJGPP 2.04). + if test -f conf$$.exe; then + # Don't use ln at all; we don't have any links + as_ln_s='cp -p' + else + as_ln_s='ln -s' + fi +elif ln conf$$.file conf$$ 2>/dev/null; then + as_ln_s=ln +else + as_ln_s='cp -p' +fi +rm -f conf$$ conf$$.exe conf$$.file + +if mkdir -p . 2>/dev/null; then + as_mkdir_p=: +else + test -d ./-p && rmdir ./-p + as_mkdir_p=false +fi + +as_executable_p="test -f" + +# Sed expression to map a string onto a valid CPP name. +as_tr_cpp="eval sed 'y%*$as_cr_letters%P$as_cr_LETTERS%;s%[^_$as_cr_alnum]%_%g'" + +# Sed expression to map a string onto a valid variable name. +as_tr_sh="eval sed 'y%*+%pp%;s%[^_$as_cr_alnum]%_%g'" + + +# IFS +# We need space, tab and new line, in precisely that order. +as_nl=' +' +IFS=" $as_nl" + +# CDPATH. +$as_unset CDPATH + +exec 6>&1 + +# Open the log real soon, to keep \$[0] and so on meaningful, and to +# report actual input values of CONFIG_FILES etc. instead of their +# values after options handling. Logging --version etc. is OK. +exec 5>>config.log +{ + echo + sed 'h;s/./-/g;s/^.../## /;s/...$/ ##/;p;x;p;x' <<_ASBOX +## Running $as_me. ## +_ASBOX +} >&5 +cat >&5 <<_CSEOF + +This file was extended by xf86-input-mouse $as_me 1.1.2, which was +generated by GNU Autoconf 2.59. Invocation command line was + + CONFIG_FILES = $CONFIG_FILES + CONFIG_HEADERS = $CONFIG_HEADERS + CONFIG_LINKS = $CONFIG_LINKS + CONFIG_COMMANDS = $CONFIG_COMMANDS + $ $0 $@ + +_CSEOF +echo "on `(hostname || uname -n) 2>/dev/null | sed 1q`" >&5 +echo >&5 +_ACEOF + +# Files that config.status was made for. +if test -n "$ac_config_files"; then + echo "config_files=\"$ac_config_files\"" >>$CONFIG_STATUS +fi + +if test -n "$ac_config_headers"; then + echo "config_headers=\"$ac_config_headers\"" >>$CONFIG_STATUS +fi + +if test -n "$ac_config_links"; then + echo "config_links=\"$ac_config_links\"" >>$CONFIG_STATUS +fi + +if test -n "$ac_config_commands"; then + echo "config_commands=\"$ac_config_commands\"" >>$CONFIG_STATUS +fi + +cat >>$CONFIG_STATUS <<\_ACEOF + +ac_cs_usage="\ +\`$as_me' instantiates files from templates according to the +current configuration. + +Usage: $0 [OPTIONS] [FILE]... + + -h, --help print this help, then exit + -V, --version print version number, then exit + -q, --quiet do not print progress messages + -d, --debug don't remove temporary files + --recheck update $as_me by reconfiguring in the same conditions + --file=FILE[:TEMPLATE] + instantiate the configuration file FILE + --header=FILE[:TEMPLATE] + instantiate the configuration header FILE + +Configuration files: +$config_files + +Configuration headers: +$config_headers + +Configuration commands: +$config_commands + +Report bugs to <bug-autoconf@gnu.org>." +_ACEOF + +cat >>$CONFIG_STATUS <<_ACEOF +ac_cs_version="\\ +xf86-input-mouse config.status 1.1.2 +configured by $0, generated by GNU Autoconf 2.59, + with options \\"`echo "$ac_configure_args" | sed 's/[\\""\`\$]/\\\\&/g'`\\" + +Copyright (C) 2003 Free Software Foundation, Inc. +This config.status script is free software; the Free Software Foundation +gives unlimited permission to copy, distribute and modify it." +srcdir=$srcdir +INSTALL="$INSTALL" +_ACEOF + +cat >>$CONFIG_STATUS <<\_ACEOF +# If no file are specified by the user, then we need to provide default +# value. By we need to know if files were specified by the user. +ac_need_defaults=: +while test $# != 0 +do + case $1 in + --*=*) + ac_option=`expr "x$1" : 'x\([^=]*\)='` + ac_optarg=`expr "x$1" : 'x[^=]*=\(.*\)'` + ac_shift=: + ;; + -*) + ac_option=$1 + ac_optarg=$2 + ac_shift=shift + ;; + *) # This is not an option, so the user has probably given explicit + # arguments. + ac_option=$1 + ac_need_defaults=false;; + esac + + case $ac_option in + # Handling of the options. +_ACEOF +cat >>$CONFIG_STATUS <<\_ACEOF + -recheck | --recheck | --rechec | --reche | --rech | --rec | --re | --r) + ac_cs_recheck=: ;; + --version | --vers* | -V ) + echo "$ac_cs_version"; exit 0 ;; + --he | --h) + # Conflict between --help and --header + { { echo "$as_me:$LINENO: error: ambiguous option: $1 +Try \`$0 --help' for more information." >&5 +echo "$as_me: error: ambiguous option: $1 +Try \`$0 --help' for more information." >&2;} + { (exit 1); exit 1; }; };; + --help | --hel | -h ) + echo "$ac_cs_usage"; exit 0 ;; + --debug | --d* | -d ) + debug=: ;; + --file | --fil | --fi | --f ) + $ac_shift + CONFIG_FILES="$CONFIG_FILES $ac_optarg" + ac_need_defaults=false;; + --header | --heade | --head | --hea ) + $ac_shift + CONFIG_HEADERS="$CONFIG_HEADERS $ac_optarg" + ac_need_defaults=false;; + -q | -quiet | --quiet | --quie | --qui | --qu | --q \ + | -silent | --silent | --silen | --sile | --sil | --si | --s) + ac_cs_silent=: ;; + + # This is an error. + -*) { { echo "$as_me:$LINENO: error: unrecognized option: $1 +Try \`$0 --help' for more information." >&5 +echo "$as_me: error: unrecognized option: $1 +Try \`$0 --help' for more information." >&2;} + { (exit 1); exit 1; }; } ;; + + *) ac_config_targets="$ac_config_targets $1" ;; + + esac + shift +done + +ac_configure_extra_args= + +if $ac_cs_silent; then + exec 6>/dev/null + ac_configure_extra_args="$ac_configure_extra_args --silent" +fi + +_ACEOF +cat >>$CONFIG_STATUS <<_ACEOF +if \$ac_cs_recheck; then + echo "running $SHELL $0 " $ac_configure_args \$ac_configure_extra_args " --no-create --no-recursion" >&6 + exec $SHELL $0 $ac_configure_args \$ac_configure_extra_args --no-create --no-recursion +fi + +_ACEOF + +cat >>$CONFIG_STATUS <<_ACEOF +# +# INIT-COMMANDS section. +# + +AMDEP_TRUE="$AMDEP_TRUE" ac_aux_dir="$ac_aux_dir" + +_ACEOF + + + +cat >>$CONFIG_STATUS <<\_ACEOF +for ac_config_target in $ac_config_targets +do + case "$ac_config_target" in + # Handling of arguments. + "Makefile" ) CONFIG_FILES="$CONFIG_FILES Makefile" ;; + "src/Makefile" ) CONFIG_FILES="$CONFIG_FILES src/Makefile" ;; + "man/Makefile" ) CONFIG_FILES="$CONFIG_FILES man/Makefile" ;; + "depfiles" ) CONFIG_COMMANDS="$CONFIG_COMMANDS depfiles" ;; + "config.h" ) CONFIG_HEADERS="$CONFIG_HEADERS config.h" ;; + *) { { echo "$as_me:$LINENO: error: invalid argument: $ac_config_target" >&5 +echo "$as_me: error: invalid argument: $ac_config_target" >&2;} + { (exit 1); exit 1; }; };; + esac +done + +# If the user did not use the arguments to specify the items to instantiate, +# then the envvar interface is used. Set only those that are not. +# We use the long form for the default assignment because of an extremely +# bizarre bug on SunOS 4.1.3. +if $ac_need_defaults; then + test "${CONFIG_FILES+set}" = set || CONFIG_FILES=$config_files + test "${CONFIG_HEADERS+set}" = set || CONFIG_HEADERS=$config_headers + test "${CONFIG_COMMANDS+set}" = set || CONFIG_COMMANDS=$config_commands +fi + +# Have a temporary directory for convenience. Make it in the build tree +# simply because there is no reason to put it here, and in addition, +# creating and moving files from /tmp can sometimes cause problems. +# Create a temporary directory, and hook for its removal unless debugging. +$debug || +{ + trap 'exit_status=$?; rm -rf $tmp && exit $exit_status' 0 + trap '{ (exit 1); exit 1; }' 1 2 13 15 +} + +# Create a (secure) tmp directory for tmp files. + +{ + tmp=`(umask 077 && mktemp -d -q "./confstatXXXXXX") 2>/dev/null` && + test -n "$tmp" && test -d "$tmp" +} || +{ + tmp=./confstat$$-$RANDOM + (umask 077 && mkdir $tmp) +} || +{ + echo "$me: cannot create a temporary directory in ." >&2 + { (exit 1); exit 1; } +} + +_ACEOF + +cat >>$CONFIG_STATUS <<_ACEOF + +# +# CONFIG_FILES section. +# + +# No need to generate the scripts if there are no CONFIG_FILES. +# This happens for instance when ./config.status config.h +if test -n "\$CONFIG_FILES"; then + # Protect against being on the right side of a sed subst in config.status. + sed 's/,@/@@/; s/@,/@@/; s/,;t t\$/@;t t/; /@;t t\$/s/[\\\\&,]/\\\\&/g; + s/@@/,@/; s/@@/@,/; s/@;t t\$/,;t t/' >\$tmp/subs.sed <<\\CEOF +s,@SHELL@,$SHELL,;t t +s,@PATH_SEPARATOR@,$PATH_SEPARATOR,;t t +s,@PACKAGE_NAME@,$PACKAGE_NAME,;t t +s,@PACKAGE_TARNAME@,$PACKAGE_TARNAME,;t t +s,@PACKAGE_VERSION@,$PACKAGE_VERSION,;t t +s,@PACKAGE_STRING@,$PACKAGE_STRING,;t t +s,@PACKAGE_BUGREPORT@,$PACKAGE_BUGREPORT,;t t +s,@exec_prefix@,$exec_prefix,;t t +s,@prefix@,$prefix,;t t +s,@program_transform_name@,$program_transform_name,;t t +s,@bindir@,$bindir,;t t +s,@sbindir@,$sbindir,;t t +s,@libexecdir@,$libexecdir,;t t +s,@datadir@,$datadir,;t t +s,@sysconfdir@,$sysconfdir,;t t +s,@sharedstatedir@,$sharedstatedir,;t t +s,@localstatedir@,$localstatedir,;t t +s,@libdir@,$libdir,;t t +s,@includedir@,$includedir,;t t +s,@oldincludedir@,$oldincludedir,;t t +s,@infodir@,$infodir,;t t +s,@mandir@,$mandir,;t t +s,@build_alias@,$build_alias,;t t +s,@host_alias@,$host_alias,;t t +s,@target_alias@,$target_alias,;t t +s,@DEFS@,$DEFS,;t t +s,@ECHO_C@,$ECHO_C,;t t +s,@ECHO_N@,$ECHO_N,;t t +s,@ECHO_T@,$ECHO_T,;t t +s,@LIBS@,$LIBS,;t t +s,@INSTALL_PROGRAM@,$INSTALL_PROGRAM,;t t +s,@INSTALL_SCRIPT@,$INSTALL_SCRIPT,;t t +s,@INSTALL_DATA@,$INSTALL_DATA,;t t +s,@CYGPATH_W@,$CYGPATH_W,;t t +s,@PACKAGE@,$PACKAGE,;t t +s,@VERSION@,$VERSION,;t t +s,@ACLOCAL@,$ACLOCAL,;t t +s,@AUTOCONF@,$AUTOCONF,;t t +s,@AUTOMAKE@,$AUTOMAKE,;t t +s,@AUTOHEADER@,$AUTOHEADER,;t t +s,@MAKEINFO@,$MAKEINFO,;t t +s,@install_sh@,$install_sh,;t t +s,@STRIP@,$STRIP,;t t +s,@ac_ct_STRIP@,$ac_ct_STRIP,;t t +s,@INSTALL_STRIP_PROGRAM@,$INSTALL_STRIP_PROGRAM,;t t +s,@mkdir_p@,$mkdir_p,;t t +s,@AWK@,$AWK,;t t +s,@SET_MAKE@,$SET_MAKE,;t t +s,@am__leading_dot@,$am__leading_dot,;t t +s,@AMTAR@,$AMTAR,;t t +s,@am__tar@,$am__tar,;t t +s,@am__untar@,$am__untar,;t t +s,@MAINTAINER_MODE_TRUE@,$MAINTAINER_MODE_TRUE,;t t +s,@MAINTAINER_MODE_FALSE@,$MAINTAINER_MODE_FALSE,;t t +s,@MAINT@,$MAINT,;t t +s,@DRIVER_NAME@,$DRIVER_NAME,;t t +s,@build@,$build,;t t +s,@build_cpu@,$build_cpu,;t t +s,@build_vendor@,$build_vendor,;t t +s,@build_os@,$build_os,;t t +s,@host@,$host,;t t +s,@host_cpu@,$host_cpu,;t t +s,@host_vendor@,$host_vendor,;t t +s,@host_os@,$host_os,;t t +s,@CC@,$CC,;t t +s,@CFLAGS@,$CFLAGS,;t t +s,@LDFLAGS@,$LDFLAGS,;t t +s,@CPPFLAGS@,$CPPFLAGS,;t t +s,@ac_ct_CC@,$ac_ct_CC,;t t +s,@EXEEXT@,$EXEEXT,;t t +s,@OBJEXT@,$OBJEXT,;t t +s,@DEPDIR@,$DEPDIR,;t t +s,@am__include@,$am__include,;t t +s,@am__quote@,$am__quote,;t t +s,@AMDEP_TRUE@,$AMDEP_TRUE,;t t +s,@AMDEP_FALSE@,$AMDEP_FALSE,;t t +s,@AMDEPBACKSLASH@,$AMDEPBACKSLASH,;t t +s,@CCDEPMODE@,$CCDEPMODE,;t t +s,@am__fastdepCC_TRUE@,$am__fastdepCC_TRUE,;t t +s,@am__fastdepCC_FALSE@,$am__fastdepCC_FALSE,;t t +s,@SED@,$SED,;t t +s,@EGREP@,$EGREP,;t t +s,@LN_S@,$LN_S,;t t +s,@ECHO@,$ECHO,;t t +s,@AR@,$AR,;t t +s,@ac_ct_AR@,$ac_ct_AR,;t t +s,@RANLIB@,$RANLIB,;t t +s,@ac_ct_RANLIB@,$ac_ct_RANLIB,;t t +s,@CPP@,$CPP,;t t +s,@CXX@,$CXX,;t t +s,@CXXFLAGS@,$CXXFLAGS,;t t +s,@ac_ct_CXX@,$ac_ct_CXX,;t t +s,@CXXDEPMODE@,$CXXDEPMODE,;t t +s,@am__fastdepCXX_TRUE@,$am__fastdepCXX_TRUE,;t t +s,@am__fastdepCXX_FALSE@,$am__fastdepCXX_FALSE,;t t +s,@CXXCPP@,$CXXCPP,;t t +s,@F77@,$F77,;t t +s,@FFLAGS@,$FFLAGS,;t t +s,@ac_ct_F77@,$ac_ct_F77,;t t +s,@LIBTOOL@,$LIBTOOL,;t t +s,@inputdir@,$inputdir,;t t +s,@PKG_CONFIG@,$PKG_CONFIG,;t t +s,@ac_pt_PKG_CONFIG@,$ac_pt_PKG_CONFIG,;t t +s,@XORG_CFLAGS@,$XORG_CFLAGS,;t t +s,@XORG_LIBS@,$XORG_LIBS,;t t +s,@APP_MAN_SUFFIX@,$APP_MAN_SUFFIX,;t t +s,@LIB_MAN_SUFFIX@,$LIB_MAN_SUFFIX,;t t +s,@FILE_MAN_SUFFIX@,$FILE_MAN_SUFFIX,;t t +s,@MISC_MAN_SUFFIX@,$MISC_MAN_SUFFIX,;t t +s,@DRIVER_MAN_SUFFIX@,$DRIVER_MAN_SUFFIX,;t t +s,@ADMIN_MAN_SUFFIX@,$ADMIN_MAN_SUFFIX,;t t +s,@APP_MAN_DIR@,$APP_MAN_DIR,;t t +s,@LIB_MAN_DIR@,$LIB_MAN_DIR,;t t +s,@FILE_MAN_DIR@,$FILE_MAN_DIR,;t t +s,@MISC_MAN_DIR@,$MISC_MAN_DIR,;t t +s,@DRIVER_MAN_DIR@,$DRIVER_MAN_DIR,;t t +s,@ADMIN_MAN_DIR@,$ADMIN_MAN_DIR,;t t +s,@LINUXDOC@,$LINUXDOC,;t t +s,@PS2PDF@,$PS2PDF,;t t +s,@BUILD_LINUXDOC_TRUE@,$BUILD_LINUXDOC_TRUE,;t t +s,@BUILD_LINUXDOC_FALSE@,$BUILD_LINUXDOC_FALSE,;t t +s,@BUILD_PDFDOC_TRUE@,$BUILD_PDFDOC_TRUE,;t t +s,@BUILD_PDFDOC_FALSE@,$BUILD_PDFDOC_FALSE,;t t +s,@MAKE_TEXT@,$MAKE_TEXT,;t t +s,@MAKE_PS@,$MAKE_PS,;t t +s,@MAKE_PDF@,$MAKE_PDF,;t t +s,@MAKE_HTML@,$MAKE_HTML,;t t +s,@LIBOBJS@,$LIBOBJS,;t t +s,@LTLIBOBJS@,$LTLIBOBJS,;t t +CEOF + +_ACEOF + + cat >>$CONFIG_STATUS <<\_ACEOF + # Split the substitutions into bite-sized pieces for seds with + # small command number limits, like on Digital OSF/1 and HP-UX. + ac_max_sed_lines=48 + ac_sed_frag=1 # Number of current file. + ac_beg=1 # First line for current file. + ac_end=$ac_max_sed_lines # Line after last line for current file. + ac_more_lines=: + ac_sed_cmds= + while $ac_more_lines; do + if test $ac_beg -gt 1; then + sed "1,${ac_beg}d; ${ac_end}q" $tmp/subs.sed >$tmp/subs.frag + else + sed "${ac_end}q" $tmp/subs.sed >$tmp/subs.frag + fi + if test ! -s $tmp/subs.frag; then + ac_more_lines=false + else + # The purpose of the label and of the branching condition is to + # speed up the sed processing (if there are no `@' at all, there + # is no need to browse any of the substitutions). + # These are the two extra sed commands mentioned above. + (echo ':t + /@[a-zA-Z_][a-zA-Z_0-9]*@/!b' && cat $tmp/subs.frag) >$tmp/subs-$ac_sed_frag.sed + if test -z "$ac_sed_cmds"; then + ac_sed_cmds="sed -f $tmp/subs-$ac_sed_frag.sed" + else + ac_sed_cmds="$ac_sed_cmds | sed -f $tmp/subs-$ac_sed_frag.sed" + fi + ac_sed_frag=`expr $ac_sed_frag + 1` + ac_beg=$ac_end + ac_end=`expr $ac_end + $ac_max_sed_lines` + fi + done + if test -z "$ac_sed_cmds"; then + ac_sed_cmds=cat + fi +fi # test -n "$CONFIG_FILES" + +_ACEOF +cat >>$CONFIG_STATUS <<\_ACEOF +for ac_file in : $CONFIG_FILES; do test "x$ac_file" = x: && continue + # Support "outfile[:infile[:infile...]]", defaulting infile="outfile.in". + case $ac_file in + - | *:- | *:-:* ) # input from stdin + cat >$tmp/stdin + ac_file_in=`echo "$ac_file" | sed 's,[^:]*:,,'` + ac_file=`echo "$ac_file" | sed 's,:.*,,'` ;; + *:* ) ac_file_in=`echo "$ac_file" | sed 's,[^:]*:,,'` + ac_file=`echo "$ac_file" | sed 's,:.*,,'` ;; + * ) ac_file_in=$ac_file.in ;; + esac + + # Compute @srcdir@, @top_srcdir@, and @INSTALL@ for subdirectories. + ac_dir=`(dirname "$ac_file") 2>/dev/null || +$as_expr X"$ac_file" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$ac_file" : 'X\(//\)[^/]' \| \ + X"$ac_file" : 'X\(//\)$' \| \ + X"$ac_file" : 'X\(/\)' \| \ + . : '\(.\)' 2>/dev/null || +echo X"$ac_file" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; } + /^X\(\/\/\)[^/].*/{ s//\1/; q; } + /^X\(\/\/\)$/{ s//\1/; q; } + /^X\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + { if $as_mkdir_p; then + mkdir -p "$ac_dir" + else + as_dir="$ac_dir" + as_dirs= + while test ! -d "$as_dir"; do + as_dirs="$as_dir $as_dirs" + as_dir=`(dirname "$as_dir") 2>/dev/null || +$as_expr X"$as_dir" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$as_dir" : 'X\(//\)[^/]' \| \ + X"$as_dir" : 'X\(//\)$' \| \ + X"$as_dir" : 'X\(/\)' \| \ + . : '\(.\)' 2>/dev/null || +echo X"$as_dir" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; } + /^X\(\/\/\)[^/].*/{ s//\1/; q; } + /^X\(\/\/\)$/{ s//\1/; q; } + /^X\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + done + test ! -n "$as_dirs" || mkdir $as_dirs + fi || { { echo "$as_me:$LINENO: error: cannot create directory \"$ac_dir\"" >&5 +echo "$as_me: error: cannot create directory \"$ac_dir\"" >&2;} + { (exit 1); exit 1; }; }; } + + ac_builddir=. + +if test "$ac_dir" != .; then + ac_dir_suffix=/`echo "$ac_dir" | sed 's,^\.[\\/],,'` + # A "../" for each directory in $ac_dir_suffix. + ac_top_builddir=`echo "$ac_dir_suffix" | sed 's,/[^\\/]*,../,g'` +else + ac_dir_suffix= ac_top_builddir= +fi + +case $srcdir in + .) # No --srcdir option. We are building in place. + ac_srcdir=. + if test -z "$ac_top_builddir"; then + ac_top_srcdir=. + else + ac_top_srcdir=`echo $ac_top_builddir | sed 's,/$,,'` + fi ;; + [\\/]* | ?:[\\/]* ) # Absolute path. + ac_srcdir=$srcdir$ac_dir_suffix; + ac_top_srcdir=$srcdir ;; + *) # Relative path. + ac_srcdir=$ac_top_builddir$srcdir$ac_dir_suffix + ac_top_srcdir=$ac_top_builddir$srcdir ;; +esac + +# Do not use `cd foo && pwd` to compute absolute paths, because +# the directories may not exist. +case `pwd` in +.) ac_abs_builddir="$ac_dir";; +*) + case "$ac_dir" in + .) ac_abs_builddir=`pwd`;; + [\\/]* | ?:[\\/]* ) ac_abs_builddir="$ac_dir";; + *) ac_abs_builddir=`pwd`/"$ac_dir";; + esac;; +esac +case $ac_abs_builddir in +.) ac_abs_top_builddir=${ac_top_builddir}.;; +*) + case ${ac_top_builddir}. in + .) ac_abs_top_builddir=$ac_abs_builddir;; + [\\/]* | ?:[\\/]* ) ac_abs_top_builddir=${ac_top_builddir}.;; + *) ac_abs_top_builddir=$ac_abs_builddir/${ac_top_builddir}.;; + esac;; +esac +case $ac_abs_builddir in +.) ac_abs_srcdir=$ac_srcdir;; +*) + case $ac_srcdir in + .) ac_abs_srcdir=$ac_abs_builddir;; + [\\/]* | ?:[\\/]* ) ac_abs_srcdir=$ac_srcdir;; + *) ac_abs_srcdir=$ac_abs_builddir/$ac_srcdir;; + esac;; +esac +case $ac_abs_builddir in +.) ac_abs_top_srcdir=$ac_top_srcdir;; +*) + case $ac_top_srcdir in + .) ac_abs_top_srcdir=$ac_abs_builddir;; + [\\/]* | ?:[\\/]* ) ac_abs_top_srcdir=$ac_top_srcdir;; + *) ac_abs_top_srcdir=$ac_abs_builddir/$ac_top_srcdir;; + esac;; +esac + + + case $INSTALL in + [\\/$]* | ?:[\\/]* ) ac_INSTALL=$INSTALL ;; + *) ac_INSTALL=$ac_top_builddir$INSTALL ;; + esac + + if test x"$ac_file" != x-; then + { echo "$as_me:$LINENO: creating $ac_file" >&5 +echo "$as_me: creating $ac_file" >&6;} + rm -f "$ac_file" + fi + # Let's still pretend it is `configure' which instantiates (i.e., don't + # use $as_me), people would be surprised to read: + # /* config.h. Generated by config.status. */ + if test x"$ac_file" = x-; then + configure_input= + else + configure_input="$ac_file. " + fi + configure_input=$configure_input"Generated from `echo $ac_file_in | + sed 's,.*/,,'` by configure." + + # First look for the input files in the build tree, otherwise in the + # src tree. + ac_file_inputs=`IFS=: + for f in $ac_file_in; do + case $f in + -) echo $tmp/stdin ;; + [\\/$]*) + # Absolute (can't be DOS-style, as IFS=:) + test -f "$f" || { { echo "$as_me:$LINENO: error: cannot find input file: $f" >&5 +echo "$as_me: error: cannot find input file: $f" >&2;} + { (exit 1); exit 1; }; } + echo "$f";; + *) # Relative + if test -f "$f"; then + # Build tree + echo "$f" + elif test -f "$srcdir/$f"; then + # Source tree + echo "$srcdir/$f" + else + # /dev/null tree + { { echo "$as_me:$LINENO: error: cannot find input file: $f" >&5 +echo "$as_me: error: cannot find input file: $f" >&2;} + { (exit 1); exit 1; }; } + fi;; + esac + done` || { (exit 1); exit 1; } +_ACEOF +cat >>$CONFIG_STATUS <<_ACEOF + sed "$ac_vpsub +$extrasub +_ACEOF +cat >>$CONFIG_STATUS <<\_ACEOF +:t +/@[a-zA-Z_][a-zA-Z_0-9]*@/!b +s,@configure_input@,$configure_input,;t t +s,@srcdir@,$ac_srcdir,;t t +s,@abs_srcdir@,$ac_abs_srcdir,;t t +s,@top_srcdir@,$ac_top_srcdir,;t t +s,@abs_top_srcdir@,$ac_abs_top_srcdir,;t t +s,@builddir@,$ac_builddir,;t t +s,@abs_builddir@,$ac_abs_builddir,;t t +s,@top_builddir@,$ac_top_builddir,;t t +s,@abs_top_builddir@,$ac_abs_top_builddir,;t t +s,@INSTALL@,$ac_INSTALL,;t t +" $ac_file_inputs | (eval "$ac_sed_cmds") >$tmp/out + rm -f $tmp/stdin + if test x"$ac_file" != x-; then + mv $tmp/out $ac_file + else + cat $tmp/out + rm -f $tmp/out + fi + +done +_ACEOF +cat >>$CONFIG_STATUS <<\_ACEOF + +# +# CONFIG_HEADER section. +# + +# These sed commands are passed to sed as "A NAME B NAME C VALUE D", where +# NAME is the cpp macro being defined and VALUE is the value it is being given. +# +# ac_d sets the value in "#define NAME VALUE" lines. +ac_dA='s,^\([ ]*\)#\([ ]*define[ ][ ]*\)' +ac_dB='[ ].*$,\1#\2' +ac_dC=' ' +ac_dD=',;t' +# ac_u turns "#undef NAME" without trailing blanks into "#define NAME VALUE". +ac_uA='s,^\([ ]*\)#\([ ]*\)undef\([ ][ ]*\)' +ac_uB='$,\1#\2define\3' +ac_uC=' ' +ac_uD=',;t' + +for ac_file in : $CONFIG_HEADERS; do test "x$ac_file" = x: && continue + # Support "outfile[:infile[:infile...]]", defaulting infile="outfile.in". + case $ac_file in + - | *:- | *:-:* ) # input from stdin + cat >$tmp/stdin + ac_file_in=`echo "$ac_file" | sed 's,[^:]*:,,'` + ac_file=`echo "$ac_file" | sed 's,:.*,,'` ;; + *:* ) ac_file_in=`echo "$ac_file" | sed 's,[^:]*:,,'` + ac_file=`echo "$ac_file" | sed 's,:.*,,'` ;; + * ) ac_file_in=$ac_file.in ;; + esac + + test x"$ac_file" != x- && { echo "$as_me:$LINENO: creating $ac_file" >&5 +echo "$as_me: creating $ac_file" >&6;} + + # First look for the input files in the build tree, otherwise in the + # src tree. + ac_file_inputs=`IFS=: + for f in $ac_file_in; do + case $f in + -) echo $tmp/stdin ;; + [\\/$]*) + # Absolute (can't be DOS-style, as IFS=:) + test -f "$f" || { { echo "$as_me:$LINENO: error: cannot find input file: $f" >&5 +echo "$as_me: error: cannot find input file: $f" >&2;} + { (exit 1); exit 1; }; } + # Do quote $f, to prevent DOS paths from being IFS'd. + echo "$f";; + *) # Relative + if test -f "$f"; then + # Build tree + echo "$f" + elif test -f "$srcdir/$f"; then + # Source tree + echo "$srcdir/$f" + else + # /dev/null tree + { { echo "$as_me:$LINENO: error: cannot find input file: $f" >&5 +echo "$as_me: error: cannot find input file: $f" >&2;} + { (exit 1); exit 1; }; } + fi;; + esac + done` || { (exit 1); exit 1; } + # Remove the trailing spaces. + sed 's/[ ]*$//' $ac_file_inputs >$tmp/in + +_ACEOF + +# Transform confdefs.h into two sed scripts, `conftest.defines' and +# `conftest.undefs', that substitutes the proper values into +# config.h.in to produce config.h. The first handles `#define' +# templates, and the second `#undef' templates. +# And first: Protect against being on the right side of a sed subst in +# config.status. Protect against being in an unquoted here document +# in config.status. +rm -f conftest.defines conftest.undefs +# Using a here document instead of a string reduces the quoting nightmare. +# Putting comments in sed scripts is not portable. +# +# `end' is used to avoid that the second main sed command (meant for +# 0-ary CPP macros) applies to n-ary macro definitions. +# See the Autoconf documentation for `clear'. +cat >confdef2sed.sed <<\_ACEOF +s/[\\&,]/\\&/g +s,[\\$`],\\&,g +t clear +: clear +s,^[ ]*#[ ]*define[ ][ ]*\([^ (][^ (]*\)\(([^)]*)\)[ ]*\(.*\)$,${ac_dA}\1${ac_dB}\1\2${ac_dC}\3${ac_dD},gp +t end +s,^[ ]*#[ ]*define[ ][ ]*\([^ ][^ ]*\)[ ]*\(.*\)$,${ac_dA}\1${ac_dB}\1${ac_dC}\2${ac_dD},gp +: end +_ACEOF +# If some macros were called several times there might be several times +# the same #defines, which is useless. Nevertheless, we may not want to +# sort them, since we want the *last* AC-DEFINE to be honored. +uniq confdefs.h | sed -n -f confdef2sed.sed >conftest.defines +sed 's/ac_d/ac_u/g' conftest.defines >conftest.undefs +rm -f confdef2sed.sed + +# This sed command replaces #undef with comments. This is necessary, for +# example, in the case of _POSIX_SOURCE, which is predefined and required +# on some systems where configure will not decide to define it. +cat >>conftest.undefs <<\_ACEOF +s,^[ ]*#[ ]*undef[ ][ ]*[a-zA-Z_][a-zA-Z_0-9]*,/* & */, +_ACEOF + +# Break up conftest.defines because some shells have a limit on the size +# of here documents, and old seds have small limits too (100 cmds). +echo ' # Handle all the #define templates only if necessary.' >>$CONFIG_STATUS +echo ' if grep "^[ ]*#[ ]*define" $tmp/in >/dev/null; then' >>$CONFIG_STATUS +echo ' # If there are no defines, we may have an empty if/fi' >>$CONFIG_STATUS +echo ' :' >>$CONFIG_STATUS +rm -f conftest.tail +while grep . conftest.defines >/dev/null +do + # Write a limited-size here document to $tmp/defines.sed. + echo ' cat >$tmp/defines.sed <<CEOF' >>$CONFIG_STATUS + # Speed up: don't consider the non `#define' lines. + echo '/^[ ]*#[ ]*define/!b' >>$CONFIG_STATUS + # Work around the forget-to-reset-the-flag bug. + echo 't clr' >>$CONFIG_STATUS + echo ': clr' >>$CONFIG_STATUS + sed ${ac_max_here_lines}q conftest.defines >>$CONFIG_STATUS + echo 'CEOF + sed -f $tmp/defines.sed $tmp/in >$tmp/out + rm -f $tmp/in + mv $tmp/out $tmp/in +' >>$CONFIG_STATUS + sed 1,${ac_max_here_lines}d conftest.defines >conftest.tail + rm -f conftest.defines + mv conftest.tail conftest.defines +done +rm -f conftest.defines +echo ' fi # grep' >>$CONFIG_STATUS +echo >>$CONFIG_STATUS + +# Break up conftest.undefs because some shells have a limit on the size +# of here documents, and old seds have small limits too (100 cmds). +echo ' # Handle all the #undef templates' >>$CONFIG_STATUS +rm -f conftest.tail +while grep . conftest.undefs >/dev/null +do + # Write a limited-size here document to $tmp/undefs.sed. + echo ' cat >$tmp/undefs.sed <<CEOF' >>$CONFIG_STATUS + # Speed up: don't consider the non `#undef' + echo '/^[ ]*#[ ]*undef/!b' >>$CONFIG_STATUS + # Work around the forget-to-reset-the-flag bug. + echo 't clr' >>$CONFIG_STATUS + echo ': clr' >>$CONFIG_STATUS + sed ${ac_max_here_lines}q conftest.undefs >>$CONFIG_STATUS + echo 'CEOF + sed -f $tmp/undefs.sed $tmp/in >$tmp/out + rm -f $tmp/in + mv $tmp/out $tmp/in +' >>$CONFIG_STATUS + sed 1,${ac_max_here_lines}d conftest.undefs >conftest.tail + rm -f conftest.undefs + mv conftest.tail conftest.undefs +done +rm -f conftest.undefs + +cat >>$CONFIG_STATUS <<\_ACEOF + # Let's still pretend it is `configure' which instantiates (i.e., don't + # use $as_me), people would be surprised to read: + # /* config.h. Generated by config.status. */ + if test x"$ac_file" = x-; then + echo "/* Generated by configure. */" >$tmp/config.h + else + echo "/* $ac_file. Generated by configure. */" >$tmp/config.h + fi + cat $tmp/in >>$tmp/config.h + rm -f $tmp/in + if test x"$ac_file" != x-; then + if diff $ac_file $tmp/config.h >/dev/null 2>&1; then + { echo "$as_me:$LINENO: $ac_file is unchanged" >&5 +echo "$as_me: $ac_file is unchanged" >&6;} + else + ac_dir=`(dirname "$ac_file") 2>/dev/null || +$as_expr X"$ac_file" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$ac_file" : 'X\(//\)[^/]' \| \ + X"$ac_file" : 'X\(//\)$' \| \ + X"$ac_file" : 'X\(/\)' \| \ + . : '\(.\)' 2>/dev/null || +echo X"$ac_file" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; } + /^X\(\/\/\)[^/].*/{ s//\1/; q; } + /^X\(\/\/\)$/{ s//\1/; q; } + /^X\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + { if $as_mkdir_p; then + mkdir -p "$ac_dir" + else + as_dir="$ac_dir" + as_dirs= + while test ! -d "$as_dir"; do + as_dirs="$as_dir $as_dirs" + as_dir=`(dirname "$as_dir") 2>/dev/null || +$as_expr X"$as_dir" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$as_dir" : 'X\(//\)[^/]' \| \ + X"$as_dir" : 'X\(//\)$' \| \ + X"$as_dir" : 'X\(/\)' \| \ + . : '\(.\)' 2>/dev/null || +echo X"$as_dir" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; } + /^X\(\/\/\)[^/].*/{ s//\1/; q; } + /^X\(\/\/\)$/{ s//\1/; q; } + /^X\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + done + test ! -n "$as_dirs" || mkdir $as_dirs + fi || { { echo "$as_me:$LINENO: error: cannot create directory \"$ac_dir\"" >&5 +echo "$as_me: error: cannot create directory \"$ac_dir\"" >&2;} + { (exit 1); exit 1; }; }; } + + rm -f $ac_file + mv $tmp/config.h $ac_file + fi + else + cat $tmp/config.h + rm -f $tmp/config.h + fi +# Compute $ac_file's index in $config_headers. +_am_stamp_count=1 +for _am_header in $config_headers :; do + case $_am_header in + $ac_file | $ac_file:* ) + break ;; + * ) + _am_stamp_count=`expr $_am_stamp_count + 1` ;; + esac +done +echo "timestamp for $ac_file" >`(dirname $ac_file) 2>/dev/null || +$as_expr X$ac_file : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X$ac_file : 'X\(//\)[^/]' \| \ + X$ac_file : 'X\(//\)$' \| \ + X$ac_file : 'X\(/\)' \| \ + . : '\(.\)' 2>/dev/null || +echo X$ac_file | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; } + /^X\(\/\/\)[^/].*/{ s//\1/; q; } + /^X\(\/\/\)$/{ s//\1/; q; } + /^X\(\/\).*/{ s//\1/; q; } + s/.*/./; q'`/stamp-h$_am_stamp_count +done +_ACEOF +cat >>$CONFIG_STATUS <<\_ACEOF + +# +# CONFIG_COMMANDS section. +# +for ac_file in : $CONFIG_COMMANDS; do test "x$ac_file" = x: && continue + ac_dest=`echo "$ac_file" | sed 's,:.*,,'` + ac_source=`echo "$ac_file" | sed 's,[^:]*:,,'` + ac_dir=`(dirname "$ac_dest") 2>/dev/null || +$as_expr X"$ac_dest" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$ac_dest" : 'X\(//\)[^/]' \| \ + X"$ac_dest" : 'X\(//\)$' \| \ + X"$ac_dest" : 'X\(/\)' \| \ + . : '\(.\)' 2>/dev/null || +echo X"$ac_dest" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; } + /^X\(\/\/\)[^/].*/{ s//\1/; q; } + /^X\(\/\/\)$/{ s//\1/; q; } + /^X\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + { if $as_mkdir_p; then + mkdir -p "$ac_dir" + else + as_dir="$ac_dir" + as_dirs= + while test ! -d "$as_dir"; do + as_dirs="$as_dir $as_dirs" + as_dir=`(dirname "$as_dir") 2>/dev/null || +$as_expr X"$as_dir" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$as_dir" : 'X\(//\)[^/]' \| \ + X"$as_dir" : 'X\(//\)$' \| \ + X"$as_dir" : 'X\(/\)' \| \ + . : '\(.\)' 2>/dev/null || +echo X"$as_dir" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; } + /^X\(\/\/\)[^/].*/{ s//\1/; q; } + /^X\(\/\/\)$/{ s//\1/; q; } + /^X\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + done + test ! -n "$as_dirs" || mkdir $as_dirs + fi || { { echo "$as_me:$LINENO: error: cannot create directory \"$ac_dir\"" >&5 +echo "$as_me: error: cannot create directory \"$ac_dir\"" >&2;} + { (exit 1); exit 1; }; }; } + + ac_builddir=. + +if test "$ac_dir" != .; then + ac_dir_suffix=/`echo "$ac_dir" | sed 's,^\.[\\/],,'` + # A "../" for each directory in $ac_dir_suffix. + ac_top_builddir=`echo "$ac_dir_suffix" | sed 's,/[^\\/]*,../,g'` +else + ac_dir_suffix= ac_top_builddir= +fi + +case $srcdir in + .) # No --srcdir option. We are building in place. + ac_srcdir=. + if test -z "$ac_top_builddir"; then + ac_top_srcdir=. + else + ac_top_srcdir=`echo $ac_top_builddir | sed 's,/$,,'` + fi ;; + [\\/]* | ?:[\\/]* ) # Absolute path. + ac_srcdir=$srcdir$ac_dir_suffix; + ac_top_srcdir=$srcdir ;; + *) # Relative path. + ac_srcdir=$ac_top_builddir$srcdir$ac_dir_suffix + ac_top_srcdir=$ac_top_builddir$srcdir ;; +esac + +# Do not use `cd foo && pwd` to compute absolute paths, because +# the directories may not exist. +case `pwd` in +.) ac_abs_builddir="$ac_dir";; +*) + case "$ac_dir" in + .) ac_abs_builddir=`pwd`;; + [\\/]* | ?:[\\/]* ) ac_abs_builddir="$ac_dir";; + *) ac_abs_builddir=`pwd`/"$ac_dir";; + esac;; +esac +case $ac_abs_builddir in +.) ac_abs_top_builddir=${ac_top_builddir}.;; +*) + case ${ac_top_builddir}. in + .) ac_abs_top_builddir=$ac_abs_builddir;; + [\\/]* | ?:[\\/]* ) ac_abs_top_builddir=${ac_top_builddir}.;; + *) ac_abs_top_builddir=$ac_abs_builddir/${ac_top_builddir}.;; + esac;; +esac +case $ac_abs_builddir in +.) ac_abs_srcdir=$ac_srcdir;; +*) + case $ac_srcdir in + .) ac_abs_srcdir=$ac_abs_builddir;; + [\\/]* | ?:[\\/]* ) ac_abs_srcdir=$ac_srcdir;; + *) ac_abs_srcdir=$ac_abs_builddir/$ac_srcdir;; + esac;; +esac +case $ac_abs_builddir in +.) ac_abs_top_srcdir=$ac_top_srcdir;; +*) + case $ac_top_srcdir in + .) ac_abs_top_srcdir=$ac_abs_builddir;; + [\\/]* | ?:[\\/]* ) ac_abs_top_srcdir=$ac_top_srcdir;; + *) ac_abs_top_srcdir=$ac_abs_builddir/$ac_top_srcdir;; + esac;; +esac + + + { echo "$as_me:$LINENO: executing $ac_dest commands" >&5 +echo "$as_me: executing $ac_dest commands" >&6;} + case $ac_dest in + depfiles ) test x"$AMDEP_TRUE" != x"" || for mf in $CONFIG_FILES; do + # Strip MF so we end up with the name of the file. + mf=`echo "$mf" | sed -e 's/:.*$//'` + # Check whether this is an Automake generated Makefile or not. + # We used to match only the files named `Makefile.in', but + # some people rename them; so instead we look at the file content. + # Grep'ing the first line is not enough: some people post-process + # each Makefile.in and add a new line on top of each file to say so. + # So let's grep whole file. + if grep '^#.*generated by automake' $mf > /dev/null 2>&1; then + dirpart=`(dirname "$mf") 2>/dev/null || +$as_expr X"$mf" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$mf" : 'X\(//\)[^/]' \| \ + X"$mf" : 'X\(//\)$' \| \ + X"$mf" : 'X\(/\)' \| \ + . : '\(.\)' 2>/dev/null || +echo X"$mf" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; } + /^X\(\/\/\)[^/].*/{ s//\1/; q; } + /^X\(\/\/\)$/{ s//\1/; q; } + /^X\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + else + continue + fi + # Extract the definition of DEPDIR, am__include, and am__quote + # from the Makefile without running `make'. + DEPDIR=`sed -n 's/^DEPDIR = //p' < "$mf"` + test -z "$DEPDIR" && continue + am__include=`sed -n 's/^am__include = //p' < "$mf"` + test -z "am__include" && continue + am__quote=`sed -n 's/^am__quote = //p' < "$mf"` + # When using ansi2knr, U may be empty or an underscore; expand it + U=`sed -n 's/^U = //p' < "$mf"` + # Find all dependency output files, they are included files with + # $(DEPDIR) in their names. We invoke sed twice because it is the + # simplest approach to changing $(DEPDIR) to its actual value in the + # expansion. + for file in `sed -n " + s/^$am__include $am__quote\(.*(DEPDIR).*\)$am__quote"'$/\1/p' <"$mf" | \ + sed -e 's/\$(DEPDIR)/'"$DEPDIR"'/g' -e 's/\$U/'"$U"'/g'`; do + # Make sure the directory exists. + test -f "$dirpart/$file" && continue + fdir=`(dirname "$file") 2>/dev/null || +$as_expr X"$file" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$file" : 'X\(//\)[^/]' \| \ + X"$file" : 'X\(//\)$' \| \ + X"$file" : 'X\(/\)' \| \ + . : '\(.\)' 2>/dev/null || +echo X"$file" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; } + /^X\(\/\/\)[^/].*/{ s//\1/; q; } + /^X\(\/\/\)$/{ s//\1/; q; } + /^X\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + { if $as_mkdir_p; then + mkdir -p $dirpart/$fdir + else + as_dir=$dirpart/$fdir + as_dirs= + while test ! -d "$as_dir"; do + as_dirs="$as_dir $as_dirs" + as_dir=`(dirname "$as_dir") 2>/dev/null || +$as_expr X"$as_dir" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$as_dir" : 'X\(//\)[^/]' \| \ + X"$as_dir" : 'X\(//\)$' \| \ + X"$as_dir" : 'X\(/\)' \| \ + . : '\(.\)' 2>/dev/null || +echo X"$as_dir" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; } + /^X\(\/\/\)[^/].*/{ s//\1/; q; } + /^X\(\/\/\)$/{ s//\1/; q; } + /^X\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + done + test ! -n "$as_dirs" || mkdir $as_dirs + fi || { { echo "$as_me:$LINENO: error: cannot create directory $dirpart/$fdir" >&5 +echo "$as_me: error: cannot create directory $dirpart/$fdir" >&2;} + { (exit 1); exit 1; }; }; } + + # echo "creating $dirpart/$file" + echo '# dummy' > "$dirpart/$file" + done +done + ;; + esac +done +_ACEOF + +cat >>$CONFIG_STATUS <<\_ACEOF + +{ (exit 0); exit 0; } +_ACEOF +chmod +x $CONFIG_STATUS +ac_clean_files=$ac_clean_files_save + + +# configure is writing to config.log, and then calls config.status. +# config.status does its own redirection, appending to config.log. +# Unfortunately, on DOS this fails, as config.log is still kept open +# by configure, so config.status won't be able to write to it; its +# output is simply discarded. So we exec the FD to /dev/null, +# effectively closing config.log, so it can be properly (re)opened and +# appended to by config.status. When coming back to configure, we +# need to make the FD available again. +if test "$no_create" != yes; then + ac_cs_success=: + ac_config_status_args= + test "$silent" = yes && + ac_config_status_args="$ac_config_status_args --quiet" + exec 5>/dev/null + $SHELL $CONFIG_STATUS $ac_config_status_args || ac_cs_success=false + exec 5>>config.log + # Use ||, not &&, to avoid exiting from the if with $? = 1, which + # would make configure fail if this is the last instruction. + $ac_cs_success || { (exit 1); exit 1; } +fi + diff --git a/driver/xf86-input-mouse/configure.ac b/driver/xf86-input-mouse/configure.ac new file mode 100644 index 000000000..c524c35f7 --- /dev/null +++ b/driver/xf86-input-mouse/configure.ac @@ -0,0 +1,94 @@ +# Copyright 2005 Adam Jackson. +# +# Permission is hereby granted, free of charge, to any person obtaining a +# copy of this software and associated documentation files (the "Software"), +# to deal in the Software without restriction, including without limitation +# on the rights to use, copy, modify, merge, publish, distribute, sub +# license, and/or sell copies of the Software, and to permit persons to whom +# the Software is furnished to do so, subject to the following conditions: +# +# The above copyright notice and this permission notice (including the next +# paragraph) shall be included in all copies or substantial portions of the +# Software. +# +# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +# IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +# FITNESS FOR A PARTICULAR PURPOSE AND NON-INFRINGEMENT. IN NO EVENT SHALL +# ADAM JACKSON BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER +# IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +# CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. +# +# Process this file with autoconf to produce a configure script + +AC_PREREQ(2.57) +AC_INIT([xf86-input-mouse], + 1.1.2, + [https://bugs.freedesktop.org/enter_bug.cgi?product=xorg], + xf86-input-mouse) + +AC_CONFIG_SRCDIR([Makefile.am]) +AC_CONFIG_AUX_DIR(.) +AM_INIT_AUTOMAKE([dist-bzip2]) + +AM_MAINTAINER_MODE + +DRIVER_NAME=mouse +AC_SUBST([DRIVER_NAME]) + +AM_CONFIG_HEADER([config.h]) + +# Checks for programs. +AC_DISABLE_STATIC +AC_PROG_LIBTOOL +AC_PROG_CC + +AH_TOP([#include "xorg-server.h"]) + +#AC_DEFINE(XFree86LOADER,1,[Stub define for loadable drivers]) +# +#AC_ARG_ENABLE(XINPUT, AS_HELP_STRING([--enable-xinput], +# [Build XInput support (default: yes)]), +# [XINPUT=$enableval],[XINPUT=yes]) +#AM_CONDITIONAL(XINPUT, test "x$XINPUT" = "xyes") +#if test "x$XINPUT" = "xyes" ; then +# AC_DEFINE(XINPUT,1,[Enable XInput support]) +#fi +# +#AC_ARG_ENABLE(XKB, AS_HELP_STRING([--enable-xkb], +# [Build XKB support (default: yes)]), +# [XKB=$enableval],[XKB=yes]) +#AM_CONDITIONAL(XKB, test "x$XKB" = "xyes") +#if test "x$XKB" = "xyes" ; then +# AC_DEFINE(XKB,1,[Enable XKB support]) +#fi + +AC_ARG_WITH(xorg-module-dir, + AC_HELP_STRING([--with-xorg-module-dir=DIR], + [Default xorg module directory [[default=$libdir/xorg/modules]]]), + [moduledir="$withval"], + [moduledir="$libdir/xorg/modules"]) +inputdir=${moduledir}/input +AC_SUBST(inputdir) + +# Checks for extensions +XORG_DRIVER_CHECK_EXT(RANDR, randrproto) +XORG_DRIVER_CHECK_EXT(XINPUT, inputproto) + +# Checks for pkg-config packages +PKG_CHECK_MODULES(XORG, [xorg-server >= 1.0.99.901] xproto $REQUIRED_MODULES) +sdkdir=$(pkg-config --variable=sdkdir xorg-server) + +CFLAGS="$CFLAGS $XORG_CFLAGS "' -I$(top_srcdir)/src' +AC_SUBST([CFLAGS]) + +# Checks for libraries. + +# Checks for header files. +AC_HEADER_STDC + +XORG_MANPAGE_SECTIONS +XORG_RELEASE_VERSION + +XORG_CHECK_LINUXDOC + +AC_OUTPUT([Makefile src/Makefile man/Makefile]) diff --git a/driver/xf86-input-mouse/depcomp b/driver/xf86-input-mouse/depcomp new file mode 100644 index 000000000..04701da53 --- /dev/null +++ b/driver/xf86-input-mouse/depcomp @@ -0,0 +1,530 @@ +#! /bin/sh +# depcomp - compile a program generating dependencies as side-effects + +scriptversion=2005-07-09.11 + +# Copyright (C) 1999, 2000, 2003, 2004, 2005 Free Software Foundation, Inc. + +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2, or (at your option) +# any later version. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. + +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA +# 02110-1301, USA. + +# As a special exception to the GNU General Public License, if you +# distribute this file as part of a program that contains a +# configuration script generated by Autoconf, you may include it under +# the same distribution terms that you use for the rest of that program. + +# Originally written by Alexandre Oliva <oliva@dcc.unicamp.br>. + +case $1 in + '') + echo "$0: No command. Try \`$0 --help' for more information." 1>&2 + exit 1; + ;; + -h | --h*) + cat <<\EOF +Usage: depcomp [--help] [--version] PROGRAM [ARGS] + +Run PROGRAMS ARGS to compile a file, generating dependencies +as side-effects. + +Environment variables: + depmode Dependency tracking mode. + source Source file read by `PROGRAMS ARGS'. + object Object file output by `PROGRAMS ARGS'. + DEPDIR directory where to store dependencies. + depfile Dependency file to output. + tmpdepfile Temporary file to use when outputing dependencies. + libtool Whether libtool is used (yes/no). + +Report bugs to <bug-automake@gnu.org>. +EOF + exit $? + ;; + -v | --v*) + echo "depcomp $scriptversion" + exit $? + ;; +esac + +if test -z "$depmode" || test -z "$source" || test -z "$object"; then + echo "depcomp: Variables source, object and depmode must be set" 1>&2 + exit 1 +fi + +# Dependencies for sub/bar.o or sub/bar.obj go into sub/.deps/bar.Po. +depfile=${depfile-`echo "$object" | + sed 's|[^\\/]*$|'${DEPDIR-.deps}'/&|;s|\.\([^.]*\)$|.P\1|;s|Pobj$|Po|'`} +tmpdepfile=${tmpdepfile-`echo "$depfile" | sed 's/\.\([^.]*\)$/.T\1/'`} + +rm -f "$tmpdepfile" + +# Some modes work just like other modes, but use different flags. We +# parameterize here, but still list the modes in the big case below, +# to make depend.m4 easier to write. Note that we *cannot* use a case +# here, because this file can only contain one case statement. +if test "$depmode" = hp; then + # HP compiler uses -M and no extra arg. + gccflag=-M + depmode=gcc +fi + +if test "$depmode" = dashXmstdout; then + # This is just like dashmstdout with a different argument. + dashmflag=-xM + depmode=dashmstdout +fi + +case "$depmode" in +gcc3) +## gcc 3 implements dependency tracking that does exactly what +## we want. Yay! Note: for some reason libtool 1.4 doesn't like +## it if -MD -MP comes after the -MF stuff. Hmm. + "$@" -MT "$object" -MD -MP -MF "$tmpdepfile" + stat=$? + if test $stat -eq 0; then : + else + rm -f "$tmpdepfile" + exit $stat + fi + mv "$tmpdepfile" "$depfile" + ;; + +gcc) +## There are various ways to get dependency output from gcc. Here's +## why we pick this rather obscure method: +## - Don't want to use -MD because we'd like the dependencies to end +## up in a subdir. Having to rename by hand is ugly. +## (We might end up doing this anyway to support other compilers.) +## - The DEPENDENCIES_OUTPUT environment variable makes gcc act like +## -MM, not -M (despite what the docs say). +## - Using -M directly means running the compiler twice (even worse +## than renaming). + if test -z "$gccflag"; then + gccflag=-MD, + fi + "$@" -Wp,"$gccflag$tmpdepfile" + stat=$? + if test $stat -eq 0; then : + else + rm -f "$tmpdepfile" + exit $stat + fi + rm -f "$depfile" + echo "$object : \\" > "$depfile" + alpha=ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz +## The second -e expression handles DOS-style file names with drive letters. + sed -e 's/^[^:]*: / /' \ + -e 's/^['$alpha']:\/[^:]*: / /' < "$tmpdepfile" >> "$depfile" +## This next piece of magic avoids the `deleted header file' problem. +## The problem is that when a header file which appears in a .P file +## is deleted, the dependency causes make to die (because there is +## typically no way to rebuild the header). We avoid this by adding +## dummy dependencies for each header file. Too bad gcc doesn't do +## this for us directly. + tr ' ' ' +' < "$tmpdepfile" | +## Some versions of gcc put a space before the `:'. On the theory +## that the space means something, we add a space to the output as +## well. +## Some versions of the HPUX 10.20 sed can't process this invocation +## correctly. Breaking it into two sed invocations is a workaround. + sed -e 's/^\\$//' -e '/^$/d' -e '/:$/d' | sed -e 's/$/ :/' >> "$depfile" + rm -f "$tmpdepfile" + ;; + +hp) + # This case exists only to let depend.m4 do its work. It works by + # looking at the text of this script. This case will never be run, + # since it is checked for above. + exit 1 + ;; + +sgi) + if test "$libtool" = yes; then + "$@" "-Wp,-MDupdate,$tmpdepfile" + else + "$@" -MDupdate "$tmpdepfile" + fi + stat=$? + if test $stat -eq 0; then : + else + rm -f "$tmpdepfile" + exit $stat + fi + rm -f "$depfile" + + if test -f "$tmpdepfile"; then # yes, the sourcefile depend on other files + echo "$object : \\" > "$depfile" + + # Clip off the initial element (the dependent). Don't try to be + # clever and replace this with sed code, as IRIX sed won't handle + # lines with more than a fixed number of characters (4096 in + # IRIX 6.2 sed, 8192 in IRIX 6.5). We also remove comment lines; + # the IRIX cc adds comments like `#:fec' to the end of the + # dependency line. + tr ' ' ' +' < "$tmpdepfile" \ + | sed -e 's/^.*\.o://' -e 's/#.*$//' -e '/^$/ d' | \ + tr ' +' ' ' >> $depfile + echo >> $depfile + + # The second pass generates a dummy entry for each header file. + tr ' ' ' +' < "$tmpdepfile" \ + | sed -e 's/^.*\.o://' -e 's/#.*$//' -e '/^$/ d' -e 's/$/:/' \ + >> $depfile + else + # The sourcefile does not contain any dependencies, so just + # store a dummy comment line, to avoid errors with the Makefile + # "include basename.Plo" scheme. + echo "#dummy" > "$depfile" + fi + rm -f "$tmpdepfile" + ;; + +aix) + # The C for AIX Compiler uses -M and outputs the dependencies + # in a .u file. In older versions, this file always lives in the + # current directory. Also, the AIX compiler puts `$object:' at the + # start of each line; $object doesn't have directory information. + # Version 6 uses the directory in both cases. + stripped=`echo "$object" | sed 's/\(.*\)\..*$/\1/'` + tmpdepfile="$stripped.u" + if test "$libtool" = yes; then + "$@" -Wc,-M + else + "$@" -M + fi + stat=$? + + if test -f "$tmpdepfile"; then : + else + stripped=`echo "$stripped" | sed 's,^.*/,,'` + tmpdepfile="$stripped.u" + fi + + if test $stat -eq 0; then : + else + rm -f "$tmpdepfile" + exit $stat + fi + + if test -f "$tmpdepfile"; then + outname="$stripped.o" + # Each line is of the form `foo.o: dependent.h'. + # Do two passes, one to just change these to + # `$object: dependent.h' and one to simply `dependent.h:'. + sed -e "s,^$outname:,$object :," < "$tmpdepfile" > "$depfile" + sed -e "s,^$outname: \(.*\)$,\1:," < "$tmpdepfile" >> "$depfile" + else + # The sourcefile does not contain any dependencies, so just + # store a dummy comment line, to avoid errors with the Makefile + # "include basename.Plo" scheme. + echo "#dummy" > "$depfile" + fi + rm -f "$tmpdepfile" + ;; + +icc) + # Intel's C compiler understands `-MD -MF file'. However on + # icc -MD -MF foo.d -c -o sub/foo.o sub/foo.c + # ICC 7.0 will fill foo.d with something like + # foo.o: sub/foo.c + # foo.o: sub/foo.h + # which is wrong. We want: + # sub/foo.o: sub/foo.c + # sub/foo.o: sub/foo.h + # sub/foo.c: + # sub/foo.h: + # ICC 7.1 will output + # foo.o: sub/foo.c sub/foo.h + # and will wrap long lines using \ : + # foo.o: sub/foo.c ... \ + # sub/foo.h ... \ + # ... + + "$@" -MD -MF "$tmpdepfile" + stat=$? + if test $stat -eq 0; then : + else + rm -f "$tmpdepfile" + exit $stat + fi + rm -f "$depfile" + # Each line is of the form `foo.o: dependent.h', + # or `foo.o: dep1.h dep2.h \', or ` dep3.h dep4.h \'. + # Do two passes, one to just change these to + # `$object: dependent.h' and one to simply `dependent.h:'. + sed "s,^[^:]*:,$object :," < "$tmpdepfile" > "$depfile" + # Some versions of the HPUX 10.20 sed can't process this invocation + # correctly. Breaking it into two sed invocations is a workaround. + sed 's,^[^:]*: \(.*\)$,\1,;s/^\\$//;/^$/d;/:$/d' < "$tmpdepfile" | + sed -e 's/$/ :/' >> "$depfile" + rm -f "$tmpdepfile" + ;; + +tru64) + # The Tru64 compiler uses -MD to generate dependencies as a side + # effect. `cc -MD -o foo.o ...' puts the dependencies into `foo.o.d'. + # At least on Alpha/Redhat 6.1, Compaq CCC V6.2-504 seems to put + # dependencies in `foo.d' instead, so we check for that too. + # Subdirectories are respected. + dir=`echo "$object" | sed -e 's|/[^/]*$|/|'` + test "x$dir" = "x$object" && dir= + base=`echo "$object" | sed -e 's|^.*/||' -e 's/\.o$//' -e 's/\.lo$//'` + + if test "$libtool" = yes; then + # With Tru64 cc, shared objects can also be used to make a + # static library. This mecanism is used in libtool 1.4 series to + # handle both shared and static libraries in a single compilation. + # With libtool 1.4, dependencies were output in $dir.libs/$base.lo.d. + # + # With libtool 1.5 this exception was removed, and libtool now + # generates 2 separate objects for the 2 libraries. These two + # compilations output dependencies in in $dir.libs/$base.o.d and + # in $dir$base.o.d. We have to check for both files, because + # one of the two compilations can be disabled. We should prefer + # $dir$base.o.d over $dir.libs/$base.o.d because the latter is + # automatically cleaned when .libs/ is deleted, while ignoring + # the former would cause a distcleancheck panic. + tmpdepfile1=$dir.libs/$base.lo.d # libtool 1.4 + tmpdepfile2=$dir$base.o.d # libtool 1.5 + tmpdepfile3=$dir.libs/$base.o.d # libtool 1.5 + tmpdepfile4=$dir.libs/$base.d # Compaq CCC V6.2-504 + "$@" -Wc,-MD + else + tmpdepfile1=$dir$base.o.d + tmpdepfile2=$dir$base.d + tmpdepfile3=$dir$base.d + tmpdepfile4=$dir$base.d + "$@" -MD + fi + + stat=$? + if test $stat -eq 0; then : + else + rm -f "$tmpdepfile1" "$tmpdepfile2" "$tmpdepfile3" "$tmpdepfile4" + exit $stat + fi + + for tmpdepfile in "$tmpdepfile1" "$tmpdepfile2" "$tmpdepfile3" "$tmpdepfile4" + do + test -f "$tmpdepfile" && break + done + if test -f "$tmpdepfile"; then + sed -e "s,^.*\.[a-z]*:,$object:," < "$tmpdepfile" > "$depfile" + # That's a tab and a space in the []. + sed -e 's,^.*\.[a-z]*:[ ]*,,' -e 's,$,:,' < "$tmpdepfile" >> "$depfile" + else + echo "#dummy" > "$depfile" + fi + rm -f "$tmpdepfile" + ;; + +#nosideeffect) + # This comment above is used by automake to tell side-effect + # dependency tracking mechanisms from slower ones. + +dashmstdout) + # Important note: in order to support this mode, a compiler *must* + # always write the preprocessed file to stdout, regardless of -o. + "$@" || exit $? + + # Remove the call to Libtool. + if test "$libtool" = yes; then + while test $1 != '--mode=compile'; do + shift + done + shift + fi + + # Remove `-o $object'. + IFS=" " + for arg + do + case $arg in + -o) + shift + ;; + $object) + shift + ;; + *) + set fnord "$@" "$arg" + shift # fnord + shift # $arg + ;; + esac + done + + test -z "$dashmflag" && dashmflag=-M + # Require at least two characters before searching for `:' + # in the target name. This is to cope with DOS-style filenames: + # a dependency such as `c:/foo/bar' could be seen as target `c' otherwise. + "$@" $dashmflag | + sed 's:^[ ]*[^: ][^:][^:]*\:[ ]*:'"$object"'\: :' > "$tmpdepfile" + rm -f "$depfile" + cat < "$tmpdepfile" > "$depfile" + tr ' ' ' +' < "$tmpdepfile" | \ +## Some versions of the HPUX 10.20 sed can't process this invocation +## correctly. Breaking it into two sed invocations is a workaround. + sed -e 's/^\\$//' -e '/^$/d' -e '/:$/d' | sed -e 's/$/ :/' >> "$depfile" + rm -f "$tmpdepfile" + ;; + +dashXmstdout) + # This case only exists to satisfy depend.m4. It is never actually + # run, as this mode is specially recognized in the preamble. + exit 1 + ;; + +makedepend) + "$@" || exit $? + # Remove any Libtool call + if test "$libtool" = yes; then + while test $1 != '--mode=compile'; do + shift + done + shift + fi + # X makedepend + shift + cleared=no + for arg in "$@"; do + case $cleared in + no) + set ""; shift + cleared=yes ;; + esac + case "$arg" in + -D*|-I*) + set fnord "$@" "$arg"; shift ;; + # Strip any option that makedepend may not understand. Remove + # the object too, otherwise makedepend will parse it as a source file. + -*|$object) + ;; + *) + set fnord "$@" "$arg"; shift ;; + esac + done + obj_suffix="`echo $object | sed 's/^.*\././'`" + touch "$tmpdepfile" + ${MAKEDEPEND-makedepend} -o"$obj_suffix" -f"$tmpdepfile" "$@" + rm -f "$depfile" + cat < "$tmpdepfile" > "$depfile" + sed '1,2d' "$tmpdepfile" | tr ' ' ' +' | \ +## Some versions of the HPUX 10.20 sed can't process this invocation +## correctly. Breaking it into two sed invocations is a workaround. + sed -e 's/^\\$//' -e '/^$/d' -e '/:$/d' | sed -e 's/$/ :/' >> "$depfile" + rm -f "$tmpdepfile" "$tmpdepfile".bak + ;; + +cpp) + # Important note: in order to support this mode, a compiler *must* + # always write the preprocessed file to stdout. + "$@" || exit $? + + # Remove the call to Libtool. + if test "$libtool" = yes; then + while test $1 != '--mode=compile'; do + shift + done + shift + fi + + # Remove `-o $object'. + IFS=" " + for arg + do + case $arg in + -o) + shift + ;; + $object) + shift + ;; + *) + set fnord "$@" "$arg" + shift # fnord + shift # $arg + ;; + esac + done + + "$@" -E | + sed -n -e '/^# [0-9][0-9]* "\([^"]*\)".*/ s:: \1 \\:p' \ + -e '/^#line [0-9][0-9]* "\([^"]*\)".*/ s:: \1 \\:p' | + sed '$ s: \\$::' > "$tmpdepfile" + rm -f "$depfile" + echo "$object : \\" > "$depfile" + cat < "$tmpdepfile" >> "$depfile" + sed < "$tmpdepfile" '/^$/d;s/^ //;s/ \\$//;s/$/ :/' >> "$depfile" + rm -f "$tmpdepfile" + ;; + +msvisualcpp) + # Important note: in order to support this mode, a compiler *must* + # always write the preprocessed file to stdout, regardless of -o, + # because we must use -o when running libtool. + "$@" || exit $? + IFS=" " + for arg + do + case "$arg" in + "-Gm"|"/Gm"|"-Gi"|"/Gi"|"-ZI"|"/ZI") + set fnord "$@" + shift + shift + ;; + *) + set fnord "$@" "$arg" + shift + shift + ;; + esac + done + "$@" -E | + sed -n '/^#line [0-9][0-9]* "\([^"]*\)"/ s::echo "`cygpath -u \\"\1\\"`":p' | sort | uniq > "$tmpdepfile" + rm -f "$depfile" + echo "$object : \\" > "$depfile" + . "$tmpdepfile" | sed 's% %\\ %g' | sed -n '/^\(.*\)$/ s:: \1 \\:p' >> "$depfile" + echo " " >> "$depfile" + . "$tmpdepfile" | sed 's% %\\ %g' | sed -n '/^\(.*\)$/ s::\1\::p' >> "$depfile" + rm -f "$tmpdepfile" + ;; + +none) + exec "$@" + ;; + +*) + echo "Unknown depmode $depmode" 1>&2 + exit 1 + ;; +esac + +exit 0 + +# Local Variables: +# mode: shell-script +# sh-indentation: 2 +# eval: (add-hook 'write-file-hooks 'time-stamp) +# time-stamp-start: "scriptversion=" +# time-stamp-format: "%:y-%02m-%02d.%02H" +# time-stamp-end: "$" +# End: diff --git a/driver/xf86-input-mouse/install-sh b/driver/xf86-input-mouse/install-sh new file mode 100644 index 000000000..4d4a9519e --- /dev/null +++ b/driver/xf86-input-mouse/install-sh @@ -0,0 +1,323 @@ +#!/bin/sh +# install - install a program, script, or datafile + +scriptversion=2005-05-14.22 + +# This originates from X11R5 (mit/util/scripts/install.sh), which was +# later released in X11R6 (xc/config/util/install.sh) with the +# following copyright and license. +# +# Copyright (C) 1994 X Consortium +# +# Permission is hereby granted, free of charge, to any person obtaining a copy +# of this software and associated documentation files (the "Software"), to +# deal in the Software without restriction, including without limitation the +# rights to use, copy, modify, merge, publish, distribute, sublicense, and/or +# sell copies of the Software, and to permit persons to whom the Software is +# furnished to do so, subject to the following conditions: +# +# The above copyright notice and this permission notice shall be included in +# all copies or substantial portions of the Software. +# +# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +# IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +# FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +# X CONSORTIUM BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +# AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNEC- +# TION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. +# +# Except as contained in this notice, the name of the X Consortium shall not +# be used in advertising or otherwise to promote the sale, use or other deal- +# ings in this Software without prior written authorization from the X Consor- +# tium. +# +# +# FSF changes to this file are in the public domain. +# +# Calling this script install-sh is preferred over install.sh, to prevent +# `make' implicit rules from creating a file called install from it +# when there is no Makefile. +# +# This script is compatible with the BSD install script, but was written +# from scratch. It can only install one file at a time, a restriction +# shared with many OS's install programs. + +# set DOITPROG to echo to test this script + +# Don't use :- since 4.3BSD and earlier shells don't like it. +doit="${DOITPROG-}" + +# put in absolute paths if you don't have them in your path; or use env. vars. + +mvprog="${MVPROG-mv}" +cpprog="${CPPROG-cp}" +chmodprog="${CHMODPROG-chmod}" +chownprog="${CHOWNPROG-chown}" +chgrpprog="${CHGRPPROG-chgrp}" +stripprog="${STRIPPROG-strip}" +rmprog="${RMPROG-rm}" +mkdirprog="${MKDIRPROG-mkdir}" + +chmodcmd="$chmodprog 0755" +chowncmd= +chgrpcmd= +stripcmd= +rmcmd="$rmprog -f" +mvcmd="$mvprog" +src= +dst= +dir_arg= +dstarg= +no_target_directory= + +usage="Usage: $0 [OPTION]... [-T] SRCFILE DSTFILE + or: $0 [OPTION]... SRCFILES... DIRECTORY + or: $0 [OPTION]... -t DIRECTORY SRCFILES... + or: $0 [OPTION]... -d DIRECTORIES... + +In the 1st form, copy SRCFILE to DSTFILE. +In the 2nd and 3rd, copy all SRCFILES to DIRECTORY. +In the 4th, create DIRECTORIES. + +Options: +-c (ignored) +-d create directories instead of installing files. +-g GROUP $chgrpprog installed files to GROUP. +-m MODE $chmodprog installed files to MODE. +-o USER $chownprog installed files to USER. +-s $stripprog installed files. +-t DIRECTORY install into DIRECTORY. +-T report an error if DSTFILE is a directory. +--help display this help and exit. +--version display version info and exit. + +Environment variables override the default commands: + CHGRPPROG CHMODPROG CHOWNPROG CPPROG MKDIRPROG MVPROG RMPROG STRIPPROG +" + +while test -n "$1"; do + case $1 in + -c) shift + continue;; + + -d) dir_arg=true + shift + continue;; + + -g) chgrpcmd="$chgrpprog $2" + shift + shift + continue;; + + --help) echo "$usage"; exit $?;; + + -m) chmodcmd="$chmodprog $2" + shift + shift + continue;; + + -o) chowncmd="$chownprog $2" + shift + shift + continue;; + + -s) stripcmd=$stripprog + shift + continue;; + + -t) dstarg=$2 + shift + shift + continue;; + + -T) no_target_directory=true + shift + continue;; + + --version) echo "$0 $scriptversion"; exit $?;; + + *) # When -d is used, all remaining arguments are directories to create. + # When -t is used, the destination is already specified. + test -n "$dir_arg$dstarg" && break + # Otherwise, the last argument is the destination. Remove it from $@. + for arg + do + if test -n "$dstarg"; then + # $@ is not empty: it contains at least $arg. + set fnord "$@" "$dstarg" + shift # fnord + fi + shift # arg + dstarg=$arg + done + break;; + esac +done + +if test -z "$1"; then + if test -z "$dir_arg"; then + echo "$0: no input file specified." >&2 + exit 1 + fi + # It's OK to call `install-sh -d' without argument. + # This can happen when creating conditional directories. + exit 0 +fi + +for src +do + # Protect names starting with `-'. + case $src in + -*) src=./$src ;; + esac + + if test -n "$dir_arg"; then + dst=$src + src= + + if test -d "$dst"; then + mkdircmd=: + chmodcmd= + else + mkdircmd=$mkdirprog + fi + else + # Waiting for this to be detected by the "$cpprog $src $dsttmp" command + # might cause directories to be created, which would be especially bad + # if $src (and thus $dsttmp) contains '*'. + if test ! -f "$src" && test ! -d "$src"; then + echo "$0: $src does not exist." >&2 + exit 1 + fi + + if test -z "$dstarg"; then + echo "$0: no destination specified." >&2 + exit 1 + fi + + dst=$dstarg + # Protect names starting with `-'. + case $dst in + -*) dst=./$dst ;; + esac + + # If destination is a directory, append the input filename; won't work + # if double slashes aren't ignored. + if test -d "$dst"; then + if test -n "$no_target_directory"; then + echo "$0: $dstarg: Is a directory" >&2 + exit 1 + fi + dst=$dst/`basename "$src"` + fi + fi + + # This sed command emulates the dirname command. + dstdir=`echo "$dst" | sed -e 's,/*$,,;s,[^/]*$,,;s,/*$,,;s,^$,.,'` + + # Make sure that the destination directory exists. + + # Skip lots of stat calls in the usual case. + if test ! -d "$dstdir"; then + defaultIFS=' + ' + IFS="${IFS-$defaultIFS}" + + oIFS=$IFS + # Some sh's can't handle IFS=/ for some reason. + IFS='%' + set x `echo "$dstdir" | sed -e 's@/@%@g' -e 's@^%@/@'` + shift + IFS=$oIFS + + pathcomp= + + while test $# -ne 0 ; do + pathcomp=$pathcomp$1 + shift + if test ! -d "$pathcomp"; then + $mkdirprog "$pathcomp" + # mkdir can fail with a `File exist' error in case several + # install-sh are creating the directory concurrently. This + # is OK. + test -d "$pathcomp" || exit + fi + pathcomp=$pathcomp/ + done + fi + + if test -n "$dir_arg"; then + $doit $mkdircmd "$dst" \ + && { test -z "$chowncmd" || $doit $chowncmd "$dst"; } \ + && { test -z "$chgrpcmd" || $doit $chgrpcmd "$dst"; } \ + && { test -z "$stripcmd" || $doit $stripcmd "$dst"; } \ + && { test -z "$chmodcmd" || $doit $chmodcmd "$dst"; } + + else + dstfile=`basename "$dst"` + + # Make a couple of temp file names in the proper directory. + dsttmp=$dstdir/_inst.$$_ + rmtmp=$dstdir/_rm.$$_ + + # Trap to clean up those temp files at exit. + trap 'ret=$?; rm -f "$dsttmp" "$rmtmp" && exit $ret' 0 + trap '(exit $?); exit' 1 2 13 15 + + # Copy the file name to the temp name. + $doit $cpprog "$src" "$dsttmp" && + + # and set any options; do chmod last to preserve setuid bits. + # + # If any of these fail, we abort the whole thing. If we want to + # ignore errors from any of these, just make sure not to ignore + # errors from the above "$doit $cpprog $src $dsttmp" command. + # + { test -z "$chowncmd" || $doit $chowncmd "$dsttmp"; } \ + && { test -z "$chgrpcmd" || $doit $chgrpcmd "$dsttmp"; } \ + && { test -z "$stripcmd" || $doit $stripcmd "$dsttmp"; } \ + && { test -z "$chmodcmd" || $doit $chmodcmd "$dsttmp"; } && + + # Now rename the file to the real destination. + { $doit $mvcmd -f "$dsttmp" "$dstdir/$dstfile" 2>/dev/null \ + || { + # The rename failed, perhaps because mv can't rename something else + # to itself, or perhaps because mv is so ancient that it does not + # support -f. + + # Now remove or move aside any old file at destination location. + # We try this two ways since rm can't unlink itself on some + # systems and the destination file might be busy for other + # reasons. In this case, the final cleanup might fail but the new + # file should still install successfully. + { + if test -f "$dstdir/$dstfile"; then + $doit $rmcmd -f "$dstdir/$dstfile" 2>/dev/null \ + || $doit $mvcmd -f "$dstdir/$dstfile" "$rmtmp" 2>/dev/null \ + || { + echo "$0: cannot unlink or rename $dstdir/$dstfile" >&2 + (exit 1); exit 1 + } + else + : + fi + } && + + # Now rename the file to the real destination. + $doit $mvcmd "$dsttmp" "$dstdir/$dstfile" + } + } + fi || { (exit 1); exit 1; } +done + +# The final little trick to "correctly" pass the exit status to the exit trap. +{ + (exit 0); exit 0 +} + +# Local variables: +# eval: (add-hook 'write-file-hooks 'time-stamp) +# time-stamp-start: "scriptversion=" +# time-stamp-format: "%:y-%02m-%02d.%02H" +# time-stamp-end: "$" +# End: diff --git a/driver/xf86-input-mouse/ltmain.sh b/driver/xf86-input-mouse/ltmain.sh new file mode 100644 index 000000000..0223495a0 --- /dev/null +++ b/driver/xf86-input-mouse/ltmain.sh @@ -0,0 +1,6911 @@ +# ltmain.sh - Provide generalized library-building support services. +# NOTE: Changing this file will not affect anything until you rerun configure. +# +# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2003, 2004, 2005 +# Free Software Foundation, Inc. +# Originally by Gordon Matzigkeit <gord@gnu.ai.mit.edu>, 1996 +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, but +# WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +# General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +# As a special exception to the GNU General Public License, if you +# distribute this file as part of a program that contains a +# configuration script generated by Autoconf, you may include it under +# the same distribution terms that you use for the rest of that program. + +basename="s,^.*/,,g" + +# Work around backward compatibility issue on IRIX 6.5. On IRIX 6.4+, sh +# is ksh but when the shell is invoked as "sh" and the current value of +# the _XPG environment variable is not equal to 1 (one), the special +# positional parameter $0, within a function call, is the name of the +# function. +progpath="$0" + +# The name of this program: +progname=`echo "$progpath" | $SED $basename` +modename="$progname" + +# Global variables: +EXIT_SUCCESS=0 +EXIT_FAILURE=1 + +PROGRAM=ltmain.sh +PACKAGE=libtool +VERSION=1.5.22 +TIMESTAMP=" (1.1220.2.365 2005/12/18 22:14:06)" + +# Be Bourne compatible (taken from Autoconf:_AS_BOURNE_COMPATIBLE). +if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then + emulate sh + NULLCMD=: + # Zsh 3.x and 4.x performs word splitting on ${1+"$@"}, which + # is contrary to our usage. Disable this feature. + alias -g '${1+"$@"}'='"$@"' + setopt NO_GLOB_SUBST +else + case `(set -o) 2>/dev/null` in *posix*) set -o posix;; esac +fi + +# Check that we have a working $echo. +if test "X$1" = X--no-reexec; then + # Discard the --no-reexec flag, and continue. + shift +elif test "X$1" = X--fallback-echo; then + # Avoid inline document here, it may be left over + : +elif test "X`($echo '\t') 2>/dev/null`" = 'X\t'; then + # Yippee, $echo works! + : +else + # Restart under the correct shell, and then maybe $echo will work. + exec $SHELL "$progpath" --no-reexec ${1+"$@"} +fi + +if test "X$1" = X--fallback-echo; then + # used as fallback echo + shift + cat <<EOF +$* +EOF + exit $EXIT_SUCCESS +fi + +default_mode= +help="Try \`$progname --help' for more information." +magic="%%%MAGIC variable%%%" +mkdir="mkdir" +mv="mv -f" +rm="rm -f" + +# Sed substitution that helps us do robust quoting. It backslashifies +# metacharacters that are still active within double-quoted strings. +Xsed="${SED}"' -e 1s/^X//' +sed_quote_subst='s/\([\\`\\"$\\\\]\)/\\\1/g' +# test EBCDIC or ASCII +case `echo X|tr X '\101'` in + A) # ASCII based system + # \n is not interpreted correctly by Solaris 8 /usr/ucb/tr + SP2NL='tr \040 \012' + NL2SP='tr \015\012 \040\040' + ;; + *) # EBCDIC based system + SP2NL='tr \100 \n' + NL2SP='tr \r\n \100\100' + ;; +esac + +# NLS nuisances. +# Only set LANG and LC_ALL to C if already set. +# These must not be set unconditionally because not all systems understand +# e.g. LANG=C (notably SCO). +# We save the old values to restore during execute mode. +for lt_var in LANG LC_ALL LC_CTYPE LC_COLLATE LC_MESSAGES +do + eval "if test \"\${$lt_var+set}\" = set; then + save_$lt_var=\$$lt_var + $lt_var=C + export $lt_var + fi" +done + +# Make sure IFS has a sensible default +lt_nl=' +' +IFS=" $lt_nl" + +if test "$build_libtool_libs" != yes && test "$build_old_libs" != yes; then + $echo "$modename: not configured to build any kind of library" 1>&2 + $echo "Fatal configuration error. See the $PACKAGE docs for more information." 1>&2 + exit $EXIT_FAILURE +fi + +# Global variables. +mode=$default_mode +nonopt= +prev= +prevopt= +run= +show="$echo" +show_help= +execute_dlfiles= +duplicate_deps=no +preserve_args= +lo2o="s/\\.lo\$/.${objext}/" +o2lo="s/\\.${objext}\$/.lo/" +extracted_archives= +extracted_serial=0 + +##################################### +# Shell function definitions: +# This seems to be the best place for them + +# func_mktempdir [string] +# Make a temporary directory that won't clash with other running +# libtool processes, and avoids race conditions if possible. If +# given, STRING is the basename for that directory. +func_mktempdir () +{ + my_template="${TMPDIR-/tmp}/${1-$progname}" + + if test "$run" = ":"; then + # Return a directory name, but don't create it in dry-run mode + my_tmpdir="${my_template}-$$" + else + + # If mktemp works, use that first and foremost + my_tmpdir=`mktemp -d "${my_template}-XXXXXXXX" 2>/dev/null` + + if test ! -d "$my_tmpdir"; then + # Failing that, at least try and use $RANDOM to avoid a race + my_tmpdir="${my_template}-${RANDOM-0}$$" + + save_mktempdir_umask=`umask` + umask 0077 + $mkdir "$my_tmpdir" + umask $save_mktempdir_umask + fi + + # If we're not in dry-run mode, bomb out on failure + test -d "$my_tmpdir" || { + $echo "cannot create temporary directory \`$my_tmpdir'" 1>&2 + exit $EXIT_FAILURE + } + fi + + $echo "X$my_tmpdir" | $Xsed +} + + +# func_win32_libid arg +# return the library type of file 'arg' +# +# Need a lot of goo to handle *both* DLLs and import libs +# Has to be a shell function in order to 'eat' the argument +# that is supplied when $file_magic_command is called. +func_win32_libid () +{ + win32_libid_type="unknown" + win32_fileres=`file -L $1 2>/dev/null` + case $win32_fileres in + *ar\ archive\ import\ library*) # definitely import + win32_libid_type="x86 archive import" + ;; + *ar\ archive*) # could be an import, or static + if eval $OBJDUMP -f $1 | $SED -e '10q' 2>/dev/null | \ + $EGREP -e 'file format pe-i386(.*architecture: i386)?' >/dev/null ; then + win32_nmres=`eval $NM -f posix -A $1 | \ + $SED -n -e '1,100{/ I /{s,.*,import,;p;q;};}'` + case $win32_nmres in + import*) win32_libid_type="x86 archive import";; + *) win32_libid_type="x86 archive static";; + esac + fi + ;; + *DLL*) + win32_libid_type="x86 DLL" + ;; + *executable*) # but shell scripts are "executable" too... + case $win32_fileres in + *MS\ Windows\ PE\ Intel*) + win32_libid_type="x86 DLL" + ;; + esac + ;; + esac + $echo $win32_libid_type +} + + +# func_infer_tag arg +# Infer tagged configuration to use if any are available and +# if one wasn't chosen via the "--tag" command line option. +# Only attempt this if the compiler in the base compile +# command doesn't match the default compiler. +# arg is usually of the form 'gcc ...' +func_infer_tag () +{ + if test -n "$available_tags" && test -z "$tagname"; then + CC_quoted= + for arg in $CC; do + case $arg in + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"") + arg="\"$arg\"" + ;; + esac + CC_quoted="$CC_quoted $arg" + done + case $@ in + # Blanks in the command may have been stripped by the calling shell, + # but not from the CC environment variable when configure was run. + " $CC "* | "$CC "* | " `$echo $CC` "* | "`$echo $CC` "* | " $CC_quoted"* | "$CC_quoted "* | " `$echo $CC_quoted` "* | "`$echo $CC_quoted` "*) ;; + # Blanks at the start of $base_compile will cause this to fail + # if we don't check for them as well. + *) + for z in $available_tags; do + if grep "^# ### BEGIN LIBTOOL TAG CONFIG: $z$" < "$progpath" > /dev/null; then + # Evaluate the configuration. + eval "`${SED} -n -e '/^# ### BEGIN LIBTOOL TAG CONFIG: '$z'$/,/^# ### END LIBTOOL TAG CONFIG: '$z'$/p' < $progpath`" + CC_quoted= + for arg in $CC; do + # Double-quote args containing other shell metacharacters. + case $arg in + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"") + arg="\"$arg\"" + ;; + esac + CC_quoted="$CC_quoted $arg" + done + case "$@ " in + " $CC "* | "$CC "* | " `$echo $CC` "* | "`$echo $CC` "* | " $CC_quoted"* | "$CC_quoted "* | " `$echo $CC_quoted` "* | "`$echo $CC_quoted` "*) + # The compiler in the base compile command matches + # the one in the tagged configuration. + # Assume this is the tagged configuration we want. + tagname=$z + break + ;; + esac + fi + done + # If $tagname still isn't set, then no tagged configuration + # was found and let the user know that the "--tag" command + # line option must be used. + if test -z "$tagname"; then + $echo "$modename: unable to infer tagged configuration" + $echo "$modename: specify a tag with \`--tag'" 1>&2 + exit $EXIT_FAILURE +# else +# $echo "$modename: using $tagname tagged configuration" + fi + ;; + esac + fi +} + + +# func_extract_an_archive dir oldlib +func_extract_an_archive () +{ + f_ex_an_ar_dir="$1"; shift + f_ex_an_ar_oldlib="$1" + + $show "(cd $f_ex_an_ar_dir && $AR x $f_ex_an_ar_oldlib)" + $run eval "(cd \$f_ex_an_ar_dir && $AR x \$f_ex_an_ar_oldlib)" || exit $? + if ($AR t "$f_ex_an_ar_oldlib" | sort | sort -uc >/dev/null 2>&1); then + : + else + $echo "$modename: ERROR: object name conflicts: $f_ex_an_ar_dir/$f_ex_an_ar_oldlib" 1>&2 + exit $EXIT_FAILURE + fi +} + +# func_extract_archives gentop oldlib ... +func_extract_archives () +{ + my_gentop="$1"; shift + my_oldlibs=${1+"$@"} + my_oldobjs="" + my_xlib="" + my_xabs="" + my_xdir="" + my_status="" + + $show "${rm}r $my_gentop" + $run ${rm}r "$my_gentop" + $show "$mkdir $my_gentop" + $run $mkdir "$my_gentop" + my_status=$? + if test "$my_status" -ne 0 && test ! -d "$my_gentop"; then + exit $my_status + fi + + for my_xlib in $my_oldlibs; do + # Extract the objects. + case $my_xlib in + [\\/]* | [A-Za-z]:[\\/]*) my_xabs="$my_xlib" ;; + *) my_xabs=`pwd`"/$my_xlib" ;; + esac + my_xlib=`$echo "X$my_xlib" | $Xsed -e 's%^.*/%%'` + my_xlib_u=$my_xlib + while :; do + case " $extracted_archives " in + *" $my_xlib_u "*) + extracted_serial=`expr $extracted_serial + 1` + my_xlib_u=lt$extracted_serial-$my_xlib ;; + *) break ;; + esac + done + extracted_archives="$extracted_archives $my_xlib_u" + my_xdir="$my_gentop/$my_xlib_u" + + $show "${rm}r $my_xdir" + $run ${rm}r "$my_xdir" + $show "$mkdir $my_xdir" + $run $mkdir "$my_xdir" + exit_status=$? + if test "$exit_status" -ne 0 && test ! -d "$my_xdir"; then + exit $exit_status + fi + case $host in + *-darwin*) + $show "Extracting $my_xabs" + # Do not bother doing anything if just a dry run + if test -z "$run"; then + darwin_orig_dir=`pwd` + cd $my_xdir || exit $? + darwin_archive=$my_xabs + darwin_curdir=`pwd` + darwin_base_archive=`$echo "X$darwin_archive" | $Xsed -e 's%^.*/%%'` + darwin_arches=`lipo -info "$darwin_archive" 2>/dev/null | $EGREP Architectures 2>/dev/null` + if test -n "$darwin_arches"; then + darwin_arches=`echo "$darwin_arches" | $SED -e 's/.*are://'` + darwin_arch= + $show "$darwin_base_archive has multiple architectures $darwin_arches" + for darwin_arch in $darwin_arches ; do + mkdir -p "unfat-$$/${darwin_base_archive}-${darwin_arch}" + lipo -thin $darwin_arch -output "unfat-$$/${darwin_base_archive}-${darwin_arch}/${darwin_base_archive}" "${darwin_archive}" + cd "unfat-$$/${darwin_base_archive}-${darwin_arch}" + func_extract_an_archive "`pwd`" "${darwin_base_archive}" + cd "$darwin_curdir" + $rm "unfat-$$/${darwin_base_archive}-${darwin_arch}/${darwin_base_archive}" + done # $darwin_arches + ## Okay now we have a bunch of thin objects, gotta fatten them up :) + darwin_filelist=`find unfat-$$ -type f -name \*.o -print -o -name \*.lo -print| xargs basename | sort -u | $NL2SP` + darwin_file= + darwin_files= + for darwin_file in $darwin_filelist; do + darwin_files=`find unfat-$$ -name $darwin_file -print | $NL2SP` + lipo -create -output "$darwin_file" $darwin_files + done # $darwin_filelist + ${rm}r unfat-$$ + cd "$darwin_orig_dir" + else + cd "$darwin_orig_dir" + func_extract_an_archive "$my_xdir" "$my_xabs" + fi # $darwin_arches + fi # $run + ;; + *) + func_extract_an_archive "$my_xdir" "$my_xabs" + ;; + esac + my_oldobjs="$my_oldobjs "`find $my_xdir -name \*.$objext -print -o -name \*.lo -print | $NL2SP` + done + func_extract_archives_result="$my_oldobjs" +} +# End of Shell function definitions +##################################### + +# Darwin sucks +eval std_shrext=\"$shrext_cmds\" + +disable_libs=no + +# Parse our command line options once, thoroughly. +while test "$#" -gt 0 +do + arg="$1" + shift + + case $arg in + -*=*) optarg=`$echo "X$arg" | $Xsed -e 's/[-_a-zA-Z0-9]*=//'` ;; + *) optarg= ;; + esac + + # If the previous option needs an argument, assign it. + if test -n "$prev"; then + case $prev in + execute_dlfiles) + execute_dlfiles="$execute_dlfiles $arg" + ;; + tag) + tagname="$arg" + preserve_args="${preserve_args}=$arg" + + # Check whether tagname contains only valid characters + case $tagname in + *[!-_A-Za-z0-9,/]*) + $echo "$progname: invalid tag name: $tagname" 1>&2 + exit $EXIT_FAILURE + ;; + esac + + case $tagname in + CC) + # Don't test for the "default" C tag, as we know, it's there, but + # not specially marked. + ;; + *) + if grep "^# ### BEGIN LIBTOOL TAG CONFIG: $tagname$" < "$progpath" > /dev/null; then + taglist="$taglist $tagname" + # Evaluate the configuration. + eval "`${SED} -n -e '/^# ### BEGIN LIBTOOL TAG CONFIG: '$tagname'$/,/^# ### END LIBTOOL TAG CONFIG: '$tagname'$/p' < $progpath`" + else + $echo "$progname: ignoring unknown tag $tagname" 1>&2 + fi + ;; + esac + ;; + *) + eval "$prev=\$arg" + ;; + esac + + prev= + prevopt= + continue + fi + + # Have we seen a non-optional argument yet? + case $arg in + --help) + show_help=yes + ;; + + --version) + $echo "$PROGRAM (GNU $PACKAGE) $VERSION$TIMESTAMP" + $echo + $echo "Copyright (C) 2005 Free Software Foundation, Inc." + $echo "This is free software; see the source for copying conditions. There is NO" + $echo "warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE." + exit $? + ;; + + --config) + ${SED} -e '1,/^# ### BEGIN LIBTOOL CONFIG/d' -e '/^# ### END LIBTOOL CONFIG/,$d' $progpath + # Now print the configurations for the tags. + for tagname in $taglist; do + ${SED} -n -e "/^# ### BEGIN LIBTOOL TAG CONFIG: $tagname$/,/^# ### END LIBTOOL TAG CONFIG: $tagname$/p" < "$progpath" + done + exit $? + ;; + + --debug) + $echo "$progname: enabling shell trace mode" + set -x + preserve_args="$preserve_args $arg" + ;; + + --dry-run | -n) + run=: + ;; + + --features) + $echo "host: $host" + if test "$build_libtool_libs" = yes; then + $echo "enable shared libraries" + else + $echo "disable shared libraries" + fi + if test "$build_old_libs" = yes; then + $echo "enable static libraries" + else + $echo "disable static libraries" + fi + exit $? + ;; + + --finish) mode="finish" ;; + + --mode) prevopt="--mode" prev=mode ;; + --mode=*) mode="$optarg" ;; + + --preserve-dup-deps) duplicate_deps="yes" ;; + + --quiet | --silent) + show=: + preserve_args="$preserve_args $arg" + ;; + + --tag) + prevopt="--tag" + prev=tag + preserve_args="$preserve_args --tag" + ;; + --tag=*) + set tag "$optarg" ${1+"$@"} + shift + prev=tag + preserve_args="$preserve_args --tag" + ;; + + -dlopen) + prevopt="-dlopen" + prev=execute_dlfiles + ;; + + -*) + $echo "$modename: unrecognized option \`$arg'" 1>&2 + $echo "$help" 1>&2 + exit $EXIT_FAILURE + ;; + + *) + nonopt="$arg" + break + ;; + esac +done + +if test -n "$prevopt"; then + $echo "$modename: option \`$prevopt' requires an argument" 1>&2 + $echo "$help" 1>&2 + exit $EXIT_FAILURE +fi + +case $disable_libs in +no) + ;; +shared) + build_libtool_libs=no + build_old_libs=yes + ;; +static) + build_old_libs=`case $build_libtool_libs in yes) echo no;; *) echo yes;; esac` + ;; +esac + +# If this variable is set in any of the actions, the command in it +# will be execed at the end. This prevents here-documents from being +# left over by shells. +exec_cmd= + +if test -z "$show_help"; then + + # Infer the operation mode. + if test -z "$mode"; then + $echo "*** Warning: inferring the mode of operation is deprecated." 1>&2 + $echo "*** Future versions of Libtool will require --mode=MODE be specified." 1>&2 + case $nonopt in + *cc | cc* | *++ | gcc* | *-gcc* | g++* | xlc*) + mode=link + for arg + do + case $arg in + -c) + mode=compile + break + ;; + esac + done + ;; + *db | *dbx | *strace | *truss) + mode=execute + ;; + *install*|cp|mv) + mode=install + ;; + *rm) + mode=uninstall + ;; + *) + # If we have no mode, but dlfiles were specified, then do execute mode. + test -n "$execute_dlfiles" && mode=execute + + # Just use the default operation mode. + if test -z "$mode"; then + if test -n "$nonopt"; then + $echo "$modename: warning: cannot infer operation mode from \`$nonopt'" 1>&2 + else + $echo "$modename: warning: cannot infer operation mode without MODE-ARGS" 1>&2 + fi + fi + ;; + esac + fi + + # Only execute mode is allowed to have -dlopen flags. + if test -n "$execute_dlfiles" && test "$mode" != execute; then + $echo "$modename: unrecognized option \`-dlopen'" 1>&2 + $echo "$help" 1>&2 + exit $EXIT_FAILURE + fi + + # Change the help message to a mode-specific one. + generic_help="$help" + help="Try \`$modename --help --mode=$mode' for more information." + + # These modes are in order of execution frequency so that they run quickly. + case $mode in + # libtool compile mode + compile) + modename="$modename: compile" + # Get the compilation command and the source file. + base_compile= + srcfile="$nonopt" # always keep a non-empty value in "srcfile" + suppress_opt=yes + suppress_output= + arg_mode=normal + libobj= + later= + + for arg + do + case $arg_mode in + arg ) + # do not "continue". Instead, add this to base_compile + lastarg="$arg" + arg_mode=normal + ;; + + target ) + libobj="$arg" + arg_mode=normal + continue + ;; + + normal ) + # Accept any command-line options. + case $arg in + -o) + if test -n "$libobj" ; then + $echo "$modename: you cannot specify \`-o' more than once" 1>&2 + exit $EXIT_FAILURE + fi + arg_mode=target + continue + ;; + + -static | -prefer-pic | -prefer-non-pic) + later="$later $arg" + continue + ;; + + -no-suppress) + suppress_opt=no + continue + ;; + + -Xcompiler) + arg_mode=arg # the next one goes into the "base_compile" arg list + continue # The current "srcfile" will either be retained or + ;; # replaced later. I would guess that would be a bug. + + -Wc,*) + args=`$echo "X$arg" | $Xsed -e "s/^-Wc,//"` + lastarg= + save_ifs="$IFS"; IFS=',' + for arg in $args; do + IFS="$save_ifs" + + # Double-quote args containing other shell metacharacters. + # Many Bourne shells cannot handle close brackets correctly + # in scan sets, so we specify it separately. + case $arg in + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"") + arg="\"$arg\"" + ;; + esac + lastarg="$lastarg $arg" + done + IFS="$save_ifs" + lastarg=`$echo "X$lastarg" | $Xsed -e "s/^ //"` + + # Add the arguments to base_compile. + base_compile="$base_compile $lastarg" + continue + ;; + + * ) + # Accept the current argument as the source file. + # The previous "srcfile" becomes the current argument. + # + lastarg="$srcfile" + srcfile="$arg" + ;; + esac # case $arg + ;; + esac # case $arg_mode + + # Aesthetically quote the previous argument. + lastarg=`$echo "X$lastarg" | $Xsed -e "$sed_quote_subst"` + + case $lastarg in + # Double-quote args containing other shell metacharacters. + # Many Bourne shells cannot handle close brackets correctly + # in scan sets, and some SunOS ksh mistreat backslash-escaping + # in scan sets (worked around with variable expansion), + # and furthermore cannot handle '|' '&' '(' ')' in scan sets + # at all, so we specify them separately. + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"") + lastarg="\"$lastarg\"" + ;; + esac + + base_compile="$base_compile $lastarg" + done # for arg + + case $arg_mode in + arg) + $echo "$modename: you must specify an argument for -Xcompile" + exit $EXIT_FAILURE + ;; + target) + $echo "$modename: you must specify a target with \`-o'" 1>&2 + exit $EXIT_FAILURE + ;; + *) + # Get the name of the library object. + [ -z "$libobj" ] && libobj=`$echo "X$srcfile" | $Xsed -e 's%^.*/%%'` + ;; + esac + + # Recognize several different file suffixes. + # If the user specifies -o file.o, it is replaced with file.lo + xform='[cCFSifmso]' + case $libobj in + *.ada) xform=ada ;; + *.adb) xform=adb ;; + *.ads) xform=ads ;; + *.asm) xform=asm ;; + *.c++) xform=c++ ;; + *.cc) xform=cc ;; + *.ii) xform=ii ;; + *.class) xform=class ;; + *.cpp) xform=cpp ;; + *.cxx) xform=cxx ;; + *.f90) xform=f90 ;; + *.for) xform=for ;; + *.java) xform=java ;; + *.obj) xform=obj ;; + esac + + libobj=`$echo "X$libobj" | $Xsed -e "s/\.$xform$/.lo/"` + + case $libobj in + *.lo) obj=`$echo "X$libobj" | $Xsed -e "$lo2o"` ;; + *) + $echo "$modename: cannot determine name of library object from \`$libobj'" 1>&2 + exit $EXIT_FAILURE + ;; + esac + + func_infer_tag $base_compile + + for arg in $later; do + case $arg in + -static) + build_old_libs=yes + continue + ;; + + -prefer-pic) + pic_mode=yes + continue + ;; + + -prefer-non-pic) + pic_mode=no + continue + ;; + esac + done + + qlibobj=`$echo "X$libobj" | $Xsed -e "$sed_quote_subst"` + case $qlibobj in + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"") + qlibobj="\"$qlibobj\"" ;; + esac + test "X$libobj" != "X$qlibobj" \ + && $echo "X$libobj" | grep '[]~#^*{};<>?"'"'"' &()|`$[]' \ + && $echo "$modename: libobj name \`$libobj' may not contain shell special characters." + objname=`$echo "X$obj" | $Xsed -e 's%^.*/%%'` + xdir=`$echo "X$obj" | $Xsed -e 's%/[^/]*$%%'` + if test "X$xdir" = "X$obj"; then + xdir= + else + xdir=$xdir/ + fi + lobj=${xdir}$objdir/$objname + + if test -z "$base_compile"; then + $echo "$modename: you must specify a compilation command" 1>&2 + $echo "$help" 1>&2 + exit $EXIT_FAILURE + fi + + # Delete any leftover library objects. + if test "$build_old_libs" = yes; then + removelist="$obj $lobj $libobj ${libobj}T" + else + removelist="$lobj $libobj ${libobj}T" + fi + + $run $rm $removelist + trap "$run $rm $removelist; exit $EXIT_FAILURE" 1 2 15 + + # On Cygwin there's no "real" PIC flag so we must build both object types + case $host_os in + cygwin* | mingw* | pw32* | os2*) + pic_mode=default + ;; + esac + if test "$pic_mode" = no && test "$deplibs_check_method" != pass_all; then + # non-PIC code in shared libraries is not supported + pic_mode=default + fi + + # Calculate the filename of the output object if compiler does + # not support -o with -c + if test "$compiler_c_o" = no; then + output_obj=`$echo "X$srcfile" | $Xsed -e 's%^.*/%%' -e 's%\.[^.]*$%%'`.${objext} + lockfile="$output_obj.lock" + removelist="$removelist $output_obj $lockfile" + trap "$run $rm $removelist; exit $EXIT_FAILURE" 1 2 15 + else + output_obj= + need_locks=no + lockfile= + fi + + # Lock this critical section if it is needed + # We use this script file to make the link, it avoids creating a new file + if test "$need_locks" = yes; then + until $run ln "$progpath" "$lockfile" 2>/dev/null; do + $show "Waiting for $lockfile to be removed" + sleep 2 + done + elif test "$need_locks" = warn; then + if test -f "$lockfile"; then + $echo "\ +*** ERROR, $lockfile exists and contains: +`cat $lockfile 2>/dev/null` + +This indicates that another process is trying to use the same +temporary object file, and libtool could not work around it because +your compiler does not support \`-c' and \`-o' together. If you +repeat this compilation, it may succeed, by chance, but you had better +avoid parallel builds (make -j) in this platform, or get a better +compiler." + + $run $rm $removelist + exit $EXIT_FAILURE + fi + $echo "$srcfile" > "$lockfile" + fi + + if test -n "$fix_srcfile_path"; then + eval srcfile=\"$fix_srcfile_path\" + fi + qsrcfile=`$echo "X$srcfile" | $Xsed -e "$sed_quote_subst"` + case $qsrcfile in + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"") + qsrcfile="\"$qsrcfile\"" ;; + esac + + $run $rm "$libobj" "${libobj}T" + + # Create a libtool object file (analogous to a ".la" file), + # but don't create it if we're doing a dry run. + test -z "$run" && cat > ${libobj}T <<EOF +# $libobj - a libtool object file +# Generated by $PROGRAM - GNU $PACKAGE $VERSION$TIMESTAMP +# +# Please DO NOT delete this file! +# It is necessary for linking the library. + +# Name of the PIC object. +EOF + + # Only build a PIC object if we are building libtool libraries. + if test "$build_libtool_libs" = yes; then + # Without this assignment, base_compile gets emptied. + fbsd_hideous_sh_bug=$base_compile + + if test "$pic_mode" != no; then + command="$base_compile $qsrcfile $pic_flag" + else + # Don't build PIC code + command="$base_compile $qsrcfile" + fi + + if test ! -d "${xdir}$objdir"; then + $show "$mkdir ${xdir}$objdir" + $run $mkdir ${xdir}$objdir + exit_status=$? + if test "$exit_status" -ne 0 && test ! -d "${xdir}$objdir"; then + exit $exit_status + fi + fi + + if test -z "$output_obj"; then + # Place PIC objects in $objdir + command="$command -o $lobj" + fi + + $run $rm "$lobj" "$output_obj" + + $show "$command" + if $run eval "$command"; then : + else + test -n "$output_obj" && $run $rm $removelist + exit $EXIT_FAILURE + fi + + if test "$need_locks" = warn && + test "X`cat $lockfile 2>/dev/null`" != "X$srcfile"; then + $echo "\ +*** ERROR, $lockfile contains: +`cat $lockfile 2>/dev/null` + +but it should contain: +$srcfile + +This indicates that another process is trying to use the same +temporary object file, and libtool could not work around it because +your compiler does not support \`-c' and \`-o' together. If you +repeat this compilation, it may succeed, by chance, but you had better +avoid parallel builds (make -j) in this platform, or get a better +compiler." + + $run $rm $removelist + exit $EXIT_FAILURE + fi + + # Just move the object if needed, then go on to compile the next one + if test -n "$output_obj" && test "X$output_obj" != "X$lobj"; then + $show "$mv $output_obj $lobj" + if $run $mv $output_obj $lobj; then : + else + error=$? + $run $rm $removelist + exit $error + fi + fi + + # Append the name of the PIC object to the libtool object file. + test -z "$run" && cat >> ${libobj}T <<EOF +pic_object='$objdir/$objname' + +EOF + + # Allow error messages only from the first compilation. + if test "$suppress_opt" = yes; then + suppress_output=' >/dev/null 2>&1' + fi + else + # No PIC object so indicate it doesn't exist in the libtool + # object file. + test -z "$run" && cat >> ${libobj}T <<EOF +pic_object=none + +EOF + fi + + # Only build a position-dependent object if we build old libraries. + if test "$build_old_libs" = yes; then + if test "$pic_mode" != yes; then + # Don't build PIC code + command="$base_compile $qsrcfile" + else + command="$base_compile $qsrcfile $pic_flag" + fi + if test "$compiler_c_o" = yes; then + command="$command -o $obj" + fi + + # Suppress compiler output if we already did a PIC compilation. + command="$command$suppress_output" + $run $rm "$obj" "$output_obj" + $show "$command" + if $run eval "$command"; then : + else + $run $rm $removelist + exit $EXIT_FAILURE + fi + + if test "$need_locks" = warn && + test "X`cat $lockfile 2>/dev/null`" != "X$srcfile"; then + $echo "\ +*** ERROR, $lockfile contains: +`cat $lockfile 2>/dev/null` + +but it should contain: +$srcfile + +This indicates that another process is trying to use the same +temporary object file, and libtool could not work around it because +your compiler does not support \`-c' and \`-o' together. If you +repeat this compilation, it may succeed, by chance, but you had better +avoid parallel builds (make -j) in this platform, or get a better +compiler." + + $run $rm $removelist + exit $EXIT_FAILURE + fi + + # Just move the object if needed + if test -n "$output_obj" && test "X$output_obj" != "X$obj"; then + $show "$mv $output_obj $obj" + if $run $mv $output_obj $obj; then : + else + error=$? + $run $rm $removelist + exit $error + fi + fi + + # Append the name of the non-PIC object the libtool object file. + # Only append if the libtool object file exists. + test -z "$run" && cat >> ${libobj}T <<EOF +# Name of the non-PIC object. +non_pic_object='$objname' + +EOF + else + # Append the name of the non-PIC object the libtool object file. + # Only append if the libtool object file exists. + test -z "$run" && cat >> ${libobj}T <<EOF +# Name of the non-PIC object. +non_pic_object=none + +EOF + fi + + $run $mv "${libobj}T" "${libobj}" + + # Unlock the critical section if it was locked + if test "$need_locks" != no; then + $run $rm "$lockfile" + fi + + exit $EXIT_SUCCESS + ;; + + # libtool link mode + link | relink) + modename="$modename: link" + case $host in + *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-os2*) + # It is impossible to link a dll without this setting, and + # we shouldn't force the makefile maintainer to figure out + # which system we are compiling for in order to pass an extra + # flag for every libtool invocation. + # allow_undefined=no + + # FIXME: Unfortunately, there are problems with the above when trying + # to make a dll which has undefined symbols, in which case not + # even a static library is built. For now, we need to specify + # -no-undefined on the libtool link line when we can be certain + # that all symbols are satisfied, otherwise we get a static library. + allow_undefined=yes + ;; + *) + allow_undefined=yes + ;; + esac + libtool_args="$nonopt" + base_compile="$nonopt $@" + compile_command="$nonopt" + finalize_command="$nonopt" + + compile_rpath= + finalize_rpath= + compile_shlibpath= + finalize_shlibpath= + convenience= + old_convenience= + deplibs= + old_deplibs= + compiler_flags= + linker_flags= + dllsearchpath= + lib_search_path=`pwd` + inst_prefix_dir= + + avoid_version=no + dlfiles= + dlprefiles= + dlself=no + export_dynamic=no + export_symbols= + export_symbols_regex= + generated= + libobjs= + ltlibs= + module=no + no_install=no + objs= + non_pic_objects= + notinst_path= # paths that contain not-installed libtool libraries + precious_files_regex= + prefer_static_libs=no + preload=no + prev= + prevarg= + release= + rpath= + xrpath= + perm_rpath= + temp_rpath= + thread_safe=no + vinfo= + vinfo_number=no + + func_infer_tag $base_compile + + # We need to know -static, to get the right output filenames. + for arg + do + case $arg in + -all-static | -static | -static-libtool-libs) + case $arg in + -all-static) + if test "$build_libtool_libs" = yes && test -z "$link_static_flag"; then + $echo "$modename: warning: complete static linking is impossible in this configuration" 1>&2 + fi + if test -n "$link_static_flag"; then + dlopen_self=$dlopen_self_static + fi + prefer_static_libs=yes + ;; + -static) + if test -z "$pic_flag" && test -n "$link_static_flag"; then + dlopen_self=$dlopen_self_static + fi + prefer_static_libs=built + ;; + -static-libtool-libs) + if test -z "$pic_flag" && test -n "$link_static_flag"; then + dlopen_self=$dlopen_self_static + fi + prefer_static_libs=yes + ;; + esac + build_libtool_libs=no + build_old_libs=yes + break + ;; + esac + done + + # See if our shared archives depend on static archives. + test -n "$old_archive_from_new_cmds" && build_old_libs=yes + + # Go through the arguments, transforming them on the way. + while test "$#" -gt 0; do + arg="$1" + shift + case $arg in + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"") + qarg=\"`$echo "X$arg" | $Xsed -e "$sed_quote_subst"`\" ### testsuite: skip nested quoting test + ;; + *) qarg=$arg ;; + esac + libtool_args="$libtool_args $qarg" + + # If the previous option needs an argument, assign it. + if test -n "$prev"; then + case $prev in + output) + compile_command="$compile_command @OUTPUT@" + finalize_command="$finalize_command @OUTPUT@" + ;; + esac + + case $prev in + dlfiles|dlprefiles) + if test "$preload" = no; then + # Add the symbol object into the linking commands. + compile_command="$compile_command @SYMFILE@" + finalize_command="$finalize_command @SYMFILE@" + preload=yes + fi + case $arg in + *.la | *.lo) ;; # We handle these cases below. + force) + if test "$dlself" = no; then + dlself=needless + export_dynamic=yes + fi + prev= + continue + ;; + self) + if test "$prev" = dlprefiles; then + dlself=yes + elif test "$prev" = dlfiles && test "$dlopen_self" != yes; then + dlself=yes + else + dlself=needless + export_dynamic=yes + fi + prev= + continue + ;; + *) + if test "$prev" = dlfiles; then + dlfiles="$dlfiles $arg" + else + dlprefiles="$dlprefiles $arg" + fi + prev= + continue + ;; + esac + ;; + expsyms) + export_symbols="$arg" + if test ! -f "$arg"; then + $echo "$modename: symbol file \`$arg' does not exist" + exit $EXIT_FAILURE + fi + prev= + continue + ;; + expsyms_regex) + export_symbols_regex="$arg" + prev= + continue + ;; + inst_prefix) + inst_prefix_dir="$arg" + prev= + continue + ;; + precious_regex) + precious_files_regex="$arg" + prev= + continue + ;; + release) + release="-$arg" + prev= + continue + ;; + objectlist) + if test -f "$arg"; then + save_arg=$arg + moreargs= + for fil in `cat $save_arg` + do +# moreargs="$moreargs $fil" + arg=$fil + # A libtool-controlled object. + + # Check to see that this really is a libtool object. + if (${SED} -e '2q' $arg | grep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then + pic_object= + non_pic_object= + + # Read the .lo file + # If there is no directory component, then add one. + case $arg in + */* | *\\*) . $arg ;; + *) . ./$arg ;; + esac + + if test -z "$pic_object" || \ + test -z "$non_pic_object" || + test "$pic_object" = none && \ + test "$non_pic_object" = none; then + $echo "$modename: cannot find name of object for \`$arg'" 1>&2 + exit $EXIT_FAILURE + fi + + # Extract subdirectory from the argument. + xdir=`$echo "X$arg" | $Xsed -e 's%/[^/]*$%%'` + if test "X$xdir" = "X$arg"; then + xdir= + else + xdir="$xdir/" + fi + + if test "$pic_object" != none; then + # Prepend the subdirectory the object is found in. + pic_object="$xdir$pic_object" + + if test "$prev" = dlfiles; then + if test "$build_libtool_libs" = yes && test "$dlopen_support" = yes; then + dlfiles="$dlfiles $pic_object" + prev= + continue + else + # If libtool objects are unsupported, then we need to preload. + prev=dlprefiles + fi + fi + + # CHECK ME: I think I busted this. -Ossama + if test "$prev" = dlprefiles; then + # Preload the old-style object. + dlprefiles="$dlprefiles $pic_object" + prev= + fi + + # A PIC object. + libobjs="$libobjs $pic_object" + arg="$pic_object" + fi + + # Non-PIC object. + if test "$non_pic_object" != none; then + # Prepend the subdirectory the object is found in. + non_pic_object="$xdir$non_pic_object" + + # A standard non-PIC object + non_pic_objects="$non_pic_objects $non_pic_object" + if test -z "$pic_object" || test "$pic_object" = none ; then + arg="$non_pic_object" + fi + else + # If the PIC object exists, use it instead. + # $xdir was prepended to $pic_object above. + non_pic_object="$pic_object" + non_pic_objects="$non_pic_objects $non_pic_object" + fi + else + # Only an error if not doing a dry-run. + if test -z "$run"; then + $echo "$modename: \`$arg' is not a valid libtool object" 1>&2 + exit $EXIT_FAILURE + else + # Dry-run case. + + # Extract subdirectory from the argument. + xdir=`$echo "X$arg" | $Xsed -e 's%/[^/]*$%%'` + if test "X$xdir" = "X$arg"; then + xdir= + else + xdir="$xdir/" + fi + + pic_object=`$echo "X${xdir}${objdir}/${arg}" | $Xsed -e "$lo2o"` + non_pic_object=`$echo "X${xdir}${arg}" | $Xsed -e "$lo2o"` + libobjs="$libobjs $pic_object" + non_pic_objects="$non_pic_objects $non_pic_object" + fi + fi + done + else + $echo "$modename: link input file \`$save_arg' does not exist" + exit $EXIT_FAILURE + fi + arg=$save_arg + prev= + continue + ;; + rpath | xrpath) + # We need an absolute path. + case $arg in + [\\/]* | [A-Za-z]:[\\/]*) ;; + *) + $echo "$modename: only absolute run-paths are allowed" 1>&2 + exit $EXIT_FAILURE + ;; + esac + if test "$prev" = rpath; then + case "$rpath " in + *" $arg "*) ;; + *) rpath="$rpath $arg" ;; + esac + else + case "$xrpath " in + *" $arg "*) ;; + *) xrpath="$xrpath $arg" ;; + esac + fi + prev= + continue + ;; + xcompiler) + compiler_flags="$compiler_flags $qarg" + prev= + compile_command="$compile_command $qarg" + finalize_command="$finalize_command $qarg" + continue + ;; + xlinker) + linker_flags="$linker_flags $qarg" + compiler_flags="$compiler_flags $wl$qarg" + prev= + compile_command="$compile_command $wl$qarg" + finalize_command="$finalize_command $wl$qarg" + continue + ;; + xcclinker) + linker_flags="$linker_flags $qarg" + compiler_flags="$compiler_flags $qarg" + prev= + compile_command="$compile_command $qarg" + finalize_command="$finalize_command $qarg" + continue + ;; + shrext) + shrext_cmds="$arg" + prev= + continue + ;; + darwin_framework|darwin_framework_skip) + test "$prev" = "darwin_framework" && compiler_flags="$compiler_flags $arg" + compile_command="$compile_command $arg" + finalize_command="$finalize_command $arg" + prev= + continue + ;; + *) + eval "$prev=\"\$arg\"" + prev= + continue + ;; + esac + fi # test -n "$prev" + + prevarg="$arg" + + case $arg in + -all-static) + if test -n "$link_static_flag"; then + compile_command="$compile_command $link_static_flag" + finalize_command="$finalize_command $link_static_flag" + fi + continue + ;; + + -allow-undefined) + # FIXME: remove this flag sometime in the future. + $echo "$modename: \`-allow-undefined' is deprecated because it is the default" 1>&2 + continue + ;; + + -avoid-version) + avoid_version=yes + continue + ;; + + -dlopen) + prev=dlfiles + continue + ;; + + -dlpreopen) + prev=dlprefiles + continue + ;; + + -export-dynamic) + export_dynamic=yes + continue + ;; + + -export-symbols | -export-symbols-regex) + if test -n "$export_symbols" || test -n "$export_symbols_regex"; then + $echo "$modename: more than one -exported-symbols argument is not allowed" + exit $EXIT_FAILURE + fi + if test "X$arg" = "X-export-symbols"; then + prev=expsyms + else + prev=expsyms_regex + fi + continue + ;; + + -framework|-arch|-isysroot) + case " $CC " in + *" ${arg} ${1} "* | *" ${arg} ${1} "*) + prev=darwin_framework_skip ;; + *) compiler_flags="$compiler_flags $arg" + prev=darwin_framework ;; + esac + compile_command="$compile_command $arg" + finalize_command="$finalize_command $arg" + continue + ;; + + -inst-prefix-dir) + prev=inst_prefix + continue + ;; + + # The native IRIX linker understands -LANG:*, -LIST:* and -LNO:* + # so, if we see these flags be careful not to treat them like -L + -L[A-Z][A-Z]*:*) + case $with_gcc/$host in + no/*-*-irix* | /*-*-irix*) + compile_command="$compile_command $arg" + finalize_command="$finalize_command $arg" + ;; + esac + continue + ;; + + -L*) + dir=`$echo "X$arg" | $Xsed -e 's/^-L//'` + # We need an absolute path. + case $dir in + [\\/]* | [A-Za-z]:[\\/]*) ;; + *) + absdir=`cd "$dir" && pwd` + if test -z "$absdir"; then + $echo "$modename: cannot determine absolute directory name of \`$dir'" 1>&2 + absdir="$dir" + notinst_path="$notinst_path $dir" + fi + dir="$absdir" + ;; + esac + case "$deplibs " in + *" -L$dir "*) ;; + *) + deplibs="$deplibs -L$dir" + lib_search_path="$lib_search_path $dir" + ;; + esac + case $host in + *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-os2*) + testbindir=`$echo "X$dir" | $Xsed -e 's*/lib$*/bin*'` + case :$dllsearchpath: in + *":$dir:"*) ;; + *) dllsearchpath="$dllsearchpath:$dir";; + esac + case :$dllsearchpath: in + *":$testbindir:"*) ;; + *) dllsearchpath="$dllsearchpath:$testbindir";; + esac + ;; + esac + continue + ;; + + -l*) + if test "X$arg" = "X-lc" || test "X$arg" = "X-lm"; then + case $host in + *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-beos*) + # These systems don't actually have a C or math library (as such) + continue + ;; + *-*-os2*) + # These systems don't actually have a C library (as such) + test "X$arg" = "X-lc" && continue + ;; + *-*-openbsd* | *-*-freebsd* | *-*-dragonfly*) + # Do not include libc due to us having libc/libc_r. + test "X$arg" = "X-lc" && continue + ;; + *-*-rhapsody* | *-*-darwin1.[012]) + # Rhapsody C and math libraries are in the System framework + deplibs="$deplibs -framework System" + continue + ;; + *-*-sco3.2v5* | *-*-sco5v6*) + # Causes problems with __ctype + test "X$arg" = "X-lc" && continue + ;; + *-*-sysv4.2uw2* | *-*-sysv5* | *-*-unixware* | *-*-OpenUNIX*) + # Compiler inserts libc in the correct place for threads to work + test "X$arg" = "X-lc" && continue + ;; + esac + elif test "X$arg" = "X-lc_r"; then + case $host in + *-*-openbsd* | *-*-freebsd* | *-*-dragonfly*) + # Do not include libc_r directly, use -pthread flag. + continue + ;; + esac + fi + deplibs="$deplibs $arg" + continue + ;; + + # Tru64 UNIX uses -model [arg] to determine the layout of C++ + # classes, name mangling, and exception handling. + -model) + compile_command="$compile_command $arg" + compiler_flags="$compiler_flags $arg" + finalize_command="$finalize_command $arg" + prev=xcompiler + continue + ;; + + -mt|-mthreads|-kthread|-Kthread|-pthread|-pthreads|--thread-safe) + compiler_flags="$compiler_flags $arg" + compile_command="$compile_command $arg" + finalize_command="$finalize_command $arg" + continue + ;; + + -module) + module=yes + continue + ;; + + # -64, -mips[0-9] enable 64-bit mode on the SGI compiler + # -r[0-9][0-9]* specifies the processor on the SGI compiler + # -xarch=*, -xtarget=* enable 64-bit mode on the Sun compiler + # +DA*, +DD* enable 64-bit mode on the HP compiler + # -q* pass through compiler args for the IBM compiler + # -m* pass through architecture-specific compiler args for GCC + # -m*, -t[45]*, -txscale* pass through architecture-specific + # compiler args for GCC + # -pg pass through profiling flag for GCC + # @file GCC response files + -64|-mips[0-9]|-r[0-9][0-9]*|-xarch=*|-xtarget=*|+DA*|+DD*|-q*|-m*|-pg| \ + -t[45]*|-txscale*|@*) + + # Unknown arguments in both finalize_command and compile_command need + # to be aesthetically quoted because they are evaled later. + arg=`$echo "X$arg" | $Xsed -e "$sed_quote_subst"` + case $arg in + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"") + arg="\"$arg\"" + ;; + esac + compile_command="$compile_command $arg" + finalize_command="$finalize_command $arg" + compiler_flags="$compiler_flags $arg" + continue + ;; + + -shrext) + prev=shrext + continue + ;; + + -no-fast-install) + fast_install=no + continue + ;; + + -no-install) + case $host in + *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-os2*) + # The PATH hackery in wrapper scripts is required on Windows + # in order for the loader to find any dlls it needs. + $echo "$modename: warning: \`-no-install' is ignored for $host" 1>&2 + $echo "$modename: warning: assuming \`-no-fast-install' instead" 1>&2 + fast_install=no + ;; + *) no_install=yes ;; + esac + continue + ;; + + -no-undefined) + allow_undefined=no + continue + ;; + + -objectlist) + prev=objectlist + continue + ;; + + -o) prev=output ;; + + -precious-files-regex) + prev=precious_regex + continue + ;; + + -release) + prev=release + continue + ;; + + -rpath) + prev=rpath + continue + ;; + + -R) + prev=xrpath + continue + ;; + + -R*) + dir=`$echo "X$arg" | $Xsed -e 's/^-R//'` + # We need an absolute path. + case $dir in + [\\/]* | [A-Za-z]:[\\/]*) ;; + *) + $echo "$modename: only absolute run-paths are allowed" 1>&2 + exit $EXIT_FAILURE + ;; + esac + case "$xrpath " in + *" $dir "*) ;; + *) xrpath="$xrpath $dir" ;; + esac + continue + ;; + + -static | -static-libtool-libs) + # The effects of -static are defined in a previous loop. + # We used to do the same as -all-static on platforms that + # didn't have a PIC flag, but the assumption that the effects + # would be equivalent was wrong. It would break on at least + # Digital Unix and AIX. + continue + ;; + + -thread-safe) + thread_safe=yes + continue + ;; + + -version-info) + prev=vinfo + continue + ;; + -version-number) + prev=vinfo + vinfo_number=yes + continue + ;; + + -Wc,*) + args=`$echo "X$arg" | $Xsed -e "$sed_quote_subst" -e 's/^-Wc,//'` + arg= + save_ifs="$IFS"; IFS=',' + for flag in $args; do + IFS="$save_ifs" + case $flag in + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"") + flag="\"$flag\"" + ;; + esac + arg="$arg $wl$flag" + compiler_flags="$compiler_flags $flag" + done + IFS="$save_ifs" + arg=`$echo "X$arg" | $Xsed -e "s/^ //"` + ;; + + -Wl,*) + args=`$echo "X$arg" | $Xsed -e "$sed_quote_subst" -e 's/^-Wl,//'` + arg= + save_ifs="$IFS"; IFS=',' + for flag in $args; do + IFS="$save_ifs" + case $flag in + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"") + flag="\"$flag\"" + ;; + esac + arg="$arg $wl$flag" + compiler_flags="$compiler_flags $wl$flag" + linker_flags="$linker_flags $flag" + done + IFS="$save_ifs" + arg=`$echo "X$arg" | $Xsed -e "s/^ //"` + ;; + + -Xcompiler) + prev=xcompiler + continue + ;; + + -Xlinker) + prev=xlinker + continue + ;; + + -XCClinker) + prev=xcclinker + continue + ;; + + # Some other compiler flag. + -* | +*) + # Unknown arguments in both finalize_command and compile_command need + # to be aesthetically quoted because they are evaled later. + arg=`$echo "X$arg" | $Xsed -e "$sed_quote_subst"` + case $arg in + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"") + arg="\"$arg\"" + ;; + esac + ;; + + *.$objext) + # A standard object. + objs="$objs $arg" + ;; + + *.lo) + # A libtool-controlled object. + + # Check to see that this really is a libtool object. + if (${SED} -e '2q' $arg | grep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then + pic_object= + non_pic_object= + + # Read the .lo file + # If there is no directory component, then add one. + case $arg in + */* | *\\*) . $arg ;; + *) . ./$arg ;; + esac + + if test -z "$pic_object" || \ + test -z "$non_pic_object" || + test "$pic_object" = none && \ + test "$non_pic_object" = none; then + $echo "$modename: cannot find name of object for \`$arg'" 1>&2 + exit $EXIT_FAILURE + fi + + # Extract subdirectory from the argument. + xdir=`$echo "X$arg" | $Xsed -e 's%/[^/]*$%%'` + if test "X$xdir" = "X$arg"; then + xdir= + else + xdir="$xdir/" + fi + + if test "$pic_object" != none; then + # Prepend the subdirectory the object is found in. + pic_object="$xdir$pic_object" + + if test "$prev" = dlfiles; then + if test "$build_libtool_libs" = yes && test "$dlopen_support" = yes; then + dlfiles="$dlfiles $pic_object" + prev= + continue + else + # If libtool objects are unsupported, then we need to preload. + prev=dlprefiles + fi + fi + + # CHECK ME: I think I busted this. -Ossama + if test "$prev" = dlprefiles; then + # Preload the old-style object. + dlprefiles="$dlprefiles $pic_object" + prev= + fi + + # A PIC object. + libobjs="$libobjs $pic_object" + arg="$pic_object" + fi + + # Non-PIC object. + if test "$non_pic_object" != none; then + # Prepend the subdirectory the object is found in. + non_pic_object="$xdir$non_pic_object" + + # A standard non-PIC object + non_pic_objects="$non_pic_objects $non_pic_object" + if test -z "$pic_object" || test "$pic_object" = none ; then + arg="$non_pic_object" + fi + else + # If the PIC object exists, use it instead. + # $xdir was prepended to $pic_object above. + non_pic_object="$pic_object" + non_pic_objects="$non_pic_objects $non_pic_object" + fi + else + # Only an error if not doing a dry-run. + if test -z "$run"; then + $echo "$modename: \`$arg' is not a valid libtool object" 1>&2 + exit $EXIT_FAILURE + else + # Dry-run case. + + # Extract subdirectory from the argument. + xdir=`$echo "X$arg" | $Xsed -e 's%/[^/]*$%%'` + if test "X$xdir" = "X$arg"; then + xdir= + else + xdir="$xdir/" + fi + + pic_object=`$echo "X${xdir}${objdir}/${arg}" | $Xsed -e "$lo2o"` + non_pic_object=`$echo "X${xdir}${arg}" | $Xsed -e "$lo2o"` + libobjs="$libobjs $pic_object" + non_pic_objects="$non_pic_objects $non_pic_object" + fi + fi + ;; + + *.$libext) + # An archive. + deplibs="$deplibs $arg" + old_deplibs="$old_deplibs $arg" + continue + ;; + + *.la) + # A libtool-controlled library. + + if test "$prev" = dlfiles; then + # This library was specified with -dlopen. + dlfiles="$dlfiles $arg" + prev= + elif test "$prev" = dlprefiles; then + # The library was specified with -dlpreopen. + dlprefiles="$dlprefiles $arg" + prev= + else + deplibs="$deplibs $arg" + fi + continue + ;; + + # Some other compiler argument. + *) + # Unknown arguments in both finalize_command and compile_command need + # to be aesthetically quoted because they are evaled later. + arg=`$echo "X$arg" | $Xsed -e "$sed_quote_subst"` + case $arg in + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"") + arg="\"$arg\"" + ;; + esac + ;; + esac # arg + + # Now actually substitute the argument into the commands. + if test -n "$arg"; then + compile_command="$compile_command $arg" + finalize_command="$finalize_command $arg" + fi + done # argument parsing loop + + if test -n "$prev"; then + $echo "$modename: the \`$prevarg' option requires an argument" 1>&2 + $echo "$help" 1>&2 + exit $EXIT_FAILURE + fi + + if test "$export_dynamic" = yes && test -n "$export_dynamic_flag_spec"; then + eval arg=\"$export_dynamic_flag_spec\" + compile_command="$compile_command $arg" + finalize_command="$finalize_command $arg" + fi + + oldlibs= + # calculate the name of the file, without its directory + outputname=`$echo "X$output" | $Xsed -e 's%^.*/%%'` + libobjs_save="$libobjs" + + if test -n "$shlibpath_var"; then + # get the directories listed in $shlibpath_var + eval shlib_search_path=\`\$echo \"X\${$shlibpath_var}\" \| \$Xsed -e \'s/:/ /g\'\` + else + shlib_search_path= + fi + eval sys_lib_search_path=\"$sys_lib_search_path_spec\" + eval sys_lib_dlsearch_path=\"$sys_lib_dlsearch_path_spec\" + + output_objdir=`$echo "X$output" | $Xsed -e 's%/[^/]*$%%'` + if test "X$output_objdir" = "X$output"; then + output_objdir="$objdir" + else + output_objdir="$output_objdir/$objdir" + fi + # Create the object directory. + if test ! -d "$output_objdir"; then + $show "$mkdir $output_objdir" + $run $mkdir $output_objdir + exit_status=$? + if test "$exit_status" -ne 0 && test ! -d "$output_objdir"; then + exit $exit_status + fi + fi + + # Determine the type of output + case $output in + "") + $echo "$modename: you must specify an output file" 1>&2 + $echo "$help" 1>&2 + exit $EXIT_FAILURE + ;; + *.$libext) linkmode=oldlib ;; + *.lo | *.$objext) linkmode=obj ;; + *.la) linkmode=lib ;; + *) linkmode=prog ;; # Anything else should be a program. + esac + + case $host in + *cygwin* | *mingw* | *pw32*) + # don't eliminate duplications in $postdeps and $predeps + duplicate_compiler_generated_deps=yes + ;; + *) + duplicate_compiler_generated_deps=$duplicate_deps + ;; + esac + specialdeplibs= + + libs= + # Find all interdependent deplibs by searching for libraries + # that are linked more than once (e.g. -la -lb -la) + for deplib in $deplibs; do + if test "X$duplicate_deps" = "Xyes" ; then + case "$libs " in + *" $deplib "*) specialdeplibs="$specialdeplibs $deplib" ;; + esac + fi + libs="$libs $deplib" + done + + if test "$linkmode" = lib; then + libs="$predeps $libs $compiler_lib_search_path $postdeps" + + # Compute libraries that are listed more than once in $predeps + # $postdeps and mark them as special (i.e., whose duplicates are + # not to be eliminated). + pre_post_deps= + if test "X$duplicate_compiler_generated_deps" = "Xyes" ; then + for pre_post_dep in $predeps $postdeps; do + case "$pre_post_deps " in + *" $pre_post_dep "*) specialdeplibs="$specialdeplibs $pre_post_deps" ;; + esac + pre_post_deps="$pre_post_deps $pre_post_dep" + done + fi + pre_post_deps= + fi + + deplibs= + newdependency_libs= + newlib_search_path= + need_relink=no # whether we're linking any uninstalled libtool libraries + notinst_deplibs= # not-installed libtool libraries + case $linkmode in + lib) + passes="conv link" + for file in $dlfiles $dlprefiles; do + case $file in + *.la) ;; + *) + $echo "$modename: libraries can \`-dlopen' only libtool libraries: $file" 1>&2 + exit $EXIT_FAILURE + ;; + esac + done + ;; + prog) + compile_deplibs= + finalize_deplibs= + alldeplibs=no + newdlfiles= + newdlprefiles= + passes="conv scan dlopen dlpreopen link" + ;; + *) passes="conv" + ;; + esac + for pass in $passes; do + if test "$linkmode,$pass" = "lib,link" || + test "$linkmode,$pass" = "prog,scan"; then + libs="$deplibs" + deplibs= + fi + if test "$linkmode" = prog; then + case $pass in + dlopen) libs="$dlfiles" ;; + dlpreopen) libs="$dlprefiles" ;; + link) libs="$deplibs %DEPLIBS% $dependency_libs" ;; + esac + fi + if test "$pass" = dlopen; then + # Collect dlpreopened libraries + save_deplibs="$deplibs" + deplibs= + fi + for deplib in $libs; do + lib= + found=no + case $deplib in + -mt|-mthreads|-kthread|-Kthread|-pthread|-pthreads|--thread-safe) + if test "$linkmode,$pass" = "prog,link"; then + compile_deplibs="$deplib $compile_deplibs" + finalize_deplibs="$deplib $finalize_deplibs" + else + compiler_flags="$compiler_flags $deplib" + fi + continue + ;; + -l*) + if test "$linkmode" != lib && test "$linkmode" != prog; then + $echo "$modename: warning: \`-l' is ignored for archives/objects" 1>&2 + continue + fi + name=`$echo "X$deplib" | $Xsed -e 's/^-l//'` + for searchdir in $newlib_search_path $lib_search_path $sys_lib_search_path $shlib_search_path; do + for search_ext in .la $std_shrext .so .a; do + # Search the libtool library + lib="$searchdir/lib${name}${search_ext}" + if test -f "$lib"; then + if test "$search_ext" = ".la"; then + found=yes + else + found=no + fi + break 2 + fi + done + done + if test "$found" != yes; then + # deplib doesn't seem to be a libtool library + if test "$linkmode,$pass" = "prog,link"; then + compile_deplibs="$deplib $compile_deplibs" + finalize_deplibs="$deplib $finalize_deplibs" + else + deplibs="$deplib $deplibs" + test "$linkmode" = lib && newdependency_libs="$deplib $newdependency_libs" + fi + continue + else # deplib is a libtool library + # If $allow_libtool_libs_with_static_runtimes && $deplib is a stdlib, + # We need to do some special things here, and not later. + if test "X$allow_libtool_libs_with_static_runtimes" = "Xyes" ; then + case " $predeps $postdeps " in + *" $deplib "*) + if (${SED} -e '2q' $lib | + grep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then + library_names= + old_library= + case $lib in + */* | *\\*) . $lib ;; + *) . ./$lib ;; + esac + for l in $old_library $library_names; do + ll="$l" + done + if test "X$ll" = "X$old_library" ; then # only static version available + found=no + ladir=`$echo "X$lib" | $Xsed -e 's%/[^/]*$%%'` + test "X$ladir" = "X$lib" && ladir="." + lib=$ladir/$old_library + if test "$linkmode,$pass" = "prog,link"; then + compile_deplibs="$deplib $compile_deplibs" + finalize_deplibs="$deplib $finalize_deplibs" + else + deplibs="$deplib $deplibs" + test "$linkmode" = lib && newdependency_libs="$deplib $newdependency_libs" + fi + continue + fi + fi + ;; + *) ;; + esac + fi + fi + ;; # -l + -L*) + case $linkmode in + lib) + deplibs="$deplib $deplibs" + test "$pass" = conv && continue + newdependency_libs="$deplib $newdependency_libs" + newlib_search_path="$newlib_search_path "`$echo "X$deplib" | $Xsed -e 's/^-L//'` + ;; + prog) + if test "$pass" = conv; then + deplibs="$deplib $deplibs" + continue + fi + if test "$pass" = scan; then + deplibs="$deplib $deplibs" + else + compile_deplibs="$deplib $compile_deplibs" + finalize_deplibs="$deplib $finalize_deplibs" + fi + newlib_search_path="$newlib_search_path "`$echo "X$deplib" | $Xsed -e 's/^-L//'` + ;; + *) + $echo "$modename: warning: \`-L' is ignored for archives/objects" 1>&2 + ;; + esac # linkmode + continue + ;; # -L + -R*) + if test "$pass" = link; then + dir=`$echo "X$deplib" | $Xsed -e 's/^-R//'` + # Make sure the xrpath contains only unique directories. + case "$xrpath " in + *" $dir "*) ;; + *) xrpath="$xrpath $dir" ;; + esac + fi + deplibs="$deplib $deplibs" + continue + ;; + *.la) lib="$deplib" ;; + *.$libext) + if test "$pass" = conv; then + deplibs="$deplib $deplibs" + continue + fi + case $linkmode in + lib) + valid_a_lib=no + case $deplibs_check_method in + match_pattern*) + set dummy $deplibs_check_method + match_pattern_regex=`expr "$deplibs_check_method" : "$2 \(.*\)"` + if eval $echo \"$deplib\" 2>/dev/null \ + | $SED 10q \ + | $EGREP "$match_pattern_regex" > /dev/null; then + valid_a_lib=yes + fi + ;; + pass_all) + valid_a_lib=yes + ;; + esac + if test "$valid_a_lib" != yes; then + $echo + $echo "*** Warning: Trying to link with static lib archive $deplib." + $echo "*** I have the capability to make that library automatically link in when" + $echo "*** you link to this library. But I can only do this if you have a" + $echo "*** shared version of the library, which you do not appear to have" + $echo "*** because the file extensions .$libext of this argument makes me believe" + $echo "*** that it is just a static archive that I should not used here." + else + $echo + $echo "*** Warning: Linking the shared library $output against the" + $echo "*** static library $deplib is not portable!" + deplibs="$deplib $deplibs" + fi + continue + ;; + prog) + if test "$pass" != link; then + deplibs="$deplib $deplibs" + else + compile_deplibs="$deplib $compile_deplibs" + finalize_deplibs="$deplib $finalize_deplibs" + fi + continue + ;; + esac # linkmode + ;; # *.$libext + *.lo | *.$objext) + if test "$pass" = conv; then + deplibs="$deplib $deplibs" + elif test "$linkmode" = prog; then + if test "$pass" = dlpreopen || test "$dlopen_support" != yes || test "$build_libtool_libs" = no; then + # If there is no dlopen support or we're linking statically, + # we need to preload. + newdlprefiles="$newdlprefiles $deplib" + compile_deplibs="$deplib $compile_deplibs" + finalize_deplibs="$deplib $finalize_deplibs" + else + newdlfiles="$newdlfiles $deplib" + fi + fi + continue + ;; + %DEPLIBS%) + alldeplibs=yes + continue + ;; + esac # case $deplib + if test "$found" = yes || test -f "$lib"; then : + else + $echo "$modename: cannot find the library \`$lib' or unhandled argument \`$deplib'" 1>&2 + exit $EXIT_FAILURE + fi + + # Check to see that this really is a libtool archive. + if (${SED} -e '2q' $lib | grep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then : + else + $echo "$modename: \`$lib' is not a valid libtool archive" 1>&2 + exit $EXIT_FAILURE + fi + + ladir=`$echo "X$lib" | $Xsed -e 's%/[^/]*$%%'` + test "X$ladir" = "X$lib" && ladir="." + + dlname= + dlopen= + dlpreopen= + libdir= + library_names= + old_library= + # If the library was installed with an old release of libtool, + # it will not redefine variables installed, or shouldnotlink + installed=yes + shouldnotlink=no + avoidtemprpath= + + + # Read the .la file + case $lib in + */* | *\\*) . $lib ;; + *) . ./$lib ;; + esac + + if test "$linkmode,$pass" = "lib,link" || + test "$linkmode,$pass" = "prog,scan" || + { test "$linkmode" != prog && test "$linkmode" != lib; }; then + test -n "$dlopen" && dlfiles="$dlfiles $dlopen" + test -n "$dlpreopen" && dlprefiles="$dlprefiles $dlpreopen" + fi + + if test "$pass" = conv; then + # Only check for convenience libraries + deplibs="$lib $deplibs" + if test -z "$libdir"; then + if test -z "$old_library"; then + $echo "$modename: cannot find name of link library for \`$lib'" 1>&2 + exit $EXIT_FAILURE + fi + # It is a libtool convenience library, so add in its objects. + convenience="$convenience $ladir/$objdir/$old_library" + old_convenience="$old_convenience $ladir/$objdir/$old_library" + tmp_libs= + for deplib in $dependency_libs; do + deplibs="$deplib $deplibs" + if test "X$duplicate_deps" = "Xyes" ; then + case "$tmp_libs " in + *" $deplib "*) specialdeplibs="$specialdeplibs $deplib" ;; + esac + fi + tmp_libs="$tmp_libs $deplib" + done + elif test "$linkmode" != prog && test "$linkmode" != lib; then + $echo "$modename: \`$lib' is not a convenience library" 1>&2 + exit $EXIT_FAILURE + fi + continue + fi # $pass = conv + + + # Get the name of the library we link against. + linklib= + for l in $old_library $library_names; do + linklib="$l" + done + if test -z "$linklib"; then + $echo "$modename: cannot find name of link library for \`$lib'" 1>&2 + exit $EXIT_FAILURE + fi + + # This library was specified with -dlopen. + if test "$pass" = dlopen; then + if test -z "$libdir"; then + $echo "$modename: cannot -dlopen a convenience library: \`$lib'" 1>&2 + exit $EXIT_FAILURE + fi + if test -z "$dlname" || + test "$dlopen_support" != yes || + test "$build_libtool_libs" = no; then + # If there is no dlname, no dlopen support or we're linking + # statically, we need to preload. We also need to preload any + # dependent libraries so libltdl's deplib preloader doesn't + # bomb out in the load deplibs phase. + dlprefiles="$dlprefiles $lib $dependency_libs" + else + newdlfiles="$newdlfiles $lib" + fi + continue + fi # $pass = dlopen + + # We need an absolute path. + case $ladir in + [\\/]* | [A-Za-z]:[\\/]*) abs_ladir="$ladir" ;; + *) + abs_ladir=`cd "$ladir" && pwd` + if test -z "$abs_ladir"; then + $echo "$modename: warning: cannot determine absolute directory name of \`$ladir'" 1>&2 + $echo "$modename: passing it literally to the linker, although it might fail" 1>&2 + abs_ladir="$ladir" + fi + ;; + esac + laname=`$echo "X$lib" | $Xsed -e 's%^.*/%%'` + + # Find the relevant object directory and library name. + if test "X$installed" = Xyes; then + if test ! -f "$libdir/$linklib" && test -f "$abs_ladir/$linklib"; then + $echo "$modename: warning: library \`$lib' was moved." 1>&2 + dir="$ladir" + absdir="$abs_ladir" + libdir="$abs_ladir" + else + dir="$libdir" + absdir="$libdir" + fi + test "X$hardcode_automatic" = Xyes && avoidtemprpath=yes + else + if test ! -f "$ladir/$objdir/$linklib" && test -f "$abs_ladir/$linklib"; then + dir="$ladir" + absdir="$abs_ladir" + # Remove this search path later + notinst_path="$notinst_path $abs_ladir" + else + dir="$ladir/$objdir" + absdir="$abs_ladir/$objdir" + # Remove this search path later + notinst_path="$notinst_path $abs_ladir" + fi + fi # $installed = yes + name=`$echo "X$laname" | $Xsed -e 's/\.la$//' -e 's/^lib//'` + + # This library was specified with -dlpreopen. + if test "$pass" = dlpreopen; then + if test -z "$libdir"; then + $echo "$modename: cannot -dlpreopen a convenience library: \`$lib'" 1>&2 + exit $EXIT_FAILURE + fi + # Prefer using a static library (so that no silly _DYNAMIC symbols + # are required to link). + if test -n "$old_library"; then + newdlprefiles="$newdlprefiles $dir/$old_library" + # Otherwise, use the dlname, so that lt_dlopen finds it. + elif test -n "$dlname"; then + newdlprefiles="$newdlprefiles $dir/$dlname" + else + newdlprefiles="$newdlprefiles $dir/$linklib" + fi + fi # $pass = dlpreopen + + if test -z "$libdir"; then + # Link the convenience library + if test "$linkmode" = lib; then + deplibs="$dir/$old_library $deplibs" + elif test "$linkmode,$pass" = "prog,link"; then + compile_deplibs="$dir/$old_library $compile_deplibs" + finalize_deplibs="$dir/$old_library $finalize_deplibs" + else + deplibs="$lib $deplibs" # used for prog,scan pass + fi + continue + fi + + + if test "$linkmode" = prog && test "$pass" != link; then + newlib_search_path="$newlib_search_path $ladir" + deplibs="$lib $deplibs" + + linkalldeplibs=no + if test "$link_all_deplibs" != no || test -z "$library_names" || + test "$build_libtool_libs" = no; then + linkalldeplibs=yes + fi + + tmp_libs= + for deplib in $dependency_libs; do + case $deplib in + -L*) newlib_search_path="$newlib_search_path "`$echo "X$deplib" | $Xsed -e 's/^-L//'`;; ### testsuite: skip nested quoting test + esac + # Need to link against all dependency_libs? + if test "$linkalldeplibs" = yes; then + deplibs="$deplib $deplibs" + else + # Need to hardcode shared library paths + # or/and link against static libraries + newdependency_libs="$deplib $newdependency_libs" + fi + if test "X$duplicate_deps" = "Xyes" ; then + case "$tmp_libs " in + *" $deplib "*) specialdeplibs="$specialdeplibs $deplib" ;; + esac + fi + tmp_libs="$tmp_libs $deplib" + done # for deplib + continue + fi # $linkmode = prog... + + if test "$linkmode,$pass" = "prog,link"; then + if test -n "$library_names" && + { { test "$prefer_static_libs" = no || + test "$prefer_static_libs,$installed" = "built,yes"; } || + test -z "$old_library"; }; then + # We need to hardcode the library path + if test -n "$shlibpath_var" && test -z "$avoidtemprpath" ; then + # Make sure the rpath contains only unique directories. + case "$temp_rpath " in + *" $dir "*) ;; + *" $absdir "*) ;; + *) temp_rpath="$temp_rpath $absdir" ;; + esac + fi + + # Hardcode the library path. + # Skip directories that are in the system default run-time + # search path. + case " $sys_lib_dlsearch_path " in + *" $absdir "*) ;; + *) + case "$compile_rpath " in + *" $absdir "*) ;; + *) compile_rpath="$compile_rpath $absdir" + esac + ;; + esac + case " $sys_lib_dlsearch_path " in + *" $libdir "*) ;; + *) + case "$finalize_rpath " in + *" $libdir "*) ;; + *) finalize_rpath="$finalize_rpath $libdir" + esac + ;; + esac + fi # $linkmode,$pass = prog,link... + + if test "$alldeplibs" = yes && + { test "$deplibs_check_method" = pass_all || + { test "$build_libtool_libs" = yes && + test -n "$library_names"; }; }; then + # We only need to search for static libraries + continue + fi + fi + + link_static=no # Whether the deplib will be linked statically + use_static_libs=$prefer_static_libs + if test "$use_static_libs" = built && test "$installed" = yes ; then + use_static_libs=no + fi + if test -n "$library_names" && + { test "$use_static_libs" = no || test -z "$old_library"; }; then + if test "$installed" = no; then + notinst_deplibs="$notinst_deplibs $lib" + need_relink=yes + fi + # This is a shared library + + # Warn about portability, can't link against -module's on + # some systems (darwin) + if test "$shouldnotlink" = yes && test "$pass" = link ; then + $echo + if test "$linkmode" = prog; then + $echo "*** Warning: Linking the executable $output against the loadable module" + else + $echo "*** Warning: Linking the shared library $output against the loadable module" + fi + $echo "*** $linklib is not portable!" + fi + if test "$linkmode" = lib && + test "$hardcode_into_libs" = yes; then + # Hardcode the library path. + # Skip directories that are in the system default run-time + # search path. + case " $sys_lib_dlsearch_path " in + *" $absdir "*) ;; + *) + case "$compile_rpath " in + *" $absdir "*) ;; + *) compile_rpath="$compile_rpath $absdir" + esac + ;; + esac + case " $sys_lib_dlsearch_path " in + *" $libdir "*) ;; + *) + case "$finalize_rpath " in + *" $libdir "*) ;; + *) finalize_rpath="$finalize_rpath $libdir" + esac + ;; + esac + fi + + if test -n "$old_archive_from_expsyms_cmds"; then + # figure out the soname + set dummy $library_names + realname="$2" + shift; shift + libname=`eval \\$echo \"$libname_spec\"` + # use dlname if we got it. it's perfectly good, no? + if test -n "$dlname"; then + soname="$dlname" + elif test -n "$soname_spec"; then + # bleh windows + case $host in + *cygwin* | mingw*) + major=`expr $current - $age` + versuffix="-$major" + ;; + esac + eval soname=\"$soname_spec\" + else + soname="$realname" + fi + + # Make a new name for the extract_expsyms_cmds to use + soroot="$soname" + soname=`$echo $soroot | ${SED} -e 's/^.*\///'` + newlib="libimp-`$echo $soname | ${SED} 's/^lib//;s/\.dll$//'`.a" + + # If the library has no export list, then create one now + if test -f "$output_objdir/$soname-def"; then : + else + $show "extracting exported symbol list from \`$soname'" + save_ifs="$IFS"; IFS='~' + cmds=$extract_expsyms_cmds + for cmd in $cmds; do + IFS="$save_ifs" + eval cmd=\"$cmd\" + $show "$cmd" + $run eval "$cmd" || exit $? + done + IFS="$save_ifs" + fi + + # Create $newlib + if test -f "$output_objdir/$newlib"; then :; else + $show "generating import library for \`$soname'" + save_ifs="$IFS"; IFS='~' + cmds=$old_archive_from_expsyms_cmds + for cmd in $cmds; do + IFS="$save_ifs" + eval cmd=\"$cmd\" + $show "$cmd" + $run eval "$cmd" || exit $? + done + IFS="$save_ifs" + fi + # make sure the library variables are pointing to the new library + dir=$output_objdir + linklib=$newlib + fi # test -n "$old_archive_from_expsyms_cmds" + + if test "$linkmode" = prog || test "$mode" != relink; then + add_shlibpath= + add_dir= + add= + lib_linked=yes + case $hardcode_action in + immediate | unsupported) + if test "$hardcode_direct" = no; then + add="$dir/$linklib" + case $host in + *-*-sco3.2v5.0.[024]*) add_dir="-L$dir" ;; + *-*-sysv4*uw2*) add_dir="-L$dir" ;; + *-*-sysv5OpenUNIX* | *-*-sysv5UnixWare7.[01].[10]* | \ + *-*-unixware7*) add_dir="-L$dir" ;; + *-*-darwin* ) + # if the lib is a module then we can not link against + # it, someone is ignoring the new warnings I added + if /usr/bin/file -L $add 2> /dev/null | + $EGREP ": [^:]* bundle" >/dev/null ; then + $echo "** Warning, lib $linklib is a module, not a shared library" + if test -z "$old_library" ; then + $echo + $echo "** And there doesn't seem to be a static archive available" + $echo "** The link will probably fail, sorry" + else + add="$dir/$old_library" + fi + fi + esac + elif test "$hardcode_minus_L" = no; then + case $host in + *-*-sunos*) add_shlibpath="$dir" ;; + esac + add_dir="-L$dir" + add="-l$name" + elif test "$hardcode_shlibpath_var" = no; then + add_shlibpath="$dir" + add="-l$name" + else + lib_linked=no + fi + ;; + relink) + if test "$hardcode_direct" = yes; then + add="$dir/$linklib" + elif test "$hardcode_minus_L" = yes; then + add_dir="-L$dir" + # Try looking first in the location we're being installed to. + if test -n "$inst_prefix_dir"; then + case $libdir in + [\\/]*) + add_dir="$add_dir -L$inst_prefix_dir$libdir" + ;; + esac + fi + add="-l$name" + elif test "$hardcode_shlibpath_var" = yes; then + add_shlibpath="$dir" + add="-l$name" + else + lib_linked=no + fi + ;; + *) lib_linked=no ;; + esac + + if test "$lib_linked" != yes; then + $echo "$modename: configuration error: unsupported hardcode properties" + exit $EXIT_FAILURE + fi + + if test -n "$add_shlibpath"; then + case :$compile_shlibpath: in + *":$add_shlibpath:"*) ;; + *) compile_shlibpath="$compile_shlibpath$add_shlibpath:" ;; + esac + fi + if test "$linkmode" = prog; then + test -n "$add_dir" && compile_deplibs="$add_dir $compile_deplibs" + test -n "$add" && compile_deplibs="$add $compile_deplibs" + else + test -n "$add_dir" && deplibs="$add_dir $deplibs" + test -n "$add" && deplibs="$add $deplibs" + if test "$hardcode_direct" != yes && \ + test "$hardcode_minus_L" != yes && \ + test "$hardcode_shlibpath_var" = yes; then + case :$finalize_shlibpath: in + *":$libdir:"*) ;; + *) finalize_shlibpath="$finalize_shlibpath$libdir:" ;; + esac + fi + fi + fi + + if test "$linkmode" = prog || test "$mode" = relink; then + add_shlibpath= + add_dir= + add= + # Finalize command for both is simple: just hardcode it. + if test "$hardcode_direct" = yes; then + add="$libdir/$linklib" + elif test "$hardcode_minus_L" = yes; then + add_dir="-L$libdir" + add="-l$name" + elif test "$hardcode_shlibpath_var" = yes; then + case :$finalize_shlibpath: in + *":$libdir:"*) ;; + *) finalize_shlibpath="$finalize_shlibpath$libdir:" ;; + esac + add="-l$name" + elif test "$hardcode_automatic" = yes; then + if test -n "$inst_prefix_dir" && + test -f "$inst_prefix_dir$libdir/$linklib" ; then + add="$inst_prefix_dir$libdir/$linklib" + else + add="$libdir/$linklib" + fi + else + # We cannot seem to hardcode it, guess we'll fake it. + add_dir="-L$libdir" + # Try looking first in the location we're being installed to. + if test -n "$inst_prefix_dir"; then + case $libdir in + [\\/]*) + add_dir="$add_dir -L$inst_prefix_dir$libdir" + ;; + esac + fi + add="-l$name" + fi + + if test "$linkmode" = prog; then + test -n "$add_dir" && finalize_deplibs="$add_dir $finalize_deplibs" + test -n "$add" && finalize_deplibs="$add $finalize_deplibs" + else + test -n "$add_dir" && deplibs="$add_dir $deplibs" + test -n "$add" && deplibs="$add $deplibs" + fi + fi + elif test "$linkmode" = prog; then + # Here we assume that one of hardcode_direct or hardcode_minus_L + # is not unsupported. This is valid on all known static and + # shared platforms. + if test "$hardcode_direct" != unsupported; then + test -n "$old_library" && linklib="$old_library" + compile_deplibs="$dir/$linklib $compile_deplibs" + finalize_deplibs="$dir/$linklib $finalize_deplibs" + else + compile_deplibs="-l$name -L$dir $compile_deplibs" + finalize_deplibs="-l$name -L$dir $finalize_deplibs" + fi + elif test "$build_libtool_libs" = yes; then + # Not a shared library + if test "$deplibs_check_method" != pass_all; then + # We're trying link a shared library against a static one + # but the system doesn't support it. + + # Just print a warning and add the library to dependency_libs so + # that the program can be linked against the static library. + $echo + $echo "*** Warning: This system can not link to static lib archive $lib." + $echo "*** I have the capability to make that library automatically link in when" + $echo "*** you link to this library. But I can only do this if you have a" + $echo "*** shared version of the library, which you do not appear to have." + if test "$module" = yes; then + $echo "*** But as you try to build a module library, libtool will still create " + $echo "*** a static module, that should work as long as the dlopening application" + $echo "*** is linked with the -dlopen flag to resolve symbols at runtime." + if test -z "$global_symbol_pipe"; then + $echo + $echo "*** However, this would only work if libtool was able to extract symbol" + $echo "*** lists from a program, using \`nm' or equivalent, but libtool could" + $echo "*** not find such a program. So, this module is probably useless." + $echo "*** \`nm' from GNU binutils and a full rebuild may help." + fi + if test "$build_old_libs" = no; then + build_libtool_libs=module + build_old_libs=yes + else + build_libtool_libs=no + fi + fi + else + deplibs="$dir/$old_library $deplibs" + link_static=yes + fi + fi # link shared/static library? + + if test "$linkmode" = lib; then + if test -n "$dependency_libs" && + { test "$hardcode_into_libs" != yes || + test "$build_old_libs" = yes || + test "$link_static" = yes; }; then + # Extract -R from dependency_libs + temp_deplibs= + for libdir in $dependency_libs; do + case $libdir in + -R*) temp_xrpath=`$echo "X$libdir" | $Xsed -e 's/^-R//'` + case " $xrpath " in + *" $temp_xrpath "*) ;; + *) xrpath="$xrpath $temp_xrpath";; + esac;; + *) temp_deplibs="$temp_deplibs $libdir";; + esac + done + dependency_libs="$temp_deplibs" + fi + + newlib_search_path="$newlib_search_path $absdir" + # Link against this library + test "$link_static" = no && newdependency_libs="$abs_ladir/$laname $newdependency_libs" + # ... and its dependency_libs + tmp_libs= + for deplib in $dependency_libs; do + newdependency_libs="$deplib $newdependency_libs" + if test "X$duplicate_deps" = "Xyes" ; then + case "$tmp_libs " in + *" $deplib "*) specialdeplibs="$specialdeplibs $deplib" ;; + esac + fi + tmp_libs="$tmp_libs $deplib" + done + + if test "$link_all_deplibs" != no; then + # Add the search paths of all dependency libraries + for deplib in $dependency_libs; do + case $deplib in + -L*) path="$deplib" ;; + *.la) + dir=`$echo "X$deplib" | $Xsed -e 's%/[^/]*$%%'` + test "X$dir" = "X$deplib" && dir="." + # We need an absolute path. + case $dir in + [\\/]* | [A-Za-z]:[\\/]*) absdir="$dir" ;; + *) + absdir=`cd "$dir" && pwd` + if test -z "$absdir"; then + $echo "$modename: warning: cannot determine absolute directory name of \`$dir'" 1>&2 + absdir="$dir" + fi + ;; + esac + if grep "^installed=no" $deplib > /dev/null; then + path="$absdir/$objdir" + else + eval libdir=`${SED} -n -e 's/^libdir=\(.*\)$/\1/p' $deplib` + if test -z "$libdir"; then + $echo "$modename: \`$deplib' is not a valid libtool archive" 1>&2 + exit $EXIT_FAILURE + fi + if test "$absdir" != "$libdir"; then + $echo "$modename: warning: \`$deplib' seems to be moved" 1>&2 + fi + path="$absdir" + fi + depdepl= + case $host in + *-*-darwin*) + # we do not want to link against static libs, + # but need to link against shared + eval deplibrary_names=`${SED} -n -e 's/^library_names=\(.*\)$/\1/p' $deplib` + if test -n "$deplibrary_names" ; then + for tmp in $deplibrary_names ; do + depdepl=$tmp + done + if test -f "$path/$depdepl" ; then + depdepl="$path/$depdepl" + fi + # do not add paths which are already there + case " $newlib_search_path " in + *" $path "*) ;; + *) newlib_search_path="$newlib_search_path $path";; + esac + fi + path="" + ;; + *) + path="-L$path" + ;; + esac + ;; + -l*) + case $host in + *-*-darwin*) + # Again, we only want to link against shared libraries + eval tmp_libs=`$echo "X$deplib" | $Xsed -e "s,^\-l,,"` + for tmp in $newlib_search_path ; do + if test -f "$tmp/lib$tmp_libs.dylib" ; then + eval depdepl="$tmp/lib$tmp_libs.dylib" + break + fi + done + path="" + ;; + *) continue ;; + esac + ;; + *) continue ;; + esac + case " $deplibs " in + *" $path "*) ;; + *) deplibs="$path $deplibs" ;; + esac + case " $deplibs " in + *" $depdepl "*) ;; + *) deplibs="$depdepl $deplibs" ;; + esac + done + fi # link_all_deplibs != no + fi # linkmode = lib + done # for deplib in $libs + dependency_libs="$newdependency_libs" + if test "$pass" = dlpreopen; then + # Link the dlpreopened libraries before other libraries + for deplib in $save_deplibs; do + deplibs="$deplib $deplibs" + done + fi + if test "$pass" != dlopen; then + if test "$pass" != conv; then + # Make sure lib_search_path contains only unique directories. + lib_search_path= + for dir in $newlib_search_path; do + case "$lib_search_path " in + *" $dir "*) ;; + *) lib_search_path="$lib_search_path $dir" ;; + esac + done + newlib_search_path= + fi + + if test "$linkmode,$pass" != "prog,link"; then + vars="deplibs" + else + vars="compile_deplibs finalize_deplibs" + fi + for var in $vars dependency_libs; do + # Add libraries to $var in reverse order + eval tmp_libs=\"\$$var\" + new_libs= + for deplib in $tmp_libs; do + # FIXME: Pedantically, this is the right thing to do, so + # that some nasty dependency loop isn't accidentally + # broken: + #new_libs="$deplib $new_libs" + # Pragmatically, this seems to cause very few problems in + # practice: + case $deplib in + -L*) new_libs="$deplib $new_libs" ;; + -R*) ;; + *) + # And here is the reason: when a library appears more + # than once as an explicit dependence of a library, or + # is implicitly linked in more than once by the + # compiler, it is considered special, and multiple + # occurrences thereof are not removed. Compare this + # with having the same library being listed as a + # dependency of multiple other libraries: in this case, + # we know (pedantically, we assume) the library does not + # need to be listed more than once, so we keep only the + # last copy. This is not always right, but it is rare + # enough that we require users that really mean to play + # such unportable linking tricks to link the library + # using -Wl,-lname, so that libtool does not consider it + # for duplicate removal. + case " $specialdeplibs " in + *" $deplib "*) new_libs="$deplib $new_libs" ;; + *) + case " $new_libs " in + *" $deplib "*) ;; + *) new_libs="$deplib $new_libs" ;; + esac + ;; + esac + ;; + esac + done + tmp_libs= + for deplib in $new_libs; do + case $deplib in + -L*) + case " $tmp_libs " in + *" $deplib "*) ;; + *) tmp_libs="$tmp_libs $deplib" ;; + esac + ;; + *) tmp_libs="$tmp_libs $deplib" ;; + esac + done + eval $var=\"$tmp_libs\" + done # for var + fi + # Last step: remove runtime libs from dependency_libs + # (they stay in deplibs) + tmp_libs= + for i in $dependency_libs ; do + case " $predeps $postdeps $compiler_lib_search_path " in + *" $i "*) + i="" + ;; + esac + if test -n "$i" ; then + tmp_libs="$tmp_libs $i" + fi + done + dependency_libs=$tmp_libs + done # for pass + if test "$linkmode" = prog; then + dlfiles="$newdlfiles" + dlprefiles="$newdlprefiles" + fi + + case $linkmode in + oldlib) + if test -n "$deplibs"; then + $echo "$modename: warning: \`-l' and \`-L' are ignored for archives" 1>&2 + fi + + if test -n "$dlfiles$dlprefiles" || test "$dlself" != no; then + $echo "$modename: warning: \`-dlopen' is ignored for archives" 1>&2 + fi + + if test -n "$rpath"; then + $echo "$modename: warning: \`-rpath' is ignored for archives" 1>&2 + fi + + if test -n "$xrpath"; then + $echo "$modename: warning: \`-R' is ignored for archives" 1>&2 + fi + + if test -n "$vinfo"; then + $echo "$modename: warning: \`-version-info/-version-number' is ignored for archives" 1>&2 + fi + + if test -n "$release"; then + $echo "$modename: warning: \`-release' is ignored for archives" 1>&2 + fi + + if test -n "$export_symbols" || test -n "$export_symbols_regex"; then + $echo "$modename: warning: \`-export-symbols' is ignored for archives" 1>&2 + fi + + # Now set the variables for building old libraries. + build_libtool_libs=no + oldlibs="$output" + objs="$objs$old_deplibs" + ;; + + lib) + # Make sure we only generate libraries of the form `libNAME.la'. + case $outputname in + lib*) + name=`$echo "X$outputname" | $Xsed -e 's/\.la$//' -e 's/^lib//'` + eval shared_ext=\"$shrext_cmds\" + eval libname=\"$libname_spec\" + ;; + *) + if test "$module" = no; then + $echo "$modename: libtool library \`$output' must begin with \`lib'" 1>&2 + $echo "$help" 1>&2 + exit $EXIT_FAILURE + fi + if test "$need_lib_prefix" != no; then + # Add the "lib" prefix for modules if required + name=`$echo "X$outputname" | $Xsed -e 's/\.la$//'` + eval shared_ext=\"$shrext_cmds\" + eval libname=\"$libname_spec\" + else + libname=`$echo "X$outputname" | $Xsed -e 's/\.la$//'` + fi + ;; + esac + + if test -n "$objs"; then + if test "$deplibs_check_method" != pass_all; then + $echo "$modename: cannot build libtool library \`$output' from non-libtool objects on this host:$objs" 2>&1 + exit $EXIT_FAILURE + else + $echo + $echo "*** Warning: Linking the shared library $output against the non-libtool" + $echo "*** objects $objs is not portable!" + libobjs="$libobjs $objs" + fi + fi + + if test "$dlself" != no; then + $echo "$modename: warning: \`-dlopen self' is ignored for libtool libraries" 1>&2 + fi + + set dummy $rpath + if test "$#" -gt 2; then + $echo "$modename: warning: ignoring multiple \`-rpath's for a libtool library" 1>&2 + fi + install_libdir="$2" + + oldlibs= + if test -z "$rpath"; then + if test "$build_libtool_libs" = yes; then + # Building a libtool convenience library. + # Some compilers have problems with a `.al' extension so + # convenience libraries should have the same extension an + # archive normally would. + oldlibs="$output_objdir/$libname.$libext $oldlibs" + build_libtool_libs=convenience + build_old_libs=yes + fi + + if test -n "$vinfo"; then + $echo "$modename: warning: \`-version-info/-version-number' is ignored for convenience libraries" 1>&2 + fi + + if test -n "$release"; then + $echo "$modename: warning: \`-release' is ignored for convenience libraries" 1>&2 + fi + else + + # Parse the version information argument. + save_ifs="$IFS"; IFS=':' + set dummy $vinfo 0 0 0 + IFS="$save_ifs" + + if test -n "$8"; then + $echo "$modename: too many parameters to \`-version-info'" 1>&2 + $echo "$help" 1>&2 + exit $EXIT_FAILURE + fi + + # convert absolute version numbers to libtool ages + # this retains compatibility with .la files and attempts + # to make the code below a bit more comprehensible + + case $vinfo_number in + yes) + number_major="$2" + number_minor="$3" + number_revision="$4" + # + # There are really only two kinds -- those that + # use the current revision as the major version + # and those that subtract age and use age as + # a minor version. But, then there is irix + # which has an extra 1 added just for fun + # + case $version_type in + darwin|linux|osf|windows|none) + current=`expr $number_major + $number_minor` + age="$number_minor" + revision="$number_revision" + ;; + freebsd-aout|freebsd-elf|sunos) + current="$number_major" + revision="$number_minor" + age="0" + ;; + irix|nonstopux) + current=`expr $number_major + $number_minor - 1` + age="$number_minor" + revision="$number_minor" + ;; + esac + ;; + no) + current="$2" + revision="$3" + age="$4" + ;; + esac + + # Check that each of the things are valid numbers. + case $current in + 0|[1-9]|[1-9][0-9]|[1-9][0-9][0-9]|[1-9][0-9][0-9][0-9]|[1-9][0-9][0-9][0-9][0-9]) ;; + *) + $echo "$modename: CURRENT \`$current' must be a nonnegative integer" 1>&2 + $echo "$modename: \`$vinfo' is not valid version information" 1>&2 + exit $EXIT_FAILURE + ;; + esac + + case $revision in + 0|[1-9]|[1-9][0-9]|[1-9][0-9][0-9]|[1-9][0-9][0-9][0-9]|[1-9][0-9][0-9][0-9][0-9]) ;; + *) + $echo "$modename: REVISION \`$revision' must be a nonnegative integer" 1>&2 + $echo "$modename: \`$vinfo' is not valid version information" 1>&2 + exit $EXIT_FAILURE + ;; + esac + + case $age in + 0|[1-9]|[1-9][0-9]|[1-9][0-9][0-9]|[1-9][0-9][0-9][0-9]|[1-9][0-9][0-9][0-9][0-9]) ;; + *) + $echo "$modename: AGE \`$age' must be a nonnegative integer" 1>&2 + $echo "$modename: \`$vinfo' is not valid version information" 1>&2 + exit $EXIT_FAILURE + ;; + esac + + if test "$age" -gt "$current"; then + $echo "$modename: AGE \`$age' is greater than the current interface number \`$current'" 1>&2 + $echo "$modename: \`$vinfo' is not valid version information" 1>&2 + exit $EXIT_FAILURE + fi + + # Calculate the version variables. + major= + versuffix= + verstring= + case $version_type in + none) ;; + + darwin) + # Like Linux, but with the current version available in + # verstring for coding it into the library header + major=.`expr $current - $age` + versuffix="$major.$age.$revision" + # Darwin ld doesn't like 0 for these options... + minor_current=`expr $current + 1` + verstring="${wl}-compatibility_version ${wl}$minor_current ${wl}-current_version ${wl}$minor_current.$revision" + ;; + + freebsd-aout) + major=".$current" + versuffix=".$current.$revision"; + ;; + + freebsd-elf) + major=".$current" + versuffix=".$current"; + ;; + + irix | nonstopux) + major=`expr $current - $age + 1` + + case $version_type in + nonstopux) verstring_prefix=nonstopux ;; + *) verstring_prefix=sgi ;; + esac + verstring="$verstring_prefix$major.$revision" + + # Add in all the interfaces that we are compatible with. + loop=$revision + while test "$loop" -ne 0; do + iface=`expr $revision - $loop` + loop=`expr $loop - 1` + verstring="$verstring_prefix$major.$iface:$verstring" + done + + # Before this point, $major must not contain `.'. + major=.$major + versuffix="$major.$revision" + ;; + + linux) + major=.`expr $current - $age` + versuffix="$major.$age.$revision" + ;; + + osf) + major=.`expr $current - $age` + versuffix=".$current.$age.$revision" + verstring="$current.$age.$revision" + + # Add in all the interfaces that we are compatible with. + loop=$age + while test "$loop" -ne 0; do + iface=`expr $current - $loop` + loop=`expr $loop - 1` + verstring="$verstring:${iface}.0" + done + + # Make executables depend on our current version. + verstring="$verstring:${current}.0" + ;; + + sunos) + major=".$current" + versuffix=".$current.$revision" + ;; + + windows) + # Use '-' rather than '.', since we only want one + # extension on DOS 8.3 filesystems. + major=`expr $current - $age` + versuffix="-$major" + ;; + + *) + $echo "$modename: unknown library version type \`$version_type'" 1>&2 + $echo "Fatal configuration error. See the $PACKAGE docs for more information." 1>&2 + exit $EXIT_FAILURE + ;; + esac + + # Clear the version info if we defaulted, and they specified a release. + if test -z "$vinfo" && test -n "$release"; then + major= + case $version_type in + darwin) + # we can't check for "0.0" in archive_cmds due to quoting + # problems, so we reset it completely + verstring= + ;; + *) + verstring="0.0" + ;; + esac + if test "$need_version" = no; then + versuffix= + else + versuffix=".0.0" + fi + fi + + # Remove version info from name if versioning should be avoided + if test "$avoid_version" = yes && test "$need_version" = no; then + major= + versuffix= + verstring="" + fi + + # Check to see if the archive will have undefined symbols. + if test "$allow_undefined" = yes; then + if test "$allow_undefined_flag" = unsupported; then + $echo "$modename: warning: undefined symbols not allowed in $host shared libraries" 1>&2 + build_libtool_libs=no + build_old_libs=yes + fi + else + # Don't allow undefined symbols. + allow_undefined_flag="$no_undefined_flag" + fi + fi + + if test "$mode" != relink; then + # Remove our outputs, but don't remove object files since they + # may have been created when compiling PIC objects. + removelist= + tempremovelist=`$echo "$output_objdir/*"` + for p in $tempremovelist; do + case $p in + *.$objext) + ;; + $output_objdir/$outputname | $output_objdir/$libname.* | $output_objdir/${libname}${release}.*) + if test "X$precious_files_regex" != "X"; then + if echo $p | $EGREP -e "$precious_files_regex" >/dev/null 2>&1 + then + continue + fi + fi + removelist="$removelist $p" + ;; + *) ;; + esac + done + if test -n "$removelist"; then + $show "${rm}r $removelist" + $run ${rm}r $removelist + fi + fi + + # Now set the variables for building old libraries. + if test "$build_old_libs" = yes && test "$build_libtool_libs" != convenience ; then + oldlibs="$oldlibs $output_objdir/$libname.$libext" + + # Transform .lo files to .o files. + oldobjs="$objs "`$echo "X$libobjs" | $SP2NL | $Xsed -e '/\.'${libext}'$/d' -e "$lo2o" | $NL2SP` + fi + + # Eliminate all temporary directories. +# for path in $notinst_path; do +# lib_search_path=`$echo "$lib_search_path " | ${SED} -e "s% $path % %g"` +# deplibs=`$echo "$deplibs " | ${SED} -e "s% -L$path % %g"` +# dependency_libs=`$echo "$dependency_libs " | ${SED} -e "s% -L$path % %g"` +# done + + if test -n "$xrpath"; then + # If the user specified any rpath flags, then add them. + temp_xrpath= + for libdir in $xrpath; do + temp_xrpath="$temp_xrpath -R$libdir" + case "$finalize_rpath " in + *" $libdir "*) ;; + *) finalize_rpath="$finalize_rpath $libdir" ;; + esac + done + if test "$hardcode_into_libs" != yes || test "$build_old_libs" = yes; then + dependency_libs="$temp_xrpath $dependency_libs" + fi + fi + + # Make sure dlfiles contains only unique files that won't be dlpreopened + old_dlfiles="$dlfiles" + dlfiles= + for lib in $old_dlfiles; do + case " $dlprefiles $dlfiles " in + *" $lib "*) ;; + *) dlfiles="$dlfiles $lib" ;; + esac + done + + # Make sure dlprefiles contains only unique files + old_dlprefiles="$dlprefiles" + dlprefiles= + for lib in $old_dlprefiles; do + case "$dlprefiles " in + *" $lib "*) ;; + *) dlprefiles="$dlprefiles $lib" ;; + esac + done + + if test "$build_libtool_libs" = yes; then + if test -n "$rpath"; then + case $host in + *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-os2* | *-*-beos*) + # these systems don't actually have a c library (as such)! + ;; + *-*-rhapsody* | *-*-darwin1.[012]) + # Rhapsody C library is in the System framework + deplibs="$deplibs -framework System" + ;; + *-*-netbsd*) + # Don't link with libc until the a.out ld.so is fixed. + ;; + *-*-openbsd* | *-*-freebsd* | *-*-dragonfly*) + # Do not include libc due to us having libc/libc_r. + ;; + *-*-sco3.2v5* | *-*-sco5v6*) + # Causes problems with __ctype + ;; + *-*-sysv4.2uw2* | *-*-sysv5* | *-*-unixware* | *-*-OpenUNIX*) + # Compiler inserts libc in the correct place for threads to work + ;; + *) + # Add libc to deplibs on all other systems if necessary. + if test "$build_libtool_need_lc" = "yes"; then + deplibs="$deplibs -lc" + fi + ;; + esac + fi + + # Transform deplibs into only deplibs that can be linked in shared. + name_save=$name + libname_save=$libname + release_save=$release + versuffix_save=$versuffix + major_save=$major + # I'm not sure if I'm treating the release correctly. I think + # release should show up in the -l (ie -lgmp5) so we don't want to + # add it in twice. Is that correct? + release="" + versuffix="" + major="" + newdeplibs= + droppeddeps=no + case $deplibs_check_method in + pass_all) + # Don't check for shared/static. Everything works. + # This might be a little naive. We might want to check + # whether the library exists or not. But this is on + # osf3 & osf4 and I'm not really sure... Just + # implementing what was already the behavior. + newdeplibs=$deplibs + ;; + test_compile) + # This code stresses the "libraries are programs" paradigm to its + # limits. Maybe even breaks it. We compile a program, linking it + # against the deplibs as a proxy for the library. Then we can check + # whether they linked in statically or dynamically with ldd. + $rm conftest.c + cat > conftest.c <<EOF + int main() { return 0; } +EOF + $rm conftest + if $LTCC $LTCFLAGS -o conftest conftest.c $deplibs; then + ldd_output=`ldd conftest` + for i in $deplibs; do + name=`expr $i : '-l\(.*\)'` + # If $name is empty we are operating on a -L argument. + if test "$name" != "" && test "$name" != "0"; then + if test "X$allow_libtool_libs_with_static_runtimes" = "Xyes" ; then + case " $predeps $postdeps " in + *" $i "*) + newdeplibs="$newdeplibs $i" + i="" + ;; + esac + fi + if test -n "$i" ; then + libname=`eval \\$echo \"$libname_spec\"` + deplib_matches=`eval \\$echo \"$library_names_spec\"` + set dummy $deplib_matches + deplib_match=$2 + if test `expr "$ldd_output" : ".*$deplib_match"` -ne 0 ; then + newdeplibs="$newdeplibs $i" + else + droppeddeps=yes + $echo + $echo "*** Warning: dynamic linker does not accept needed library $i." + $echo "*** I have the capability to make that library automatically link in when" + $echo "*** you link to this library. But I can only do this if you have a" + $echo "*** shared version of the library, which I believe you do not have" + $echo "*** because a test_compile did reveal that the linker did not use it for" + $echo "*** its dynamic dependency list that programs get resolved with at runtime." + fi + fi + else + newdeplibs="$newdeplibs $i" + fi + done + else + # Error occurred in the first compile. Let's try to salvage + # the situation: Compile a separate program for each library. + for i in $deplibs; do + name=`expr $i : '-l\(.*\)'` + # If $name is empty we are operating on a -L argument. + if test "$name" != "" && test "$name" != "0"; then + $rm conftest + if $LTCC $LTCFLAGS -o conftest conftest.c $i; then + ldd_output=`ldd conftest` + if test "X$allow_libtool_libs_with_static_runtimes" = "Xyes" ; then + case " $predeps $postdeps " in + *" $i "*) + newdeplibs="$newdeplibs $i" + i="" + ;; + esac + fi + if test -n "$i" ; then + libname=`eval \\$echo \"$libname_spec\"` + deplib_matches=`eval \\$echo \"$library_names_spec\"` + set dummy $deplib_matches + deplib_match=$2 + if test `expr "$ldd_output" : ".*$deplib_match"` -ne 0 ; then + newdeplibs="$newdeplibs $i" + else + droppeddeps=yes + $echo + $echo "*** Warning: dynamic linker does not accept needed library $i." + $echo "*** I have the capability to make that library automatically link in when" + $echo "*** you link to this library. But I can only do this if you have a" + $echo "*** shared version of the library, which you do not appear to have" + $echo "*** because a test_compile did reveal that the linker did not use this one" + $echo "*** as a dynamic dependency that programs can get resolved with at runtime." + fi + fi + else + droppeddeps=yes + $echo + $echo "*** Warning! Library $i is needed by this library but I was not able to" + $echo "*** make it link in! You will probably need to install it or some" + $echo "*** library that it depends on before this library will be fully" + $echo "*** functional. Installing it before continuing would be even better." + fi + else + newdeplibs="$newdeplibs $i" + fi + done + fi + ;; + file_magic*) + set dummy $deplibs_check_method + file_magic_regex=`expr "$deplibs_check_method" : "$2 \(.*\)"` + for a_deplib in $deplibs; do + name=`expr $a_deplib : '-l\(.*\)'` + # If $name is empty we are operating on a -L argument. + if test "$name" != "" && test "$name" != "0"; then + if test "X$allow_libtool_libs_with_static_runtimes" = "Xyes" ; then + case " $predeps $postdeps " in + *" $a_deplib "*) + newdeplibs="$newdeplibs $a_deplib" + a_deplib="" + ;; + esac + fi + if test -n "$a_deplib" ; then + libname=`eval \\$echo \"$libname_spec\"` + for i in $lib_search_path $sys_lib_search_path $shlib_search_path; do + potential_libs=`ls $i/$libname[.-]* 2>/dev/null` + for potent_lib in $potential_libs; do + # Follow soft links. + if ls -lLd "$potent_lib" 2>/dev/null \ + | grep " -> " >/dev/null; then + continue + fi + # The statement above tries to avoid entering an + # endless loop below, in case of cyclic links. + # We might still enter an endless loop, since a link + # loop can be closed while we follow links, + # but so what? + potlib="$potent_lib" + while test -h "$potlib" 2>/dev/null; do + potliblink=`ls -ld $potlib | ${SED} 's/.* -> //'` + case $potliblink in + [\\/]* | [A-Za-z]:[\\/]*) potlib="$potliblink";; + *) potlib=`$echo "X$potlib" | $Xsed -e 's,[^/]*$,,'`"$potliblink";; + esac + done + if eval $file_magic_cmd \"\$potlib\" 2>/dev/null \ + | ${SED} 10q \ + | $EGREP "$file_magic_regex" > /dev/null; then + newdeplibs="$newdeplibs $a_deplib" + a_deplib="" + break 2 + fi + done + done + fi + if test -n "$a_deplib" ; then + droppeddeps=yes + $echo + $echo "*** Warning: linker path does not have real file for library $a_deplib." + $echo "*** I have the capability to make that library automatically link in when" + $echo "*** you link to this library. But I can only do this if you have a" + $echo "*** shared version of the library, which you do not appear to have" + $echo "*** because I did check the linker path looking for a file starting" + if test -z "$potlib" ; then + $echo "*** with $libname but no candidates were found. (...for file magic test)" + else + $echo "*** with $libname and none of the candidates passed a file format test" + $echo "*** using a file magic. Last file checked: $potlib" + fi + fi + else + # Add a -L argument. + newdeplibs="$newdeplibs $a_deplib" + fi + done # Gone through all deplibs. + ;; + match_pattern*) + set dummy $deplibs_check_method + match_pattern_regex=`expr "$deplibs_check_method" : "$2 \(.*\)"` + for a_deplib in $deplibs; do + name=`expr $a_deplib : '-l\(.*\)'` + # If $name is empty we are operating on a -L argument. + if test -n "$name" && test "$name" != "0"; then + if test "X$allow_libtool_libs_with_static_runtimes" = "Xyes" ; then + case " $predeps $postdeps " in + *" $a_deplib "*) + newdeplibs="$newdeplibs $a_deplib" + a_deplib="" + ;; + esac + fi + if test -n "$a_deplib" ; then + libname=`eval \\$echo \"$libname_spec\"` + for i in $lib_search_path $sys_lib_search_path $shlib_search_path; do + potential_libs=`ls $i/$libname[.-]* 2>/dev/null` + for potent_lib in $potential_libs; do + potlib="$potent_lib" # see symlink-check above in file_magic test + if eval $echo \"$potent_lib\" 2>/dev/null \ + | ${SED} 10q \ + | $EGREP "$match_pattern_regex" > /dev/null; then + newdeplibs="$newdeplibs $a_deplib" + a_deplib="" + break 2 + fi + done + done + fi + if test -n "$a_deplib" ; then + droppeddeps=yes + $echo + $echo "*** Warning: linker path does not have real file for library $a_deplib." + $echo "*** I have the capability to make that library automatically link in when" + $echo "*** you link to this library. But I can only do this if you have a" + $echo "*** shared version of the library, which you do not appear to have" + $echo "*** because I did check the linker path looking for a file starting" + if test -z "$potlib" ; then + $echo "*** with $libname but no candidates were found. (...for regex pattern test)" + else + $echo "*** with $libname and none of the candidates passed a file format test" + $echo "*** using a regex pattern. Last file checked: $potlib" + fi + fi + else + # Add a -L argument. + newdeplibs="$newdeplibs $a_deplib" + fi + done # Gone through all deplibs. + ;; + none | unknown | *) + newdeplibs="" + tmp_deplibs=`$echo "X $deplibs" | $Xsed -e 's/ -lc$//' \ + -e 's/ -[LR][^ ]*//g'` + if test "X$allow_libtool_libs_with_static_runtimes" = "Xyes" ; then + for i in $predeps $postdeps ; do + # can't use Xsed below, because $i might contain '/' + tmp_deplibs=`$echo "X $tmp_deplibs" | ${SED} -e "1s,^X,," -e "s,$i,,"` + done + fi + if $echo "X $tmp_deplibs" | $Xsed -e 's/[ ]//g' \ + | grep . >/dev/null; then + $echo + if test "X$deplibs_check_method" = "Xnone"; then + $echo "*** Warning: inter-library dependencies are not supported in this platform." + else + $echo "*** Warning: inter-library dependencies are not known to be supported." + fi + $echo "*** All declared inter-library dependencies are being dropped." + droppeddeps=yes + fi + ;; + esac + versuffix=$versuffix_save + major=$major_save + release=$release_save + libname=$libname_save + name=$name_save + + case $host in + *-*-rhapsody* | *-*-darwin1.[012]) + # On Rhapsody replace the C library is the System framework + newdeplibs=`$echo "X $newdeplibs" | $Xsed -e 's/ -lc / -framework System /'` + ;; + esac + + if test "$droppeddeps" = yes; then + if test "$module" = yes; then + $echo + $echo "*** Warning: libtool could not satisfy all declared inter-library" + $echo "*** dependencies of module $libname. Therefore, libtool will create" + $echo "*** a static module, that should work as long as the dlopening" + $echo "*** application is linked with the -dlopen flag." + if test -z "$global_symbol_pipe"; then + $echo + $echo "*** However, this would only work if libtool was able to extract symbol" + $echo "*** lists from a program, using \`nm' or equivalent, but libtool could" + $echo "*** not find such a program. So, this module is probably useless." + $echo "*** \`nm' from GNU binutils and a full rebuild may help." + fi + if test "$build_old_libs" = no; then + oldlibs="$output_objdir/$libname.$libext" + build_libtool_libs=module + build_old_libs=yes + else + build_libtool_libs=no + fi + else + $echo "*** The inter-library dependencies that have been dropped here will be" + $echo "*** automatically added whenever a program is linked with this library" + $echo "*** or is declared to -dlopen it." + + if test "$allow_undefined" = no; then + $echo + $echo "*** Since this library must not contain undefined symbols," + $echo "*** because either the platform does not support them or" + $echo "*** it was explicitly requested with -no-undefined," + $echo "*** libtool will only create a static version of it." + if test "$build_old_libs" = no; then + oldlibs="$output_objdir/$libname.$libext" + build_libtool_libs=module + build_old_libs=yes + else + build_libtool_libs=no + fi + fi + fi + fi + # Done checking deplibs! + deplibs=$newdeplibs + fi + + + # move library search paths that coincide with paths to not yet + # installed libraries to the beginning of the library search list + new_libs= + for path in $notinst_path; do + case " $new_libs " in + *" -L$path/$objdir "*) ;; + *) + case " $deplibs " in + *" -L$path/$objdir "*) + new_libs="$new_libs -L$path/$objdir" ;; + esac + ;; + esac + done + for deplib in $deplibs; do + case $deplib in + -L*) + case " $new_libs " in + *" $deplib "*) ;; + *) new_libs="$new_libs $deplib" ;; + esac + ;; + *) new_libs="$new_libs $deplib" ;; + esac + done + deplibs="$new_libs" + + + # All the library-specific variables (install_libdir is set above). + library_names= + old_library= + dlname= + + # Test again, we may have decided not to build it any more + if test "$build_libtool_libs" = yes; then + if test "$hardcode_into_libs" = yes; then + # Hardcode the library paths + hardcode_libdirs= + dep_rpath= + rpath="$finalize_rpath" + test "$mode" != relink && rpath="$compile_rpath$rpath" + for libdir in $rpath; do + if test -n "$hardcode_libdir_flag_spec"; then + if test -n "$hardcode_libdir_separator"; then + if test -z "$hardcode_libdirs"; then + hardcode_libdirs="$libdir" + else + # Just accumulate the unique libdirs. + case $hardcode_libdir_separator$hardcode_libdirs$hardcode_libdir_separator in + *"$hardcode_libdir_separator$libdir$hardcode_libdir_separator"*) + ;; + *) + hardcode_libdirs="$hardcode_libdirs$hardcode_libdir_separator$libdir" + ;; + esac + fi + else + eval flag=\"$hardcode_libdir_flag_spec\" + dep_rpath="$dep_rpath $flag" + fi + elif test -n "$runpath_var"; then + case "$perm_rpath " in + *" $libdir "*) ;; + *) perm_rpath="$perm_rpath $libdir" ;; + esac + fi + done + # Substitute the hardcoded libdirs into the rpath. + if test -n "$hardcode_libdir_separator" && + test -n "$hardcode_libdirs"; then + libdir="$hardcode_libdirs" + if test -n "$hardcode_libdir_flag_spec_ld"; then + eval dep_rpath=\"$hardcode_libdir_flag_spec_ld\" + else + eval dep_rpath=\"$hardcode_libdir_flag_spec\" + fi + fi + if test -n "$runpath_var" && test -n "$perm_rpath"; then + # We should set the runpath_var. + rpath= + for dir in $perm_rpath; do + rpath="$rpath$dir:" + done + eval "$runpath_var='$rpath\$$runpath_var'; export $runpath_var" + fi + test -n "$dep_rpath" && deplibs="$dep_rpath $deplibs" + fi + + shlibpath="$finalize_shlibpath" + test "$mode" != relink && shlibpath="$compile_shlibpath$shlibpath" + if test -n "$shlibpath"; then + eval "$shlibpath_var='$shlibpath\$$shlibpath_var'; export $shlibpath_var" + fi + + # Get the real and link names of the library. + eval shared_ext=\"$shrext_cmds\" + eval library_names=\"$library_names_spec\" + set dummy $library_names + realname="$2" + shift; shift + + if test -n "$soname_spec"; then + eval soname=\"$soname_spec\" + else + soname="$realname" + fi + if test -z "$dlname"; then + dlname=$soname + fi + + lib="$output_objdir/$realname" + linknames= + for link + do + linknames="$linknames $link" + done + + # Use standard objects if they are pic + test -z "$pic_flag" && libobjs=`$echo "X$libobjs" | $SP2NL | $Xsed -e "$lo2o" | $NL2SP` + + # Prepare the list of exported symbols + if test -z "$export_symbols"; then + if test "$always_export_symbols" = yes || test -n "$export_symbols_regex"; then + $show "generating symbol list for \`$libname.la'" + export_symbols="$output_objdir/$libname.exp" + $run $rm $export_symbols + cmds=$export_symbols_cmds + save_ifs="$IFS"; IFS='~' + for cmd in $cmds; do + IFS="$save_ifs" + eval cmd=\"$cmd\" + if len=`expr "X$cmd" : ".*"` && + test "$len" -le "$max_cmd_len" || test "$max_cmd_len" -le -1; then + $show "$cmd" + $run eval "$cmd" || exit $? + skipped_export=false + else + # The command line is too long to execute in one step. + $show "using reloadable object file for export list..." + skipped_export=: + # Break out early, otherwise skipped_export may be + # set to false by a later but shorter cmd. + break + fi + done + IFS="$save_ifs" + if test -n "$export_symbols_regex"; then + $show "$EGREP -e \"$export_symbols_regex\" \"$export_symbols\" > \"${export_symbols}T\"" + $run eval '$EGREP -e "$export_symbols_regex" "$export_symbols" > "${export_symbols}T"' + $show "$mv \"${export_symbols}T\" \"$export_symbols\"" + $run eval '$mv "${export_symbols}T" "$export_symbols"' + fi + fi + fi + + if test -n "$export_symbols" && test -n "$include_expsyms"; then + $run eval '$echo "X$include_expsyms" | $SP2NL >> "$export_symbols"' + fi + + tmp_deplibs= + for test_deplib in $deplibs; do + case " $convenience " in + *" $test_deplib "*) ;; + *) + tmp_deplibs="$tmp_deplibs $test_deplib" + ;; + esac + done + deplibs="$tmp_deplibs" + + if test -n "$convenience"; then + if test -n "$whole_archive_flag_spec"; then + save_libobjs=$libobjs + eval libobjs=\"\$libobjs $whole_archive_flag_spec\" + else + gentop="$output_objdir/${outputname}x" + generated="$generated $gentop" + + func_extract_archives $gentop $convenience + libobjs="$libobjs $func_extract_archives_result" + fi + fi + + if test "$thread_safe" = yes && test -n "$thread_safe_flag_spec"; then + eval flag=\"$thread_safe_flag_spec\" + linker_flags="$linker_flags $flag" + fi + + # Make a backup of the uninstalled library when relinking + if test "$mode" = relink; then + $run eval '(cd $output_objdir && $rm ${realname}U && $mv $realname ${realname}U)' || exit $? + fi + + # Do each of the archive commands. + if test "$module" = yes && test -n "$module_cmds" ; then + if test -n "$export_symbols" && test -n "$module_expsym_cmds"; then + eval test_cmds=\"$module_expsym_cmds\" + cmds=$module_expsym_cmds + else + eval test_cmds=\"$module_cmds\" + cmds=$module_cmds + fi + else + if test -n "$export_symbols" && test -n "$archive_expsym_cmds"; then + eval test_cmds=\"$archive_expsym_cmds\" + cmds=$archive_expsym_cmds + else + eval test_cmds=\"$archive_cmds\" + cmds=$archive_cmds + fi + fi + + if test "X$skipped_export" != "X:" && + len=`expr "X$test_cmds" : ".*" 2>/dev/null` && + test "$len" -le "$max_cmd_len" || test "$max_cmd_len" -le -1; then + : + else + # The command line is too long to link in one step, link piecewise. + $echo "creating reloadable object files..." + + # Save the value of $output and $libobjs because we want to + # use them later. If we have whole_archive_flag_spec, we + # want to use save_libobjs as it was before + # whole_archive_flag_spec was expanded, because we can't + # assume the linker understands whole_archive_flag_spec. + # This may have to be revisited, in case too many + # convenience libraries get linked in and end up exceeding + # the spec. + if test -z "$convenience" || test -z "$whole_archive_flag_spec"; then + save_libobjs=$libobjs + fi + save_output=$output + output_la=`$echo "X$output" | $Xsed -e "$basename"` + + # Clear the reloadable object creation command queue and + # initialize k to one. + test_cmds= + concat_cmds= + objlist= + delfiles= + last_robj= + k=1 + output=$output_objdir/$output_la-${k}.$objext + # Loop over the list of objects to be linked. + for obj in $save_libobjs + do + eval test_cmds=\"$reload_cmds $objlist $last_robj\" + if test "X$objlist" = X || + { len=`expr "X$test_cmds" : ".*" 2>/dev/null` && + test "$len" -le "$max_cmd_len"; }; then + objlist="$objlist $obj" + else + # The command $test_cmds is almost too long, add a + # command to the queue. + if test "$k" -eq 1 ; then + # The first file doesn't have a previous command to add. + eval concat_cmds=\"$reload_cmds $objlist $last_robj\" + else + # All subsequent reloadable object files will link in + # the last one created. + eval concat_cmds=\"\$concat_cmds~$reload_cmds $objlist $last_robj\" + fi + last_robj=$output_objdir/$output_la-${k}.$objext + k=`expr $k + 1` + output=$output_objdir/$output_la-${k}.$objext + objlist=$obj + len=1 + fi + done + # Handle the remaining objects by creating one last + # reloadable object file. All subsequent reloadable object + # files will link in the last one created. + test -z "$concat_cmds" || concat_cmds=$concat_cmds~ + eval concat_cmds=\"\${concat_cmds}$reload_cmds $objlist $last_robj\" + + if ${skipped_export-false}; then + $show "generating symbol list for \`$libname.la'" + export_symbols="$output_objdir/$libname.exp" + $run $rm $export_symbols + libobjs=$output + # Append the command to create the export file. + eval concat_cmds=\"\$concat_cmds~$export_symbols_cmds\" + fi + + # Set up a command to remove the reloadable object files + # after they are used. + i=0 + while test "$i" -lt "$k" + do + i=`expr $i + 1` + delfiles="$delfiles $output_objdir/$output_la-${i}.$objext" + done + + $echo "creating a temporary reloadable object file: $output" + + # Loop through the commands generated above and execute them. + save_ifs="$IFS"; IFS='~' + for cmd in $concat_cmds; do + IFS="$save_ifs" + $show "$cmd" + $run eval "$cmd" || exit $? + done + IFS="$save_ifs" + + libobjs=$output + # Restore the value of output. + output=$save_output + + if test -n "$convenience" && test -n "$whole_archive_flag_spec"; then + eval libobjs=\"\$libobjs $whole_archive_flag_spec\" + fi + # Expand the library linking commands again to reset the + # value of $libobjs for piecewise linking. + + # Do each of the archive commands. + if test "$module" = yes && test -n "$module_cmds" ; then + if test -n "$export_symbols" && test -n "$module_expsym_cmds"; then + cmds=$module_expsym_cmds + else + cmds=$module_cmds + fi + else + if test -n "$export_symbols" && test -n "$archive_expsym_cmds"; then + cmds=$archive_expsym_cmds + else + cmds=$archive_cmds + fi + fi + + # Append the command to remove the reloadable object files + # to the just-reset $cmds. + eval cmds=\"\$cmds~\$rm $delfiles\" + fi + save_ifs="$IFS"; IFS='~' + for cmd in $cmds; do + IFS="$save_ifs" + eval cmd=\"$cmd\" + $show "$cmd" + $run eval "$cmd" || { + lt_exit=$? + + # Restore the uninstalled library and exit + if test "$mode" = relink; then + $run eval '(cd $output_objdir && $rm ${realname}T && $mv ${realname}U $realname)' + fi + + exit $lt_exit + } + done + IFS="$save_ifs" + + # Restore the uninstalled library and exit + if test "$mode" = relink; then + $run eval '(cd $output_objdir && $rm ${realname}T && $mv $realname ${realname}T && $mv "$realname"U $realname)' || exit $? + + if test -n "$convenience"; then + if test -z "$whole_archive_flag_spec"; then + $show "${rm}r $gentop" + $run ${rm}r "$gentop" + fi + fi + + exit $EXIT_SUCCESS + fi + + # Create links to the real library. + for linkname in $linknames; do + if test "$realname" != "$linkname"; then + $show "(cd $output_objdir && $rm $linkname && $LN_S $realname $linkname)" + $run eval '(cd $output_objdir && $rm $linkname && $LN_S $realname $linkname)' || exit $? + fi + done + + # If -module or -export-dynamic was specified, set the dlname. + if test "$module" = yes || test "$export_dynamic" = yes; then + # On all known operating systems, these are identical. + dlname="$soname" + fi + fi + ;; + + obj) + if test -n "$deplibs"; then + $echo "$modename: warning: \`-l' and \`-L' are ignored for objects" 1>&2 + fi + + if test -n "$dlfiles$dlprefiles" || test "$dlself" != no; then + $echo "$modename: warning: \`-dlopen' is ignored for objects" 1>&2 + fi + + if test -n "$rpath"; then + $echo "$modename: warning: \`-rpath' is ignored for objects" 1>&2 + fi + + if test -n "$xrpath"; then + $echo "$modename: warning: \`-R' is ignored for objects" 1>&2 + fi + + if test -n "$vinfo"; then + $echo "$modename: warning: \`-version-info' is ignored for objects" 1>&2 + fi + + if test -n "$release"; then + $echo "$modename: warning: \`-release' is ignored for objects" 1>&2 + fi + + case $output in + *.lo) + if test -n "$objs$old_deplibs"; then + $echo "$modename: cannot build library object \`$output' from non-libtool objects" 1>&2 + exit $EXIT_FAILURE + fi + libobj="$output" + obj=`$echo "X$output" | $Xsed -e "$lo2o"` + ;; + *) + libobj= + obj="$output" + ;; + esac + + # Delete the old objects. + $run $rm $obj $libobj + + # Objects from convenience libraries. This assumes + # single-version convenience libraries. Whenever we create + # different ones for PIC/non-PIC, this we'll have to duplicate + # the extraction. + reload_conv_objs= + gentop= + # reload_cmds runs $LD directly, so let us get rid of + # -Wl from whole_archive_flag_spec and hope we can get by with + # turning comma into space.. + wl= + + if test -n "$convenience"; then + if test -n "$whole_archive_flag_spec"; then + eval tmp_whole_archive_flags=\"$whole_archive_flag_spec\" + reload_conv_objs=$reload_objs\ `$echo "X$tmp_whole_archive_flags" | $Xsed -e 's|,| |g'` + else + gentop="$output_objdir/${obj}x" + generated="$generated $gentop" + + func_extract_archives $gentop $convenience + reload_conv_objs="$reload_objs $func_extract_archives_result" + fi + fi + + # Create the old-style object. + reload_objs="$objs$old_deplibs "`$echo "X$libobjs" | $SP2NL | $Xsed -e '/\.'${libext}$'/d' -e '/\.lib$/d' -e "$lo2o" | $NL2SP`" $reload_conv_objs" ### testsuite: skip nested quoting test + + output="$obj" + cmds=$reload_cmds + save_ifs="$IFS"; IFS='~' + for cmd in $cmds; do + IFS="$save_ifs" + eval cmd=\"$cmd\" + $show "$cmd" + $run eval "$cmd" || exit $? + done + IFS="$save_ifs" + + # Exit if we aren't doing a library object file. + if test -z "$libobj"; then + if test -n "$gentop"; then + $show "${rm}r $gentop" + $run ${rm}r $gentop + fi + + exit $EXIT_SUCCESS + fi + + if test "$build_libtool_libs" != yes; then + if test -n "$gentop"; then + $show "${rm}r $gentop" + $run ${rm}r $gentop + fi + + # Create an invalid libtool object if no PIC, so that we don't + # accidentally link it into a program. + # $show "echo timestamp > $libobj" + # $run eval "echo timestamp > $libobj" || exit $? + exit $EXIT_SUCCESS + fi + + if test -n "$pic_flag" || test "$pic_mode" != default; then + # Only do commands if we really have different PIC objects. + reload_objs="$libobjs $reload_conv_objs" + output="$libobj" + cmds=$reload_cmds + save_ifs="$IFS"; IFS='~' + for cmd in $cmds; do + IFS="$save_ifs" + eval cmd=\"$cmd\" + $show "$cmd" + $run eval "$cmd" || exit $? + done + IFS="$save_ifs" + fi + + if test -n "$gentop"; then + $show "${rm}r $gentop" + $run ${rm}r $gentop + fi + + exit $EXIT_SUCCESS + ;; + + prog) + case $host in + *cygwin*) output=`$echo $output | ${SED} -e 's,.exe$,,;s,$,.exe,'` ;; + esac + if test -n "$vinfo"; then + $echo "$modename: warning: \`-version-info' is ignored for programs" 1>&2 + fi + + if test -n "$release"; then + $echo "$modename: warning: \`-release' is ignored for programs" 1>&2 + fi + + if test "$preload" = yes; then + if test "$dlopen_support" = unknown && test "$dlopen_self" = unknown && + test "$dlopen_self_static" = unknown; then + $echo "$modename: warning: \`AC_LIBTOOL_DLOPEN' not used. Assuming no dlopen support." + fi + fi + + case $host in + *-*-rhapsody* | *-*-darwin1.[012]) + # On Rhapsody replace the C library is the System framework + compile_deplibs=`$echo "X $compile_deplibs" | $Xsed -e 's/ -lc / -framework System /'` + finalize_deplibs=`$echo "X $finalize_deplibs" | $Xsed -e 's/ -lc / -framework System /'` + ;; + esac + + case $host in + *darwin*) + # Don't allow lazy linking, it breaks C++ global constructors + if test "$tagname" = CXX ; then + compile_command="$compile_command ${wl}-bind_at_load" + finalize_command="$finalize_command ${wl}-bind_at_load" + fi + ;; + esac + + + # move library search paths that coincide with paths to not yet + # installed libraries to the beginning of the library search list + new_libs= + for path in $notinst_path; do + case " $new_libs " in + *" -L$path/$objdir "*) ;; + *) + case " $compile_deplibs " in + *" -L$path/$objdir "*) + new_libs="$new_libs -L$path/$objdir" ;; + esac + ;; + esac + done + for deplib in $compile_deplibs; do + case $deplib in + -L*) + case " $new_libs " in + *" $deplib "*) ;; + *) new_libs="$new_libs $deplib" ;; + esac + ;; + *) new_libs="$new_libs $deplib" ;; + esac + done + compile_deplibs="$new_libs" + + + compile_command="$compile_command $compile_deplibs" + finalize_command="$finalize_command $finalize_deplibs" + + if test -n "$rpath$xrpath"; then + # If the user specified any rpath flags, then add them. + for libdir in $rpath $xrpath; do + # This is the magic to use -rpath. + case "$finalize_rpath " in + *" $libdir "*) ;; + *) finalize_rpath="$finalize_rpath $libdir" ;; + esac + done + fi + + # Now hardcode the library paths + rpath= + hardcode_libdirs= + for libdir in $compile_rpath $finalize_rpath; do + if test -n "$hardcode_libdir_flag_spec"; then + if test -n "$hardcode_libdir_separator"; then + if test -z "$hardcode_libdirs"; then + hardcode_libdirs="$libdir" + else + # Just accumulate the unique libdirs. + case $hardcode_libdir_separator$hardcode_libdirs$hardcode_libdir_separator in + *"$hardcode_libdir_separator$libdir$hardcode_libdir_separator"*) + ;; + *) + hardcode_libdirs="$hardcode_libdirs$hardcode_libdir_separator$libdir" + ;; + esac + fi + else + eval flag=\"$hardcode_libdir_flag_spec\" + rpath="$rpath $flag" + fi + elif test -n "$runpath_var"; then + case "$perm_rpath " in + *" $libdir "*) ;; + *) perm_rpath="$perm_rpath $libdir" ;; + esac + fi + case $host in + *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-os2*) + testbindir=`$echo "X$libdir" | $Xsed -e 's*/lib$*/bin*'` + case :$dllsearchpath: in + *":$libdir:"*) ;; + *) dllsearchpath="$dllsearchpath:$libdir";; + esac + case :$dllsearchpath: in + *":$testbindir:"*) ;; + *) dllsearchpath="$dllsearchpath:$testbindir";; + esac + ;; + esac + done + # Substitute the hardcoded libdirs into the rpath. + if test -n "$hardcode_libdir_separator" && + test -n "$hardcode_libdirs"; then + libdir="$hardcode_libdirs" + eval rpath=\" $hardcode_libdir_flag_spec\" + fi + compile_rpath="$rpath" + + rpath= + hardcode_libdirs= + for libdir in $finalize_rpath; do + if test -n "$hardcode_libdir_flag_spec"; then + if test -n "$hardcode_libdir_separator"; then + if test -z "$hardcode_libdirs"; then + hardcode_libdirs="$libdir" + else + # Just accumulate the unique libdirs. + case $hardcode_libdir_separator$hardcode_libdirs$hardcode_libdir_separator in + *"$hardcode_libdir_separator$libdir$hardcode_libdir_separator"*) + ;; + *) + hardcode_libdirs="$hardcode_libdirs$hardcode_libdir_separator$libdir" + ;; + esac + fi + else + eval flag=\"$hardcode_libdir_flag_spec\" + rpath="$rpath $flag" + fi + elif test -n "$runpath_var"; then + case "$finalize_perm_rpath " in + *" $libdir "*) ;; + *) finalize_perm_rpath="$finalize_perm_rpath $libdir" ;; + esac + fi + done + # Substitute the hardcoded libdirs into the rpath. + if test -n "$hardcode_libdir_separator" && + test -n "$hardcode_libdirs"; then + libdir="$hardcode_libdirs" + eval rpath=\" $hardcode_libdir_flag_spec\" + fi + finalize_rpath="$rpath" + + if test -n "$libobjs" && test "$build_old_libs" = yes; then + # Transform all the library objects into standard objects. + compile_command=`$echo "X$compile_command" | $SP2NL | $Xsed -e "$lo2o" | $NL2SP` + finalize_command=`$echo "X$finalize_command" | $SP2NL | $Xsed -e "$lo2o" | $NL2SP` + fi + + dlsyms= + if test -n "$dlfiles$dlprefiles" || test "$dlself" != no; then + if test -n "$NM" && test -n "$global_symbol_pipe"; then + dlsyms="${outputname}S.c" + else + $echo "$modename: not configured to extract global symbols from dlpreopened files" 1>&2 + fi + fi + + if test -n "$dlsyms"; then + case $dlsyms in + "") ;; + *.c) + # Discover the nlist of each of the dlfiles. + nlist="$output_objdir/${outputname}.nm" + + $show "$rm $nlist ${nlist}S ${nlist}T" + $run $rm "$nlist" "${nlist}S" "${nlist}T" + + # Parse the name list into a source file. + $show "creating $output_objdir/$dlsyms" + + test -z "$run" && $echo > "$output_objdir/$dlsyms" "\ +/* $dlsyms - symbol resolution table for \`$outputname' dlsym emulation. */ +/* Generated by $PROGRAM - GNU $PACKAGE $VERSION$TIMESTAMP */ + +#ifdef __cplusplus +extern \"C\" { +#endif + +/* Prevent the only kind of declaration conflicts we can make. */ +#define lt_preloaded_symbols some_other_symbol + +/* External symbol declarations for the compiler. */\ +" + + if test "$dlself" = yes; then + $show "generating symbol list for \`$output'" + + test -z "$run" && $echo ': @PROGRAM@ ' > "$nlist" + + # Add our own program objects to the symbol list. + progfiles=`$echo "X$objs$old_deplibs" | $SP2NL | $Xsed -e "$lo2o" | $NL2SP` + for arg in $progfiles; do + $show "extracting global C symbols from \`$arg'" + $run eval "$NM $arg | $global_symbol_pipe >> '$nlist'" + done + + if test -n "$exclude_expsyms"; then + $run eval '$EGREP -v " ($exclude_expsyms)$" "$nlist" > "$nlist"T' + $run eval '$mv "$nlist"T "$nlist"' + fi + + if test -n "$export_symbols_regex"; then + $run eval '$EGREP -e "$export_symbols_regex" "$nlist" > "$nlist"T' + $run eval '$mv "$nlist"T "$nlist"' + fi + + # Prepare the list of exported symbols + if test -z "$export_symbols"; then + export_symbols="$output_objdir/$outputname.exp" + $run $rm $export_symbols + $run eval "${SED} -n -e '/^: @PROGRAM@ $/d' -e 's/^.* \(.*\)$/\1/p' "'< "$nlist" > "$export_symbols"' + case $host in + *cygwin* | *mingw* ) + $run eval "echo EXPORTS "'> "$output_objdir/$outputname.def"' + $run eval 'cat "$export_symbols" >> "$output_objdir/$outputname.def"' + ;; + esac + else + $run eval "${SED} -e 's/\([].[*^$]\)/\\\\\1/g' -e 's/^/ /' -e 's/$/$/'"' < "$export_symbols" > "$output_objdir/$outputname.exp"' + $run eval 'grep -f "$output_objdir/$outputname.exp" < "$nlist" > "$nlist"T' + $run eval 'mv "$nlist"T "$nlist"' + case $host in + *cygwin* | *mingw* ) + $run eval "echo EXPORTS "'> "$output_objdir/$outputname.def"' + $run eval 'cat "$nlist" >> "$output_objdir/$outputname.def"' + ;; + esac + fi + fi + + for arg in $dlprefiles; do + $show "extracting global C symbols from \`$arg'" + name=`$echo "$arg" | ${SED} -e 's%^.*/%%'` + $run eval '$echo ": $name " >> "$nlist"' + $run eval "$NM $arg | $global_symbol_pipe >> '$nlist'" + done + + if test -z "$run"; then + # Make sure we have at least an empty file. + test -f "$nlist" || : > "$nlist" + + if test -n "$exclude_expsyms"; then + $EGREP -v " ($exclude_expsyms)$" "$nlist" > "$nlist"T + $mv "$nlist"T "$nlist" + fi + + # Try sorting and uniquifying the output. + if grep -v "^: " < "$nlist" | + if sort -k 3 </dev/null >/dev/null 2>&1; then + sort -k 3 + else + sort +2 + fi | + uniq > "$nlist"S; then + : + else + grep -v "^: " < "$nlist" > "$nlist"S + fi + + if test -f "$nlist"S; then + eval "$global_symbol_to_cdecl"' < "$nlist"S >> "$output_objdir/$dlsyms"' + else + $echo '/* NONE */' >> "$output_objdir/$dlsyms" + fi + + $echo >> "$output_objdir/$dlsyms" "\ + +#undef lt_preloaded_symbols + +#if defined (__STDC__) && __STDC__ +# define lt_ptr void * +#else +# define lt_ptr char * +# define const +#endif + +/* The mapping between symbol names and symbols. */ +" + + case $host in + *cygwin* | *mingw* ) + $echo >> "$output_objdir/$dlsyms" "\ +/* DATA imports from DLLs on WIN32 can't be const, because + runtime relocations are performed -- see ld's documentation + on pseudo-relocs */ +struct { +" + ;; + * ) + $echo >> "$output_objdir/$dlsyms" "\ +const struct { +" + ;; + esac + + + $echo >> "$output_objdir/$dlsyms" "\ + const char *name; + lt_ptr address; +} +lt_preloaded_symbols[] = +{\ +" + + eval "$global_symbol_to_c_name_address" < "$nlist" >> "$output_objdir/$dlsyms" + + $echo >> "$output_objdir/$dlsyms" "\ + {0, (lt_ptr) 0} +}; + +/* This works around a problem in FreeBSD linker */ +#ifdef FREEBSD_WORKAROUND +static const void *lt_preloaded_setup() { + return lt_preloaded_symbols; +} +#endif + +#ifdef __cplusplus +} +#endif\ +" + fi + + pic_flag_for_symtable= + case $host in + # compiling the symbol table file with pic_flag works around + # a FreeBSD bug that causes programs to crash when -lm is + # linked before any other PIC object. But we must not use + # pic_flag when linking with -static. The problem exists in + # FreeBSD 2.2.6 and is fixed in FreeBSD 3.1. + *-*-freebsd2*|*-*-freebsd3.0*|*-*-freebsdelf3.0*) + case "$compile_command " in + *" -static "*) ;; + *) pic_flag_for_symtable=" $pic_flag -DFREEBSD_WORKAROUND";; + esac;; + *-*-hpux*) + case "$compile_command " in + *" -static "*) ;; + *) pic_flag_for_symtable=" $pic_flag";; + esac + esac + + # Now compile the dynamic symbol file. + $show "(cd $output_objdir && $LTCC $LTCFLAGS -c$no_builtin_flag$pic_flag_for_symtable \"$dlsyms\")" + $run eval '(cd $output_objdir && $LTCC $LTCFLAGS -c$no_builtin_flag$pic_flag_for_symtable "$dlsyms")' || exit $? + + # Clean up the generated files. + $show "$rm $output_objdir/$dlsyms $nlist ${nlist}S ${nlist}T" + $run $rm "$output_objdir/$dlsyms" "$nlist" "${nlist}S" "${nlist}T" + + # Transform the symbol file into the correct name. + case $host in + *cygwin* | *mingw* ) + if test -f "$output_objdir/${outputname}.def" ; then + compile_command=`$echo "X$compile_command" | $SP2NL | $Xsed -e "s%@SYMFILE@%$output_objdir/${outputname}.def $output_objdir/${outputname}S.${objext}%" | $NL2SP` + finalize_command=`$echo "X$finalize_command" | $SP2NL | $Xsed -e "s%@SYMFILE@%$output_objdir/${outputname}.def $output_objdir/${outputname}S.${objext}%" | $NL2SP` + else + compile_command=`$echo "X$compile_command" | $SP2NL | $Xsed -e "s%@SYMFILE@%$output_objdir/${outputname}S.${objext}%" | $NL2SP` + finalize_command=`$echo "X$finalize_command" | $SP2NL | $Xsed -e "s%@SYMFILE@%$output_objdir/${outputname}S.${objext}%" | $NL2SP` + fi + ;; + * ) + compile_command=`$echo "X$compile_command" | $SP2NL | $Xsed -e "s%@SYMFILE@%$output_objdir/${outputname}S.${objext}%" | $NL2SP` + finalize_command=`$echo "X$finalize_command" | $SP2NL | $Xsed -e "s%@SYMFILE@%$output_objdir/${outputname}S.${objext}%" | $NL2SP` + ;; + esac + ;; + *) + $echo "$modename: unknown suffix for \`$dlsyms'" 1>&2 + exit $EXIT_FAILURE + ;; + esac + else + # We keep going just in case the user didn't refer to + # lt_preloaded_symbols. The linker will fail if global_symbol_pipe + # really was required. + + # Nullify the symbol file. + compile_command=`$echo "X$compile_command" | $SP2NL | $Xsed -e "s% @SYMFILE@%%" | $NL2SP` + finalize_command=`$echo "X$finalize_command" | $SP2NL | $Xsed -e "s% @SYMFILE@%%" | $NL2SP` + fi + + if test "$need_relink" = no || test "$build_libtool_libs" != yes; then + # Replace the output file specification. + compile_command=`$echo "X$compile_command" | $SP2NL | $Xsed -e 's%@OUTPUT@%'"$output"'%g' | $NL2SP` + link_command="$compile_command$compile_rpath" + + # We have no uninstalled library dependencies, so finalize right now. + $show "$link_command" + $run eval "$link_command" + exit_status=$? + + # Delete the generated files. + if test -n "$dlsyms"; then + $show "$rm $output_objdir/${outputname}S.${objext}" + $run $rm "$output_objdir/${outputname}S.${objext}" + fi + + exit $exit_status + fi + + if test -n "$shlibpath_var"; then + # We should set the shlibpath_var + rpath= + for dir in $temp_rpath; do + case $dir in + [\\/]* | [A-Za-z]:[\\/]*) + # Absolute path. + rpath="$rpath$dir:" + ;; + *) + # Relative path: add a thisdir entry. + rpath="$rpath\$thisdir/$dir:" + ;; + esac + done + temp_rpath="$rpath" + fi + + if test -n "$compile_shlibpath$finalize_shlibpath"; then + compile_command="$shlibpath_var=\"$compile_shlibpath$finalize_shlibpath\$$shlibpath_var\" $compile_command" + fi + if test -n "$finalize_shlibpath"; then + finalize_command="$shlibpath_var=\"$finalize_shlibpath\$$shlibpath_var\" $finalize_command" + fi + + compile_var= + finalize_var= + if test -n "$runpath_var"; then + if test -n "$perm_rpath"; then + # We should set the runpath_var. + rpath= + for dir in $perm_rpath; do + rpath="$rpath$dir:" + done + compile_var="$runpath_var=\"$rpath\$$runpath_var\" " + fi + if test -n "$finalize_perm_rpath"; then + # We should set the runpath_var. + rpath= + for dir in $finalize_perm_rpath; do + rpath="$rpath$dir:" + done + finalize_var="$runpath_var=\"$rpath\$$runpath_var\" " + fi + fi + + if test "$no_install" = yes; then + # We don't need to create a wrapper script. + link_command="$compile_var$compile_command$compile_rpath" + # Replace the output file specification. + link_command=`$echo "X$link_command" | $Xsed -e 's%@OUTPUT@%'"$output"'%g'` + # Delete the old output file. + $run $rm $output + # Link the executable and exit + $show "$link_command" + $run eval "$link_command" || exit $? + exit $EXIT_SUCCESS + fi + + if test "$hardcode_action" = relink; then + # Fast installation is not supported + link_command="$compile_var$compile_command$compile_rpath" + relink_command="$finalize_var$finalize_command$finalize_rpath" + + $echo "$modename: warning: this platform does not like uninstalled shared libraries" 1>&2 + $echo "$modename: \`$output' will be relinked during installation" 1>&2 + else + if test "$fast_install" != no; then + link_command="$finalize_var$compile_command$finalize_rpath" + if test "$fast_install" = yes; then + relink_command=`$echo "X$compile_var$compile_command$compile_rpath" | $SP2NL | $Xsed -e 's%@OUTPUT@%\$progdir/\$file%g' | $NL2SP` + else + # fast_install is set to needless + relink_command= + fi + else + link_command="$compile_var$compile_command$compile_rpath" + relink_command="$finalize_var$finalize_command$finalize_rpath" + fi + fi + + # Replace the output file specification. + link_command=`$echo "X$link_command" | $Xsed -e 's%@OUTPUT@%'"$output_objdir/$outputname"'%g'` + + # Delete the old output files. + $run $rm $output $output_objdir/$outputname $output_objdir/lt-$outputname + + $show "$link_command" + $run eval "$link_command" || exit $? + + # Now create the wrapper script. + $show "creating $output" + + # Quote the relink command for shipping. + if test -n "$relink_command"; then + # Preserve any variables that may affect compiler behavior + for var in $variables_saved_for_relink; do + if eval test -z \"\${$var+set}\"; then + relink_command="{ test -z \"\${$var+set}\" || unset $var || { $var=; export $var; }; }; $relink_command" + elif eval var_value=\$$var; test -z "$var_value"; then + relink_command="$var=; export $var; $relink_command" + else + var_value=`$echo "X$var_value" | $Xsed -e "$sed_quote_subst"` + relink_command="$var=\"$var_value\"; export $var; $relink_command" + fi + done + relink_command="(cd `pwd`; $relink_command)" + relink_command=`$echo "X$relink_command" | $SP2NL | $Xsed -e "$sed_quote_subst" | $NL2SP` + fi + + # Quote $echo for shipping. + if test "X$echo" = "X$SHELL $progpath --fallback-echo"; then + case $progpath in + [\\/]* | [A-Za-z]:[\\/]*) qecho="$SHELL $progpath --fallback-echo";; + *) qecho="$SHELL `pwd`/$progpath --fallback-echo";; + esac + qecho=`$echo "X$qecho" | $Xsed -e "$sed_quote_subst"` + else + qecho=`$echo "X$echo" | $Xsed -e "$sed_quote_subst"` + fi + + # Only actually do things if our run command is non-null. + if test -z "$run"; then + # win32 will think the script is a binary if it has + # a .exe suffix, so we strip it off here. + case $output in + *.exe) output=`$echo $output|${SED} 's,.exe$,,'` ;; + esac + # test for cygwin because mv fails w/o .exe extensions + case $host in + *cygwin*) + exeext=.exe + outputname=`$echo $outputname|${SED} 's,.exe$,,'` ;; + *) exeext= ;; + esac + case $host in + *cygwin* | *mingw* ) + output_name=`basename $output` + output_path=`dirname $output` + cwrappersource="$output_path/$objdir/lt-$output_name.c" + cwrapper="$output_path/$output_name.exe" + $rm $cwrappersource $cwrapper + trap "$rm $cwrappersource $cwrapper; exit $EXIT_FAILURE" 1 2 15 + + cat > $cwrappersource <<EOF + +/* $cwrappersource - temporary wrapper executable for $objdir/$outputname + Generated by $PROGRAM - GNU $PACKAGE $VERSION$TIMESTAMP + + The $output program cannot be directly executed until all the libtool + libraries that it depends on are installed. + + This wrapper executable should never be moved out of the build directory. + If it is, it will not operate correctly. + + Currently, it simply execs the wrapper *script* "/bin/sh $output", + but could eventually absorb all of the scripts functionality and + exec $objdir/$outputname directly. +*/ +EOF + cat >> $cwrappersource<<"EOF" +#include <stdio.h> +#include <stdlib.h> +#include <unistd.h> +#include <malloc.h> +#include <stdarg.h> +#include <assert.h> +#include <string.h> +#include <ctype.h> +#include <sys/stat.h> + +#if defined(PATH_MAX) +# define LT_PATHMAX PATH_MAX +#elif defined(MAXPATHLEN) +# define LT_PATHMAX MAXPATHLEN +#else +# define LT_PATHMAX 1024 +#endif + +#ifndef DIR_SEPARATOR +# define DIR_SEPARATOR '/' +# define PATH_SEPARATOR ':' +#endif + +#if defined (_WIN32) || defined (__MSDOS__) || defined (__DJGPP__) || \ + defined (__OS2__) +# define HAVE_DOS_BASED_FILE_SYSTEM +# ifndef DIR_SEPARATOR_2 +# define DIR_SEPARATOR_2 '\\' +# endif +# ifndef PATH_SEPARATOR_2 +# define PATH_SEPARATOR_2 ';' +# endif +#endif + +#ifndef DIR_SEPARATOR_2 +# define IS_DIR_SEPARATOR(ch) ((ch) == DIR_SEPARATOR) +#else /* DIR_SEPARATOR_2 */ +# define IS_DIR_SEPARATOR(ch) \ + (((ch) == DIR_SEPARATOR) || ((ch) == DIR_SEPARATOR_2)) +#endif /* DIR_SEPARATOR_2 */ + +#ifndef PATH_SEPARATOR_2 +# define IS_PATH_SEPARATOR(ch) ((ch) == PATH_SEPARATOR) +#else /* PATH_SEPARATOR_2 */ +# define IS_PATH_SEPARATOR(ch) ((ch) == PATH_SEPARATOR_2) +#endif /* PATH_SEPARATOR_2 */ + +#define XMALLOC(type, num) ((type *) xmalloc ((num) * sizeof(type))) +#define XFREE(stale) do { \ + if (stale) { free ((void *) stale); stale = 0; } \ +} while (0) + +/* -DDEBUG is fairly common in CFLAGS. */ +#undef DEBUG +#if defined DEBUGWRAPPER +# define DEBUG(format, ...) fprintf(stderr, format, __VA_ARGS__) +#else +# define DEBUG(format, ...) +#endif + +const char *program_name = NULL; + +void * xmalloc (size_t num); +char * xstrdup (const char *string); +const char * base_name (const char *name); +char * find_executable(const char *wrapper); +int check_executable(const char *path); +char * strendzap(char *str, const char *pat); +void lt_fatal (const char *message, ...); + +int +main (int argc, char *argv[]) +{ + char **newargz; + int i; + + program_name = (char *) xstrdup (base_name (argv[0])); + DEBUG("(main) argv[0] : %s\n",argv[0]); + DEBUG("(main) program_name : %s\n",program_name); + newargz = XMALLOC(char *, argc+2); +EOF + + cat >> $cwrappersource <<EOF + newargz[0] = (char *) xstrdup("$SHELL"); +EOF + + cat >> $cwrappersource <<"EOF" + newargz[1] = find_executable(argv[0]); + if (newargz[1] == NULL) + lt_fatal("Couldn't find %s", argv[0]); + DEBUG("(main) found exe at : %s\n",newargz[1]); + /* we know the script has the same name, without the .exe */ + /* so make sure newargz[1] doesn't end in .exe */ + strendzap(newargz[1],".exe"); + for (i = 1; i < argc; i++) + newargz[i+1] = xstrdup(argv[i]); + newargz[argc+1] = NULL; + + for (i=0; i<argc+1; i++) + { + DEBUG("(main) newargz[%d] : %s\n",i,newargz[i]); + ; + } + +EOF + + case $host_os in + mingw*) + cat >> $cwrappersource <<EOF + execv("$SHELL",(char const **)newargz); +EOF + ;; + *) + cat >> $cwrappersource <<EOF + execv("$SHELL",newargz); +EOF + ;; + esac + + cat >> $cwrappersource <<"EOF" + return 127; +} + +void * +xmalloc (size_t num) +{ + void * p = (void *) malloc (num); + if (!p) + lt_fatal ("Memory exhausted"); + + return p; +} + +char * +xstrdup (const char *string) +{ + return string ? strcpy ((char *) xmalloc (strlen (string) + 1), string) : NULL +; +} + +const char * +base_name (const char *name) +{ + const char *base; + +#if defined (HAVE_DOS_BASED_FILE_SYSTEM) + /* Skip over the disk name in MSDOS pathnames. */ + if (isalpha ((unsigned char)name[0]) && name[1] == ':') + name += 2; +#endif + + for (base = name; *name; name++) + if (IS_DIR_SEPARATOR (*name)) + base = name + 1; + return base; +} + +int +check_executable(const char * path) +{ + struct stat st; + + DEBUG("(check_executable) : %s\n", path ? (*path ? path : "EMPTY!") : "NULL!"); + if ((!path) || (!*path)) + return 0; + + if ((stat (path, &st) >= 0) && + ( + /* MinGW & native WIN32 do not support S_IXOTH or S_IXGRP */ +#if defined (S_IXOTH) + ((st.st_mode & S_IXOTH) == S_IXOTH) || +#endif +#if defined (S_IXGRP) + ((st.st_mode & S_IXGRP) == S_IXGRP) || +#endif + ((st.st_mode & S_IXUSR) == S_IXUSR)) + ) + return 1; + else + return 0; +} + +/* Searches for the full path of the wrapper. Returns + newly allocated full path name if found, NULL otherwise */ +char * +find_executable (const char* wrapper) +{ + int has_slash = 0; + const char* p; + const char* p_next; + /* static buffer for getcwd */ + char tmp[LT_PATHMAX + 1]; + int tmp_len; + char* concat_name; + + DEBUG("(find_executable) : %s\n", wrapper ? (*wrapper ? wrapper : "EMPTY!") : "NULL!"); + + if ((wrapper == NULL) || (*wrapper == '\0')) + return NULL; + + /* Absolute path? */ +#if defined (HAVE_DOS_BASED_FILE_SYSTEM) + if (isalpha ((unsigned char)wrapper[0]) && wrapper[1] == ':') + { + concat_name = xstrdup (wrapper); + if (check_executable(concat_name)) + return concat_name; + XFREE(concat_name); + } + else + { +#endif + if (IS_DIR_SEPARATOR (wrapper[0])) + { + concat_name = xstrdup (wrapper); + if (check_executable(concat_name)) + return concat_name; + XFREE(concat_name); + } +#if defined (HAVE_DOS_BASED_FILE_SYSTEM) + } +#endif + + for (p = wrapper; *p; p++) + if (*p == '/') + { + has_slash = 1; + break; + } + if (!has_slash) + { + /* no slashes; search PATH */ + const char* path = getenv ("PATH"); + if (path != NULL) + { + for (p = path; *p; p = p_next) + { + const char* q; + size_t p_len; + for (q = p; *q; q++) + if (IS_PATH_SEPARATOR(*q)) + break; + p_len = q - p; + p_next = (*q == '\0' ? q : q + 1); + if (p_len == 0) + { + /* empty path: current directory */ + if (getcwd (tmp, LT_PATHMAX) == NULL) + lt_fatal ("getcwd failed"); + tmp_len = strlen(tmp); + concat_name = XMALLOC(char, tmp_len + 1 + strlen(wrapper) + 1); + memcpy (concat_name, tmp, tmp_len); + concat_name[tmp_len] = '/'; + strcpy (concat_name + tmp_len + 1, wrapper); + } + else + { + concat_name = XMALLOC(char, p_len + 1 + strlen(wrapper) + 1); + memcpy (concat_name, p, p_len); + concat_name[p_len] = '/'; + strcpy (concat_name + p_len + 1, wrapper); + } + if (check_executable(concat_name)) + return concat_name; + XFREE(concat_name); + } + } + /* not found in PATH; assume curdir */ + } + /* Relative path | not found in path: prepend cwd */ + if (getcwd (tmp, LT_PATHMAX) == NULL) + lt_fatal ("getcwd failed"); + tmp_len = strlen(tmp); + concat_name = XMALLOC(char, tmp_len + 1 + strlen(wrapper) + 1); + memcpy (concat_name, tmp, tmp_len); + concat_name[tmp_len] = '/'; + strcpy (concat_name + tmp_len + 1, wrapper); + + if (check_executable(concat_name)) + return concat_name; + XFREE(concat_name); + return NULL; +} + +char * +strendzap(char *str, const char *pat) +{ + size_t len, patlen; + + assert(str != NULL); + assert(pat != NULL); + + len = strlen(str); + patlen = strlen(pat); + + if (patlen <= len) + { + str += len - patlen; + if (strcmp(str, pat) == 0) + *str = '\0'; + } + return str; +} + +static void +lt_error_core (int exit_status, const char * mode, + const char * message, va_list ap) +{ + fprintf (stderr, "%s: %s: ", program_name, mode); + vfprintf (stderr, message, ap); + fprintf (stderr, ".\n"); + + if (exit_status >= 0) + exit (exit_status); +} + +void +lt_fatal (const char *message, ...) +{ + va_list ap; + va_start (ap, message); + lt_error_core (EXIT_FAILURE, "FATAL", message, ap); + va_end (ap); +} +EOF + # we should really use a build-platform specific compiler + # here, but OTOH, the wrappers (shell script and this C one) + # are only useful if you want to execute the "real" binary. + # Since the "real" binary is built for $host, then this + # wrapper might as well be built for $host, too. + $run $LTCC $LTCFLAGS -s -o $cwrapper $cwrappersource + ;; + esac + $rm $output + trap "$rm $output; exit $EXIT_FAILURE" 1 2 15 + + $echo > $output "\ +#! $SHELL + +# $output - temporary wrapper script for $objdir/$outputname +# Generated by $PROGRAM - GNU $PACKAGE $VERSION$TIMESTAMP +# +# The $output program cannot be directly executed until all the libtool +# libraries that it depends on are installed. +# +# This wrapper script should never be moved out of the build directory. +# If it is, it will not operate correctly. + +# Sed substitution that helps us do robust quoting. It backslashifies +# metacharacters that are still active within double-quoted strings. +Xsed='${SED} -e 1s/^X//' +sed_quote_subst='$sed_quote_subst' + +# Be Bourne compatible (taken from Autoconf:_AS_BOURNE_COMPATIBLE). +if test -n \"\${ZSH_VERSION+set}\" && (emulate sh) >/dev/null 2>&1; then + emulate sh + NULLCMD=: + # Zsh 3.x and 4.x performs word splitting on \${1+\"\$@\"}, which + # is contrary to our usage. Disable this feature. + alias -g '\${1+\"\$@\"}'='\"\$@\"' + setopt NO_GLOB_SUBST +else + case \`(set -o) 2>/dev/null\` in *posix*) set -o posix;; esac +fi + +# The HP-UX ksh and POSIX shell print the target directory to stdout +# if CDPATH is set. +(unset CDPATH) >/dev/null 2>&1 && unset CDPATH + +relink_command=\"$relink_command\" + +# This environment variable determines our operation mode. +if test \"\$libtool_install_magic\" = \"$magic\"; then + # install mode needs the following variable: + notinst_deplibs='$notinst_deplibs' +else + # When we are sourced in execute mode, \$file and \$echo are already set. + if test \"\$libtool_execute_magic\" != \"$magic\"; then + echo=\"$qecho\" + file=\"\$0\" + # Make sure echo works. + if test \"X\$1\" = X--no-reexec; then + # Discard the --no-reexec flag, and continue. + shift + elif test \"X\`(\$echo '\t') 2>/dev/null\`\" = 'X\t'; then + # Yippee, \$echo works! + : + else + # Restart under the correct shell, and then maybe \$echo will work. + exec $SHELL \"\$0\" --no-reexec \${1+\"\$@\"} + fi + fi\ +" + $echo >> $output "\ + + # Find the directory that this script lives in. + thisdir=\`\$echo \"X\$file\" | \$Xsed -e 's%/[^/]*$%%'\` + test \"x\$thisdir\" = \"x\$file\" && thisdir=. + + # Follow symbolic links until we get to the real thisdir. + file=\`ls -ld \"\$file\" | ${SED} -n 's/.*-> //p'\` + while test -n \"\$file\"; do + destdir=\`\$echo \"X\$file\" | \$Xsed -e 's%/[^/]*\$%%'\` + + # If there was a directory component, then change thisdir. + if test \"x\$destdir\" != \"x\$file\"; then + case \"\$destdir\" in + [\\\\/]* | [A-Za-z]:[\\\\/]*) thisdir=\"\$destdir\" ;; + *) thisdir=\"\$thisdir/\$destdir\" ;; + esac + fi + + file=\`\$echo \"X\$file\" | \$Xsed -e 's%^.*/%%'\` + file=\`ls -ld \"\$thisdir/\$file\" | ${SED} -n 's/.*-> //p'\` + done + + # Try to get the absolute directory name. + absdir=\`cd \"\$thisdir\" && pwd\` + test -n \"\$absdir\" && thisdir=\"\$absdir\" +" + + if test "$fast_install" = yes; then + $echo >> $output "\ + program=lt-'$outputname'$exeext + progdir=\"\$thisdir/$objdir\" + + if test ! -f \"\$progdir/\$program\" || \\ + { file=\`ls -1dt \"\$progdir/\$program\" \"\$progdir/../\$program\" 2>/dev/null | ${SED} 1q\`; \\ + test \"X\$file\" != \"X\$progdir/\$program\"; }; then + + file=\"\$\$-\$program\" + + if test ! -d \"\$progdir\"; then + $mkdir \"\$progdir\" + else + $rm \"\$progdir/\$file\" + fi" + + $echo >> $output "\ + + # relink executable if necessary + if test -n \"\$relink_command\"; then + if relink_command_output=\`eval \$relink_command 2>&1\`; then : + else + $echo \"\$relink_command_output\" >&2 + $rm \"\$progdir/\$file\" + exit $EXIT_FAILURE + fi + fi + + $mv \"\$progdir/\$file\" \"\$progdir/\$program\" 2>/dev/null || + { $rm \"\$progdir/\$program\"; + $mv \"\$progdir/\$file\" \"\$progdir/\$program\"; } + $rm \"\$progdir/\$file\" + fi" + else + $echo >> $output "\ + program='$outputname' + progdir=\"\$thisdir/$objdir\" +" + fi + + $echo >> $output "\ + + if test -f \"\$progdir/\$program\"; then" + + # Export our shlibpath_var if we have one. + if test "$shlibpath_overrides_runpath" = yes && test -n "$shlibpath_var" && test -n "$temp_rpath"; then + $echo >> $output "\ + # Add our own library path to $shlibpath_var + $shlibpath_var=\"$temp_rpath\$$shlibpath_var\" + + # Some systems cannot cope with colon-terminated $shlibpath_var + # The second colon is a workaround for a bug in BeOS R4 sed + $shlibpath_var=\`\$echo \"X\$$shlibpath_var\" | \$Xsed -e 's/::*\$//'\` + + export $shlibpath_var +" + fi + + # fixup the dll searchpath if we need to. + if test -n "$dllsearchpath"; then + $echo >> $output "\ + # Add the dll search path components to the executable PATH + PATH=$dllsearchpath:\$PATH +" + fi + + $echo >> $output "\ + if test \"\$libtool_execute_magic\" != \"$magic\"; then + # Run the actual program with our arguments. +" + case $host in + # Backslashes separate directories on plain windows + *-*-mingw | *-*-os2*) + $echo >> $output "\ + exec \"\$progdir\\\\\$program\" \${1+\"\$@\"} +" + ;; + + *) + $echo >> $output "\ + exec \"\$progdir/\$program\" \${1+\"\$@\"} +" + ;; + esac + $echo >> $output "\ + \$echo \"\$0: cannot exec \$program \$*\" + exit $EXIT_FAILURE + fi + else + # The program doesn't exist. + \$echo \"\$0: error: \\\`\$progdir/\$program' does not exist\" 1>&2 + \$echo \"This script is just a wrapper for \$program.\" 1>&2 + $echo \"See the $PACKAGE documentation for more information.\" 1>&2 + exit $EXIT_FAILURE + fi +fi\ +" + chmod +x $output + fi + exit $EXIT_SUCCESS + ;; + esac + + # See if we need to build an old-fashioned archive. + for oldlib in $oldlibs; do + + if test "$build_libtool_libs" = convenience; then + oldobjs="$libobjs_save" + addlibs="$convenience" + build_libtool_libs=no + else + if test "$build_libtool_libs" = module; then + oldobjs="$libobjs_save" + build_libtool_libs=no + else + oldobjs="$old_deplibs $non_pic_objects" + fi + addlibs="$old_convenience" + fi + + if test -n "$addlibs"; then + gentop="$output_objdir/${outputname}x" + generated="$generated $gentop" + + func_extract_archives $gentop $addlibs + oldobjs="$oldobjs $func_extract_archives_result" + fi + + # Do each command in the archive commands. + if test -n "$old_archive_from_new_cmds" && test "$build_libtool_libs" = yes; then + cmds=$old_archive_from_new_cmds + else + # POSIX demands no paths to be encoded in archives. We have + # to avoid creating archives with duplicate basenames if we + # might have to extract them afterwards, e.g., when creating a + # static archive out of a convenience library, or when linking + # the entirety of a libtool archive into another (currently + # not supported by libtool). + if (for obj in $oldobjs + do + $echo "X$obj" | $Xsed -e 's%^.*/%%' + done | sort | sort -uc >/dev/null 2>&1); then + : + else + $echo "copying selected object files to avoid basename conflicts..." + + if test -z "$gentop"; then + gentop="$output_objdir/${outputname}x" + generated="$generated $gentop" + + $show "${rm}r $gentop" + $run ${rm}r "$gentop" + $show "$mkdir $gentop" + $run $mkdir "$gentop" + exit_status=$? + if test "$exit_status" -ne 0 && test ! -d "$gentop"; then + exit $exit_status + fi + fi + + save_oldobjs=$oldobjs + oldobjs= + counter=1 + for obj in $save_oldobjs + do + objbase=`$echo "X$obj" | $Xsed -e 's%^.*/%%'` + case " $oldobjs " in + " ") oldobjs=$obj ;; + *[\ /]"$objbase "*) + while :; do + # Make sure we don't pick an alternate name that also + # overlaps. + newobj=lt$counter-$objbase + counter=`expr $counter + 1` + case " $oldobjs " in + *[\ /]"$newobj "*) ;; + *) if test ! -f "$gentop/$newobj"; then break; fi ;; + esac + done + $show "ln $obj $gentop/$newobj || cp $obj $gentop/$newobj" + $run ln "$obj" "$gentop/$newobj" || + $run cp "$obj" "$gentop/$newobj" + oldobjs="$oldobjs $gentop/$newobj" + ;; + *) oldobjs="$oldobjs $obj" ;; + esac + done + fi + + eval cmds=\"$old_archive_cmds\" + + if len=`expr "X$cmds" : ".*"` && + test "$len" -le "$max_cmd_len" || test "$max_cmd_len" -le -1; then + cmds=$old_archive_cmds + else + # the command line is too long to link in one step, link in parts + $echo "using piecewise archive linking..." + save_RANLIB=$RANLIB + RANLIB=: + objlist= + concat_cmds= + save_oldobjs=$oldobjs + + # Is there a better way of finding the last object in the list? + for obj in $save_oldobjs + do + last_oldobj=$obj + done + for obj in $save_oldobjs + do + oldobjs="$objlist $obj" + objlist="$objlist $obj" + eval test_cmds=\"$old_archive_cmds\" + if len=`expr "X$test_cmds" : ".*" 2>/dev/null` && + test "$len" -le "$max_cmd_len"; then + : + else + # the above command should be used before it gets too long + oldobjs=$objlist + if test "$obj" = "$last_oldobj" ; then + RANLIB=$save_RANLIB + fi + test -z "$concat_cmds" || concat_cmds=$concat_cmds~ + eval concat_cmds=\"\${concat_cmds}$old_archive_cmds\" + objlist= + fi + done + RANLIB=$save_RANLIB + oldobjs=$objlist + if test "X$oldobjs" = "X" ; then + eval cmds=\"\$concat_cmds\" + else + eval cmds=\"\$concat_cmds~\$old_archive_cmds\" + fi + fi + fi + save_ifs="$IFS"; IFS='~' + for cmd in $cmds; do + eval cmd=\"$cmd\" + IFS="$save_ifs" + $show "$cmd" + $run eval "$cmd" || exit $? + done + IFS="$save_ifs" + done + + if test -n "$generated"; then + $show "${rm}r$generated" + $run ${rm}r$generated + fi + + # Now create the libtool archive. + case $output in + *.la) + old_library= + test "$build_old_libs" = yes && old_library="$libname.$libext" + $show "creating $output" + + # Preserve any variables that may affect compiler behavior + for var in $variables_saved_for_relink; do + if eval test -z \"\${$var+set}\"; then + relink_command="{ test -z \"\${$var+set}\" || unset $var || { $var=; export $var; }; }; $relink_command" + elif eval var_value=\$$var; test -z "$var_value"; then + relink_command="$var=; export $var; $relink_command" + else + var_value=`$echo "X$var_value" | $Xsed -e "$sed_quote_subst"` + relink_command="$var=\"$var_value\"; export $var; $relink_command" + fi + done + # Quote the link command for shipping. + relink_command="(cd `pwd`; $SHELL $progpath $preserve_args --mode=relink $libtool_args @inst_prefix_dir@)" + relink_command=`$echo "X$relink_command" | $SP2NL | $Xsed -e "$sed_quote_subst" | $NL2SP` + if test "$hardcode_automatic" = yes ; then + relink_command= + fi + + + # Only create the output if not a dry run. + if test -z "$run"; then + for installed in no yes; do + if test "$installed" = yes; then + if test -z "$install_libdir"; then + break + fi + output="$output_objdir/$outputname"i + # Replace all uninstalled libtool libraries with the installed ones + newdependency_libs= + for deplib in $dependency_libs; do + case $deplib in + *.la) + name=`$echo "X$deplib" | $Xsed -e 's%^.*/%%'` + eval libdir=`${SED} -n -e 's/^libdir=\(.*\)$/\1/p' $deplib` + if test -z "$libdir"; then + $echo "$modename: \`$deplib' is not a valid libtool archive" 1>&2 + exit $EXIT_FAILURE + fi + newdependency_libs="$newdependency_libs $libdir/$name" + ;; + *) newdependency_libs="$newdependency_libs $deplib" ;; + esac + done + dependency_libs="$newdependency_libs" + newdlfiles= + for lib in $dlfiles; do + name=`$echo "X$lib" | $Xsed -e 's%^.*/%%'` + eval libdir=`${SED} -n -e 's/^libdir=\(.*\)$/\1/p' $lib` + if test -z "$libdir"; then + $echo "$modename: \`$lib' is not a valid libtool archive" 1>&2 + exit $EXIT_FAILURE + fi + newdlfiles="$newdlfiles $libdir/$name" + done + dlfiles="$newdlfiles" + newdlprefiles= + for lib in $dlprefiles; do + name=`$echo "X$lib" | $Xsed -e 's%^.*/%%'` + eval libdir=`${SED} -n -e 's/^libdir=\(.*\)$/\1/p' $lib` + if test -z "$libdir"; then + $echo "$modename: \`$lib' is not a valid libtool archive" 1>&2 + exit $EXIT_FAILURE + fi + newdlprefiles="$newdlprefiles $libdir/$name" + done + dlprefiles="$newdlprefiles" + else + newdlfiles= + for lib in $dlfiles; do + case $lib in + [\\/]* | [A-Za-z]:[\\/]*) abs="$lib" ;; + *) abs=`pwd`"/$lib" ;; + esac + newdlfiles="$newdlfiles $abs" + done + dlfiles="$newdlfiles" + newdlprefiles= + for lib in $dlprefiles; do + case $lib in + [\\/]* | [A-Za-z]:[\\/]*) abs="$lib" ;; + *) abs=`pwd`"/$lib" ;; + esac + newdlprefiles="$newdlprefiles $abs" + done + dlprefiles="$newdlprefiles" + fi + $rm $output + # place dlname in correct position for cygwin + tdlname=$dlname + case $host,$output,$installed,$module,$dlname in + *cygwin*,*lai,yes,no,*.dll | *mingw*,*lai,yes,no,*.dll) tdlname=../bin/$dlname ;; + esac + $echo > $output "\ +# $outputname - a libtool library file +# Generated by $PROGRAM - GNU $PACKAGE $VERSION$TIMESTAMP +# +# Please DO NOT delete this file! +# It is necessary for linking the library. + +# The name that we can dlopen(3). +dlname='$tdlname' + +# Names of this library. +library_names='$library_names' + +# The name of the static archive. +old_library='$old_library' + +# Libraries that this one depends upon. +dependency_libs='$dependency_libs' + +# Version information for $libname. +current=$current +age=$age +revision=$revision + +# Is this an already installed library? +installed=$installed + +# Should we warn about portability when linking against -modules? +shouldnotlink=$module + +# Files to dlopen/dlpreopen +dlopen='$dlfiles' +dlpreopen='$dlprefiles' + +# Directory that this library needs to be installed in: +libdir='$install_libdir'" + if test "$installed" = no && test "$need_relink" = yes; then + $echo >> $output "\ +relink_command=\"$relink_command\"" + fi + done + fi + + # Do a symbolic link so that the libtool archive can be found in + # LD_LIBRARY_PATH before the program is installed. + $show "(cd $output_objdir && $rm $outputname && $LN_S ../$outputname $outputname)" + $run eval '(cd $output_objdir && $rm $outputname && $LN_S ../$outputname $outputname)' || exit $? + ;; + esac + exit $EXIT_SUCCESS + ;; + + # libtool install mode + install) + modename="$modename: install" + + # There may be an optional sh(1) argument at the beginning of + # install_prog (especially on Windows NT). + if test "$nonopt" = "$SHELL" || test "$nonopt" = /bin/sh || + # Allow the use of GNU shtool's install command. + $echo "X$nonopt" | grep shtool > /dev/null; then + # Aesthetically quote it. + arg=`$echo "X$nonopt" | $Xsed -e "$sed_quote_subst"` + case $arg in + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"") + arg="\"$arg\"" + ;; + esac + install_prog="$arg " + arg="$1" + shift + else + install_prog= + arg=$nonopt + fi + + # The real first argument should be the name of the installation program. + # Aesthetically quote it. + arg=`$echo "X$arg" | $Xsed -e "$sed_quote_subst"` + case $arg in + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"") + arg="\"$arg\"" + ;; + esac + install_prog="$install_prog$arg" + + # We need to accept at least all the BSD install flags. + dest= + files= + opts= + prev= + install_type= + isdir=no + stripme= + for arg + do + if test -n "$dest"; then + files="$files $dest" + dest=$arg + continue + fi + + case $arg in + -d) isdir=yes ;; + -f) + case " $install_prog " in + *[\\\ /]cp\ *) ;; + *) prev=$arg ;; + esac + ;; + -g | -m | -o) prev=$arg ;; + -s) + stripme=" -s" + continue + ;; + -*) + ;; + *) + # If the previous option needed an argument, then skip it. + if test -n "$prev"; then + prev= + else + dest=$arg + continue + fi + ;; + esac + + # Aesthetically quote the argument. + arg=`$echo "X$arg" | $Xsed -e "$sed_quote_subst"` + case $arg in + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"") + arg="\"$arg\"" + ;; + esac + install_prog="$install_prog $arg" + done + + if test -z "$install_prog"; then + $echo "$modename: you must specify an install program" 1>&2 + $echo "$help" 1>&2 + exit $EXIT_FAILURE + fi + + if test -n "$prev"; then + $echo "$modename: the \`$prev' option requires an argument" 1>&2 + $echo "$help" 1>&2 + exit $EXIT_FAILURE + fi + + if test -z "$files"; then + if test -z "$dest"; then + $echo "$modename: no file or destination specified" 1>&2 + else + $echo "$modename: you must specify a destination" 1>&2 + fi + $echo "$help" 1>&2 + exit $EXIT_FAILURE + fi + + # Strip any trailing slash from the destination. + dest=`$echo "X$dest" | $Xsed -e 's%/$%%'` + + # Check to see that the destination is a directory. + test -d "$dest" && isdir=yes + if test "$isdir" = yes; then + destdir="$dest" + destname= + else + destdir=`$echo "X$dest" | $Xsed -e 's%/[^/]*$%%'` + test "X$destdir" = "X$dest" && destdir=. + destname=`$echo "X$dest" | $Xsed -e 's%^.*/%%'` + + # Not a directory, so check to see that there is only one file specified. + set dummy $files + if test "$#" -gt 2; then + $echo "$modename: \`$dest' is not a directory" 1>&2 + $echo "$help" 1>&2 + exit $EXIT_FAILURE + fi + fi + case $destdir in + [\\/]* | [A-Za-z]:[\\/]*) ;; + *) + for file in $files; do + case $file in + *.lo) ;; + *) + $echo "$modename: \`$destdir' must be an absolute directory name" 1>&2 + $echo "$help" 1>&2 + exit $EXIT_FAILURE + ;; + esac + done + ;; + esac + + # This variable tells wrapper scripts just to set variables rather + # than running their programs. + libtool_install_magic="$magic" + + staticlibs= + future_libdirs= + current_libdirs= + for file in $files; do + + # Do each installation. + case $file in + *.$libext) + # Do the static libraries later. + staticlibs="$staticlibs $file" + ;; + + *.la) + # Check to see that this really is a libtool archive. + if (${SED} -e '2q' $file | grep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then : + else + $echo "$modename: \`$file' is not a valid libtool archive" 1>&2 + $echo "$help" 1>&2 + exit $EXIT_FAILURE + fi + + library_names= + old_library= + relink_command= + # If there is no directory component, then add one. + case $file in + */* | *\\*) . $file ;; + *) . ./$file ;; + esac + + # Add the libdir to current_libdirs if it is the destination. + if test "X$destdir" = "X$libdir"; then + case "$current_libdirs " in + *" $libdir "*) ;; + *) current_libdirs="$current_libdirs $libdir" ;; + esac + else + # Note the libdir as a future libdir. + case "$future_libdirs " in + *" $libdir "*) ;; + *) future_libdirs="$future_libdirs $libdir" ;; + esac + fi + + dir=`$echo "X$file" | $Xsed -e 's%/[^/]*$%%'`/ + test "X$dir" = "X$file/" && dir= + dir="$dir$objdir" + + if test -n "$relink_command"; then + # Determine the prefix the user has applied to our future dir. + inst_prefix_dir=`$echo "$destdir" | $SED "s%$libdir\$%%"` + + # Don't allow the user to place us outside of our expected + # location b/c this prevents finding dependent libraries that + # are installed to the same prefix. + # At present, this check doesn't affect windows .dll's that + # are installed into $libdir/../bin (currently, that works fine) + # but it's something to keep an eye on. + if test "$inst_prefix_dir" = "$destdir"; then + $echo "$modename: error: cannot install \`$file' to a directory not ending in $libdir" 1>&2 + exit $EXIT_FAILURE + fi + + if test -n "$inst_prefix_dir"; then + # Stick the inst_prefix_dir data into the link command. + relink_command=`$echo "$relink_command" | $SP2NL | $SED "s%@inst_prefix_dir@%-inst-prefix-dir $inst_prefix_dir%" | $NL2SP` + else + relink_command=`$echo "$relink_command" | $SP2NL | $SED "s%@inst_prefix_dir@%%" | $NL2SP` + fi + + $echo "$modename: warning: relinking \`$file'" 1>&2 + $show "$relink_command" + if $run eval "$relink_command"; then : + else + $echo "$modename: error: relink \`$file' with the above command before installing it" 1>&2 + exit $EXIT_FAILURE + fi + fi + + # See the names of the shared library. + set dummy $library_names + if test -n "$2"; then + realname="$2" + shift + shift + + srcname="$realname" + test -n "$relink_command" && srcname="$realname"T + + # Install the shared library and build the symlinks. + $show "$install_prog $dir/$srcname $destdir/$realname" + $run eval "$install_prog $dir/$srcname $destdir/$realname" || exit $? + if test -n "$stripme" && test -n "$striplib"; then + $show "$striplib $destdir/$realname" + $run eval "$striplib $destdir/$realname" || exit $? + fi + + if test "$#" -gt 0; then + # Delete the old symlinks, and create new ones. + # Try `ln -sf' first, because the `ln' binary might depend on + # the symlink we replace! Solaris /bin/ln does not understand -f, + # so we also need to try rm && ln -s. + for linkname + do + if test "$linkname" != "$realname"; then + $show "(cd $destdir && { $LN_S -f $realname $linkname || { $rm $linkname && $LN_S $realname $linkname; }; })" + $run eval "(cd $destdir && { $LN_S -f $realname $linkname || { $rm $linkname && $LN_S $realname $linkname; }; })" + fi + done + fi + + # Do each command in the postinstall commands. + lib="$destdir/$realname" + cmds=$postinstall_cmds + save_ifs="$IFS"; IFS='~' + for cmd in $cmds; do + IFS="$save_ifs" + eval cmd=\"$cmd\" + $show "$cmd" + $run eval "$cmd" || { + lt_exit=$? + + # Restore the uninstalled library and exit + if test "$mode" = relink; then + $run eval '(cd $output_objdir && $rm ${realname}T && $mv ${realname}U $realname)' + fi + + exit $lt_exit + } + done + IFS="$save_ifs" + fi + + # Install the pseudo-library for information purposes. + name=`$echo "X$file" | $Xsed -e 's%^.*/%%'` + instname="$dir/$name"i + $show "$install_prog $instname $destdir/$name" + $run eval "$install_prog $instname $destdir/$name" || exit $? + + # Maybe install the static library, too. + test -n "$old_library" && staticlibs="$staticlibs $dir/$old_library" + ;; + + *.lo) + # Install (i.e. copy) a libtool object. + + # Figure out destination file name, if it wasn't already specified. + if test -n "$destname"; then + destfile="$destdir/$destname" + else + destfile=`$echo "X$file" | $Xsed -e 's%^.*/%%'` + destfile="$destdir/$destfile" + fi + + # Deduce the name of the destination old-style object file. + case $destfile in + *.lo) + staticdest=`$echo "X$destfile" | $Xsed -e "$lo2o"` + ;; + *.$objext) + staticdest="$destfile" + destfile= + ;; + *) + $echo "$modename: cannot copy a libtool object to \`$destfile'" 1>&2 + $echo "$help" 1>&2 + exit $EXIT_FAILURE + ;; + esac + + # Install the libtool object if requested. + if test -n "$destfile"; then + $show "$install_prog $file $destfile" + $run eval "$install_prog $file $destfile" || exit $? + fi + + # Install the old object if enabled. + if test "$build_old_libs" = yes; then + # Deduce the name of the old-style object file. + staticobj=`$echo "X$file" | $Xsed -e "$lo2o"` + + $show "$install_prog $staticobj $staticdest" + $run eval "$install_prog \$staticobj \$staticdest" || exit $? + fi + exit $EXIT_SUCCESS + ;; + + *) + # Figure out destination file name, if it wasn't already specified. + if test -n "$destname"; then + destfile="$destdir/$destname" + else + destfile=`$echo "X$file" | $Xsed -e 's%^.*/%%'` + destfile="$destdir/$destfile" + fi + + # If the file is missing, and there is a .exe on the end, strip it + # because it is most likely a libtool script we actually want to + # install + stripped_ext="" + case $file in + *.exe) + if test ! -f "$file"; then + file=`$echo $file|${SED} 's,.exe$,,'` + stripped_ext=".exe" + fi + ;; + esac + + # Do a test to see if this is really a libtool program. + case $host in + *cygwin*|*mingw*) + wrapper=`$echo $file | ${SED} -e 's,.exe$,,'` + ;; + *) + wrapper=$file + ;; + esac + if (${SED} -e '4q' $wrapper | grep "^# Generated by .*$PACKAGE")>/dev/null 2>&1; then + notinst_deplibs= + relink_command= + + # Note that it is not necessary on cygwin/mingw to append a dot to + # foo even if both foo and FILE.exe exist: automatic-append-.exe + # behavior happens only for exec(3), not for open(2)! Also, sourcing + # `FILE.' does not work on cygwin managed mounts. + # + # If there is no directory component, then add one. + case $wrapper in + */* | *\\*) . ${wrapper} ;; + *) . ./${wrapper} ;; + esac + + # Check the variables that should have been set. + if test -z "$notinst_deplibs"; then + $echo "$modename: invalid libtool wrapper script \`$wrapper'" 1>&2 + exit $EXIT_FAILURE + fi + + finalize=yes + for lib in $notinst_deplibs; do + # Check to see that each library is installed. + libdir= + if test -f "$lib"; then + # If there is no directory component, then add one. + case $lib in + */* | *\\*) . $lib ;; + *) . ./$lib ;; + esac + fi + libfile="$libdir/"`$echo "X$lib" | $Xsed -e 's%^.*/%%g'` ### testsuite: skip nested quoting test + if test -n "$libdir" && test ! -f "$libfile"; then + $echo "$modename: warning: \`$lib' has not been installed in \`$libdir'" 1>&2 + finalize=no + fi + done + + relink_command= + # Note that it is not necessary on cygwin/mingw to append a dot to + # foo even if both foo and FILE.exe exist: automatic-append-.exe + # behavior happens only for exec(3), not for open(2)! Also, sourcing + # `FILE.' does not work on cygwin managed mounts. + # + # If there is no directory component, then add one. + case $wrapper in + */* | *\\*) . ${wrapper} ;; + *) . ./${wrapper} ;; + esac + + outputname= + if test "$fast_install" = no && test -n "$relink_command"; then + if test "$finalize" = yes && test -z "$run"; then + tmpdir=`func_mktempdir` + file=`$echo "X$file$stripped_ext" | $Xsed -e 's%^.*/%%'` + outputname="$tmpdir/$file" + # Replace the output file specification. + relink_command=`$echo "X$relink_command" | $SP2NL | $Xsed -e 's%@OUTPUT@%'"$outputname"'%g' | $NL2SP` + + $show "$relink_command" + if $run eval "$relink_command"; then : + else + $echo "$modename: error: relink \`$file' with the above command before installing it" 1>&2 + ${rm}r "$tmpdir" + continue + fi + file="$outputname" + else + $echo "$modename: warning: cannot relink \`$file'" 1>&2 + fi + else + # Install the binary that we compiled earlier. + file=`$echo "X$file$stripped_ext" | $Xsed -e "s%\([^/]*\)$%$objdir/\1%"` + fi + fi + + # remove .exe since cygwin /usr/bin/install will append another + # one anyway + case $install_prog,$host in + */usr/bin/install*,*cygwin*) + case $file:$destfile in + *.exe:*.exe) + # this is ok + ;; + *.exe:*) + destfile=$destfile.exe + ;; + *:*.exe) + destfile=`$echo $destfile | ${SED} -e 's,.exe$,,'` + ;; + esac + ;; + esac + $show "$install_prog$stripme $file $destfile" + $run eval "$install_prog\$stripme \$file \$destfile" || exit $? + test -n "$outputname" && ${rm}r "$tmpdir" + ;; + esac + done + + for file in $staticlibs; do + name=`$echo "X$file" | $Xsed -e 's%^.*/%%'` + + # Set up the ranlib parameters. + oldlib="$destdir/$name" + + $show "$install_prog $file $oldlib" + $run eval "$install_prog \$file \$oldlib" || exit $? + + if test -n "$stripme" && test -n "$old_striplib"; then + $show "$old_striplib $oldlib" + $run eval "$old_striplib $oldlib" || exit $? + fi + + # Do each command in the postinstall commands. + cmds=$old_postinstall_cmds + save_ifs="$IFS"; IFS='~' + for cmd in $cmds; do + IFS="$save_ifs" + eval cmd=\"$cmd\" + $show "$cmd" + $run eval "$cmd" || exit $? + done + IFS="$save_ifs" + done + + if test -n "$future_libdirs"; then + $echo "$modename: warning: remember to run \`$progname --finish$future_libdirs'" 1>&2 + fi + + if test -n "$current_libdirs"; then + # Maybe just do a dry run. + test -n "$run" && current_libdirs=" -n$current_libdirs" + exec_cmd='$SHELL $progpath $preserve_args --finish$current_libdirs' + else + exit $EXIT_SUCCESS + fi + ;; + + # libtool finish mode + finish) + modename="$modename: finish" + libdirs="$nonopt" + admincmds= + + if test -n "$finish_cmds$finish_eval" && test -n "$libdirs"; then + for dir + do + libdirs="$libdirs $dir" + done + + for libdir in $libdirs; do + if test -n "$finish_cmds"; then + # Do each command in the finish commands. + cmds=$finish_cmds + save_ifs="$IFS"; IFS='~' + for cmd in $cmds; do + IFS="$save_ifs" + eval cmd=\"$cmd\" + $show "$cmd" + $run eval "$cmd" || admincmds="$admincmds + $cmd" + done + IFS="$save_ifs" + fi + if test -n "$finish_eval"; then + # Do the single finish_eval. + eval cmds=\"$finish_eval\" + $run eval "$cmds" || admincmds="$admincmds + $cmds" + fi + done + fi + + # Exit here if they wanted silent mode. + test "$show" = : && exit $EXIT_SUCCESS + + $echo "X----------------------------------------------------------------------" | $Xsed + $echo "Libraries have been installed in:" + for libdir in $libdirs; do + $echo " $libdir" + done + $echo + $echo "If you ever happen to want to link against installed libraries" + $echo "in a given directory, LIBDIR, you must either use libtool, and" + $echo "specify the full pathname of the library, or use the \`-LLIBDIR'" + $echo "flag during linking and do at least one of the following:" + if test -n "$shlibpath_var"; then + $echo " - add LIBDIR to the \`$shlibpath_var' environment variable" + $echo " during execution" + fi + if test -n "$runpath_var"; then + $echo " - add LIBDIR to the \`$runpath_var' environment variable" + $echo " during linking" + fi + if test -n "$hardcode_libdir_flag_spec"; then + libdir=LIBDIR + eval flag=\"$hardcode_libdir_flag_spec\" + + $echo " - use the \`$flag' linker flag" + fi + if test -n "$admincmds"; then + $echo " - have your system administrator run these commands:$admincmds" + fi + if test -f /etc/ld.so.conf; then + $echo " - have your system administrator add LIBDIR to \`/etc/ld.so.conf'" + fi + $echo + $echo "See any operating system documentation about shared libraries for" + $echo "more information, such as the ld(1) and ld.so(8) manual pages." + $echo "X----------------------------------------------------------------------" | $Xsed + exit $EXIT_SUCCESS + ;; + + # libtool execute mode + execute) + modename="$modename: execute" + + # The first argument is the command name. + cmd="$nonopt" + if test -z "$cmd"; then + $echo "$modename: you must specify a COMMAND" 1>&2 + $echo "$help" + exit $EXIT_FAILURE + fi + + # Handle -dlopen flags immediately. + for file in $execute_dlfiles; do + if test ! -f "$file"; then + $echo "$modename: \`$file' is not a file" 1>&2 + $echo "$help" 1>&2 + exit $EXIT_FAILURE + fi + + dir= + case $file in + *.la) + # Check to see that this really is a libtool archive. + if (${SED} -e '2q' $file | grep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then : + else + $echo "$modename: \`$lib' is not a valid libtool archive" 1>&2 + $echo "$help" 1>&2 + exit $EXIT_FAILURE + fi + + # Read the libtool library. + dlname= + library_names= + + # If there is no directory component, then add one. + case $file in + */* | *\\*) . $file ;; + *) . ./$file ;; + esac + + # Skip this library if it cannot be dlopened. + if test -z "$dlname"; then + # Warn if it was a shared library. + test -n "$library_names" && $echo "$modename: warning: \`$file' was not linked with \`-export-dynamic'" + continue + fi + + dir=`$echo "X$file" | $Xsed -e 's%/[^/]*$%%'` + test "X$dir" = "X$file" && dir=. + + if test -f "$dir/$objdir/$dlname"; then + dir="$dir/$objdir" + else + $echo "$modename: cannot find \`$dlname' in \`$dir' or \`$dir/$objdir'" 1>&2 + exit $EXIT_FAILURE + fi + ;; + + *.lo) + # Just add the directory containing the .lo file. + dir=`$echo "X$file" | $Xsed -e 's%/[^/]*$%%'` + test "X$dir" = "X$file" && dir=. + ;; + + *) + $echo "$modename: warning \`-dlopen' is ignored for non-libtool libraries and objects" 1>&2 + continue + ;; + esac + + # Get the absolute pathname. + absdir=`cd "$dir" && pwd` + test -n "$absdir" && dir="$absdir" + + # Now add the directory to shlibpath_var. + if eval "test -z \"\$$shlibpath_var\""; then + eval "$shlibpath_var=\"\$dir\"" + else + eval "$shlibpath_var=\"\$dir:\$$shlibpath_var\"" + fi + done + + # This variable tells wrapper scripts just to set shlibpath_var + # rather than running their programs. + libtool_execute_magic="$magic" + + # Check if any of the arguments is a wrapper script. + args= + for file + do + case $file in + -*) ;; + *) + # Do a test to see if this is really a libtool program. + if (${SED} -e '4q' $file | grep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then + # If there is no directory component, then add one. + case $file in + */* | *\\*) . $file ;; + *) . ./$file ;; + esac + + # Transform arg to wrapped name. + file="$progdir/$program" + fi + ;; + esac + # Quote arguments (to preserve shell metacharacters). + file=`$echo "X$file" | $Xsed -e "$sed_quote_subst"` + args="$args \"$file\"" + done + + if test -z "$run"; then + if test -n "$shlibpath_var"; then + # Export the shlibpath_var. + eval "export $shlibpath_var" + fi + + # Restore saved environment variables + for lt_var in LANG LC_ALL LC_CTYPE LC_COLLATE LC_MESSAGES + do + eval "if test \"\${save_$lt_var+set}\" = set; then + $lt_var=\$save_$lt_var; export $lt_var + else + $lt_unset $lt_var + fi" + done + + + # Now prepare to actually exec the command. + exec_cmd="\$cmd$args" + else + # Display what would be done. + if test -n "$shlibpath_var"; then + eval "\$echo \"\$shlibpath_var=\$$shlibpath_var\"" + $echo "export $shlibpath_var" + fi + $echo "$cmd$args" + exit $EXIT_SUCCESS + fi + ;; + + # libtool clean and uninstall mode + clean | uninstall) + modename="$modename: $mode" + rm="$nonopt" + files= + rmforce= + exit_status=0 + + # This variable tells wrapper scripts just to set variables rather + # than running their programs. + libtool_install_magic="$magic" + + for arg + do + case $arg in + -f) rm="$rm $arg"; rmforce=yes ;; + -*) rm="$rm $arg" ;; + *) files="$files $arg" ;; + esac + done + + if test -z "$rm"; then + $echo "$modename: you must specify an RM program" 1>&2 + $echo "$help" 1>&2 + exit $EXIT_FAILURE + fi + + rmdirs= + + origobjdir="$objdir" + for file in $files; do + dir=`$echo "X$file" | $Xsed -e 's%/[^/]*$%%'` + if test "X$dir" = "X$file"; then + dir=. + objdir="$origobjdir" + else + objdir="$dir/$origobjdir" + fi + name=`$echo "X$file" | $Xsed -e 's%^.*/%%'` + test "$mode" = uninstall && objdir="$dir" + + # Remember objdir for removal later, being careful to avoid duplicates + if test "$mode" = clean; then + case " $rmdirs " in + *" $objdir "*) ;; + *) rmdirs="$rmdirs $objdir" ;; + esac + fi + + # Don't error if the file doesn't exist and rm -f was used. + if (test -L "$file") >/dev/null 2>&1 \ + || (test -h "$file") >/dev/null 2>&1 \ + || test -f "$file"; then + : + elif test -d "$file"; then + exit_status=1 + continue + elif test "$rmforce" = yes; then + continue + fi + + rmfiles="$file" + + case $name in + *.la) + # Possibly a libtool archive, so verify it. + if (${SED} -e '2q' $file | grep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then + . $dir/$name + + # Delete the libtool libraries and symlinks. + for n in $library_names; do + rmfiles="$rmfiles $objdir/$n" + done + test -n "$old_library" && rmfiles="$rmfiles $objdir/$old_library" + + case "$mode" in + clean) + case " $library_names " in + # " " in the beginning catches empty $dlname + *" $dlname "*) ;; + *) rmfiles="$rmfiles $objdir/$dlname" ;; + esac + test -n "$libdir" && rmfiles="$rmfiles $objdir/$name $objdir/${name}i" + ;; + uninstall) + if test -n "$library_names"; then + # Do each command in the postuninstall commands. + cmds=$postuninstall_cmds + save_ifs="$IFS"; IFS='~' + for cmd in $cmds; do + IFS="$save_ifs" + eval cmd=\"$cmd\" + $show "$cmd" + $run eval "$cmd" + if test "$?" -ne 0 && test "$rmforce" != yes; then + exit_status=1 + fi + done + IFS="$save_ifs" + fi + + if test -n "$old_library"; then + # Do each command in the old_postuninstall commands. + cmds=$old_postuninstall_cmds + save_ifs="$IFS"; IFS='~' + for cmd in $cmds; do + IFS="$save_ifs" + eval cmd=\"$cmd\" + $show "$cmd" + $run eval "$cmd" + if test "$?" -ne 0 && test "$rmforce" != yes; then + exit_status=1 + fi + done + IFS="$save_ifs" + fi + # FIXME: should reinstall the best remaining shared library. + ;; + esac + fi + ;; + + *.lo) + # Possibly a libtool object, so verify it. + if (${SED} -e '2q' $file | grep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then + + # Read the .lo file + . $dir/$name + + # Add PIC object to the list of files to remove. + if test -n "$pic_object" \ + && test "$pic_object" != none; then + rmfiles="$rmfiles $dir/$pic_object" + fi + + # Add non-PIC object to the list of files to remove. + if test -n "$non_pic_object" \ + && test "$non_pic_object" != none; then + rmfiles="$rmfiles $dir/$non_pic_object" + fi + fi + ;; + + *) + if test "$mode" = clean ; then + noexename=$name + case $file in + *.exe) + file=`$echo $file|${SED} 's,.exe$,,'` + noexename=`$echo $name|${SED} 's,.exe$,,'` + # $file with .exe has already been added to rmfiles, + # add $file without .exe + rmfiles="$rmfiles $file" + ;; + esac + # Do a test to see if this is a libtool program. + if (${SED} -e '4q' $file | grep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then + relink_command= + . $dir/$noexename + + # note $name still contains .exe if it was in $file originally + # as does the version of $file that was added into $rmfiles + rmfiles="$rmfiles $objdir/$name $objdir/${name}S.${objext}" + if test "$fast_install" = yes && test -n "$relink_command"; then + rmfiles="$rmfiles $objdir/lt-$name" + fi + if test "X$noexename" != "X$name" ; then + rmfiles="$rmfiles $objdir/lt-${noexename}.c" + fi + fi + fi + ;; + esac + $show "$rm $rmfiles" + $run $rm $rmfiles || exit_status=1 + done + objdir="$origobjdir" + + # Try to remove the ${objdir}s in the directories where we deleted files + for dir in $rmdirs; do + if test -d "$dir"; then + $show "rmdir $dir" + $run rmdir $dir >/dev/null 2>&1 + fi + done + + exit $exit_status + ;; + + "") + $echo "$modename: you must specify a MODE" 1>&2 + $echo "$generic_help" 1>&2 + exit $EXIT_FAILURE + ;; + esac + + if test -z "$exec_cmd"; then + $echo "$modename: invalid operation mode \`$mode'" 1>&2 + $echo "$generic_help" 1>&2 + exit $EXIT_FAILURE + fi +fi # test -z "$show_help" + +if test -n "$exec_cmd"; then + eval exec $exec_cmd + exit $EXIT_FAILURE +fi + +# We need to display help for each of the modes. +case $mode in +"") $echo \ +"Usage: $modename [OPTION]... [MODE-ARG]... + +Provide generalized library-building support services. + + --config show all configuration variables + --debug enable verbose shell tracing +-n, --dry-run display commands without modifying any files + --features display basic configuration information and exit + --finish same as \`--mode=finish' + --help display this help message and exit + --mode=MODE use operation mode MODE [default=inferred from MODE-ARGS] + --quiet same as \`--silent' + --silent don't print informational messages + --tag=TAG use configuration variables from tag TAG + --version print version information + +MODE must be one of the following: + + clean remove files from the build directory + compile compile a source file into a libtool object + execute automatically set library path, then run a program + finish complete the installation of libtool libraries + install install libraries or executables + link create a library or an executable + uninstall remove libraries from an installed directory + +MODE-ARGS vary depending on the MODE. Try \`$modename --help --mode=MODE' for +a more detailed description of MODE. + +Report bugs to <bug-libtool@gnu.org>." + exit $EXIT_SUCCESS + ;; + +clean) + $echo \ +"Usage: $modename [OPTION]... --mode=clean RM [RM-OPTION]... FILE... + +Remove files from the build directory. + +RM is the name of the program to use to delete files associated with each FILE +(typically \`/bin/rm'). RM-OPTIONS are options (such as \`-f') to be passed +to RM. + +If FILE is a libtool library, object or program, all the files associated +with it are deleted. Otherwise, only FILE itself is deleted using RM." + ;; + +compile) + $echo \ +"Usage: $modename [OPTION]... --mode=compile COMPILE-COMMAND... SOURCEFILE + +Compile a source file into a libtool library object. + +This mode accepts the following additional options: + + -o OUTPUT-FILE set the output file name to OUTPUT-FILE + -prefer-pic try to building PIC objects only + -prefer-non-pic try to building non-PIC objects only + -static always build a \`.o' file suitable for static linking + +COMPILE-COMMAND is a command to be used in creating a \`standard' object file +from the given SOURCEFILE. + +The output file name is determined by removing the directory component from +SOURCEFILE, then substituting the C source code suffix \`.c' with the +library object suffix, \`.lo'." + ;; + +execute) + $echo \ +"Usage: $modename [OPTION]... --mode=execute COMMAND [ARGS]... + +Automatically set library path, then run a program. + +This mode accepts the following additional options: + + -dlopen FILE add the directory containing FILE to the library path + +This mode sets the library path environment variable according to \`-dlopen' +flags. + +If any of the ARGS are libtool executable wrappers, then they are translated +into their corresponding uninstalled binary, and any of their required library +directories are added to the library path. + +Then, COMMAND is executed, with ARGS as arguments." + ;; + +finish) + $echo \ +"Usage: $modename [OPTION]... --mode=finish [LIBDIR]... + +Complete the installation of libtool libraries. + +Each LIBDIR is a directory that contains libtool libraries. + +The commands that this mode executes may require superuser privileges. Use +the \`--dry-run' option if you just want to see what would be executed." + ;; + +install) + $echo \ +"Usage: $modename [OPTION]... --mode=install INSTALL-COMMAND... + +Install executables or libraries. + +INSTALL-COMMAND is the installation command. The first component should be +either the \`install' or \`cp' program. + +The rest of the components are interpreted as arguments to that command (only +BSD-compatible install options are recognized)." + ;; + +link) + $echo \ +"Usage: $modename [OPTION]... --mode=link LINK-COMMAND... + +Link object files or libraries together to form another library, or to +create an executable program. + +LINK-COMMAND is a command using the C compiler that you would use to create +a program from several object files. + +The following components of LINK-COMMAND are treated specially: + + -all-static do not do any dynamic linking at all + -avoid-version do not add a version suffix if possible + -dlopen FILE \`-dlpreopen' FILE if it cannot be dlopened at runtime + -dlpreopen FILE link in FILE and add its symbols to lt_preloaded_symbols + -export-dynamic allow symbols from OUTPUT-FILE to be resolved with dlsym(3) + -export-symbols SYMFILE + try to export only the symbols listed in SYMFILE + -export-symbols-regex REGEX + try to export only the symbols matching REGEX + -LLIBDIR search LIBDIR for required installed libraries + -lNAME OUTPUT-FILE requires the installed library libNAME + -module build a library that can dlopened + -no-fast-install disable the fast-install mode + -no-install link a not-installable executable + -no-undefined declare that a library does not refer to external symbols + -o OUTPUT-FILE create OUTPUT-FILE from the specified objects + -objectlist FILE Use a list of object files found in FILE to specify objects + -precious-files-regex REGEX + don't remove output files matching REGEX + -release RELEASE specify package release information + -rpath LIBDIR the created library will eventually be installed in LIBDIR + -R[ ]LIBDIR add LIBDIR to the runtime path of programs and libraries + -static do not do any dynamic linking of uninstalled libtool libraries + -static-libtool-libs + do not do any dynamic linking of libtool libraries + -version-info CURRENT[:REVISION[:AGE]] + specify library version info [each variable defaults to 0] + +All other options (arguments beginning with \`-') are ignored. + +Every other argument is treated as a filename. Files ending in \`.la' are +treated as uninstalled libtool libraries, other files are standard or library +object files. + +If the OUTPUT-FILE ends in \`.la', then a libtool library is created, +only library objects (\`.lo' files) may be specified, and \`-rpath' is +required, except when creating a convenience library. + +If OUTPUT-FILE ends in \`.a' or \`.lib', then a standard library is created +using \`ar' and \`ranlib', or on Windows using \`lib'. + +If OUTPUT-FILE ends in \`.lo' or \`.${objext}', then a reloadable object file +is created, otherwise an executable program is created." + ;; + +uninstall) + $echo \ +"Usage: $modename [OPTION]... --mode=uninstall RM [RM-OPTION]... FILE... + +Remove libraries from an installation directory. + +RM is the name of the program to use to delete files associated with each FILE +(typically \`/bin/rm'). RM-OPTIONS are options (such as \`-f') to be passed +to RM. + +If FILE is a libtool library, all the files associated with it are deleted. +Otherwise, only FILE itself is deleted using RM." + ;; + +*) + $echo "$modename: invalid operation mode \`$mode'" 1>&2 + $echo "$help" 1>&2 + exit $EXIT_FAILURE + ;; +esac + +$echo +$echo "Try \`$modename --help' for more information about other modes." + +exit $? + +# The TAGs below are defined such that we never get into a situation +# in which we disable both kinds of libraries. Given conflicting +# choices, we go for a static library, that is the most portable, +# since we can't tell whether shared libraries were disabled because +# the user asked for that or because the platform doesn't support +# them. This is particularly important on AIX, because we don't +# support having both static and shared libraries enabled at the same +# time on that platform, so we default to a shared-only configuration. +# If a disable-shared tag is given, we'll fallback to a static-only +# configuration. But we'll never go from static-only to shared-only. + +# ### BEGIN LIBTOOL TAG CONFIG: disable-shared +disable_libs=shared +# ### END LIBTOOL TAG CONFIG: disable-shared + +# ### BEGIN LIBTOOL TAG CONFIG: disable-static +disable_libs=static +# ### END LIBTOOL TAG CONFIG: disable-static + +# Local Variables: +# mode:shell-script +# sh-indentation:2 +# End: diff --git a/driver/xf86-input-mouse/man/Makefile.am b/driver/xf86-input-mouse/man/Makefile.am new file mode 100644 index 000000000..da732097c --- /dev/null +++ b/driver/xf86-input-mouse/man/Makefile.am @@ -0,0 +1,59 @@ +# $Id: Makefile.am,v 1.1.1.1 2006/11/26 19:55:03 matthieu Exp $ +# +# Copyright 2005 Sun Microsystems, Inc. All rights reserved. +# +# Permission to use, copy, modify, distribute, and sell this software and its +# documentation for any purpose is hereby granted without fee, provided that +# the above copyright notice appear in all copies and that both that +# copyright notice and this permission notice appear in supporting +# documentation. +# +# The above copyright notice and this permission notice shall be included +# in all copies or substantial portions of the Software. +# +# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +# OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +# MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +# IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +# OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +# ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +# OTHER DEALINGS IN THE SOFTWARE. +# +# Except as contained in this notice, the name of the copyright holders shall +# not be used in advertising or otherwise to promote the sale, use or +# other dealings in this Software without prior written authorization +# from the copyright holders. +# + +drivermandir = $(DRIVER_MAN_DIR) + +driverman_PRE = mousedrv.man + +driverman_DATA = $(driverman_PRE:man=@DRIVER_MAN_SUFFIX@) + +EXTRA_DIST = mousedrv.man + +CLEANFILES = $(driverman_DATA) + +SED = sed + +# Strings to replace in man pages +XORGRELSTRING = @PACKAGE_STRING@ + XORGMANNAME = X Version 11 + +MAN_SUBSTS = \ + -e 's|__vendorversion__|"$(XORGRELSTRING)" "$(XORGMANNAME)"|' \ + -e 's|__xorgversion__|"$(XORGRELSTRING)" "$(XORGMANNAME)"|' \ + -e 's|__xservername__|Xorg|g' \ + -e 's|__xconfigfile__|xorg.conf|g' \ + -e 's|__projectroot__|$(prefix)|g' \ + -e 's|__appmansuffix__|$(APP_MAN_SUFFIX)|g' \ + -e 's|__drivermansuffix__|$(DRIVER_MAN_SUFFIX)|g' \ + -e 's|__adminmansuffix__|$(ADMIN_MAN_SUFFIX)|g' \ + -e 's|__miscmansuffix__|$(MISC_MAN_SUFFIX)|g' \ + -e 's|__filemansuffix__|$(FILE_MAN_SUFFIX)|g' + +SUFFIXES = .$(DRIVER_MAN_SUFFIX) .man + +.man.$(DRIVER_MAN_SUFFIX): + sed $(MAN_SUBSTS) < $< > $@ diff --git a/driver/xf86-input-mouse/man/Makefile.in b/driver/xf86-input-mouse/man/Makefile.in new file mode 100644 index 000000000..d1f8641f1 --- /dev/null +++ b/driver/xf86-input-mouse/man/Makefile.in @@ -0,0 +1,425 @@ +# Makefile.in generated by automake 1.9.6 from Makefile.am. +# @configure_input@ + +# Copyright (C) 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001, 2002, +# 2003, 2004, 2005 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + +@SET_MAKE@ + +# $Id: Makefile.in,v 1.1.1.1 2006/11/26 19:55:03 matthieu Exp $ +# +# Copyright 2005 Sun Microsystems, Inc. All rights reserved. +# +# Permission to use, copy, modify, distribute, and sell this software and its +# documentation for any purpose is hereby granted without fee, provided that +# the above copyright notice appear in all copies and that both that +# copyright notice and this permission notice appear in supporting +# documentation. +# +# The above copyright notice and this permission notice shall be included +# in all copies or substantial portions of the Software. +# +# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +# OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +# MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +# IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +# OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +# ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +# OTHER DEALINGS IN THE SOFTWARE. +# +# Except as contained in this notice, the name of the copyright holders shall +# not be used in advertising or otherwise to promote the sale, use or +# other dealings in this Software without prior written authorization +# from the copyright holders. +# + +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ +top_builddir = .. +am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd +INSTALL = @INSTALL@ +install_sh_DATA = $(install_sh) -c -m 644 +install_sh_PROGRAM = $(install_sh) -c +install_sh_SCRIPT = $(install_sh) -c +INSTALL_HEADER = $(INSTALL_DATA) +transform = $(program_transform_name) +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +build_triplet = @build@ +host_triplet = @host@ +subdir = man +DIST_COMMON = $(srcdir)/Makefile.am $(srcdir)/Makefile.in +ACLOCAL_M4 = $(top_srcdir)/aclocal.m4 +am__aclocal_m4_deps = $(top_srcdir)/configure.ac +am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \ + $(ACLOCAL_M4) +mkinstalldirs = $(install_sh) -d +CONFIG_HEADER = $(top_builddir)/config.h +CONFIG_CLEAN_FILES = +SOURCES = +DIST_SOURCES = +am__vpath_adj_setup = srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`; +am__vpath_adj = case $$p in \ + $(srcdir)/*) f=`echo "$$p" | sed "s|^$$srcdirstrip/||"`;; \ + *) f=$$p;; \ + esac; +am__strip_dir = `echo $$p | sed -e 's|^.*/||'`; +am__installdirs = "$(DESTDIR)$(drivermandir)" +drivermanDATA_INSTALL = $(INSTALL_DATA) +DATA = $(driverman_DATA) +DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST) +ACLOCAL = @ACLOCAL@ +ADMIN_MAN_DIR = @ADMIN_MAN_DIR@ +ADMIN_MAN_SUFFIX = @ADMIN_MAN_SUFFIX@ +AMDEP_FALSE = @AMDEP_FALSE@ +AMDEP_TRUE = @AMDEP_TRUE@ +AMTAR = @AMTAR@ +APP_MAN_DIR = @APP_MAN_DIR@ +APP_MAN_SUFFIX = @APP_MAN_SUFFIX@ +AR = @AR@ +AUTOCONF = @AUTOCONF@ +AUTOHEADER = @AUTOHEADER@ +AUTOMAKE = @AUTOMAKE@ +AWK = @AWK@ +BUILD_LINUXDOC_FALSE = @BUILD_LINUXDOC_FALSE@ +BUILD_LINUXDOC_TRUE = @BUILD_LINUXDOC_TRUE@ +BUILD_PDFDOC_FALSE = @BUILD_PDFDOC_FALSE@ +BUILD_PDFDOC_TRUE = @BUILD_PDFDOC_TRUE@ +CC = @CC@ +CCDEPMODE = @CCDEPMODE@ +CFLAGS = @CFLAGS@ +CPP = @CPP@ +CPPFLAGS = @CPPFLAGS@ +CXX = @CXX@ +CXXCPP = @CXXCPP@ +CXXDEPMODE = @CXXDEPMODE@ +CXXFLAGS = @CXXFLAGS@ +CYGPATH_W = @CYGPATH_W@ +DEFS = @DEFS@ +DEPDIR = @DEPDIR@ +DRIVER_MAN_DIR = @DRIVER_MAN_DIR@ +DRIVER_MAN_SUFFIX = @DRIVER_MAN_SUFFIX@ +DRIVER_NAME = @DRIVER_NAME@ +ECHO = @ECHO@ +ECHO_C = @ECHO_C@ +ECHO_N = @ECHO_N@ +ECHO_T = @ECHO_T@ +EGREP = @EGREP@ +EXEEXT = @EXEEXT@ +F77 = @F77@ +FFLAGS = @FFLAGS@ +FILE_MAN_DIR = @FILE_MAN_DIR@ +FILE_MAN_SUFFIX = @FILE_MAN_SUFFIX@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@ +LDFLAGS = @LDFLAGS@ +LIBOBJS = @LIBOBJS@ +LIBS = @LIBS@ +LIBTOOL = @LIBTOOL@ +LIB_MAN_DIR = @LIB_MAN_DIR@ +LIB_MAN_SUFFIX = @LIB_MAN_SUFFIX@ +LINUXDOC = @LINUXDOC@ +LN_S = @LN_S@ +LTLIBOBJS = @LTLIBOBJS@ +MAINT = @MAINT@ +MAINTAINER_MODE_FALSE = @MAINTAINER_MODE_FALSE@ +MAINTAINER_MODE_TRUE = @MAINTAINER_MODE_TRUE@ +MAKEINFO = @MAKEINFO@ +MAKE_HTML = @MAKE_HTML@ +MAKE_PDF = @MAKE_PDF@ +MAKE_PS = @MAKE_PS@ +MAKE_TEXT = @MAKE_TEXT@ +MISC_MAN_DIR = @MISC_MAN_DIR@ +MISC_MAN_SUFFIX = @MISC_MAN_SUFFIX@ +OBJEXT = @OBJEXT@ +PACKAGE = @PACKAGE@ +PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@ +PACKAGE_NAME = @PACKAGE_NAME@ +PACKAGE_STRING = @PACKAGE_STRING@ +PACKAGE_TARNAME = @PACKAGE_TARNAME@ +PACKAGE_VERSION = @PACKAGE_VERSION@ +PATH_SEPARATOR = @PATH_SEPARATOR@ +PKG_CONFIG = @PKG_CONFIG@ +PS2PDF = @PS2PDF@ +RANLIB = @RANLIB@ +SED = sed +SET_MAKE = @SET_MAKE@ +SHELL = @SHELL@ +STRIP = @STRIP@ +VERSION = @VERSION@ +XORG_CFLAGS = @XORG_CFLAGS@ +XORG_LIBS = @XORG_LIBS@ +ac_ct_AR = @ac_ct_AR@ +ac_ct_CC = @ac_ct_CC@ +ac_ct_CXX = @ac_ct_CXX@ +ac_ct_F77 = @ac_ct_F77@ +ac_ct_RANLIB = @ac_ct_RANLIB@ +ac_ct_STRIP = @ac_ct_STRIP@ +ac_pt_PKG_CONFIG = @ac_pt_PKG_CONFIG@ +am__fastdepCC_FALSE = @am__fastdepCC_FALSE@ +am__fastdepCC_TRUE = @am__fastdepCC_TRUE@ +am__fastdepCXX_FALSE = @am__fastdepCXX_FALSE@ +am__fastdepCXX_TRUE = @am__fastdepCXX_TRUE@ +am__include = @am__include@ +am__leading_dot = @am__leading_dot@ +am__quote = @am__quote@ +am__tar = @am__tar@ +am__untar = @am__untar@ +bindir = @bindir@ +build = @build@ +build_alias = @build_alias@ +build_cpu = @build_cpu@ +build_os = @build_os@ +build_vendor = @build_vendor@ +datadir = @datadir@ +exec_prefix = @exec_prefix@ +host = @host@ +host_alias = @host_alias@ +host_cpu = @host_cpu@ +host_os = @host_os@ +host_vendor = @host_vendor@ +includedir = @includedir@ +infodir = @infodir@ +inputdir = @inputdir@ +install_sh = @install_sh@ +libdir = @libdir@ +libexecdir = @libexecdir@ +localstatedir = @localstatedir@ +mandir = @mandir@ +mkdir_p = @mkdir_p@ +oldincludedir = @oldincludedir@ +prefix = @prefix@ +program_transform_name = @program_transform_name@ +sbindir = @sbindir@ +sharedstatedir = @sharedstatedir@ +sysconfdir = @sysconfdir@ +target_alias = @target_alias@ +drivermandir = $(DRIVER_MAN_DIR) +driverman_PRE = mousedrv.man +driverman_DATA = $(driverman_PRE:man=@DRIVER_MAN_SUFFIX@) +EXTRA_DIST = mousedrv.man +CLEANFILES = $(driverman_DATA) + +# Strings to replace in man pages +XORGRELSTRING = @PACKAGE_STRING@ +XORGMANNAME = X Version 11 +MAN_SUBSTS = \ + -e 's|__vendorversion__|"$(XORGRELSTRING)" "$(XORGMANNAME)"|' \ + -e 's|__xorgversion__|"$(XORGRELSTRING)" "$(XORGMANNAME)"|' \ + -e 's|__xservername__|Xorg|g' \ + -e 's|__xconfigfile__|xorg.conf|g' \ + -e 's|__projectroot__|$(prefix)|g' \ + -e 's|__appmansuffix__|$(APP_MAN_SUFFIX)|g' \ + -e 's|__drivermansuffix__|$(DRIVER_MAN_SUFFIX)|g' \ + -e 's|__adminmansuffix__|$(ADMIN_MAN_SUFFIX)|g' \ + -e 's|__miscmansuffix__|$(MISC_MAN_SUFFIX)|g' \ + -e 's|__filemansuffix__|$(FILE_MAN_SUFFIX)|g' + +SUFFIXES = .$(DRIVER_MAN_SUFFIX) .man +all: all-am + +.SUFFIXES: +.SUFFIXES: .$(DRIVER_MAN_SUFFIX) .man +$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(am__configure_deps) + @for dep in $?; do \ + case '$(am__configure_deps)' in \ + *$$dep*) \ + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh \ + && exit 0; \ + exit 1;; \ + esac; \ + done; \ + echo ' cd $(top_srcdir) && $(AUTOMAKE) --gnu man/Makefile'; \ + cd $(top_srcdir) && \ + $(AUTOMAKE) --gnu man/Makefile +.PRECIOUS: Makefile +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + @case '$?' in \ + *config.status*) \ + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \ + *) \ + echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe)'; \ + cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe);; \ + esac; + +$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES) + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh + +$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps) + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh +$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps) + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh + +mostlyclean-libtool: + -rm -f *.lo + +clean-libtool: + -rm -rf .libs _libs + +distclean-libtool: + -rm -f libtool +uninstall-info-am: +install-drivermanDATA: $(driverman_DATA) + @$(NORMAL_INSTALL) + test -z "$(drivermandir)" || $(mkdir_p) "$(DESTDIR)$(drivermandir)" + @list='$(driverman_DATA)'; for p in $$list; do \ + if test -f "$$p"; then d=; else d="$(srcdir)/"; fi; \ + f=$(am__strip_dir) \ + echo " $(drivermanDATA_INSTALL) '$$d$$p' '$(DESTDIR)$(drivermandir)/$$f'"; \ + $(drivermanDATA_INSTALL) "$$d$$p" "$(DESTDIR)$(drivermandir)/$$f"; \ + done + +uninstall-drivermanDATA: + @$(NORMAL_UNINSTALL) + @list='$(driverman_DATA)'; for p in $$list; do \ + f=$(am__strip_dir) \ + echo " rm -f '$(DESTDIR)$(drivermandir)/$$f'"; \ + rm -f "$(DESTDIR)$(drivermandir)/$$f"; \ + done +tags: TAGS +TAGS: + +ctags: CTAGS +CTAGS: + + +distdir: $(DISTFILES) + @srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`; \ + topsrcdirstrip=`echo "$(top_srcdir)" | sed 's|.|.|g'`; \ + list='$(DISTFILES)'; for file in $$list; do \ + case $$file in \ + $(srcdir)/*) file=`echo "$$file" | sed "s|^$$srcdirstrip/||"`;; \ + $(top_srcdir)/*) file=`echo "$$file" | sed "s|^$$topsrcdirstrip/|$(top_builddir)/|"`;; \ + esac; \ + if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \ + dir=`echo "$$file" | sed -e 's,/[^/]*$$,,'`; \ + if test "$$dir" != "$$file" && test "$$dir" != "."; then \ + dir="/$$dir"; \ + $(mkdir_p) "$(distdir)$$dir"; \ + else \ + dir=''; \ + fi; \ + if test -d $$d/$$file; then \ + if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \ + cp -pR $(srcdir)/$$file $(distdir)$$dir || exit 1; \ + fi; \ + cp -pR $$d/$$file $(distdir)$$dir || exit 1; \ + else \ + test -f $(distdir)/$$file \ + || cp -p $$d/$$file $(distdir)/$$file \ + || exit 1; \ + fi; \ + done +check-am: all-am +check: check-am +all-am: Makefile $(DATA) +installdirs: + for dir in "$(DESTDIR)$(drivermandir)"; do \ + test -z "$$dir" || $(mkdir_p) "$$dir"; \ + done +install: install-am +install-exec: install-exec-am +install-data: install-data-am +uninstall: uninstall-am + +install-am: all-am + @$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am + +installcheck: installcheck-am +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \ + install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \ + `test -z '$(STRIP)' || \ + echo "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'"` install +mostlyclean-generic: + +clean-generic: + -test -z "$(CLEANFILES)" || rm -f $(CLEANFILES) + +distclean-generic: + -test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES) + +maintainer-clean-generic: + @echo "This command is intended for maintainers to use" + @echo "it deletes files that may require special tools to rebuild." +clean: clean-am + +clean-am: clean-generic clean-libtool mostlyclean-am + +distclean: distclean-am + -rm -f Makefile +distclean-am: clean-am distclean-generic distclean-libtool + +dvi: dvi-am + +dvi-am: + +html: html-am + +info: info-am + +info-am: + +install-data-am: install-drivermanDATA + +install-exec-am: + +install-info: install-info-am + +install-man: + +installcheck-am: + +maintainer-clean: maintainer-clean-am + -rm -f Makefile +maintainer-clean-am: distclean-am maintainer-clean-generic + +mostlyclean: mostlyclean-am + +mostlyclean-am: mostlyclean-generic mostlyclean-libtool + +pdf: pdf-am + +pdf-am: + +ps: ps-am + +ps-am: + +uninstall-am: uninstall-drivermanDATA uninstall-info-am + +.PHONY: all all-am check check-am clean clean-generic clean-libtool \ + distclean distclean-generic distclean-libtool distdir dvi \ + dvi-am html html-am info info-am install install-am \ + install-data install-data-am install-drivermanDATA \ + install-exec install-exec-am install-info install-info-am \ + install-man install-strip installcheck installcheck-am \ + installdirs maintainer-clean maintainer-clean-generic \ + mostlyclean mostlyclean-generic mostlyclean-libtool pdf pdf-am \ + ps ps-am uninstall uninstall-am uninstall-drivermanDATA \ + uninstall-info-am + + +.man.$(DRIVER_MAN_SUFFIX): + sed $(MAN_SUBSTS) < $< > $@ +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/driver/xf86-input-mouse/man/mousedrv.man b/driver/xf86-input-mouse/man/mousedrv.man new file mode 100644 index 000000000..231935c40 --- /dev/null +++ b/driver/xf86-input-mouse/man/mousedrv.man @@ -0,0 +1,248 @@ +.\" $XFree86: xc/programs/Xserver/hw/xfree86/input/mouse/mouse.man,v 1.6 2003/04/03 22:18:31 dawes Exp $ +.\" shorthand for double quote that works everywhere. +.ds q \N'34' +.TH MOUSE __drivermansuffix__ __vendorversion__ +.SH NAME +mouse \- Mouse input driver +.SH SYNOPSIS +.nf +.B "Section \*qInputDevice\*q" +.BI " Identifier \*q" idevname \*q +.B " Driver \*qmouse\*q" +.BI " Option \*qProtocol\*q \*q" protoname \*q +.BI " Option \*qDevice\*q \*q" devpath \*q +\ \ ... +.B EndSection +.fi +.SH DESCRIPTION +.B mouse +is an __xservername__ input driver for mice. The driver supports most available +mouse types and interfaces. USB mice are only supported on some OSs, +and the level of support for PS/2 mice depends on the OS. +.PP +The +.B mouse +driver functions as a pointer input device, and may be used as the +X server's core pointer. Multiple mice are supported by multiple +instances of this driver. +.SH SUPPORTED HARDWARE +There is a detailed list of hardware that the +.B mouse +driver supports in the +.I README.mouse +document. This can be found +in __projectroot__/lib/X11/doc/, or online at +http://www.x.org/current/mouse.html. +.SH CONFIGURATION DETAILS +Please refer to __xconfigfile__(__filemansuffix__) for general configuration +details and for options that can be used with all input drivers. This +section only covers configuration details specific to this driver. +.PP +The driver can auto-detect the mouse type on some platforms. On some +platforms this is limited to plug and play serial mice, and on some the +auto-detection works for any mouse that the OS's kernel driver supports. +On others, it is always necessary to specify the mouse protocol in the +config file. The +.I README.mouse +document contains some detailed information about this. +.PP +The following driver +.B Options +are supported: +.TP 7 +.BI "Option \*qProtocol\*q \*q" string \*q +Specify the mouse protocol. Valid protocol types include: +.PP +.RS 12 +Auto, Microsoft, MouseSystems, MMSeries, Logitech, MouseMan, MMHitTab, +GlidePoint, IntelliMouse, ThinkingMouse, ValuMouseScroll, AceCad, PS/2, ImPS/2, +ExplorerPS/2, ThinkingMousePS/2, MouseManPlusPS/2, GlidePointPS/2, +NetMousePS/2, NetScrollPS/2, BusMouse, SysMouse, WSMouse, USB, VUID, Xqueue. +.RE +.PP +.RS 7 +Not all protocols are supported on all platforms. The "Auto" platform +specifies that protocol auto-detection should be attempted. There is no +default protocol setting, and specifying this option is mandatory. +.RE +.TP 7 +.BI "Option \*qDevice\*q \*q" string \*q +Specifies the device through which the mouse can be accessed. A common +setting is "/dev/mouse", which is often a symbolic link to the real +device. This option is mandatory, and there is no default setting. +.TP 7 +.BI "Option \*qButtons\*q \*q" integer \*q +Specifies the number of mouse buttons. In cases where the number of buttons +cannot be auto-detected, the default value is 3. The maximum number is 24. +.TP 7 +.BI "Option \*qEmulate3Buttons\*q \*q" boolean \*q +Enable/disable the emulation of the third (middle) mouse button for mice +which only have two physical buttons. The third button is emulated by +pressing both buttons simultaneously. Default: off +.TP 7 +.BI "Option \*qEmulate3Timeout\*q \*q" integer \*q +Sets the timeout (in milliseconds) that the driver waits before deciding +if two buttons where pressed "simultaneously" when 3 button emulation is +enabled. Default: 50. +.TP 7 +.BI "Option \*qChordMiddle\*q \*q" boolean \*q +Enable/disable handling of mice that send left+right events when the middle +button is used. Default: off. +.TP 7 +.BI "Option \*qEmulateWheel\*q \*q" boolean \*q +Enable/disable "wheel" emulation. Wheel emulation means emulating button +press/release events when the mouse is moved while a specific real button +is pressed. Wheel button events (typically buttons 4 and 5) are +usually used for scrolling. Wheel emulation is useful for getting wheel-like +behaviour with trackballs. It can also be useful for mice with 4 or +more buttons but no wheel. See the description of the +.BR EmulateWheelButton , +.BR EmulateWheelInertia , +.BR XAxisMapping , +and +.B YAxisMapping +options below. Default: off. +.TP 7 +.BI "Option \*qEmulateWheelButton\*q \*q" integer \*q +Specifies which button must be held down to enable wheel emulation mode. +While this button is down, X and/or Y pointer movement will generate button +press/release events as specified for the +.B XAxisMapping +and +.B YAxisMapping +settings. Default: 4. +.TP 7 +.BI "Option \*qEmulateWheelInertia\*q \*q" integer \*q +Specifies how far (in pixels) the pointer must move to generate button +press/release events in wheel emulation mode. Default: 10. +.TP 7 +.BI "Option \*qEmulateWheelTimeout\*q \*q" integer \*q +Specifies the time in milliseconds the +.BR EmulateWheelButton +must be pressed before wheel emulation is started. If the +.BR EmulateWheelButton +is released before this timeout, the original button press/release event +is sent. Default: 200. +.TP 7 +.BI "Option \*qXAxisMapping\*q \*q" "N1 N2" \*q +Specifies which buttons are mapped to motion in the X direction in wheel +emulation mode. Button number +.I N1 +is mapped to the negative X axis motion and button number +.I N2 +is mapped to the positive X axis motion. Default: no mapping. +.TP 7 +.BI "Option \*qYAxisMapping\*q \*q" "N1 N2" \*q +Specifies which buttons are mapped to motion in the Y direction in wheel +emulation mode. Button number +.I N1 +is mapped to the negative Y axis motion and button number +.I N2 +is mapped to the positive Y axis motion. Default: no mapping. +.TP 7 +.BI "Option \*qZAxisMapping\*q \*qX\*q" +.TP 7 +.BI "Option \*qZAxisMapping\*q \*qY\*q" +.TP 7 +.BI "Option \*qZAxisMapping\*q \*q" "N1 N2" \*q +.TP 7 +.BI "Option \*qZAxisMapping\*q \*q" "N1 N2 N3 N4" \*q +Set the mapping for the Z axis (wheel) motion to buttons or another axis +.RB ( X +or +.BR Y ). +Button number +.I N1 +is mapped to the negative Z axis motion and button number +.I N2 +is mapped to the positive Z axis motion. For mice with two wheels, +four button numbers can be specified, with the negative and positive motion +of the second wheel mapped respectively to buttons number +.I N3 +and +.IR N4 . +Note that the protocols for mice with one and two wheels can be different +and the driver may not be able to autodetect it. +Default: "4 5". +.TP 7 +.BI "Option \*qButtonMapping\*q \*q" "N1 N2 [...]" \*q +Specifies how physical mouse buttons are mapped to logical buttons. +Physcial button 1 is mapped to logical button +.IR N1 , +physical button 2 to +.IR N2 , +and so forth. This enables the use of physical buttons that are obscured by +.IR ZAxisMapping . +Default:\ "1\ 2\ 3\ 8\ 9\ 10\ ...". +.TP 7 +.BI "Option \*qFlipXY\*q \*q" boolean \*q +Enable/disable swapping the X and Y axes. This transformation is applied +after the +.BR InvX , +.B InvY +and +.BR AngleOffset +transformations. Default: off. +.TP 7 +.BI "Option \*qInvX\*q \*q" boolean \*q +Invert the X axis. Default: off. +.TP 7 +.BI "Option \*qInvY\*q \*q" boolean \*q +Invert the Y axis. Default: off. +.TP 7 +.BI "Option \*qAngleOffset\*q \*q" integer \*q +Specify a clockwise angular offset (in degrees) to apply to the pointer +motion. This transformation is applied before the +.BR FlipXY , +.B InvX +and +.B InvY +transformations. Default: 0. +.TP 7 +.BI "Option \*qSampleRate\*q \*q" integer \*q +Sets the number of motion/button events the mouse sends per second. Setting +this is only supported for some mice, including some Logitech mice and +some PS/2 mice on some platforms. Default: whatever the mouse is +already set to. +.TP 7 +.BI "Option \*qResolution\*q \*q" integer \*q +Sets the resolution of the device in counts per inch. Setting this is +only supported for some mice, including some PS/2 mice on some platforms. +Default: whatever the mouse is already set to. +.TP 7 +.BI "Option \*qDragLockButtons\*q \*q" "L1 B2 L3 B4" \*q +Sets \*qdrag lock buttons\*q that simulate holding a button down, so +that low dexterity people do not have to hold a button down at the +same time they move a mouse cursor. Button numbers occur in pairs, +with the lock button number occurring first, followed by the button +number that is the target of the lock button. +.TP 7 +.BI "Option \*qDragLockButtons\*q \*q" "M1" \*q +Sets a \*qmaster drag lock button\*q that acts as a \*qMeta Key\*q +indicating that the next button pressed is to be +\*qdrag locked\*q. +.TP 7 +.BI "Option \*qClearDTR\*q \*q" boolean \*q +Enable/disable clearing the DTR line on the serial port used by the mouse. +Some dual-protocol mice require the DTR line to be cleared to operate +in the non-default protocol. This option is for serial mice only. +Default: off. +.TP 7 +.BI "Option \*qClearRTS\*q \*q" boolean \*q +Enable/disable clearing the RTS line on the serial port used by the mouse. +Some dual-protocol mice require the RTS line to be cleared to operate +in the non-default protocol. This option is for serial mice only. +Default: off. +.TP 7 +.BI "Option \*qBaudRate\*q \*q" integer \*q +Set the baud rate to use for communicating with a serial mouse. This +option should rarely be required because the default is correct for almost +all situations. Valid values include: 300, 1200, 2400, 4800, 9600, 19200. +Default: 1200. +.PP +There are some other options that may be used to control various parameters +for serial port communication, but they are not documented here because +the driver sets them correctly for each mouse protocol type. +.SH "SEE ALSO" +__xservername__(__appmansuffix__), __xconfigfile__(__filemansuffix__), xorgconfig(__appmansuffix__), Xserver(__appmansuffix__), X(__miscmansuffix__), +README.mouse. diff --git a/driver/xf86-input-mouse/missing b/driver/xf86-input-mouse/missing new file mode 100644 index 000000000..894e786e1 --- /dev/null +++ b/driver/xf86-input-mouse/missing @@ -0,0 +1,360 @@ +#! /bin/sh +# Common stub for a few missing GNU programs while installing. + +scriptversion=2005-06-08.21 + +# Copyright (C) 1996, 1997, 1999, 2000, 2002, 2003, 2004, 2005 +# Free Software Foundation, Inc. +# Originally by Fran,cois Pinard <pinard@iro.umontreal.ca>, 1996. + +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2, or (at your option) +# any later version. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. + +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA +# 02110-1301, USA. + +# As a special exception to the GNU General Public License, if you +# distribute this file as part of a program that contains a +# configuration script generated by Autoconf, you may include it under +# the same distribution terms that you use for the rest of that program. + +if test $# -eq 0; then + echo 1>&2 "Try \`$0 --help' for more information" + exit 1 +fi + +run=: + +# In the cases where this matters, `missing' is being run in the +# srcdir already. +if test -f configure.ac; then + configure_ac=configure.ac +else + configure_ac=configure.in +fi + +msg="missing on your system" + +case "$1" in +--run) + # Try to run requested program, and just exit if it succeeds. + run= + shift + "$@" && exit 0 + # Exit code 63 means version mismatch. This often happens + # when the user try to use an ancient version of a tool on + # a file that requires a minimum version. In this case we + # we should proceed has if the program had been absent, or + # if --run hadn't been passed. + if test $? = 63; then + run=: + msg="probably too old" + fi + ;; + + -h|--h|--he|--hel|--help) + echo "\ +$0 [OPTION]... PROGRAM [ARGUMENT]... + +Handle \`PROGRAM [ARGUMENT]...' for when PROGRAM is missing, or return an +error status if there is no known handling for PROGRAM. + +Options: + -h, --help display this help and exit + -v, --version output version information and exit + --run try to run the given command, and emulate it if it fails + +Supported PROGRAM values: + aclocal touch file \`aclocal.m4' + autoconf touch file \`configure' + autoheader touch file \`config.h.in' + automake touch all \`Makefile.in' files + bison create \`y.tab.[ch]', if possible, from existing .[ch] + flex create \`lex.yy.c', if possible, from existing .c + help2man touch the output file + lex create \`lex.yy.c', if possible, from existing .c + makeinfo touch the output file + tar try tar, gnutar, gtar, then tar without non-portable flags + yacc create \`y.tab.[ch]', if possible, from existing .[ch] + +Send bug reports to <bug-automake@gnu.org>." + exit $? + ;; + + -v|--v|--ve|--ver|--vers|--versi|--versio|--version) + echo "missing $scriptversion (GNU Automake)" + exit $? + ;; + + -*) + echo 1>&2 "$0: Unknown \`$1' option" + echo 1>&2 "Try \`$0 --help' for more information" + exit 1 + ;; + +esac + +# Now exit if we have it, but it failed. Also exit now if we +# don't have it and --version was passed (most likely to detect +# the program). +case "$1" in + lex|yacc) + # Not GNU programs, they don't have --version. + ;; + + tar) + if test -n "$run"; then + echo 1>&2 "ERROR: \`tar' requires --run" + exit 1 + elif test "x$2" = "x--version" || test "x$2" = "x--help"; then + exit 1 + fi + ;; + + *) + if test -z "$run" && ($1 --version) > /dev/null 2>&1; then + # We have it, but it failed. + exit 1 + elif test "x$2" = "x--version" || test "x$2" = "x--help"; then + # Could not run --version or --help. This is probably someone + # running `$TOOL --version' or `$TOOL --help' to check whether + # $TOOL exists and not knowing $TOOL uses missing. + exit 1 + fi + ;; +esac + +# If it does not exist, or fails to run (possibly an outdated version), +# try to emulate it. +case "$1" in + aclocal*) + echo 1>&2 "\ +WARNING: \`$1' is $msg. You should only need it if + you modified \`acinclude.m4' or \`${configure_ac}'. You might want + to install the \`Automake' and \`Perl' packages. Grab them from + any GNU archive site." + touch aclocal.m4 + ;; + + autoconf) + echo 1>&2 "\ +WARNING: \`$1' is $msg. You should only need it if + you modified \`${configure_ac}'. You might want to install the + \`Autoconf' and \`GNU m4' packages. Grab them from any GNU + archive site." + touch configure + ;; + + autoheader) + echo 1>&2 "\ +WARNING: \`$1' is $msg. You should only need it if + you modified \`acconfig.h' or \`${configure_ac}'. You might want + to install the \`Autoconf' and \`GNU m4' packages. Grab them + from any GNU archive site." + files=`sed -n 's/^[ ]*A[CM]_CONFIG_HEADER(\([^)]*\)).*/\1/p' ${configure_ac}` + test -z "$files" && files="config.h" + touch_files= + for f in $files; do + case "$f" in + *:*) touch_files="$touch_files "`echo "$f" | + sed -e 's/^[^:]*://' -e 's/:.*//'`;; + *) touch_files="$touch_files $f.in";; + esac + done + touch $touch_files + ;; + + automake*) + echo 1>&2 "\ +WARNING: \`$1' is $msg. You should only need it if + you modified \`Makefile.am', \`acinclude.m4' or \`${configure_ac}'. + You might want to install the \`Automake' and \`Perl' packages. + Grab them from any GNU archive site." + find . -type f -name Makefile.am -print | + sed 's/\.am$/.in/' | + while read f; do touch "$f"; done + ;; + + autom4te) + echo 1>&2 "\ +WARNING: \`$1' is needed, but is $msg. + You might have modified some files without having the + proper tools for further handling them. + You can get \`$1' as part of \`Autoconf' from any GNU + archive site." + + file=`echo "$*" | sed -n 's/.*--output[ =]*\([^ ]*\).*/\1/p'` + test -z "$file" && file=`echo "$*" | sed -n 's/.*-o[ ]*\([^ ]*\).*/\1/p'` + if test -f "$file"; then + touch $file + else + test -z "$file" || exec >$file + echo "#! /bin/sh" + echo "# Created by GNU Automake missing as a replacement of" + echo "# $ $@" + echo "exit 0" + chmod +x $file + exit 1 + fi + ;; + + bison|yacc) + echo 1>&2 "\ +WARNING: \`$1' $msg. You should only need it if + you modified a \`.y' file. You may need the \`Bison' package + in order for those modifications to take effect. You can get + \`Bison' from any GNU archive site." + rm -f y.tab.c y.tab.h + if [ $# -ne 1 ]; then + eval LASTARG="\${$#}" + case "$LASTARG" in + *.y) + SRCFILE=`echo "$LASTARG" | sed 's/y$/c/'` + if [ -f "$SRCFILE" ]; then + cp "$SRCFILE" y.tab.c + fi + SRCFILE=`echo "$LASTARG" | sed 's/y$/h/'` + if [ -f "$SRCFILE" ]; then + cp "$SRCFILE" y.tab.h + fi + ;; + esac + fi + if [ ! -f y.tab.h ]; then + echo >y.tab.h + fi + if [ ! -f y.tab.c ]; then + echo 'main() { return 0; }' >y.tab.c + fi + ;; + + lex|flex) + echo 1>&2 "\ +WARNING: \`$1' is $msg. You should only need it if + you modified a \`.l' file. You may need the \`Flex' package + in order for those modifications to take effect. You can get + \`Flex' from any GNU archive site." + rm -f lex.yy.c + if [ $# -ne 1 ]; then + eval LASTARG="\${$#}" + case "$LASTARG" in + *.l) + SRCFILE=`echo "$LASTARG" | sed 's/l$/c/'` + if [ -f "$SRCFILE" ]; then + cp "$SRCFILE" lex.yy.c + fi + ;; + esac + fi + if [ ! -f lex.yy.c ]; then + echo 'main() { return 0; }' >lex.yy.c + fi + ;; + + help2man) + echo 1>&2 "\ +WARNING: \`$1' is $msg. You should only need it if + you modified a dependency of a manual page. You may need the + \`Help2man' package in order for those modifications to take + effect. You can get \`Help2man' from any GNU archive site." + + file=`echo "$*" | sed -n 's/.*-o \([^ ]*\).*/\1/p'` + if test -z "$file"; then + file=`echo "$*" | sed -n 's/.*--output=\([^ ]*\).*/\1/p'` + fi + if [ -f "$file" ]; then + touch $file + else + test -z "$file" || exec >$file + echo ".ab help2man is required to generate this page" + exit 1 + fi + ;; + + makeinfo) + echo 1>&2 "\ +WARNING: \`$1' is $msg. You should only need it if + you modified a \`.texi' or \`.texinfo' file, or any other file + indirectly affecting the aspect of the manual. The spurious + call might also be the consequence of using a buggy \`make' (AIX, + DU, IRIX). You might want to install the \`Texinfo' package or + the \`GNU make' package. Grab either from any GNU archive site." + # The file to touch is that specified with -o ... + file=`echo "$*" | sed -n 's/.*-o \([^ ]*\).*/\1/p'` + if test -z "$file"; then + # ... or it is the one specified with @setfilename ... + infile=`echo "$*" | sed 's/.* \([^ ]*\) *$/\1/'` + file=`sed -n '/^@setfilename/ { s/.* \([^ ]*\) *$/\1/; p; q; }' $infile` + # ... or it is derived from the source name (dir/f.texi becomes f.info) + test -z "$file" && file=`echo "$infile" | sed 's,.*/,,;s,.[^.]*$,,'`.info + fi + # If the file does not exist, the user really needs makeinfo; + # let's fail without touching anything. + test -f $file || exit 1 + touch $file + ;; + + tar) + shift + + # We have already tried tar in the generic part. + # Look for gnutar/gtar before invocation to avoid ugly error + # messages. + if (gnutar --version > /dev/null 2>&1); then + gnutar "$@" && exit 0 + fi + if (gtar --version > /dev/null 2>&1); then + gtar "$@" && exit 0 + fi + firstarg="$1" + if shift; then + case "$firstarg" in + *o*) + firstarg=`echo "$firstarg" | sed s/o//` + tar "$firstarg" "$@" && exit 0 + ;; + esac + case "$firstarg" in + *h*) + firstarg=`echo "$firstarg" | sed s/h//` + tar "$firstarg" "$@" && exit 0 + ;; + esac + fi + + echo 1>&2 "\ +WARNING: I can't seem to be able to run \`tar' with the given arguments. + You may want to install GNU tar or Free paxutils, or check the + command line arguments." + exit 1 + ;; + + *) + echo 1>&2 "\ +WARNING: \`$1' is needed, and is $msg. + You might have modified some files without having the + proper tools for further handling them. Check the \`README' file, + it often tells you about the needed prerequisites for installing + this package. You may also peek at any GNU archive site, in case + some other package would contain this missing \`$1' program." + exit 1 + ;; +esac + +exit 0 + +# Local variables: +# eval: (add-hook 'write-file-hooks 'time-stamp) +# time-stamp-start: "scriptversion=" +# time-stamp-format: "%:y-%02m-%02d.%02H" +# time-stamp-end: "$" +# End: diff --git a/driver/xf86-input-mouse/src/Makefile.am b/driver/xf86-input-mouse/src/Makefile.am new file mode 100644 index 000000000..3c0962b0a --- /dev/null +++ b/driver/xf86-input-mouse/src/Makefile.am @@ -0,0 +1,31 @@ +# Copyright 2005 Adam Jackson. +# +# Permission is hereby granted, free of charge, to any person obtaining a +# copy of this software and associated documentation files (the "Software"), +# to deal in the Software without restriction, including without limitation +# on the rights to use, copy, modify, merge, publish, distribute, sub +# license, and/or sell copies of the Software, and to permit persons to whom +# the Software is furnished to do so, subject to the following conditions: +# +# The above copyright notice and this permission notice (including the next +# paragraph) shall be included in all copies or substantial portions of the +# Software. +# +# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +# IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +# FITNESS FOR A PARTICULAR PURPOSE AND NON-INFRINGEMENT. IN NO EVENT SHALL +# ADAM JACKSON BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER +# IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +# CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + + +# this is obnoxious: +# -module lets us name the module exactly how we want +# -avoid-version prevents gratuitous .0.0.0 version numbers on the end +# _ladir passes a dummy rpath to libtool so the thing will actually link +# TODO: -nostdlib/-Bstatic/-lgcc platform magic, not installing the .a, etc. +@DRIVER_NAME@_drv_la_LTLIBRARIES = @DRIVER_NAME@_drv.la +@DRIVER_NAME@_drv_la_LDFLAGS = -module -avoid-version +@DRIVER_NAME@_drv_ladir = @inputdir@ + +@DRIVER_NAME@_drv_la_SOURCES = @DRIVER_NAME@.c @DRIVER_NAME@.h pnp.c mousePriv.h diff --git a/driver/xf86-input-mouse/src/Makefile.in b/driver/xf86-input-mouse/src/Makefile.in new file mode 100644 index 000000000..519247d49 --- /dev/null +++ b/driver/xf86-input-mouse/src/Makefile.in @@ -0,0 +1,511 @@ +# Makefile.in generated by automake 1.9.6 from Makefile.am. +# @configure_input@ + +# Copyright (C) 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001, 2002, +# 2003, 2004, 2005 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + +@SET_MAKE@ + +# Copyright 2005 Adam Jackson. +# +# Permission is hereby granted, free of charge, to any person obtaining a +# copy of this software and associated documentation files (the "Software"), +# to deal in the Software without restriction, including without limitation +# on the rights to use, copy, modify, merge, publish, distribute, sub +# license, and/or sell copies of the Software, and to permit persons to whom +# the Software is furnished to do so, subject to the following conditions: +# +# The above copyright notice and this permission notice (including the next +# paragraph) shall be included in all copies or substantial portions of the +# Software. +# +# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +# IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +# FITNESS FOR A PARTICULAR PURPOSE AND NON-INFRINGEMENT. IN NO EVENT SHALL +# ADAM JACKSON BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER +# IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +# CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ +top_builddir = .. +am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd +INSTALL = @INSTALL@ +install_sh_DATA = $(install_sh) -c -m 644 +install_sh_PROGRAM = $(install_sh) -c +install_sh_SCRIPT = $(install_sh) -c +INSTALL_HEADER = $(INSTALL_DATA) +transform = $(program_transform_name) +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +build_triplet = @build@ +host_triplet = @host@ +subdir = src +DIST_COMMON = $(srcdir)/Makefile.am $(srcdir)/Makefile.in +ACLOCAL_M4 = $(top_srcdir)/aclocal.m4 +am__aclocal_m4_deps = $(top_srcdir)/configure.ac +am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \ + $(ACLOCAL_M4) +mkinstalldirs = $(install_sh) -d +CONFIG_HEADER = $(top_builddir)/config.h +CONFIG_CLEAN_FILES = +am__vpath_adj_setup = srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`; +am__vpath_adj = case $$p in \ + $(srcdir)/*) f=`echo "$$p" | sed "s|^$$srcdirstrip/||"`;; \ + *) f=$$p;; \ + esac; +am__strip_dir = `echo $$p | sed -e 's|^.*/||'`; +am__installdirs = "$(DESTDIR)$(@DRIVER_NAME@_drv_ladir)" +@DRIVER_NAME@_drv_laLTLIBRARIES_INSTALL = $(INSTALL) +LTLIBRARIES = $(@DRIVER_NAME@_drv_la_LTLIBRARIES) +@DRIVER_NAME@_drv_la_LIBADD = +am_@DRIVER_NAME@_drv_la_OBJECTS = @DRIVER_NAME@.lo pnp.lo +@DRIVER_NAME@_drv_la_OBJECTS = $(am_@DRIVER_NAME@_drv_la_OBJECTS) +DEFAULT_INCLUDES = -I. -I$(srcdir) -I$(top_builddir) +depcomp = $(SHELL) $(top_srcdir)/depcomp +am__depfiles_maybe = depfiles +COMPILE = $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) \ + $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LTCOMPILE = $(LIBTOOL) --tag=CC --mode=compile $(CC) $(DEFS) \ + $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) \ + $(AM_CFLAGS) $(CFLAGS) +CCLD = $(CC) +LINK = $(LIBTOOL) --tag=CC --mode=link $(CCLD) $(AM_CFLAGS) $(CFLAGS) \ + $(AM_LDFLAGS) $(LDFLAGS) -o $@ +SOURCES = $(@DRIVER_NAME@_drv_la_SOURCES) +DIST_SOURCES = $(@DRIVER_NAME@_drv_la_SOURCES) +ETAGS = etags +CTAGS = ctags +DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST) +ACLOCAL = @ACLOCAL@ +ADMIN_MAN_DIR = @ADMIN_MAN_DIR@ +ADMIN_MAN_SUFFIX = @ADMIN_MAN_SUFFIX@ +AMDEP_FALSE = @AMDEP_FALSE@ +AMDEP_TRUE = @AMDEP_TRUE@ +AMTAR = @AMTAR@ +APP_MAN_DIR = @APP_MAN_DIR@ +APP_MAN_SUFFIX = @APP_MAN_SUFFIX@ +AR = @AR@ +AUTOCONF = @AUTOCONF@ +AUTOHEADER = @AUTOHEADER@ +AUTOMAKE = @AUTOMAKE@ +AWK = @AWK@ +BUILD_LINUXDOC_FALSE = @BUILD_LINUXDOC_FALSE@ +BUILD_LINUXDOC_TRUE = @BUILD_LINUXDOC_TRUE@ +BUILD_PDFDOC_FALSE = @BUILD_PDFDOC_FALSE@ +BUILD_PDFDOC_TRUE = @BUILD_PDFDOC_TRUE@ +CC = @CC@ +CCDEPMODE = @CCDEPMODE@ +CFLAGS = @CFLAGS@ +CPP = @CPP@ +CPPFLAGS = @CPPFLAGS@ +CXX = @CXX@ +CXXCPP = @CXXCPP@ +CXXDEPMODE = @CXXDEPMODE@ +CXXFLAGS = @CXXFLAGS@ +CYGPATH_W = @CYGPATH_W@ +DEFS = @DEFS@ +DEPDIR = @DEPDIR@ +DRIVER_MAN_DIR = @DRIVER_MAN_DIR@ +DRIVER_MAN_SUFFIX = @DRIVER_MAN_SUFFIX@ +DRIVER_NAME = @DRIVER_NAME@ +ECHO = @ECHO@ +ECHO_C = @ECHO_C@ +ECHO_N = @ECHO_N@ +ECHO_T = @ECHO_T@ +EGREP = @EGREP@ +EXEEXT = @EXEEXT@ +F77 = @F77@ +FFLAGS = @FFLAGS@ +FILE_MAN_DIR = @FILE_MAN_DIR@ +FILE_MAN_SUFFIX = @FILE_MAN_SUFFIX@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@ +LDFLAGS = @LDFLAGS@ +LIBOBJS = @LIBOBJS@ +LIBS = @LIBS@ +LIBTOOL = @LIBTOOL@ +LIB_MAN_DIR = @LIB_MAN_DIR@ +LIB_MAN_SUFFIX = @LIB_MAN_SUFFIX@ +LINUXDOC = @LINUXDOC@ +LN_S = @LN_S@ +LTLIBOBJS = @LTLIBOBJS@ +MAINT = @MAINT@ +MAINTAINER_MODE_FALSE = @MAINTAINER_MODE_FALSE@ +MAINTAINER_MODE_TRUE = @MAINTAINER_MODE_TRUE@ +MAKEINFO = @MAKEINFO@ +MAKE_HTML = @MAKE_HTML@ +MAKE_PDF = @MAKE_PDF@ +MAKE_PS = @MAKE_PS@ +MAKE_TEXT = @MAKE_TEXT@ +MISC_MAN_DIR = @MISC_MAN_DIR@ +MISC_MAN_SUFFIX = @MISC_MAN_SUFFIX@ +OBJEXT = @OBJEXT@ +PACKAGE = @PACKAGE@ +PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@ +PACKAGE_NAME = @PACKAGE_NAME@ +PACKAGE_STRING = @PACKAGE_STRING@ +PACKAGE_TARNAME = @PACKAGE_TARNAME@ +PACKAGE_VERSION = @PACKAGE_VERSION@ +PATH_SEPARATOR = @PATH_SEPARATOR@ +PKG_CONFIG = @PKG_CONFIG@ +PS2PDF = @PS2PDF@ +RANLIB = @RANLIB@ +SED = @SED@ +SET_MAKE = @SET_MAKE@ +SHELL = @SHELL@ +STRIP = @STRIP@ +VERSION = @VERSION@ +XORG_CFLAGS = @XORG_CFLAGS@ +XORG_LIBS = @XORG_LIBS@ +ac_ct_AR = @ac_ct_AR@ +ac_ct_CC = @ac_ct_CC@ +ac_ct_CXX = @ac_ct_CXX@ +ac_ct_F77 = @ac_ct_F77@ +ac_ct_RANLIB = @ac_ct_RANLIB@ +ac_ct_STRIP = @ac_ct_STRIP@ +ac_pt_PKG_CONFIG = @ac_pt_PKG_CONFIG@ +am__fastdepCC_FALSE = @am__fastdepCC_FALSE@ +am__fastdepCC_TRUE = @am__fastdepCC_TRUE@ +am__fastdepCXX_FALSE = @am__fastdepCXX_FALSE@ +am__fastdepCXX_TRUE = @am__fastdepCXX_TRUE@ +am__include = @am__include@ +am__leading_dot = @am__leading_dot@ +am__quote = @am__quote@ +am__tar = @am__tar@ +am__untar = @am__untar@ +bindir = @bindir@ +build = @build@ +build_alias = @build_alias@ +build_cpu = @build_cpu@ +build_os = @build_os@ +build_vendor = @build_vendor@ +datadir = @datadir@ +exec_prefix = @exec_prefix@ +host = @host@ +host_alias = @host_alias@ +host_cpu = @host_cpu@ +host_os = @host_os@ +host_vendor = @host_vendor@ +includedir = @includedir@ +infodir = @infodir@ +inputdir = @inputdir@ +install_sh = @install_sh@ +libdir = @libdir@ +libexecdir = @libexecdir@ +localstatedir = @localstatedir@ +mandir = @mandir@ +mkdir_p = @mkdir_p@ +oldincludedir = @oldincludedir@ +prefix = @prefix@ +program_transform_name = @program_transform_name@ +sbindir = @sbindir@ +sharedstatedir = @sharedstatedir@ +sysconfdir = @sysconfdir@ +target_alias = @target_alias@ + +# this is obnoxious: +# -module lets us name the module exactly how we want +# -avoid-version prevents gratuitous .0.0.0 version numbers on the end +# _ladir passes a dummy rpath to libtool so the thing will actually link +# TODO: -nostdlib/-Bstatic/-lgcc platform magic, not installing the .a, etc. +@DRIVER_NAME@_drv_la_LTLIBRARIES = @DRIVER_NAME@_drv.la +@DRIVER_NAME@_drv_la_LDFLAGS = -module -avoid-version +@DRIVER_NAME@_drv_ladir = @inputdir@ +@DRIVER_NAME@_drv_la_SOURCES = @DRIVER_NAME@.c @DRIVER_NAME@.h pnp.c mousePriv.h +all: all-am + +.SUFFIXES: +.SUFFIXES: .c .lo .o .obj +$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(am__configure_deps) + @for dep in $?; do \ + case '$(am__configure_deps)' in \ + *$$dep*) \ + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh \ + && exit 0; \ + exit 1;; \ + esac; \ + done; \ + echo ' cd $(top_srcdir) && $(AUTOMAKE) --gnu src/Makefile'; \ + cd $(top_srcdir) && \ + $(AUTOMAKE) --gnu src/Makefile +.PRECIOUS: Makefile +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + @case '$?' in \ + *config.status*) \ + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \ + *) \ + echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe)'; \ + cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe);; \ + esac; + +$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES) + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh + +$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps) + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh +$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps) + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh +install-@DRIVER_NAME@_drv_laLTLIBRARIES: $(@DRIVER_NAME@_drv_la_LTLIBRARIES) + @$(NORMAL_INSTALL) + test -z "$(@DRIVER_NAME@_drv_ladir)" || $(mkdir_p) "$(DESTDIR)$(@DRIVER_NAME@_drv_ladir)" + @list='$(@DRIVER_NAME@_drv_la_LTLIBRARIES)'; for p in $$list; do \ + if test -f $$p; then \ + f=$(am__strip_dir) \ + echo " $(LIBTOOL) --mode=install $(@DRIVER_NAME@_drv_laLTLIBRARIES_INSTALL) $(INSTALL_STRIP_FLAG) '$$p' '$(DESTDIR)$(@DRIVER_NAME@_drv_ladir)/$$f'"; \ + $(LIBTOOL) --mode=install $(@DRIVER_NAME@_drv_laLTLIBRARIES_INSTALL) $(INSTALL_STRIP_FLAG) "$$p" "$(DESTDIR)$(@DRIVER_NAME@_drv_ladir)/$$f"; \ + else :; fi; \ + done + +uninstall-@DRIVER_NAME@_drv_laLTLIBRARIES: + @$(NORMAL_UNINSTALL) + @set -x; list='$(@DRIVER_NAME@_drv_la_LTLIBRARIES)'; for p in $$list; do \ + p=$(am__strip_dir) \ + echo " $(LIBTOOL) --mode=uninstall rm -f '$(DESTDIR)$(@DRIVER_NAME@_drv_ladir)/$$p'"; \ + $(LIBTOOL) --mode=uninstall rm -f "$(DESTDIR)$(@DRIVER_NAME@_drv_ladir)/$$p"; \ + done + +clean-@DRIVER_NAME@_drv_laLTLIBRARIES: + -test -z "$(@DRIVER_NAME@_drv_la_LTLIBRARIES)" || rm -f $(@DRIVER_NAME@_drv_la_LTLIBRARIES) + @list='$(@DRIVER_NAME@_drv_la_LTLIBRARIES)'; for p in $$list; do \ + dir="`echo $$p | sed -e 's|/[^/]*$$||'`"; \ + test "$$dir" != "$$p" || dir=.; \ + echo "rm -f \"$${dir}/so_locations\""; \ + rm -f "$${dir}/so_locations"; \ + done +@DRIVER_NAME@_drv.la: $(@DRIVER_NAME@_drv_la_OBJECTS) $(@DRIVER_NAME@_drv_la_DEPENDENCIES) + $(LINK) -rpath $(@DRIVER_NAME@_drv_ladir) $(@DRIVER_NAME@_drv_la_LDFLAGS) $(@DRIVER_NAME@_drv_la_OBJECTS) $(@DRIVER_NAME@_drv_la_LIBADD) $(LIBS) + +mostlyclean-compile: + -rm -f *.$(OBJEXT) + +distclean-compile: + -rm -f *.tab.c + +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/@DRIVER_NAME@.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/pnp.Plo@am__quote@ + +.c.o: +@am__fastdepCC_TRUE@ if $(COMPILE) -MT $@ -MD -MP -MF "$(DEPDIR)/$*.Tpo" -c -o $@ $<; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/$*.Tpo" "$(DEPDIR)/$*.Po"; else rm -f "$(DEPDIR)/$*.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='$<' object='$@' libtool=no @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(COMPILE) -c $< + +.c.obj: +@am__fastdepCC_TRUE@ if $(COMPILE) -MT $@ -MD -MP -MF "$(DEPDIR)/$*.Tpo" -c -o $@ `$(CYGPATH_W) '$<'`; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/$*.Tpo" "$(DEPDIR)/$*.Po"; else rm -f "$(DEPDIR)/$*.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='$<' object='$@' libtool=no @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(COMPILE) -c `$(CYGPATH_W) '$<'` + +.c.lo: +@am__fastdepCC_TRUE@ if $(LTCOMPILE) -MT $@ -MD -MP -MF "$(DEPDIR)/$*.Tpo" -c -o $@ $<; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/$*.Tpo" "$(DEPDIR)/$*.Plo"; else rm -f "$(DEPDIR)/$*.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='$<' object='$@' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LTCOMPILE) -c -o $@ $< + +mostlyclean-libtool: + -rm -f *.lo + +clean-libtool: + -rm -rf .libs _libs + +distclean-libtool: + -rm -f libtool +uninstall-info-am: + +ID: $(HEADERS) $(SOURCES) $(LISP) $(TAGS_FILES) + list='$(SOURCES) $(HEADERS) $(LISP) $(TAGS_FILES)'; \ + unique=`for i in $$list; do \ + if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \ + done | \ + $(AWK) ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + mkid -fID $$unique +tags: TAGS + +TAGS: $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) \ + $(TAGS_FILES) $(LISP) + tags=; \ + here=`pwd`; \ + list='$(SOURCES) $(HEADERS) $(LISP) $(TAGS_FILES)'; \ + unique=`for i in $$list; do \ + if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \ + done | \ + $(AWK) ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + if test -z "$(ETAGS_ARGS)$$tags$$unique"; then :; else \ + test -n "$$unique" || unique=$$empty_fix; \ + $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \ + $$tags $$unique; \ + fi +ctags: CTAGS +CTAGS: $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) \ + $(TAGS_FILES) $(LISP) + tags=; \ + here=`pwd`; \ + list='$(SOURCES) $(HEADERS) $(LISP) $(TAGS_FILES)'; \ + unique=`for i in $$list; do \ + if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \ + done | \ + $(AWK) ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + test -z "$(CTAGS_ARGS)$$tags$$unique" \ + || $(CTAGS) $(CTAGSFLAGS) $(AM_CTAGSFLAGS) $(CTAGS_ARGS) \ + $$tags $$unique + +GTAGS: + here=`$(am__cd) $(top_builddir) && pwd` \ + && cd $(top_srcdir) \ + && gtags -i $(GTAGS_ARGS) $$here + +distclean-tags: + -rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags + +distdir: $(DISTFILES) + @srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`; \ + topsrcdirstrip=`echo "$(top_srcdir)" | sed 's|.|.|g'`; \ + list='$(DISTFILES)'; for file in $$list; do \ + case $$file in \ + $(srcdir)/*) file=`echo "$$file" | sed "s|^$$srcdirstrip/||"`;; \ + $(top_srcdir)/*) file=`echo "$$file" | sed "s|^$$topsrcdirstrip/|$(top_builddir)/|"`;; \ + esac; \ + if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \ + dir=`echo "$$file" | sed -e 's,/[^/]*$$,,'`; \ + if test "$$dir" != "$$file" && test "$$dir" != "."; then \ + dir="/$$dir"; \ + $(mkdir_p) "$(distdir)$$dir"; \ + else \ + dir=''; \ + fi; \ + if test -d $$d/$$file; then \ + if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \ + cp -pR $(srcdir)/$$file $(distdir)$$dir || exit 1; \ + fi; \ + cp -pR $$d/$$file $(distdir)$$dir || exit 1; \ + else \ + test -f $(distdir)/$$file \ + || cp -p $$d/$$file $(distdir)/$$file \ + || exit 1; \ + fi; \ + done +check-am: all-am +check: check-am +all-am: Makefile $(LTLIBRARIES) +installdirs: + for dir in "$(DESTDIR)$(@DRIVER_NAME@_drv_ladir)"; do \ + test -z "$$dir" || $(mkdir_p) "$$dir"; \ + done +install: install-am +install-exec: install-exec-am +install-data: install-data-am +uninstall: uninstall-am + +install-am: all-am + @$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am + +installcheck: installcheck-am +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \ + install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \ + `test -z '$(STRIP)' || \ + echo "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'"` install +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES) + +maintainer-clean-generic: + @echo "This command is intended for maintainers to use" + @echo "it deletes files that may require special tools to rebuild." +clean: clean-am + +clean-am: clean-@DRIVER_NAME@_drv_laLTLIBRARIES clean-generic \ + clean-libtool mostlyclean-am + +distclean: distclean-am + -rm -rf ./$(DEPDIR) + -rm -f Makefile +distclean-am: clean-am distclean-compile distclean-generic \ + distclean-libtool distclean-tags + +dvi: dvi-am + +dvi-am: + +html: html-am + +info: info-am + +info-am: + +install-data-am: install-@DRIVER_NAME@_drv_laLTLIBRARIES + +install-exec-am: + +install-info: install-info-am + +install-man: + +installcheck-am: + +maintainer-clean: maintainer-clean-am + -rm -rf ./$(DEPDIR) + -rm -f Makefile +maintainer-clean-am: distclean-am maintainer-clean-generic + +mostlyclean: mostlyclean-am + +mostlyclean-am: mostlyclean-compile mostlyclean-generic \ + mostlyclean-libtool + +pdf: pdf-am + +pdf-am: + +ps: ps-am + +ps-am: + +uninstall-am: uninstall-@DRIVER_NAME@_drv_laLTLIBRARIES \ + uninstall-info-am + +.PHONY: CTAGS GTAGS all all-am check check-am clean \ + clean-@DRIVER_NAME@_drv_laLTLIBRARIES clean-generic \ + clean-libtool ctags distclean distclean-compile \ + distclean-generic distclean-libtool distclean-tags distdir dvi \ + dvi-am html html-am info info-am install \ + install-@DRIVER_NAME@_drv_laLTLIBRARIES install-am \ + install-data install-data-am install-exec install-exec-am \ + install-info install-info-am install-man install-strip \ + installcheck installcheck-am installdirs maintainer-clean \ + maintainer-clean-generic mostlyclean mostlyclean-compile \ + mostlyclean-generic mostlyclean-libtool pdf pdf-am ps ps-am \ + tags uninstall uninstall-@DRIVER_NAME@_drv_laLTLIBRARIES \ + uninstall-am uninstall-info-am + +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/driver/xf86-input-mouse/src/mouse.c b/driver/xf86-input-mouse/src/mouse.c new file mode 100644 index 000000000..d3eb62a00 --- /dev/null +++ b/driver/xf86-input-mouse/src/mouse.c @@ -0,0 +1,3796 @@ +/* $XdotOrg: driver/xf86-input-mouse/src/mouse.c,v 1.29 2006/04/21 11:15:23 mhopf Exp $ */ +/* $XFree86: xc/programs/Xserver/hw/xfree86/input/mouse/mouse.c,v 1.79 2003/11/03 05:11:48 tsi Exp $ */ +/* + * + * Copyright 1990,91 by Thomas Roell, Dinkelscherben, Germany. + * Copyright 1993 by David Dawes <dawes@xfree86.org> + * Copyright 2002 by SuSE Linux AG, Author: Egbert Eich + * Copyright 1994-2002 by The XFree86 Project, Inc. + * Copyright 2002 by Paul Elliott + * + * Permission to use, copy, modify, distribute, and sell this software and its + * documentation for any purpose is hereby granted without fee, provided that + * the above copyright notice appear in all copies and that both that + * copyright notice and this permission notice appear in supporting + * documentation, and that the names of copyright holders not be + * used in advertising or publicity pertaining to distribution of the + * software without specific, written prior permission. The copyright holders + * make no representations about the suitability of this + * software for any purpose. It is provided "as is" without express or + * implied warranty. + * + * THE COPYRIGHT HOLDERS DISCLAIM ALL WARRANTIES WITH REGARD TO THIS + * SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND + * FITNESS, IN NO EVENT SHALL THE COPYRIGHT HOLDERS BE LIABLE FOR ANY + * SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER + * RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF + * CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN + * CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + * + */ +/* Patch for PS/2 Intellimouse - Tim Goodwin 1997-11-06. */ + +/* + * [JCH-96/01/21] Added fourth button support for PROT_GLIDEPOINT mouse + * protocol. + */ + +/* + * [TVO-97/03/05] Added microsoft IntelliMouse support + */ + +/* + * [PME-02/08/11] Added suport for drag lock buttons + * for use with 4 button trackballs for convenience + * and to help limited dexterity persons + */ + +#ifdef HAVE_CONFIG_H +#include "config.h" +#endif + +#include <math.h> +#include <string.h> +#include <stdio.h> +#include <stdlib.h> +#define NEED_EVENTS +#include <X11/X.h> +#include <X11/Xproto.h> + +#include "xf86.h" + +#ifdef XINPUT +#include <X11/extensions/XI.h> +#include <X11/extensions/XIproto.h> +#include "extnsionst.h" +#include "extinit.h" +#else +#include "inputstr.h" +#endif + +#include "xf86Xinput.h" +#include "xf86_OSproc.h" +#include "xf86OSmouse.h" + +#ifndef NEED_XF86_TYPES +#define NEED_XF86_TYPES /* for xisb.h when !XFree86LOADER */ +#endif + +#include "compiler.h" + +#include "xisb.h" +#include "mouse.h" +#include "mousePriv.h" +#include "mipointer.h" + +enum { + /* number of bits in mapped nibble */ + NIB_BITS=4, + /* size of map of nibbles to bitmask */ + NIB_SIZE= (1 << NIB_BITS), + /* mask for map */ + NIB_MASK= (NIB_SIZE -1), + /* number of maps to map all the buttons */ + NIB_COUNT = ((MSE_MAXBUTTONS+NIB_BITS-1)/NIB_BITS) +}; + +/*data to be used in implementing trackball drag locks.*/ +typedef struct _DragLockRec { + + /* Fields used to implement trackball drag locks. */ + /* mask for those buttons that are ordinary drag lock buttons */ + int lockButtonsM; + + /* mask for the master drag lock button if any */ + int masterLockM; + + /* button state up/down from last time adjusted for drag locks */ + int lockLastButtons; + + /* + * true if master lock state i.e. master drag lock + * button has just been pressed + */ + int masterTS; + + /* simulate these buttons being down although they are not */ + int simulatedDown; + + /* + * data to map bits for drag lock buttons to corresponding + * bits for the target buttons + */ + int nib_table[NIB_COUNT][NIB_SIZE]; + +} DragLockRec, *DragLockPtr; + + + +#ifdef XFree86LOADER +static const OptionInfoRec *MouseAvailableOptions(void *unused); +#endif +static InputInfoPtr MousePreInit(InputDriverPtr drv, IDevPtr dev, int flags); +#if 0 +static void MouseUnInit(InputDriverPtr drv, InputInfoPtr pInfo, int flags); +#endif + +static int MouseProc(DeviceIntPtr device, int what); +static Bool MouseConvert(LocalDevicePtr local, int first, int num, int v0, + int v1, int v2, int v3, int v4, int v5, int *x, + int *y); + +static void MouseCtrl(DeviceIntPtr device, PtrCtrl *ctrl); +static void MousePostEvent(InputInfoPtr pInfo, int buttons, + int dx, int dy, int dz, int dw); +static void MouseReadInput(InputInfoPtr pInfo); +static void MouseBlockHandler(pointer data, struct timeval **waitTime, + pointer LastSelectMask); +static void MouseWakeupHandler(pointer data, int i, pointer LastSelectMask); +static void FlushButtons(MouseDevPtr pMse); + +static Bool SetupMouse(InputInfoPtr pInfo); +static Bool initMouseHW(InputInfoPtr pInfo); +#ifdef SUPPORT_MOUSE_RESET +static Bool mouseReset(InputInfoPtr pInfo, unsigned char val); +static void ps2WakeupHandler(pointer data, int i, pointer LastSelectMask); +static void ps2BlockHandler(pointer data, struct timeval **waitTime, + pointer LastSelectMask); +#endif + +/* mouse autoprobe stuff */ +static const char *autoOSProtocol(InputInfoPtr pInfo, int *protoPara); +static void autoProbeMouse(InputInfoPtr pInfo, Bool inSync, Bool lostSync); +static void checkForErraticMovements(InputInfoPtr pInfo, int dx, int dy); +static Bool collectData(MouseDevPtr pMse, unsigned char u); +static void SetMouseProto(MouseDevPtr pMse, MouseProtocolID protocolID); +static Bool autoGood(MouseDevPtr pMse); + +#undef MOUSE +_X_EXPORT InputDriverRec MOUSE = { + 1, + "mouse", + NULL, + MousePreInit, + /*MouseUnInit,*/NULL, + NULL, + 0 +}; + +typedef enum { + OPTION_ALWAYS_CORE, + OPTION_SEND_CORE_EVENTS, + OPTION_CORE_POINTER, + OPTION_SEND_DRAG_EVENTS, + OPTION_HISTORY_SIZE, + OPTION_DEVICE, + OPTION_PROTOCOL, + OPTION_BUTTONS, + OPTION_EMULATE_3_BUTTONS, + OPTION_EMULATE_3_TIMEOUT, + OPTION_CHORD_MIDDLE, + OPTION_FLIP_XY, + OPTION_INV_X, + OPTION_INV_Y, + OPTION_ANGLE_OFFSET, + OPTION_Z_AXIS_MAPPING, + OPTION_SAMPLE_RATE, + OPTION_RESOLUTION, + OPTION_EMULATE_WHEEL, + OPTION_EMU_WHEEL_BUTTON, + OPTION_EMU_WHEEL_INERTIA, + OPTION_EMU_WHEEL_TIMEOUT, + OPTION_X_AXIS_MAPPING, + OPTION_Y_AXIS_MAPPING, + OPTION_AUTO_SOFT, + OPTION_CLEAR_DTR, + OPTION_CLEAR_RTS, + OPTION_BAUD_RATE, + OPTION_DATA_BITS, + OPTION_STOP_BITS, + OPTION_PARITY, + OPTION_FLOW_CONTROL, + OPTION_VTIME, + OPTION_VMIN, + OPTION_DRAGLOCKBUTTONS, + OPTION_DOUBLECLICK_BUTTONS, + OPTION_BUTTON_MAPPING +} MouseOpts; + +#ifdef XFree86LOADER +static const OptionInfoRec mouseOptions[] = { + { OPTION_ALWAYS_CORE, "AlwaysCore", OPTV_BOOLEAN, {0}, FALSE }, + { OPTION_SEND_CORE_EVENTS, "SendCoreEvents", OPTV_BOOLEAN, {0}, FALSE }, + { OPTION_CORE_POINTER, "CorePointer", OPTV_BOOLEAN, {0}, FALSE }, + { OPTION_SEND_DRAG_EVENTS, "SendDragEvents", OPTV_BOOLEAN, {0}, FALSE }, + { OPTION_HISTORY_SIZE, "HistorySize", OPTV_INTEGER, {0}, FALSE }, + { OPTION_DEVICE, "Device", OPTV_STRING, {0}, FALSE }, + { OPTION_PROTOCOL, "Protocol", OPTV_STRING, {0}, FALSE }, + { OPTION_BUTTONS, "Buttons", OPTV_INTEGER, {0}, FALSE }, + { OPTION_EMULATE_3_BUTTONS, "Emulate3Buttons",OPTV_BOOLEAN, {0}, FALSE }, + { OPTION_EMULATE_3_TIMEOUT, "Emulate3Timeout",OPTV_INTEGER, {0}, FALSE }, + { OPTION_CHORD_MIDDLE, "ChordMiddle", OPTV_BOOLEAN, {0}, FALSE }, + { OPTION_FLIP_XY, "FlipXY", OPTV_BOOLEAN, {0}, FALSE }, + { OPTION_INV_X, "InvX", OPTV_BOOLEAN, {0}, FALSE }, + { OPTION_INV_Y, "InvY", OPTV_BOOLEAN, {0}, FALSE }, + { OPTION_ANGLE_OFFSET, "AngleOffset", OPTV_INTEGER, {0}, FALSE }, + { OPTION_Z_AXIS_MAPPING, "ZAxisMapping", OPTV_STRING, {0}, FALSE }, + { OPTION_SAMPLE_RATE, "SampleRate", OPTV_INTEGER, {0}, FALSE }, + { OPTION_RESOLUTION, "Resolution", OPTV_INTEGER, {0}, FALSE }, + { OPTION_EMULATE_WHEEL, "EmulateWheel", OPTV_BOOLEAN, {0}, FALSE }, + { OPTION_EMU_WHEEL_BUTTON, "EmulateWheelButton", OPTV_INTEGER, {0}, FALSE }, + { OPTION_EMU_WHEEL_INERTIA, "EmulateWheelInertia", OPTV_INTEGER, {0}, FALSE }, + { OPTION_EMU_WHEEL_TIMEOUT, "EmulateWheelTimeout", OPTV_INTEGER, {0}, FALSE }, + { OPTION_X_AXIS_MAPPING, "XAxisMapping", OPTV_STRING, {0}, FALSE }, + { OPTION_Y_AXIS_MAPPING, "YAxisMapping", OPTV_STRING, {0}, FALSE }, + { OPTION_AUTO_SOFT, "AutoSoft", OPTV_BOOLEAN, {0}, FALSE }, + /* serial options */ + { OPTION_CLEAR_DTR, "ClearDTR", OPTV_BOOLEAN, {0}, FALSE }, + { OPTION_CLEAR_RTS, "ClearRTS", OPTV_BOOLEAN, {0}, FALSE }, + { OPTION_BAUD_RATE, "BaudRate", OPTV_INTEGER, {0}, FALSE }, + { OPTION_DATA_BITS, "DataBits", OPTV_INTEGER, {0}, FALSE }, + { OPTION_STOP_BITS, "StopBits", OPTV_INTEGER, {0}, FALSE }, + { OPTION_PARITY, "Parity", OPTV_STRING, {0}, FALSE }, + { OPTION_FLOW_CONTROL, "FlowControl", OPTV_STRING, {0}, FALSE }, + { OPTION_VTIME, "VTime", OPTV_INTEGER, {0}, FALSE }, + { OPTION_VMIN, "VMin", OPTV_INTEGER, {0}, FALSE }, + /* end serial options */ + { OPTION_DRAGLOCKBUTTONS, "DragLockButtons",OPTV_STRING, {0}, FALSE }, + { OPTION_DOUBLECLICK_BUTTONS,"DoubleClickButtons", OPTV_STRING, {0}, FALSE }, + { OPTION_BUTTON_MAPPING, "ButtonMapping", OPTV_STRING, {0}, FALSE }, + { -1, NULL, OPTV_NONE, {0}, FALSE } +}; +#endif + +#define RETRY_COUNT 4 + +/* + * Microsoft (all serial models), Logitech MouseMan, First Mouse, etc, + * ALPS GlidePoint, Thinking Mouse. + */ +static const char *msDefaults[] = { + "BaudRate", "1200", + "DataBits", "7", + "StopBits", "1", + "Parity", "None", + "FlowControl", "None", + "VTime", "0", + "VMin", "1", + NULL +}; +/* MouseSystems */ +static const char *mlDefaults[] = { + "BaudRate", "1200", + "DataBits", "8", + "StopBits", "2", + "Parity", "None", + "FlowControl", "None", + "VTime", "0", + "VMin", "1", + NULL +}; +/* MMSeries */ +static const char *mmDefaults[] = { + "BaudRate", "1200", + "DataBits", "8", + "StopBits", "1", + "Parity", "Odd", + "FlowControl", "None", + "VTime", "0", + "VMin", "1", + NULL +}; +#if 0 +/* Logitech series 9 *//* same as msc: now mlDefaults */ +static const char *logiDefaults[] = { + "BaudRate", "1200", + "DataBits", "8", + "StopBits", "2", + "Parity", "None", + "FlowControl", "None", + "VTime", "0", + "VMin", "1", + NULL +}; +#endif +/* Hitachi Tablet */ +static const char *mmhitDefaults[] = { + "BaudRate", "1200", + "DataBits", "8", + "StopBits", "1", + "Parity", "None", + "FlowControl", "None", + "VTime", "0", + "VMin", "1", + NULL +}; +/* AceCad Tablet */ +static const char *acecadDefaults[] = { + "BaudRate", "9600", + "DataBits", "8", + "StopBits", "1", + "Parity", "Odd", + "FlowControl", "None", + "VTime", "0", + "VMin", "1", + NULL +}; + +static MouseProtocolRec mouseProtocols[] = { + + /* Serial protocols */ + { "Microsoft", MSE_SERIAL, msDefaults, PROT_MS }, + { "MouseSystems", MSE_SERIAL, mlDefaults, PROT_MSC }, + { "MMSeries", MSE_SERIAL, mmDefaults, PROT_MM }, + { "Logitech", MSE_SERIAL, mlDefaults, PROT_LOGI }, + { "MouseMan", MSE_SERIAL, msDefaults, PROT_LOGIMAN }, + { "MMHitTab", MSE_SERIAL, mmhitDefaults, PROT_MMHIT }, + { "GlidePoint", MSE_SERIAL, msDefaults, PROT_GLIDE }, + { "IntelliMouse", MSE_SERIAL, msDefaults, PROT_IMSERIAL }, + { "ThinkingMouse", MSE_SERIAL, msDefaults, PROT_THINKING }, + { "AceCad", MSE_SERIAL, acecadDefaults, PROT_ACECAD }, + { "ValuMouseScroll", MSE_SERIAL, msDefaults, PROT_VALUMOUSESCROLL }, + + /* Standard PS/2 */ + { "PS/2", MSE_PS2, NULL, PROT_PS2 }, + { "GenericPS/2", MSE_PS2, NULL, PROT_GENPS2 }, + + /* Extended PS/2 */ + { "ImPS/2", MSE_XPS2, NULL, PROT_IMPS2 }, + { "ExplorerPS/2", MSE_XPS2, NULL, PROT_EXPPS2 }, + { "ThinkingMousePS/2", MSE_XPS2, NULL, PROT_THINKPS2 }, + { "MouseManPlusPS/2", MSE_XPS2, NULL, PROT_MMPS2 }, + { "GlidePointPS/2", MSE_XPS2, NULL, PROT_GLIDEPS2 }, + { "NetMousePS/2", MSE_XPS2, NULL, PROT_NETPS2 }, + { "NetScrollPS/2", MSE_XPS2, NULL, PROT_NETSCPS2 }, + + /* Bus Mouse */ + { "BusMouse", MSE_BUS, NULL, PROT_BM }, + + /* Auto-detect (PnP) */ + { "Auto", MSE_AUTO, NULL, PROT_AUTO }, + + /* Misc (usually OS-specific) */ + { "SysMouse", MSE_MISC, mlDefaults, PROT_SYSMOUSE }, + + /* end of list */ + { NULL, MSE_NONE, NULL, PROT_UNKNOWN } +}; + +#ifdef XFree86LOADER +/*ARGSUSED*/ +static const OptionInfoRec * +MouseAvailableOptions(void *unused) +{ + return (mouseOptions); +} +#endif + +/* Process options common to all mouse types. */ +static void +MouseCommonOptions(InputInfoPtr pInfo) +{ + MouseDevPtr pMse; + MessageType buttons_from = X_CONFIG; + char *s; + int origButtons; + int i; + + pMse = pInfo->private; + + pMse->buttons = xf86SetIntOption(pInfo->options, "Buttons", 0); + if (!pMse->buttons) { + pMse->buttons = MSE_DFLTBUTTONS; + buttons_from = X_DEFAULT; + } + origButtons = pMse->buttons; + + pMse->emulate3Buttons = xf86SetBoolOption(pInfo->options, + "Emulate3Buttons", FALSE); + if (!xf86FindOptionValue(pInfo->options,"Emulate3Buttons")) { + pMse->emulate3ButtonsSoft = TRUE; + pMse->emulate3Buttons = TRUE; + } + + pMse->emulate3Timeout = xf86SetIntOption(pInfo->options, + "Emulate3Timeout", 50); + if (pMse->emulate3Buttons || pMse->emulate3ButtonsSoft) { + MessageType from = X_CONFIG; + if (pMse->emulate3ButtonsSoft) + from = X_DEFAULT; + xf86Msg(from, "%s: Emulate3Buttons, Emulate3Timeout: %d\n", + pInfo->name, pMse->emulate3Timeout); + } + + pMse->chordMiddle = xf86SetBoolOption(pInfo->options, "ChordMiddle", FALSE); + if (pMse->chordMiddle) + xf86Msg(X_CONFIG, "%s: ChordMiddle\n", pInfo->name); + pMse->flipXY = xf86SetBoolOption(pInfo->options, "FlipXY", FALSE); + if (pMse->flipXY) + xf86Msg(X_CONFIG, "%s: FlipXY\n", pInfo->name); + if (xf86SetBoolOption(pInfo->options, "InvX", FALSE)) { + pMse->invX = -1; + xf86Msg(X_CONFIG, "%s: InvX\n", pInfo->name); + } else + pMse->invX = 1; + if (xf86SetBoolOption(pInfo->options, "InvY", FALSE)) { + pMse->invY = -1; + xf86Msg(X_CONFIG, "%s: InvY\n", pInfo->name); + } else + pMse->invY = 1; + pMse->angleOffset = xf86SetIntOption(pInfo->options, "AngleOffset", 0); + + + if (pMse->pDragLock) + xfree(pMse->pDragLock); + pMse->pDragLock = NULL; + + s = xf86SetStrOption(pInfo->options, "DragLockButtons", NULL); + + if (s) { + int lock; /* lock button */ + int target; /* target button */ + int lockM,targetM; /* bitmasks for drag lock, target */ + int i, j; /* indexes */ + char *s1; /* parse input string */ + DragLockPtr pLock; + + pLock = pMse->pDragLock = xcalloc(1, sizeof(DragLockRec)); + /* init code */ + + /* initial string to be taken apart */ + s1 = s; + + /* keep getting numbers which are buttons */ + while ((s1 != NULL) && (lock = strtol(s1, &s1, 10)) != 0) { + + /* check sanity for a button */ + if ((lock < 0) || (lock > MSE_MAXBUTTONS)) { + xf86Msg(X_WARNING, "DragLock: Invalid button number = %d\n", + lock); + break; + }; + /* turn into a button mask */ + lockM = 1 << (lock - 1); + + /* try to get drag lock button */ + if ((s1 == NULL) || ((target=strtol(s1, &s1, 10)) == 0)) { + /*if no target, must be a master drag lock button */ + /* save master drag lock mask */ + pLock->masterLockM = lockM; + xf86Msg(X_CONFIG, + "DragLock button %d is master drag lock", + lock); + } else { + /* have target button number*/ + /* check target button number for sanity */ + if ((target < 0) || (target > MSE_MAXBUTTONS)) { + xf86Msg(X_WARNING, + "DragLock: Invalid button number for target=%d\n", + target); + break; + } + + /* target button mask */ + targetM = 1 << (target - 1); + + xf86Msg(X_CONFIG, + "DragLock: button %d is drag lock for button %d\n", + lock,target); + lock--; + + /* initialize table that maps drag lock mask to target mask */ + pLock->nib_table[lock / NIB_BITS][1 << (lock % NIB_BITS)] = + targetM; + + /* add new drag lock to mask of drag locks */ + pLock->lockButtonsM |= lockM; + } + + } + + /* + * fill out rest of map that maps sets of drag lock buttons + * to sets of target buttons, in the form of masks + */ + + /* for each nibble */ + for (i = 0; i < NIB_COUNT; i++) { + /* for each possible set of bits for that nibble */ + for (j = 0; j < NIB_SIZE; j++) { + int ff, fM, otherbits; + + /* get first bit set in j*/ + ff = ffs(j) - 1; + /* if 0 bits set nothing to do */ + if (ff >= 0) { + /* form mask for fist bit set */ + fM = 1 << ff; + /* mask off first bit set to get remaining bits set*/ + otherbits = j & ~fM; + /* + * if otherbits =0 then only 1 bit set + * so j=fM + * nib_table[i][fM] already calculated if fM has + * only 1 bit set. + * nib_table[i][j] has already been filled in + * by previous loop. otherwise + * otherbits < j so nibtable[i][otherbits] + * has already been calculated. + */ + if (otherbits) + pLock->nib_table[i][j] = + pLock->nib_table[i][fM] | + pLock->nib_table[i][otherbits]; + + } + } + } + xfree(s); + } + + s = xf86SetStrOption(pInfo->options, "ZAxisMapping", "4 5"); + if (s) { + int b1 = 0, b2 = 0, b3 = 0, b4 = 0; + char *msg = NULL; + + pMse->negativeZ = pMse->positiveZ = MSE_NOAXISMAP; + pMse->negativeW = pMse->positiveW = MSE_NOAXISMAP; + if (!xf86NameCmp(s, "x")) { + pMse->negativeZ = pMse->positiveZ = MSE_MAPTOX; + msg = xstrdup("X axis"); + } else if (!xf86NameCmp(s, "y")) { + pMse->negativeZ = pMse->positiveZ = MSE_MAPTOY; + msg = xstrdup("Y axis"); + } else if (sscanf(s, "%d %d %d %d", &b1, &b2, &b3, &b4) >= 2 && + b1 > 0 && b1 <= MSE_MAXBUTTONS && + b2 > 0 && b2 <= MSE_MAXBUTTONS) { + msg = xstrdup("buttons XX and YY"); + if (msg) + sprintf(msg, "buttons %d and %d", b1, b2); + pMse->negativeZ = 1 << (b1-1); + pMse->positiveZ = 1 << (b2-1); + if (b3 > 0 && b3 <= MSE_MAXBUTTONS && + b4 > 0 && b4 <= MSE_MAXBUTTONS) { + if (msg) + xfree(msg); + msg = xstrdup("buttons XX, YY, ZZ and WW"); + if (msg) + sprintf(msg, "buttons %d, %d, %d and %d", b1, b2, b3, b4); + pMse->negativeW = 1 << (b3-1); + pMse->positiveW = 1 << (b4-1); + } + if (b1 > pMse->buttons) pMse->buttons = b1; + if (b2 > pMse->buttons) pMse->buttons = b2; + if (b3 > pMse->buttons) pMse->buttons = b3; + if (b4 > pMse->buttons) pMse->buttons = b4; + } + if (msg) { + xf86Msg(X_CONFIG, "%s: ZAxisMapping: %s\n", pInfo->name, msg); + xfree(msg); + } else { + xf86Msg(X_WARNING, "%s: Invalid ZAxisMapping value: \"%s\"\n", + pInfo->name, s); + } + xfree(s); + } + if (xf86SetBoolOption(pInfo->options, "EmulateWheel", FALSE)) { + Bool yFromConfig = FALSE; + int wheelButton; + + pMse->emulateWheel = TRUE; + wheelButton = xf86SetIntOption(pInfo->options, + "EmulateWheelButton", 4); + if (wheelButton < 0 || wheelButton > MSE_MAXBUTTONS) { + xf86Msg(X_WARNING, "%s: Invalid EmulateWheelButton value: %d\n", + pInfo->name, wheelButton); + wheelButton = 4; + } + pMse->wheelButton = wheelButton; + + pMse->wheelInertia = xf86SetIntOption(pInfo->options, + "EmulateWheelInertia", 10); + if (pMse->wheelInertia <= 0) { + xf86Msg(X_WARNING, "%s: Invalid EmulateWheelInertia value: %d\n", + pInfo->name, pMse->wheelInertia); + pMse->wheelInertia = 10; + } + pMse->wheelButtonTimeout = xf86SetIntOption(pInfo->options, + "EmulateWheelTimeout", 200); + if (pMse->wheelButtonTimeout <= 0) { + xf86Msg(X_WARNING, "%s: Invalid EmulateWheelTimeout value: %d\n", + pInfo->name, pMse->wheelButtonTimeout); + pMse->wheelButtonTimeout = 200; + } + + pMse->negativeX = MSE_NOAXISMAP; + pMse->positiveX = MSE_NOAXISMAP; + s = xf86SetStrOption(pInfo->options, "XAxisMapping", NULL); + if (s) { + int b1 = 0, b2 = 0; + char *msg = NULL; + + if ((sscanf(s, "%d %d", &b1, &b2) == 2) && + b1 > 0 && b1 <= MSE_MAXBUTTONS && + b2 > 0 && b2 <= MSE_MAXBUTTONS) { + msg = xstrdup("buttons XX and YY"); + if (msg) + sprintf(msg, "buttons %d and %d", b1, b2); + pMse->negativeX = b1; + pMse->positiveX = b2; + if (b1 > pMse->buttons) pMse->buttons = b1; + if (b2 > pMse->buttons) pMse->buttons = b2; + } else { + xf86Msg(X_WARNING, "%s: Invalid XAxisMapping value: \"%s\"\n", + pInfo->name, s); + } + if (msg) { + xf86Msg(X_CONFIG, "%s: XAxisMapping: %s\n", pInfo->name, msg); + xfree(msg); + } + xfree(s); + } + s = xf86SetStrOption(pInfo->options, "YAxisMapping", NULL); + if (s) { + int b1 = 0, b2 = 0; + char *msg = NULL; + + if ((sscanf(s, "%d %d", &b1, &b2) == 2) && + b1 > 0 && b1 <= MSE_MAXBUTTONS && + b2 > 0 && b2 <= MSE_MAXBUTTONS) { + msg = xstrdup("buttons XX and YY"); + if (msg) + sprintf(msg, "buttons %d and %d", b1, b2); + pMse->negativeY = b1; + pMse->positiveY = b2; + if (b1 > pMse->buttons) pMse->buttons = b1; + if (b2 > pMse->buttons) pMse->buttons = b2; + yFromConfig = TRUE; + } else { + xf86Msg(X_WARNING, "%s: Invalid YAxisMapping value: \"%s\"\n", + pInfo->name, s); + } + if (msg) { + xf86Msg(X_CONFIG, "%s: YAxisMapping: %s\n", pInfo->name, msg); + xfree(msg); + } + xfree(s); + } + if (!yFromConfig) { + pMse->negativeY = 4; + pMse->positiveY = 5; + if (pMse->negativeY > pMse->buttons) + pMse->buttons = pMse->negativeY; + if (pMse->positiveY > pMse->buttons) + pMse->buttons = pMse->positiveY; + xf86Msg(X_DEFAULT, "%s: YAxisMapping: buttons %d and %d\n", + pInfo->name, pMse->negativeY, pMse->positiveY); + } + xf86Msg(X_CONFIG, "%s: EmulateWheel, EmulateWheelButton: %d, " + "EmulateWheelInertia: %d, " + "EmulateWheelTimeout: %d\n", + pInfo->name, wheelButton, pMse->wheelInertia, + pMse->wheelButtonTimeout); + } + s = xf86SetStrOption(pInfo->options, "ButtonMapping", NULL); + if (s) { + int b, n = 0; + char *s1 = s; + /* keep getting numbers which are buttons */ + while (s1 && n < MSE_MAXBUTTONS && (b = strtol(s1, &s1, 10)) != 0) { + /* check sanity for a button */ + if (b < 0 || b > MSE_MAXBUTTONS) { + xf86Msg(X_WARNING, + "ButtonMapping: Invalid button number = %d\n", b); + break; + }; + pMse->buttonMap[n++] = 1 << (b-1); + if (b > pMse->buttons) pMse->buttons = b; + } + xfree(s); + } + /* get maximum of mapped buttons */ + for (i = pMse->buttons-1; i >= 0; i--) { + int f = ffs (pMse->buttonMap[i]); + if (f > pMse->buttons) + pMse->buttons = f; + } + if (origButtons != pMse->buttons) + buttons_from = X_CONFIG; + xf86Msg(buttons_from, "%s: Buttons: %d\n", pInfo->name, pMse->buttons); + + pMse->doubleClickSourceButtonMask = 0; + pMse->doubleClickTargetButtonMask = 0; + pMse->doubleClickTargetButton = 0; + s = xf86SetStrOption(pInfo->options, "DoubleClickButtons", NULL); + if (s) { + int b1 = 0, b2 = 0; + char *msg = NULL; + + if ((sscanf(s, "%d %d", &b1, &b2) == 2) && + (b1 > 0) && (b1 <= MSE_MAXBUTTONS) && (b2 > 0) && (b2 <= MSE_MAXBUTTONS)) { + msg = xstrdup("buttons XX and YY"); + if (msg) + sprintf(msg, "buttons %d and %d", b1, b2); + pMse->doubleClickTargetButton = b1; + pMse->doubleClickTargetButtonMask = 1 << (b1 - 1); + pMse->doubleClickSourceButtonMask = 1 << (b2 - 1); + if (b1 > pMse->buttons) pMse->buttons = b1; + if (b2 > pMse->buttons) pMse->buttons = b2; + } else { + xf86Msg(X_WARNING, "%s: Invalid DoubleClickButtons value: \"%s\"\n", + pInfo->name, s); + } + if (msg) { + xf86Msg(X_CONFIG, "%s: DoubleClickButtons: %s\n", pInfo->name, msg); + xfree(msg); + } + xfree(s); + } +} +/* + * map bits corresponding to lock buttons. + * for each bit for a lock button, + * turn on bit corresponding to button button that the lock + * button services. + */ + +static int +lock2targetMap(DragLockPtr pLock, int lockMask) +{ + int result,i; + result = 0; + + /* + * for each nibble group of bits, use + * map for that group to get corresponding + * bits, turn them on. + * if 4 or less buttons only first map will + * need to be used. + */ + for (i = 0; (i < NIB_COUNT) && lockMask; i++) { + result |= pLock->nib_table[i][lockMask& NIB_MASK]; + + lockMask &= ~NIB_MASK; + lockMask >>= NIB_BITS; + } + return result; +} + +static void +MouseHWOptions(InputInfoPtr pInfo) +{ + MouseDevPtr pMse = pInfo->private; + mousePrivPtr mPriv = (mousePrivPtr)pMse->mousePriv; + + if (mPriv == NULL) + return; + + if ((mPriv->soft + = xf86SetBoolOption(pInfo->options, "AutoSoft", FALSE))) { + xf86Msg(X_CONFIG, "Don't initialize mouse when auto-probing\n"); + } + pMse->sampleRate = xf86SetIntOption(pInfo->options, "SampleRate", 0); + if (pMse->sampleRate) { + xf86Msg(X_CONFIG, "%s: SampleRate: %d\n", pInfo->name, + pMse->sampleRate); + } + pMse->resolution = xf86SetIntOption(pInfo->options, "Resolution", 0); + if (pMse->resolution) { + xf86Msg(X_CONFIG, "%s: Resolution: %d\n", pInfo->name, + pMse->resolution); + } +} + +static void +MouseSerialOptions(InputInfoPtr pInfo) +{ + MouseDevPtr pMse = pInfo->private; + Bool clearDTR, clearRTS; + + + pMse->baudRate = xf86SetIntOption(pInfo->options, "BaudRate", 0); + if (pMse->baudRate) { + xf86Msg(X_CONFIG, "%s: BaudRate: %d\n", pInfo->name, + pMse->baudRate); + } + + if ((clearDTR = xf86SetBoolOption(pInfo->options, "ClearDTR",FALSE))) + pMse->mouseFlags |= MF_CLEAR_DTR; + + + if ((clearRTS = xf86SetBoolOption(pInfo->options, "ClearRTS",FALSE))) + pMse->mouseFlags |= MF_CLEAR_RTS; + + if (clearDTR || clearRTS) { + xf86Msg(X_CONFIG, "%s: ", pInfo->name); + if (clearDTR) { + xf86ErrorF("ClearDTR"); + if (clearRTS) + xf86ErrorF(", "); + } + if (clearRTS) { + xf86ErrorF("ClearRTS"); + } + xf86ErrorF("\n"); + } +} + +static MouseProtocolID +ProtocolNameToID(const char *name) +{ + int i; + + for (i = 0; mouseProtocols[i].name; i++) + if (xf86NameCmp(name, mouseProtocols[i].name) == 0) + return mouseProtocols[i].id; + return PROT_UNKNOWN; +} + +static const char * +ProtocolIDToName(MouseProtocolID id) +{ + int i; + + switch (id) { + case PROT_UNKNOWN: + return "Unknown"; + break; + case PROT_UNSUP: + return "Unsupported"; + break; + default: + for (i = 0; mouseProtocols[i].name; i++) + if (id == mouseProtocols[i].id) + return mouseProtocols[i].name; + return "Invalid"; + } +} + +const char * +xf86MouseProtocolIDToName(MouseProtocolID id) +{ + return ProtocolIDToName(id); +} + +MouseProtocolID +xf86MouseProtocolNameToID(const char *name) +{ + return ProtocolNameToID(name); +} + +static int +ProtocolIDToClass(MouseProtocolID id) +{ + int i; + + switch (id) { + case PROT_UNKNOWN: + case PROT_UNSUP: + return MSE_NONE; + break; + default: + for (i = 0; mouseProtocols[i].name; i++) + if (id == mouseProtocols[i].id) + return mouseProtocols[i].class; + return MSE_NONE; + } +} + +static MouseProtocolPtr +GetProtocol(MouseProtocolID id) { + int i; + + switch (id) { + case PROT_UNKNOWN: + case PROT_UNSUP: + return NULL; + break; + default: + for (i = 0; mouseProtocols[i].name; i++) + if (id == mouseProtocols[i].id) { + return &mouseProtocols[i]; + } + return NULL; + } +} + +static OSMouseInfoPtr osInfo = NULL; + +static Bool +InitProtocols(void) +{ + int classes; + int i; + const char *osname = NULL; + + if (osInfo) + return TRUE; + + osInfo = xf86OSMouseInit(0); + if (!osInfo) + return FALSE; + if (!osInfo->SupportedInterfaces) + return FALSE; + + classes = osInfo->SupportedInterfaces(); + if (!classes) + return FALSE; + + /* Mark unsupported interface classes. */ + for (i = 0; mouseProtocols[i].name; i++) + if (!(mouseProtocols[i].class & classes)) + mouseProtocols[i].id = PROT_UNSUP; + + for (i = 0; mouseProtocols[i].name; i++) + if (mouseProtocols[i].class & MSE_MISC) + if (!osInfo->CheckProtocol || + !osInfo->CheckProtocol(mouseProtocols[i].name)) + mouseProtocols[i].id = PROT_UNSUP; + + /* NetBSD uses PROT_BM for "PS/2". */ + xf86GetOS(&osname, NULL, NULL, NULL); + if (osname && xf86NameCmp(osname, "netbsd") == 0) + for (i = 0; mouseProtocols[i].name; i++) + if (mouseProtocols[i].id == PROT_PS2) + mouseProtocols[i].id = PROT_BM; + + return TRUE; +} + +static InputInfoPtr +MousePreInit(InputDriverPtr drv, IDevPtr dev, int flags) +{ + InputInfoPtr pInfo; + MouseDevPtr pMse; + mousePrivPtr mPriv; + MessageType protocolFrom = X_DEFAULT, deviceFrom = X_CONFIG; + const char *protocol, *osProt = NULL; + const char *device; + MouseProtocolID protocolID; + MouseProtocolPtr pProto; + Bool detected; + int i; + + if (!InitProtocols()) + return NULL; + + if (!(pInfo = xf86AllocateInput(drv, 0))) + return NULL; + + /* Initialise the InputInfoRec. */ + pInfo->name = dev->identifier; + pInfo->type_name = XI_MOUSE; + pInfo->flags = XI86_POINTER_CAPABLE | XI86_SEND_DRAG_EVENTS; + pInfo->device_control = MouseProc; + pInfo->read_input = MouseReadInput; + pInfo->motion_history_proc = xf86GetMotionEvents; + pInfo->history_size = 0; + pInfo->control_proc = NULL; + pInfo->close_proc = NULL; + pInfo->switch_mode = NULL; + pInfo->conversion_proc = MouseConvert; + pInfo->reverse_conversion_proc = NULL; + pInfo->fd = -1; + pInfo->dev = NULL; + pInfo->private_flags = 0; + pInfo->always_core_feedback = 0; + pInfo->conf_idev = dev; + + /* Check if SendDragEvents has been disabled. */ + if (!xf86SetBoolOption(dev->commonOptions, "SendDragEvents", TRUE)) { + pInfo->flags &= ~XI86_SEND_DRAG_EVENTS; + } + + /* Allocate the MouseDevRec and initialise it. */ + /* + * XXX This should be done by a function in the core server since the + * MouseDevRec is defined in the os-support layer. + */ + if (!(pMse = xcalloc(sizeof(MouseDevRec), 1))) + return pInfo; + pInfo->private = pMse; + pMse->Ctrl = MouseCtrl; + pMse->PostEvent = MousePostEvent; + pMse->CommonOptions = MouseCommonOptions; + + /* Find the protocol type. */ + protocol = xf86SetStrOption(dev->commonOptions, "Protocol", NULL); + if (protocol) { + protocolFrom = X_CONFIG; + } else if (osInfo->DefaultProtocol) { + protocol = osInfo->DefaultProtocol(); + protocolFrom = X_DEFAULT; + } + if (!protocol) { + xf86Msg(X_ERROR, "%s: No Protocol specified\n", pInfo->name); + return pInfo; + } + + /* Default Mapping: 1 2 3 8 9 10 11 ... */ + for (i = 0; i < MSE_MAXBUTTONS; i++) + pMse->buttonMap[i] = 1 << (i > 2 && i < MSE_MAXBUTTONS-4 ? i+4 : i); + + protocolID = ProtocolNameToID(protocol); + do { + detected = TRUE; + switch (protocolID) { + case PROT_AUTO: + if (osInfo->SetupAuto) { + if ((osProt = osInfo->SetupAuto(pInfo,NULL))) { + MouseProtocolID id = ProtocolNameToID(osProt); + if (id == PROT_UNKNOWN || id == PROT_UNSUP) { + protocolID = id; + protocol = osProt; + detected = FALSE; + } + } + } + break; + case PROT_UNKNOWN: + /* Check for a builtin OS-specific protocol, + * and call its PreInit. */ + if (osInfo->CheckProtocol + && osInfo->CheckProtocol(protocol)) { + if (!xf86CheckStrOption(dev->commonOptions, "Device", NULL) && + HAVE_FIND_DEVICE && osInfo->FindDevice) { + xf86Msg(X_WARNING, "%s: No Device specified, " + "looking for one...\n", pInfo->name); + if (!osInfo->FindDevice(pInfo, protocol, 0)) { + xf86Msg(X_ERROR, "%s: Cannot find which device " + "to use.\n", pInfo->name); + } else + deviceFrom = X_PROBED; + } + if (osInfo->PreInit) { + osInfo->PreInit(pInfo, protocol, 0); + } + return pInfo; + } + xf86Msg(X_ERROR, "%s: Unknown protocol \"%s\"\n", + pInfo->name, protocol); + return pInfo; + break; + case PROT_UNSUP: + xf86Msg(X_ERROR, + "%s: Protocol \"%s\" is not supported on this " + "platform\n", pInfo->name, protocol); + return pInfo; + break; + default: + break; + + } + } while (!detected); + + if (!xf86CheckStrOption(dev->commonOptions, "Device", NULL) && + HAVE_FIND_DEVICE && osInfo->FindDevice) { + xf86Msg(X_WARNING, "%s: No Device specified, looking for one...\n", + pInfo->name); + if (!osInfo->FindDevice(pInfo, protocol, 0)) { + xf86Msg(X_ERROR, "%s: Cannot find which device to use.\n", + pInfo->name); + } else { + deviceFrom = X_PROBED; + xf86MarkOptionUsedByName(dev->commonOptions, "Device"); + } + } + + device = xf86CheckStrOption(dev->commonOptions, "Device", NULL); + if (device) + xf86Msg(deviceFrom, "%s: Device: \"%s\"\n", pInfo->name, device); + + xf86Msg(protocolFrom, "%s: Protocol: \"%s\"\n", pInfo->name, protocol); + if (!(pProto = GetProtocol(protocolID))) + return pInfo; + + pMse->protocolID = protocolID; + pMse->oldProtocolID = protocolID; /* hack */ + + pMse->autoProbe = FALSE; + /* Collect the options, and process the common options. */ + xf86CollectInputOptions(pInfo, pProto->defaults, NULL); + xf86ProcessCommonOptions(pInfo, pInfo->options); + + /* XXX should handle this OS dependency elsewhere. */ +#ifndef __OS2ELF__ + /* OS/2 has a mouse handled by the OS - it cannot fail here */ + + /* Check if the device can be opened. */ + pInfo->fd = xf86OpenSerial(pInfo->options); + if (pInfo->fd == -1) { + if (xf86GetAllowMouseOpenFail()) + xf86Msg(X_WARNING, "%s: cannot open input device\n", pInfo->name); + else { + xf86Msg(X_ERROR, "%s: cannot open input device\n", pInfo->name); + if (pMse->mousePriv) + xfree(pMse->mousePriv); + xfree(pMse); + pInfo->private = NULL; + return pInfo; + } + } + xf86CloseSerial(pInfo->fd); +#endif + pInfo->fd = -1; + + if (!(mPriv = (pointer) xcalloc(sizeof(mousePrivRec), 1))) + return pInfo; + pMse->mousePriv = mPriv; + pMse->CommonOptions(pInfo); + pMse->checkMovements = checkForErraticMovements; + pMse->autoProbeMouse = autoProbeMouse; + pMse->collectData = collectData; + pMse->dataGood = autoGood; + + MouseHWOptions(pInfo); + MouseSerialOptions(pInfo); + + pInfo->flags |= XI86_CONFIGURED; + return pInfo; +} + + +static void +MouseReadInput(InputInfoPtr pInfo) +{ + MouseDevPtr pMse; + int j, buttons, dx, dy, dz, dw, baddata; + int pBufP; + int c; + unsigned char *pBuf, u; + + + pMse = pInfo->private; + pBufP = pMse->protoBufTail; + pBuf = pMse->protoBuf; + + /* + * Set blocking to -1 on the first call because we know there is data to + * read. Xisb automatically clears it after one successful read so that + * succeeding reads are preceeded by a select with a 0 timeout to prevent + * read from blocking indefinitely. + */ + XisbBlockDuration(pMse->buffer, -1); + + while ((c = XisbRead(pMse->buffer)) >= 0) { + u = (unsigned char)c; + +#if defined (EXTMOUSEDEBUG) || defined (MOUSEDATADEBUG) + ErrorF("mouse byte: %2.2x\n",u); +#endif + +#if 1 + /* if we do autoprobing collect the data */ + if (pMse->collectData && pMse->autoProbe) + if (pMse->collectData(pMse,u)) + continue; +#endif +#ifdef SUPPORT_MOUSE_RESET + if (mouseReset(pInfo,u)) { + pBufP = 0; + continue; + } +#endif + if (pBufP >= pMse->protoPara[4]) { + /* + * Buffer contains a full packet, which has already been processed: + * Empty the buffer and check for optional 4th byte, which will be + * processed directly, without being put into the buffer first. + */ + pBufP = 0; + if ((u & pMse->protoPara[0]) != pMse->protoPara[1] && + (u & pMse->protoPara[5]) == pMse->protoPara[6]) { + /* + * Hack for Logitech MouseMan Mouse - Middle button + * + * Unfortunately this mouse has variable length packets: the + * standard Microsoft 3 byte packet plus an optional 4th byte + * whenever the middle button status changes. + * + * We have already processed the standard packet with the + * movement and button info. Now post an event message with + * the old status of the left and right buttons and the + * updated middle button. + */ + /* + * Even worse, different MouseMen and TrackMen differ in the + * 4th byte: some will send 0x00/0x20, others 0x01/0x21, or + * even 0x02/0x22, so I have to strip off the lower bits. + * [CHRIS-211092] + * + * [JCH-96/01/21] + * HACK for ALPS "fourth button". (It's bit 0x10 of the + * "fourth byte" and it is activated by tapping the glidepad + * with the finger! 8^) We map it to bit bit3, and the + * reverse map in xf86Events just has to be extended so that + * it is identified as Button 4. The lower half of the + * reverse-map may remain unchanged. + */ + /* + * [KAZU-030897] + * Receive the fourth byte only when preceeding three bytes + * have been detected (pBufP >= pMse->protoPara[4]). In the + * previous versions, the test was pBufP == 0; we may have + * mistakingly received a byte even if we didn't see anything + * preceeding the byte. + */ +#ifdef EXTMOUSEDEBUG + ErrorF("mouse 4th byte %02x\n",u); +#endif + dx = dy = dz = dw = 0; + buttons = 0; + switch (pMse->protocolID) { + + /* + * [KAZU-221197] + * IntelliMouse, NetMouse (including NetMouse Pro) and Mie + * Mouse always send the fourth byte, whereas the fourth byte + * is optional for GlidePoint and ThinkingMouse. The fourth + * byte is also optional for MouseMan+ and FirstMouse+ in + * their native mode. It is always sent if they are in the + * IntelliMouse compatible mode. + */ + case PROT_IMSERIAL: /* IntelliMouse, NetMouse, Mie Mouse, + MouseMan+ */ + dz = (u & 0x08) ? + (u & 0x0f) - 16 : (u & 0x0f); + if ((dz >= 7) || (dz <= -7)) + dz = 0; + buttons |= ((int)(u & 0x10) >> 3) + | ((int)(u & 0x20) >> 2) + | (pMse->lastButtons & 0x05); + break; + + case PROT_GLIDE: + case PROT_THINKING: + buttons |= ((int)(u & 0x10) >> 1); + /* fall through */ + + default: + buttons |= ((int)(u & 0x20) >> 4) | + (pMse->lastButtons & 0x05); + break; + } + goto post_event; + } + } + /* End of packet buffer flush and 4th byte hack. */ + + /* + * Append next byte to buffer (which is empty or contains an + * incomplete packet); iterate if packet (still) not complete. + */ + pBuf[pBufP++] = u; + if (pBufP != pMse->protoPara[4]) continue; +#ifdef EXTMOUSEDEBUG2 + { + int i; + ErrorF("received %d bytes",pBufP); + for ( i=0; i < pBufP; i++) + ErrorF(" %02x",pBuf[i]); + ErrorF("\n"); + } +#endif + + /* + * Hack for resyncing: We check here for a package that is: + * a) illegal (detected by wrong data-package header) + * b) invalid (0x80 == -128 and that might be wrong for MouseSystems) + * c) bad header-package + * + * NOTE: b) is a violation of the MouseSystems-Protocol, since values + * of -128 are allowed, but since they are very seldom we can + * easily use them as package-header with no button pressed. + * NOTE/2: On a PS/2 mouse any byte is valid as a data byte. + * Furthermore, 0x80 is not valid as a header byte. For a PS/2 + * mouse we skip checking data bytes. For resyncing a PS/2 + * mouse we require the two most significant bits in the header + * byte to be 0. These are the overflow bits, and in case of + * an overflow we actually lose sync. Overflows are very rare, + * however, and we quickly gain sync again after an overflow + * condition. This is the best we can do. (Actually, we could + * use bit 0x08 in the header byte for resyncing, since that + * bit is supposed to be always on, but nobody told Microsoft...) + */ + + /* + * [KAZU,OYVIND-120398] + * The above hack is wrong! Because of b) above, we shall see + * erroneous mouse events so often when the MouseSystem mouse is + * moved quickly. As for the PS/2 and its variants, we don't need + * to treat them as special cases, because protoPara[2] and + * protoPara[3] are both 0x00 for them, thus, any data bytes will + * never be discarded. 0x80 is rejected for MMSeries, Logitech + * and MMHittab protocols, because protoPara[2] and protoPara[3] + * are 0x80 and 0x00 respectively. The other protocols are 7-bit + * protocols; there is no use checking 0x80. + * + * All in all we should check the condition a) only. + */ + + /* + * [OYVIND-120498] + * Check packet for valid data: + * If driver is in sync with datastream, the packet is considered + * bad if any byte (header and/or data) contains an invalid value. + * + * If packet is bad, we discard the first byte and shift the buffer. + * Next iteration will then check the new situation for validity. + * + * If flag MF_SAFE is set in proto[7] and the driver + * is out of sync, the packet is also considered bad if + * any of the data bytes contains a valid header byte value. + * This situation could occur if the buffer contains + * the tail of one packet and the header of the next. + * + * Note: The driver starts in out-of-sync mode (pMse->inSync = 0). + */ + + baddata = 0; + + /* All databytes must be valid. */ + for (j = 1; j < pBufP; j++ ) + if ((pBuf[j] & pMse->protoPara[2]) != pMse->protoPara[3]) + baddata = 1; + + /* If out of sync, don't mistake a header byte for data. */ + if ((pMse->protoPara[7] & MPF_SAFE) && !pMse->inSync) + for (j = 1; j < pBufP; j++ ) + if ((pBuf[j] & pMse->protoPara[0]) == pMse->protoPara[1]) + baddata = 1; + + /* Accept or reject the packet ? */ + if ((pBuf[0] & pMse->protoPara[0]) != pMse->protoPara[1] || baddata) { + if (pMse->inSync) { +#ifdef EXTMOUSEDEBUG + ErrorF("mouse driver lost sync\n"); +#endif + } +#ifdef EXTMOUSEDEBUG + ErrorF("skipping byte %02x\n",*pBuf); +#endif + /* Tell auto probe that we are out of sync */ + if (pMse->autoProbeMouse && pMse->autoProbe) + pMse->autoProbeMouse(pInfo, FALSE, pMse->inSync); + pMse->protoBufTail = --pBufP; + for (j = 0; j < pBufP; j++) + pBuf[j] = pBuf[j+1]; + pMse->inSync = 0; + continue; + } + /* Tell auto probe that we were successful */ + if (pMse->autoProbeMouse && pMse->autoProbe) + pMse->autoProbeMouse(pInfo, TRUE, FALSE); + + if (!pMse->inSync) { +#ifdef EXTMOUSEDEBUG + ErrorF("mouse driver back in sync\n"); +#endif + pMse->inSync = 1; + } + + if (!pMse->dataGood(pMse)) + continue; + + /* + * Packet complete and verified, now process it ... + */ + REDO_INTERPRET: + dz = dw = 0; + switch (pMse->protocolID) { + case PROT_LOGIMAN: /* MouseMan / TrackMan [CHRIS-211092] */ + case PROT_MS: /* Microsoft */ + if (pMse->chordMiddle) + buttons = (((int) pBuf[0] & 0x30) == 0x30) ? 2 : + ((int)(pBuf[0] & 0x20) >> 3) + | ((int)(pBuf[0] & 0x10) >> 4); + else + buttons = (pMse->lastButtons & 2) + | ((int)(pBuf[0] & 0x20) >> 3) + | ((int)(pBuf[0] & 0x10) >> 4); + dx = (char)(((pBuf[0] & 0x03) << 6) | (pBuf[1] & 0x3F)); + dy = (char)(((pBuf[0] & 0x0C) << 4) | (pBuf[2] & 0x3F)); + break; + + case PROT_GLIDE: /* ALPS GlidePoint */ + case PROT_THINKING: /* ThinkingMouse */ + case PROT_IMSERIAL: /* IntelliMouse, NetMouse, Mie Mouse, MouseMan+ */ + buttons = (pMse->lastButtons & (8 + 2)) + | ((int)(pBuf[0] & 0x20) >> 3) + | ((int)(pBuf[0] & 0x10) >> 4); + dx = (char)(((pBuf[0] & 0x03) << 6) | (pBuf[1] & 0x3F)); + dy = (char)(((pBuf[0] & 0x0C) << 4) | (pBuf[2] & 0x3F)); + break; + + case PROT_MSC: /* Mouse Systems Corp */ + buttons = (~pBuf[0]) & 0x07; + dx = (char)(pBuf[1]) + (char)(pBuf[3]); + dy = - ((char)(pBuf[2]) + (char)(pBuf[4])); + break; + + case PROT_MMHIT: /* MM_HitTablet */ + buttons = pBuf[0] & 0x07; + if (buttons != 0) + buttons = 1 << (buttons - 1); + dx = (pBuf[0] & 0x10) ? pBuf[1] : - pBuf[1]; + dy = (pBuf[0] & 0x08) ? - pBuf[2] : pBuf[2]; + break; + + case PROT_ACECAD: /* ACECAD */ + /* ACECAD is almost exactly like MM but the buttons are different */ + buttons = (pBuf[0] & 0x02) | ((pBuf[0] & 0x04) >> 2) | + ((pBuf[0] & 1) << 2); + dx = (pBuf[0] & 0x10) ? pBuf[1] : - pBuf[1]; + dy = (pBuf[0] & 0x08) ? - pBuf[2] : pBuf[2]; + break; + + case PROT_MM: /* MM Series */ + case PROT_LOGI: /* Logitech Mice */ + buttons = pBuf[0] & 0x07; + dx = (pBuf[0] & 0x10) ? pBuf[1] : - pBuf[1]; + dy = (pBuf[0] & 0x08) ? - pBuf[2] : pBuf[2]; + break; + + case PROT_BM: /* BusMouse */ + buttons = (~pBuf[0]) & 0x07; + dx = (char)pBuf[1]; + dy = - (char)pBuf[2]; + break; + + case PROT_PS2: /* PS/2 mouse */ + case PROT_GENPS2: /* generic PS/2 mouse */ + buttons = (pBuf[0] & 0x04) >> 1 | /* Middle */ + (pBuf[0] & 0x02) >> 1 | /* Right */ + (pBuf[0] & 0x01) << 2; /* Left */ + dx = (pBuf[0] & 0x10) ? (int)pBuf[1]-256 : (int)pBuf[1]; + dy = (pBuf[0] & 0x20) ? -((int)pBuf[2]-256) : -(int)pBuf[2]; + break; + + /* PS/2 mouse variants */ + case PROT_IMPS2: /* IntelliMouse PS/2 */ + case PROT_NETPS2: /* NetMouse PS/2 */ + buttons = (pBuf[0] & 0x04) >> 1 | /* Middle */ + (pBuf[0] & 0x02) >> 1 | /* Right */ + (pBuf[0] & 0x01) << 2 | /* Left */ + (pBuf[0] & 0x40) >> 3 | /* button 4 */ + (pBuf[0] & 0x80) >> 3; /* button 5 */ + dx = (pBuf[0] & 0x10) ? pBuf[1]-256 : pBuf[1]; + dy = (pBuf[0] & 0x20) ? -(pBuf[2]-256) : -pBuf[2]; + /* + * The next cast must be 'signed char' for platforms (like PPC) + * where char defaults to unsigned. + */ + dz = (signed char)(pBuf[3] | ((pBuf[3] & 0x08) ? 0xf8 : 0)); + if ((pBuf[3] & 0xf8) && ((pBuf[3] & 0xf8) != 0xf8)) { + if (pMse->autoProbe) { + SetMouseProto(pMse, PROT_EXPPS2); + xf86Msg(X_INFO, + "Mouse autoprobe: Changing protocol to %s\n", + pMse->protocol); + + goto REDO_INTERPRET; + } else + dz = 0; + } + break; + + case PROT_EXPPS2: /* IntelliMouse Explorer PS/2 */ + if (pMse->autoProbe && (pBuf[3] & 0xC0)) { + SetMouseProto(pMse, PROT_IMPS2); + xf86Msg(X_INFO,"Mouse autoprobe: Changing protocol to %s\n", + pMse->protocol); + goto REDO_INTERPRET; + } + buttons = (pBuf[0] & 0x04) >> 1 | /* Middle */ + (pBuf[0] & 0x02) >> 1 | /* Right */ + (pBuf[0] & 0x01) << 2 | /* Left */ + (pBuf[3] & 0x10) >> 1 | /* button 4 */ + (pBuf[3] & 0x20) >> 1; /* button 5 */ + dx = (pBuf[0] & 0x10) ? pBuf[1]-256 : pBuf[1]; + dy = (pBuf[0] & 0x20) ? -(pBuf[2]-256) : -pBuf[2]; + if (pMse->negativeW != MSE_NOAXISMAP) { + switch (pBuf[3] & 0x0f) { + case 0x00: break; + case 0x01: dz = 1; break; + case 0x02: dw = 1; break; + case 0x0e: dw = -1; break; + case 0x0f: dz = -1; break; + default: + xf86Msg(X_INFO, + "Mouse autoprobe: Disabling secondary wheel\n"); + pMse->negativeW = pMse->positiveW = MSE_NOAXISMAP; + } + } + if (pMse->negativeW == MSE_NOAXISMAP) + dz = (pBuf[3]&0x08) ? (pBuf[3]&0x0f) - 16 : (pBuf[3]&0x0f); + break; + + case PROT_MMPS2: /* MouseMan+ PS/2 */ + buttons = (pBuf[0] & 0x04) >> 1 | /* Middle */ + (pBuf[0] & 0x02) >> 1 | /* Right */ + (pBuf[0] & 0x01) << 2; /* Left */ + dx = (pBuf[0] & 0x10) ? pBuf[1] - 256 : pBuf[1]; + if (((pBuf[0] & 0x48) == 0x48) && + (abs(dx) > 191) && + ((((pBuf[2] & 0x03) << 2) | 0x02) == (pBuf[1] & 0x0f))) { + /* extended data packet */ + switch ((((pBuf[0] & 0x30) >> 2) | ((pBuf[1] & 0x30) >> 4))) { + case 1: /* wheel data packet */ + buttons |= ((pBuf[2] & 0x10) ? 0x08 : 0) | /* 4th button */ + ((pBuf[2] & 0x20) ? 0x10 : 0); /* 5th button */ + dx = dy = 0; + dz = (pBuf[2] & 0x08) ? (pBuf[2] & 0x0f) - 16 : + (pBuf[2] & 0x0f); + break; + case 2: /* Logitech reserves this packet type */ + /* + * IBM ScrollPoint uses this packet to encode its + * stick movement. + */ + buttons |= (pMse->lastButtons & ~0x07); + dx = dy = 0; + dz = (pBuf[2] & 0x80) ? ((pBuf[2] >> 4) & 0x0f) - 16 : + ((pBuf[2] >> 4) & 0x0f); + dw = (pBuf[2] & 0x08) ? (pBuf[2] & 0x0f) - 16 : + (pBuf[2] & 0x0f); + break; + case 0: /* device type packet - shouldn't happen */ + default: + buttons |= (pMse->lastButtons & ~0x07); + dx = dy = 0; + dz = 0; + break; + } + } else { + buttons |= (pMse->lastButtons & ~0x07); + dx = (pBuf[0] & 0x10) ? pBuf[1]-256 : pBuf[1]; + dy = (pBuf[0] & 0x20) ? -(pBuf[2]-256) : -pBuf[2]; + } + break; + + case PROT_GLIDEPS2: /* GlidePoint PS/2 */ + buttons = (pBuf[0] & 0x04) >> 1 | /* Middle */ + (pBuf[0] & 0x02) >> 1 | /* Right */ + (pBuf[0] & 0x01) << 2 | /* Left */ + ((pBuf[0] & 0x08) ? 0 : 0x08);/* fourth button */ + dx = (pBuf[0] & 0x10) ? pBuf[1]-256 : pBuf[1]; + dy = (pBuf[0] & 0x20) ? -(pBuf[2]-256) : -pBuf[2]; + break; + + case PROT_NETSCPS2: /* NetScroll PS/2 */ + buttons = (pBuf[0] & 0x04) >> 1 | /* Middle */ + (pBuf[0] & 0x02) >> 1 | /* Right */ + (pBuf[0] & 0x01) << 2 | /* Left */ + ((pBuf[3] & 0x02) ? 0x08 : 0) | /* button 4 */ + ((pBuf[3] & 0x01) ? 0x10 : 0); /* button 5 */ + dx = (pBuf[0] & 0x10) ? pBuf[1]-256 : pBuf[1]; + dy = (pBuf[0] & 0x20) ? -(pBuf[2]-256) : -pBuf[2]; + dz = (pBuf[3] & 0x10) ? pBuf[4] - 256 : pBuf[4]; + break; + + case PROT_THINKPS2: /* ThinkingMouse PS/2 */ + buttons = (pBuf[0] & 0x04) >> 1 | /* Middle */ + (pBuf[0] & 0x02) >> 1 | /* Right */ + (pBuf[0] & 0x01) << 2 | /* Left */ + ((pBuf[0] & 0x08) ? 0x08 : 0);/* fourth button */ + pBuf[1] |= (pBuf[0] & 0x40) ? 0x80 : 0x00; + dx = (pBuf[0] & 0x10) ? pBuf[1]-256 : pBuf[1]; + dy = (pBuf[0] & 0x20) ? -(pBuf[2]-256) : -pBuf[2]; + break; + + case PROT_SYSMOUSE: /* sysmouse */ + buttons = (~pBuf[0]) & 0x07; + dx = (signed char)(pBuf[1]) + (signed char)(pBuf[3]); + dy = - ((signed char)(pBuf[2]) + (signed char)(pBuf[4])); + /* FreeBSD sysmouse sends additional data bytes */ + if (pMse->protoPara[4] >= 8) { + /* + * These casts must be 'signed char' for platforms (like PPC) + * where char defaults to unsigned. + */ + dz = ((signed char)(pBuf[5] << 1) + + (signed char)(pBuf[6] << 1)) >> 1; + buttons |= (int)(~pBuf[7] & 0x7f) << 3; + } + break; + + case PROT_VALUMOUSESCROLL: /* Kensington ValuMouseScroll */ + buttons = ((int)(pBuf[0] & 0x20) >> 3) + | ((int)(pBuf[0] & 0x10) >> 4) + | ((int)(pBuf[3] & 0x10) >> 3); + dx = (char)(((pBuf[0] & 0x03) << 6) | (pBuf[1] & 0x3F)); + dy = (char)(((pBuf[0] & 0x0C) << 4) | (pBuf[2] & 0x3F)); + dz = (pBuf[3] & 0x08) ? ((int)(pBuf[3] & 0x0F) - 0x10) : + ((int)(pBuf[3] & 0x0F)); + break; + + default: /* There's a table error */ +#ifdef EXTMOUSEDEBUG + ErrorF("mouse table error\n"); +#endif + continue; + } +#ifdef EXTMOUSEDEBUG + ErrorF("packet"); + for ( j=0; j < pBufP; j++) + ErrorF(" %02x",pBuf[j]); + ErrorF("\n"); +#endif + +post_event: +#ifdef EXTMOUSEDEBUG + ErrorF("dx=%i dy=%i dz=%i dw=%i buttons=%x\n",dx,dy,dz,dw,buttons); +#endif + /* When auto-probing check if data makes sense */ + if (pMse->checkMovements && pMse->autoProbe) + pMse->checkMovements(pInfo,dx,dy); + /* post an event */ + pMse->PostEvent(pInfo, buttons, dx, dy, dz, dw); + + /* + * We don't reset pBufP here yet, as there may be an additional data + * byte in some protocols. See above. + */ + } + pMse->protoBufTail = pBufP; +} + +/* + * MouseCtrl -- + * Alter the control parameters for the mouse. Note that all special + * protocol values are handled by dix. + */ + +static void +MouseCtrl(DeviceIntPtr device, PtrCtrl *ctrl) +{ + InputInfoPtr pInfo; + MouseDevPtr pMse; + + pInfo = device->public.devicePrivate; + pMse = pInfo->private; + +#ifdef EXTMOUSEDEBUG + ErrorF("MouseCtrl pMse=%p\n", pMse); +#endif + + pMse->num = ctrl->num; + pMse->den = ctrl->den; + pMse->threshold = ctrl->threshold; +} + +/* + *************************************************************************** + * + * MouseProc -- + * + *************************************************************************** + */ + +static int +MouseProc(DeviceIntPtr device, int what) +{ + InputInfoPtr pInfo; + MouseDevPtr pMse; + mousePrivPtr mPriv; + unsigned char map[MSE_MAXBUTTONS + 1]; + int i; + + pInfo = device->public.devicePrivate; + pMse = pInfo->private; + pMse->device = device; + + switch (what) + { + case DEVICE_INIT: + device->public.on = FALSE; + /* + * [KAZU-241097] We don't know exactly how many buttons the + * device has, so setup the map with the maximum number. + */ + for (i = 0; i < MSE_MAXBUTTONS; i++) + map[i + 1] = i + 1; + + InitPointerDeviceStruct((DevicePtr)device, map, + min(pMse->buttons, MSE_MAXBUTTONS), + miPointerGetMotionEvents, pMse->Ctrl, + miPointerGetMotionBufferSize()); + + /* X valuator */ + xf86InitValuatorAxisStruct(device, 0, 0, -1, 1, 0, 1); + xf86InitValuatorDefaults(device, 0); + /* Y valuator */ + xf86InitValuatorAxisStruct(device, 1, 0, -1, 1, 0, 1); + xf86InitValuatorDefaults(device, 1); + xf86MotionHistoryAllocate(pInfo); + +#ifdef EXTMOUSEDEBUG + ErrorF("assigning %p atom=%d name=%s\n", device, pInfo->atom, + pInfo->name); +#endif + break; + + case DEVICE_ON: + pInfo->fd = xf86OpenSerial(pInfo->options); + if (pInfo->fd == -1) + xf86Msg(X_WARNING, "%s: cannot open input device\n", pInfo->name); + else { + if (pMse->xisbscale) + pMse->buffer = XisbNew(pInfo->fd, pMse->xisbscale * 4); + else + pMse->buffer = XisbNew(pInfo->fd, 64); + if (!pMse->buffer) { + xf86CloseSerial(pInfo->fd); + pInfo->fd = -1; + } else { + if (!SetupMouse(pInfo)) { + xf86CloseSerial(pInfo->fd); + pInfo->fd = -1; + XisbFree(pMse->buffer); + pMse->buffer = NULL; + } else { + mPriv = (mousePrivPtr)pMse->mousePriv; + if (mPriv != NULL) { + if ( pMse->protocolID != PROT_AUTO) { + pMse->inSync = TRUE; /* @@@ */ + if (mPriv->soft) + mPriv->autoState = AUTOPROBE_GOOD; + else + mPriv->autoState = AUTOPROBE_H_GOOD; + } else { + if (mPriv->soft) + mPriv->autoState = AUTOPROBE_NOPROTO; + else + mPriv->autoState = AUTOPROBE_H_NOPROTO; + } + } + xf86FlushInput(pInfo->fd); + xf86AddEnabledDevice(pInfo); + } + } + } + pMse->lastButtons = 0; + pMse->lastMappedButtons = 0; + pMse->emulateState = 0; + pMse->emulate3Pending = FALSE; + pMse->wheelButtonExpires = GetTimeInMillis (); + device->public.on = TRUE; + FlushButtons(pMse); + if (pMse->emulate3Buttons || pMse->emulate3ButtonsSoft) + { + RegisterBlockAndWakeupHandlers (MouseBlockHandler, MouseWakeupHandler, + (pointer) pInfo); + } + break; + + case DEVICE_OFF: + case DEVICE_CLOSE: + if (pInfo->fd != -1) { + xf86RemoveEnabledDevice(pInfo); + if (pMse->buffer) { + XisbFree(pMse->buffer); + pMse->buffer = NULL; + } + xf86CloseSerial(pInfo->fd); + pInfo->fd = -1; + if (pMse->emulate3Buttons || pMse->emulate3ButtonsSoft) + { + RemoveBlockAndWakeupHandlers (MouseBlockHandler, MouseWakeupHandler, + (pointer) pInfo); + } + } + device->public.on = FALSE; + usleep(300000); + break; + } + return Success; +} + +/* + *************************************************************************** + * + * MouseConvert -- + * Convert valuators to X and Y. + * + *************************************************************************** + */ +static Bool +MouseConvert(InputInfoPtr pInfo, int first, int num, int v0, int v1, int v2, + int v3, int v4, int v5, int *x, int *y) +{ + if (first != 0 || num != 2) + return FALSE; + + *x = v0; + *y = v1; + + return TRUE; +} + +/********************************************************************** + * + * FlushButtons -- send button up events for sanity. + * + **********************************************************************/ + +static void +FlushButtons(MouseDevPtr pMse) +{ + + /* If no button down is pending xf86PostButtonEvent() + * will discard them. So we are on the safe side. */ + + int i, blocked; + + pMse->lastButtons = 0; + pMse->lastMappedButtons = 0; + + blocked = xf86BlockSIGIO (); + for (i = 1; i <= 5; i++) + xf86PostButtonEvent(pMse->device,0,i,0,0,0); + xf86UnblockSIGIO (blocked); +} + +/********************************************************************** + * + * Emulate3Button support code + * + **********************************************************************/ + + +/* + * Lets create a simple finite-state machine for 3 button emulation: + * + * We track buttons 1 and 3 (left and right). There are 11 states: + * 0 ground - initial state + * 1 delayed left - left pressed, waiting for right + * 2 delayed right - right pressed, waiting for left + * 3 pressed middle - right and left pressed, emulated middle sent + * 4 pressed left - left pressed and sent + * 5 pressed right - right pressed and sent + * 6 released left - left released after emulated middle + * 7 released right - right released after emulated middle + * 8 repressed left - left pressed after released left + * 9 repressed right - right pressed after released right + * 10 pressed both - both pressed, not emulating middle + * + * At each state, we need handlers for the following events + * 0: no buttons down + * 1: left button down + * 2: right button down + * 3: both buttons down + * 4: emulate3Timeout passed without a button change + * Note that button events are not deltas, they are the set of buttons being + * pressed now. It's possible (ie, mouse hardware does it) to go from (eg) + * left down to right down without anything in between, so all cases must be + * handled. + * + * a handler consists of three values: + * 0: action1 + * 1: action2 + * 2: new emulation state + * + * action > 0: ButtonPress + * action = 0: nothing + * action < 0: ButtonRelease + * + * The comment preceeding each section is the current emulation state. + * The comments to the right are of the form + * <button state> (<events>) -> <new emulation state> + * which should be read as + * If the buttons are in <button state>, generate <events> then go to + * <new emulation state>. + */ +static signed char stateTab[11][5][3] = { +/* 0 ground */ + { + { 0, 0, 0 }, /* nothing -> ground (no change) */ + { 0, 0, 1 }, /* left -> delayed left */ + { 0, 0, 2 }, /* right -> delayed right */ + { 2, 0, 3 }, /* left & right (middle press) -> pressed middle */ + { 0, 0, -1 } /* timeout N/A */ + }, +/* 1 delayed left */ + { + { 1, -1, 0 }, /* nothing (left event) -> ground */ + { 0, 0, 1 }, /* left -> delayed left (no change) */ + { 1, -1, 2 }, /* right (left event) -> delayed right */ + { 2, 0, 3 }, /* left & right (middle press) -> pressed middle */ + { 1, 0, 4 }, /* timeout (left press) -> pressed left */ + }, +/* 2 delayed right */ + { + { 3, -3, 0 }, /* nothing (right event) -> ground */ + { 3, -3, 1 }, /* left (right event) -> delayed left (no change) */ + { 0, 0, 2 }, /* right -> delayed right (no change) */ + { 2, 0, 3 }, /* left & right (middle press) -> pressed middle */ + { 3, 0, 5 }, /* timeout (right press) -> pressed right */ + }, +/* 3 pressed middle */ + { + { -2, 0, 0 }, /* nothing (middle release) -> ground */ + { 0, 0, 7 }, /* left -> released right */ + { 0, 0, 6 }, /* right -> released left */ + { 0, 0, 3 }, /* left & right -> pressed middle (no change) */ + { 0, 0, -1 }, /* timeout N/A */ + }, +/* 4 pressed left */ + { + { -1, 0, 0 }, /* nothing (left release) -> ground */ + { 0, 0, 4 }, /* left -> pressed left (no change) */ + { -1, 0, 2 }, /* right (left release) -> delayed right */ + { 3, 0, 10 }, /* left & right (right press) -> pressed both */ + { 0, 0, -1 }, /* timeout N/A */ + }, +/* 5 pressed right */ + { + { -3, 0, 0 }, /* nothing (right release) -> ground */ + { -3, 0, 1 }, /* left (right release) -> delayed left */ + { 0, 0, 5 }, /* right -> pressed right (no change) */ + { 1, 0, 10 }, /* left & right (left press) -> pressed both */ + { 0, 0, -1 }, /* timeout N/A */ + }, +/* 6 released left */ + { + { -2, 0, 0 }, /* nothing (middle release) -> ground */ + { -2, 0, 1 }, /* left (middle release) -> delayed left */ + { 0, 0, 6 }, /* right -> released left (no change) */ + { 1, 0, 8 }, /* left & right (left press) -> repressed left */ + { 0, 0, -1 }, /* timeout N/A */ + }, +/* 7 released right */ + { + { -2, 0, 0 }, /* nothing (middle release) -> ground */ + { 0, 0, 7 }, /* left -> released right (no change) */ + { -2, 0, 2 }, /* right (middle release) -> delayed right */ + { 3, 0, 9 }, /* left & right (right press) -> repressed right */ + { 0, 0, -1 }, /* timeout N/A */ + }, +/* 8 repressed left */ + { + { -2, -1, 0 }, /* nothing (middle release, left release) -> ground */ + { -2, 0, 4 }, /* left (middle release) -> pressed left */ + { -1, 0, 6 }, /* right (left release) -> released left */ + { 0, 0, 8 }, /* left & right -> repressed left (no change) */ + { 0, 0, -1 }, /* timeout N/A */ + }, +/* 9 repressed right */ + { + { -2, -3, 0 }, /* nothing (middle release, right release) -> ground */ + { -3, 0, 7 }, /* left (right release) -> released right */ + { -2, 0, 5 }, /* right (middle release) -> pressed right */ + { 0, 0, 9 }, /* left & right -> repressed right (no change) */ + { 0, 0, -1 }, /* timeout N/A */ + }, +/* 10 pressed both */ + { + { -1, -3, 0 }, /* nothing (left release, right release) -> ground */ + { -3, 0, 4 }, /* left (right release) -> pressed left */ + { -1, 0, 5 }, /* right (left release) -> pressed right */ + { 0, 0, 10 }, /* left & right -> pressed both (no change) */ + { 0, 0, -1 }, /* timeout N/A */ + }, +}; + +/* + * Table to allow quick reversal of natural button mapping to correct mapping + */ + +/* + * [JCH-96/01/21] The ALPS GlidePoint pad extends the MS protocol + * with a fourth button activated by tapping the PAD. + * The 2nd line corresponds to 4th button on; the drv sends + * the buttons in the following map (MSBit described first) : + * 0 | 4th | 1st | 2nd | 3rd + * And we remap them (MSBit described first) : + * 0 | 4th | 3rd | 2nd | 1st + */ +static char reverseMap[16] = { 0, 4, 2, 6, + 1, 5, 3, 7, + 8, 12, 10, 14, + 9, 13, 11, 15 }; + +static char hitachMap[16] = { 0, 2, 1, 3, + 8, 10, 9, 11, + 4, 6, 5, 7, + 12, 14, 13, 15 }; + +#define reverseBits(map, b) (((b) & ~0x0f) | map[(b) & 0x0f]) + +static CARD32 +buttonTimer(InputInfoPtr pInfo) +{ + MouseDevPtr pMse; + int sigstate; + int id; + + pMse = pInfo->private; + + sigstate = xf86BlockSIGIO (); + + pMse->emulate3Pending = FALSE; + if ((id = stateTab[pMse->emulateState][4][0]) != 0) { + xf86PostButtonEvent(pInfo->dev, 0, abs(id), (id >= 0), 0, 0); + pMse->emulateState = stateTab[pMse->emulateState][4][2]; + } else { + ErrorF("Got unexpected buttonTimer in state %d\n", pMse->emulateState); + } + + xf86UnblockSIGIO (sigstate); + return 0; +} + +static Bool +Emulate3ButtonsSoft(InputInfoPtr pInfo) +{ + MouseDevPtr pMse = pInfo->private; + + if (!pMse->emulate3ButtonsSoft) + return TRUE; + + pMse->emulate3Buttons = FALSE; + + if (pMse->emulate3Pending) + buttonTimer(pInfo); + + xf86Msg(X_INFO,"3rd Button detected: disabling emulate3Button\n"); + + return FALSE; +} + +static void MouseBlockHandler(pointer data, + struct timeval **waitTime, + pointer LastSelectMask) +{ + InputInfoPtr pInfo = (InputInfoPtr) data; + MouseDevPtr pMse = (MouseDevPtr) pInfo->private; + int ms; + + if (pMse->emulate3Pending) + { + ms = pMse->emulate3Expires - GetTimeInMillis (); + if (ms <= 0) + ms = 0; + AdjustWaitForDelay (waitTime, ms); + } +} + +static void MouseWakeupHandler(pointer data, + int i, + pointer LastSelectMask) +{ + InputInfoPtr pInfo = (InputInfoPtr) data; + MouseDevPtr pMse = (MouseDevPtr) pInfo->private; + int ms; + + if (pMse->emulate3Pending) + { + ms = pMse->emulate3Expires - GetTimeInMillis (); + if (ms <= 0) + buttonTimer (pInfo); + } +} + +/******************************************************************* + * + * Post mouse events + * + *******************************************************************/ + +static void +MouseDoPostEvent(InputInfoPtr pInfo, int buttons, int dx, int dy) +{ + MouseDevPtr pMse; + int emulateButtons; + int id, change; + int emuWheelDelta, emuWheelButton, emuWheelButtonMask; + int wheelButtonMask; + int ms; + + pMse = pInfo->private; + + change = buttons ^ pMse->lastMappedButtons; + pMse->lastMappedButtons = buttons; + + /* Do single button double click */ + if (pMse->doubleClickSourceButtonMask) { + if (buttons & pMse->doubleClickSourceButtonMask) { + if (!(pMse->doubleClickOldSourceState)) { + /* double-click button has just been pressed. Ignore it if target button + * is already down. + */ + if (!(buttons & pMse->doubleClickTargetButtonMask)) { + /* Target button isn't down, so send a double-click */ + xf86PostButtonEvent(pInfo->dev, 0, pMse->doubleClickTargetButton, 1, 0, 0); + xf86PostButtonEvent(pInfo->dev, 0, pMse->doubleClickTargetButton, 0, 0, 0); + xf86PostButtonEvent(pInfo->dev, 0, pMse->doubleClickTargetButton, 1, 0, 0); + xf86PostButtonEvent(pInfo->dev, 0, pMse->doubleClickTargetButton, 0, 0, 0); + } + } + pMse->doubleClickOldSourceState = 1; + } + else + pMse->doubleClickOldSourceState = 0; + + /* Whatever happened, mask the double-click button so it doesn't get + * processed as a normal button as well. + */ + buttons &= ~(pMse->doubleClickSourceButtonMask); + change &= ~(pMse->doubleClickSourceButtonMask); + } + + if (pMse->emulateWheel) { + /* Emulate wheel button handling */ + wheelButtonMask = 1 << (pMse->wheelButton - 1); + + if (change & wheelButtonMask) { + if (buttons & wheelButtonMask) { + /* Start timeout handling */ + pMse->wheelButtonExpires = GetTimeInMillis () + pMse->wheelButtonTimeout; + ms = - pMse->wheelButtonTimeout; + } else { + ms = pMse->wheelButtonExpires - GetTimeInMillis (); + + if (0 < ms) { + /* + * If the button is released early enough emit the button + * press/release events + */ + xf86PostButtonEvent(pInfo->dev, 0, pMse->wheelButton, 1, 0, 0); + xf86PostButtonEvent(pInfo->dev, 0, pMse->wheelButton, 0, 0, 0); + } + } + } else + ms = pMse->wheelButtonExpires - GetTimeInMillis (); + + /* Intercept wheel emulation. */ + if (buttons & wheelButtonMask) { + if (ms <= 0) { + /* Y axis movement */ + if (pMse->negativeY != MSE_NOAXISMAP) { + pMse->wheelYDistance += dy; + if (pMse->wheelYDistance < 0) { + emuWheelDelta = -pMse->wheelInertia; + emuWheelButton = pMse->negativeY; + } else { + emuWheelDelta = pMse->wheelInertia; + emuWheelButton = pMse->positiveY; + } + emuWheelButtonMask = 1 << (emuWheelButton - 1); + while (abs(pMse->wheelYDistance) > pMse->wheelInertia) { + pMse->wheelYDistance -= emuWheelDelta; + + /* + * Synthesize the press and release, but not when + * the button to be synthesized is already pressed + * "for real". + */ + if (!(emuWheelButtonMask & buttons) || + (emuWheelButtonMask & wheelButtonMask)) { + xf86PostButtonEvent(pInfo->dev, 0, emuWheelButton, 1, 0, 0); + xf86PostButtonEvent(pInfo->dev, 0, emuWheelButton, 0, 0, 0); + } + } + } + + /* X axis movement */ + if (pMse->negativeX != MSE_NOAXISMAP) { + pMse->wheelXDistance += dx; + if (pMse->wheelXDistance < 0) { + emuWheelDelta = -pMse->wheelInertia; + emuWheelButton = pMse->negativeX; + } else { + emuWheelDelta = pMse->wheelInertia; + emuWheelButton = pMse->positiveX; + } + emuWheelButtonMask = 1 << (emuWheelButton - 1); + while (abs(pMse->wheelXDistance) > pMse->wheelInertia) { + pMse->wheelXDistance -= emuWheelDelta; + + /* + * Synthesize the press and release, but not when + * the button to be synthesized is already pressed + * "for real". + */ + if (!(emuWheelButtonMask & buttons) || + (emuWheelButtonMask & wheelButtonMask)) { + xf86PostButtonEvent(pInfo->dev, 0, emuWheelButton, 1, 0, 0); + xf86PostButtonEvent(pInfo->dev, 0, emuWheelButton, 0, 0, 0); + } + } + } + } + + /* Absorb the mouse movement while the wheel button is pressed. */ + dx = 0; + dy = 0; + } + /* + * Button events for the wheel button are only emitted through + * the timeout code. + */ + buttons &= ~wheelButtonMask; + change &= ~wheelButtonMask; + } + + if (pMse->emulate3ButtonsSoft && pMse->emulate3Pending && (dx || dy)) + buttonTimer(pInfo); + + if (dx || dy) + xf86PostMotionEvent(pInfo->dev, 0, 0, 2, dx, dy); + + if (change) { + + /* + * adjust buttons state for drag locks! + * if there is drag locks + */ + if (pMse->pDragLock) { + DragLockPtr pLock; + int tarOfGoingDown, tarOfDown; + int realbuttons; + + /* get drag lock block */ + pLock = pMse->pDragLock; + /* save real buttons */ + realbuttons = buttons; + + /* if drag lock used */ + + /* state of drag lock buttons not seen always up */ + + buttons &= ~pLock->lockButtonsM; + + /* + * if lock buttons being depressed changes state of + * targets simulatedDown. + */ + tarOfGoingDown = lock2targetMap(pLock, + realbuttons & change & pLock->lockButtonsM); + pLock->simulatedDown ^= tarOfGoingDown; + + /* targets of drag locks down */ + tarOfDown = lock2targetMap(pLock, + realbuttons & pLock->lockButtonsM); + + /* + * when simulatedDown set and target pressed, + * simulatedDown goes false + */ + pLock->simulatedDown &= ~(realbuttons & change); + + /* + * if master drag lock released + * then master drag lock state on + */ + pLock->masterTS |= (~realbuttons & change) & pLock->masterLockM; + + /* if master state, buttons going down are simulatedDown */ + if (pLock->masterTS) + pLock->simulatedDown |= (realbuttons & change); + + /* if any button pressed, no longer in master drag lock state */ + if (realbuttons & change) + pLock->masterTS = 0; + + /* if simulatedDown or drag lock down, simulate down */ + buttons |= (pLock->simulatedDown | tarOfDown); + + /* master button not seen */ + buttons &= ~(pLock->masterLockM); + + /* buttons changed since last time */ + change = buttons ^ pLock->lockLastButtons; + + /* save this time for next last time. */ + pLock->lockLastButtons = buttons; + } + + if (pMse->emulate3Buttons + && (!(buttons & 0x02) || Emulate3ButtonsSoft(pInfo))) { + + /* handle all but buttons 1 & 3 normally */ + + change &= ~05; + + /* emulate the third button by the other two */ + + emulateButtons = (buttons & 01) | ((buttons &04) >> 1); + + if ((id = stateTab[pMse->emulateState][emulateButtons][0]) != 0) + xf86PostButtonEvent(pInfo->dev, 0, abs(id), (id >= 0), 0, 0); + if ((id = stateTab[pMse->emulateState][emulateButtons][1]) != 0) + xf86PostButtonEvent(pInfo->dev, 0, abs(id), (id >= 0), 0, 0); + + pMse->emulateState = + stateTab[pMse->emulateState][emulateButtons][2]; + + if (stateTab[pMse->emulateState][4][0] != 0) { + pMse->emulate3Expires = GetTimeInMillis () + pMse->emulate3Timeout; + pMse->emulate3Pending = TRUE; + } else { + pMse->emulate3Pending = FALSE; + } + } + + while (change) { + id = ffs(change); + change &= ~(1 << (id - 1)); + xf86PostButtonEvent(pInfo->dev, 0, id, + (buttons & (1 << (id - 1))), 0, 0); + } + + } +} + +static void +MousePostEvent(InputInfoPtr pInfo, int truebuttons, + int dx, int dy, int dz, int dw) +{ + MouseDevPtr pMse; + int zbutton = 0, wbutton = 0, zbuttoncount = 0, wbuttoncount = 0; + int i, b, buttons = 0; + + pMse = pInfo->private; + if (pMse->protocolID == PROT_MMHIT) + b = reverseBits(hitachMap, truebuttons); + else + b = reverseBits(reverseMap, truebuttons); + + /* Remap mouse buttons */ + b &= (1<<MSE_MAXBUTTONS)-1; + for (i = 0; b; i++) { + if (b & 1) + buttons |= pMse->buttonMap[i]; + b >>= 1; + } + + /* Map the Z axis movement. */ + /* XXX Could this go in the conversion_proc? */ + switch (pMse->negativeZ) { + case MSE_NOZMAP: /* do nothing */ + dz = 0; + break; + case MSE_MAPTOX: + if (dz != 0) { + dx = dz; + dz = 0; + } + break; + case MSE_MAPTOY: + if (dz != 0) { + dy = dz; + dz = 0; + } + break; + default: /* buttons */ + buttons &= ~(pMse->negativeZ | pMse->positiveZ); + if (dz < 0) { + zbutton = pMse->negativeZ; + zbuttoncount = -dz; + } else if (dz > 0) { + zbutton = pMse->positiveZ; + zbuttoncount = dz; + } + dz = 0; + break; + } + switch (pMse->negativeW) { + case MSE_NOZMAP: /* do nothing */ + dw = 0; + break; + case MSE_MAPTOX: + if (dw != 0) { + dx = dw; + dw = 0; + } + break; + case MSE_MAPTOY: + if (dw != 0) { + dy = dw; + dw = 0; + } + break; + default: /* buttons */ + buttons &= ~(pMse->negativeW | pMse->positiveW); + if (dw < 0) { + wbutton = pMse->negativeW; + wbuttoncount = -dw; + } else if (dw > 0) { + wbutton = pMse->positiveW; + wbuttoncount = dw; + } + dw = 0; + break; + } + + + /* Apply angle offset */ + if (pMse->angleOffset != 0) { + double rad = 3.141592653 * pMse->angleOffset / 180.0; + int ndx = dx; + dx = (int)((dx * cos(rad)) + (dy * sin(rad)) + 0.5); + dy = (int)((dy * cos(rad)) - (ndx * sin(rad)) + 0.5); + } + + dx = pMse->invX * dx; + dy = pMse->invY * dy; + if (pMse->flipXY) { + int tmp = dx; + dx = dy; + dy = tmp; + } + + /* If mouse wheel movement has to be mapped on a button, we need to + * loop for button press and release events. */ + do { + MouseDoPostEvent(pInfo, buttons | zbutton | wbutton, dx, dy); + dx = dy = 0; + if (zbutton || wbutton) + MouseDoPostEvent(pInfo, buttons, 0, 0); + if (--zbuttoncount <= 0) + zbutton = 0; + if (--wbuttoncount <= 0) + wbutton = 0; + } while (zbutton || wbutton); + + pMse->lastButtons = truebuttons; +} +/****************************************************************** + * + * Mouse Setup Code + * + ******************************************************************/ +/* + * This array is indexed by the MouseProtocolID values, so the order of the + * entries must match that of the MouseProtocolID enum in xf86OSmouse.h. + */ +static unsigned char proto[PROT_NUMPROTOS][8] = { + /* --header-- ---data--- packet -4th-byte- mouse */ + /* mask id mask id bytes mask id flags */ + /* Serial mice */ + { 0x40, 0x40, 0x40, 0x00, 3, ~0x23, 0x00, MPF_NONE }, /* MicroSoft */ + { 0xf8, 0x80, 0x00, 0x00, 5, 0x00, 0xff, MPF_SAFE }, /* MouseSystems */ + { 0xe0, 0x80, 0x80, 0x00, 3, 0x00, 0xff, MPF_NONE }, /* MMSeries */ + { 0xe0, 0x80, 0x80, 0x00, 3, 0x00, 0xff, MPF_NONE }, /* Logitech */ + { 0x40, 0x40, 0x40, 0x00, 3, ~0x23, 0x00, MPF_NONE }, /* MouseMan */ + { 0xe0, 0x80, 0x80, 0x00, 3, 0x00, 0xff, MPF_NONE }, /* MM_HitTablet */ + { 0x40, 0x40, 0x40, 0x00, 3, ~0x33, 0x00, MPF_NONE }, /* GlidePoint */ + { 0x40, 0x40, 0x40, 0x00, 3, ~0x3f, 0x00, MPF_NONE }, /* IntelliMouse */ + { 0x40, 0x40, 0x40, 0x00, 3, ~0x33, 0x00, MPF_NONE }, /* ThinkingMouse */ + { 0x80, 0x80, 0x80, 0x00, 3, 0x00, 0xff, MPF_NONE }, /* ACECAD */ + { 0x40, 0x40, 0x40, 0x00, 4, 0x00, 0xff, MPF_NONE }, /* ValuMouseScroll */ + /* PS/2 variants */ + { 0xc0, 0x00, 0x00, 0x00, 3, 0x00, 0xff, MPF_NONE }, /* PS/2 mouse */ + { 0xc8, 0x08, 0x00, 0x00, 3, 0x00, 0x00, MPF_NONE }, /* genericPS/2 mouse*/ + { 0x08, 0x08, 0x00, 0x00, 4, 0x00, 0xff, MPF_NONE }, /* IntelliMouse */ + { 0x08, 0x08, 0x00, 0x00, 4, 0x00, 0xff, MPF_NONE }, /* Explorer */ + { 0x80, 0x80, 0x00, 0x00, 3, 0x00, 0xff, MPF_NONE }, /* ThinkingMouse */ + { 0x08, 0x08, 0x00, 0x00, 3, 0x00, 0xff, MPF_NONE }, /* MouseMan+ */ + { 0xc0, 0x00, 0x00, 0x00, 3, 0x00, 0xff, MPF_NONE }, /* GlidePoint */ + { 0x08, 0x08, 0x00, 0x00, 4, 0x00, 0xff, MPF_NONE }, /* NetMouse */ + { 0xc0, 0x00, 0x00, 0x00, 6, 0x00, 0xff, MPF_NONE }, /* NetScroll */ + /* Bus Mouse */ + { 0xf8, 0x80, 0x00, 0x00, 5, 0x00, 0xff, MPF_NONE }, /* BusMouse */ + { 0xf8, 0x80, 0x00, 0x00, 5, 0x00, 0xff, MPF_NONE }, /* Auto (dummy) */ + { 0xf8, 0x80, 0x00, 0x00, 8, 0x00, 0xff, MPF_NONE }, /* SysMouse */ +}; + + +/* + * SetupMouse -- + * Sets up the mouse parameters + */ +static Bool +SetupMouse(InputInfoPtr pInfo) +{ + MouseDevPtr pMse; + int i; + int protoPara[8] = {-1, -1, -1, -1, -1, -1, -1, -1}; + const char *name = NULL; + Bool automatic = FALSE; + + pMse = pInfo->private; + + /* Handle the "Auto" protocol. */ + if (pMse->protocolID == PROT_AUTO) { + /* + * We come here when user specifies protocol "auto" in + * the configuration file or thru the xf86misc extensions. + * So we initialize autoprobing here. + * Probe for PnP/OS mouse first. If unsuccessful + * try to guess protocol from incoming data. + */ + automatic = TRUE; + pMse->autoProbe = TRUE; + name = autoOSProtocol(pInfo,protoPara); + if (name) { +#ifdef EXTMOUSEDEBUG + ErrorF("PnP/OS Mouse detected: %s\n",name); +#endif + } + } + + SetMouseProto(pMse, pMse->protocolID); + + if (automatic) { + if (name) { + /* Possible protoPara overrides from SetupAuto. */ + for (i = 0; i < sizeof(pMse->protoPara); i++) + if (protoPara[i] != -1) + pMse->protoPara[i] = protoPara[i]; + /* if we come here PnP/OS mouse probing was successful */ + } else { +#if 1 + /* PnP/OS mouse probing wasn't successful; we look at data */ +#else + xf86Msg(X_ERROR, "%s: cannot determine the mouse protocol\n", + pInfo->name); + return FALSE; +#endif + } + } + + /* + * If protocol has changed fetch the default options + * for the new protocol. + */ + if (pMse->oldProtocolID != pMse->protocolID) { + pointer tmp = NULL; + if ((pMse->protocolID >= 0) + && (pMse->protocolID < PROT_NUMPROTOS) + && mouseProtocols[pMse->protocolID].defaults) + tmp = xf86OptionListCreate( + mouseProtocols[pMse->protocolID].defaults, -1, 0); + pInfo->options = xf86OptionListMerge(pInfo->options, tmp); + /* + * If baudrate is set write it back to the option + * list so that the serial interface code can access + * the new value. Not set means default. + */ + if (pMse->baudRate) + xf86ReplaceIntOption(pInfo->options, "BaudRate", pMse->baudRate); + pMse->oldProtocolID = pMse->protocolID; /* hack */ + } + + + /* Set the port parameters. */ + if (!automatic) + xf86SetSerial(pInfo->fd, pInfo->options); + + if (!initMouseHW(pInfo)) + return FALSE; + + pMse->protoBufTail = 0; + pMse->inSync = 0; + + return TRUE; +} + +/******************************************************************** + * + * Mouse HW setup code + * + ********************************************************************/ + +/* +** The following lines take care of the Logitech MouseMan protocols. +** The "Logitech" protocol is for the old "series 9" Logitech products. +** All products since then use the "MouseMan" protocol. Some models +** were programmable, but most (all?) of the current models are not. +** +** NOTE: There are different versions of both MouseMan and TrackMan! +** Hence I add another protocol PROT_LOGIMAN, which the user can +** specify as MouseMan in his XF86Config file. This entry was +** formerly handled as a special case of PROT_MS. However, people +** who don't have the middle button problem, can still specify +** Microsoft and use PROT_MS. +** +** By default, these mice should use a 3 byte Microsoft protocol +** plus a 4th byte for the middle button. However, the mouse might +** have switched to a different protocol before we use it, so I send +** the proper sequence just in case. +** +** NOTE: - all commands to (at least the European) MouseMan have to +** be sent at 1200 Baud. +** - each command starts with a '*'. +** - whenever the MouseMan receives a '*', it will switch back +** to 1200 Baud. Hence I have to select the desired protocol +** first, then select the baud rate. +** +** The protocols supported by the (European) MouseMan are: +** - 5 byte packed binary protocol, as with the Mouse Systems +** mouse. Selected by sequence "*U". +** - 2 button 3 byte MicroSoft compatible protocol. Selected +** by sequence "*V". +** - 3 button 3+1 byte MicroSoft compatible protocol (default). +** Selected by sequence "*X". +** +** The following baud rates are supported: +** - 1200 Baud (default). Selected by sequence "*n". +** - 9600 Baud. Selected by sequence "*q". +** +** Selecting a sample rate is no longer supported with the MouseMan! +** [CHRIS-211092] +*/ + +/* + * Do a reset wrap mode before reset. + */ +#define do_ps2Reset(x) { \ + int i = RETRY_COUNT;\ + while (i-- > 0) { \ + xf86FlushInput(x->fd); \ + if (ps2Reset(x)) break; \ + } \ + } + + +static Bool +initMouseHW(InputInfoPtr pInfo) +{ + MouseDevPtr pMse = pInfo->private; + const char *s; + unsigned char c; + int speed; + pointer options; + unsigned char *param = NULL; + int paramlen = 0; + int count = RETRY_COUNT; + Bool ps2Init = TRUE; + + switch (pMse->protocolID) { + case PROT_LOGI: /* Logitech Mice */ + /* + * The baud rate selection command must be sent at the current + * baud rate; try all likely settings. + */ + speed = pMse->baudRate; + switch (speed) { + case 9600: + s = "*q"; + break; + case 4800: + s = "*p"; + break; + case 2400: + s = "*o"; + break; + case 1200: + s = "*n"; + break; + default: + /* Fallback value */ + speed = 1200; + s = "*n"; + } + xf86SetSerialSpeed(pInfo->fd, 9600); + xf86WriteSerial(pInfo->fd, s, 2); + usleep(100000); + xf86SetSerialSpeed(pInfo->fd, 4800); + xf86WriteSerial(pInfo->fd, s, 2); + usleep(100000); + xf86SetSerialSpeed(pInfo->fd, 2400); + xf86WriteSerial(pInfo->fd, s, 2); + usleep(100000); + xf86SetSerialSpeed(pInfo->fd, 1200); + xf86WriteSerial(pInfo->fd, s, 2); + usleep(100000); + xf86SetSerialSpeed(pInfo->fd, speed); + + /* Select MM series data format. */ + xf86WriteSerial(pInfo->fd, "S", 1); + usleep(100000); + /* Set the parameters up for the MM series protocol. */ + options = pInfo->options; + xf86CollectInputOptions(pInfo, mmDefaults, NULL); + xf86SetSerial(pInfo->fd, pInfo->options); + pInfo->options = options; + + /* Select report rate/frequency. */ + if (pMse->sampleRate <= 0) c = 'O'; /* 100 */ + else if (pMse->sampleRate <= 15) c = 'J'; /* 10 */ + else if (pMse->sampleRate <= 27) c = 'K'; /* 20 */ + else if (pMse->sampleRate <= 42) c = 'L'; /* 35 */ + else if (pMse->sampleRate <= 60) c = 'R'; /* 50 */ + else if (pMse->sampleRate <= 85) c = 'M'; /* 67 */ + else if (pMse->sampleRate <= 125) c = 'Q'; /* 100 */ + else c = 'N'; /* 150 */ + xf86WriteSerial(pInfo->fd, &c, 1); + break; + + case PROT_LOGIMAN: + speed = pMse->baudRate; + switch (speed) { + case 9600: + s = "*q"; + break; + case 1200: + s = "*n"; + break; + default: + /* Fallback value */ + speed = 1200; + s = "*n"; + } + xf86SetSerialSpeed(pInfo->fd, 1200); + xf86WriteSerial(pInfo->fd, "*n", 2); + xf86WriteSerial(pInfo->fd, "*X", 2); + xf86WriteSerial(pInfo->fd, s, 2); + usleep(100000); + xf86SetSerialSpeed(pInfo->fd, speed); + break; + + case PROT_MMHIT: /* MM_HitTablet */ + /* + * Initialize Hitachi PUMA Plus - Model 1212E to desired settings. + * The tablet must be configured to be in MM mode, NO parity, + * Binary Format. pMse->sampleRate controls the sensitivity + * of the tablet. We only use this tablet for it's 4-button puck + * so we don't run in "Absolute Mode". + */ + xf86WriteSerial(pInfo->fd, "z8", 2); /* Set Parity = "NONE" */ + usleep(50000); + xf86WriteSerial(pInfo->fd, "zb", 2); /* Set Format = "Binary" */ + usleep(50000); + xf86WriteSerial(pInfo->fd, "@", 1); /* Set Report Mode = "Stream" */ + usleep(50000); + xf86WriteSerial(pInfo->fd, "R", 1); /* Set Output Rate = "45 rps" */ + usleep(50000); + xf86WriteSerial(pInfo->fd, "I\x20", 2); /* Set Incrememtal Mode "20" */ + usleep(50000); + xf86WriteSerial(pInfo->fd, "E", 1); /* Set Data Type = "Relative */ + usleep(50000); + /* + * These sample rates translate to 'lines per inch' on the Hitachi + * tablet. + */ + if (pMse->sampleRate <= 40) c = 'g'; + else if (pMse->sampleRate <= 100) c = 'd'; + else if (pMse->sampleRate <= 200) c = 'e'; + else if (pMse->sampleRate <= 500) c = 'h'; + else if (pMse->sampleRate <= 1000) c = 'j'; + else c = 'd'; + xf86WriteSerial(pInfo->fd, &c, 1); + usleep(50000); + xf86WriteSerial(pInfo->fd, "\021", 1); /* Resume DATA output */ + break; + + case PROT_THINKING: /* ThinkingMouse */ + /* This mouse may send a PnP ID string, ignore it. */ + usleep(200000); + xf86FlushInput(pInfo->fd); + /* Send the command to initialize the beast. */ + for (s = "E5E5"; *s; ++s) { + xf86WriteSerial(pInfo->fd, s, 1); + if ((xf86WaitForInput(pInfo->fd, 1000000) <= 0)) + break; + xf86ReadSerial(pInfo->fd, &c, 1); + if (c != *s) + break; + } + break; + + case PROT_MSC: /* MouseSystems Corp */ + usleep(100000); + xf86FlushInput(pInfo->fd); + break; + + case PROT_ACECAD: + /* initialize */ + /* A nul character resets. */ + xf86WriteSerial(pInfo->fd, "", 1); + usleep(50000); + /* Stream out relative mode high resolution increments of 1. */ + xf86WriteSerial(pInfo->fd, "@EeI!", 5); + break; + + case PROT_BM: /* bus/InPort mouse */ + if (osInfo->SetBMRes) + osInfo->SetBMRes(pInfo, pMse->protocol, pMse->sampleRate, + pMse->resolution); + break; + + case PROT_GENPS2: + ps2Init = FALSE; + break; + + case PROT_PS2: + case PROT_GLIDEPS2: + break; + + case PROT_IMPS2: /* IntelliMouse */ + { + static unsigned char seq[] = { 243, 200, 243, 100, 243, 80 }; + param = seq; + paramlen = sizeof(seq); + } + break; + + case PROT_EXPPS2: /* IntelliMouse Explorer */ + { + static unsigned char seq[] = { 243, 200, 243, 100, 243, 80, + 243, 200, 243, 200, 243, 80 }; + + param = seq; + paramlen = sizeof(seq); + } + break; + + case PROT_NETPS2: /* NetMouse, NetMouse Pro, Mie Mouse */ + case PROT_NETSCPS2: /* NetScroll */ + { + static unsigned char seq[] = { 232, 3, 230, 230, 230, 233 }; + + param = seq; + paramlen = sizeof(seq); + } + break; + + case PROT_MMPS2: /* MouseMan+, FirstMouse+ */ + { + static unsigned char seq[] = { 230, 232, 0, 232, 3, 232, 2, 232, 1, + 230, 232, 3, 232, 1, 232, 2, 232, 3 }; + param = seq; + paramlen = sizeof(seq); + } + break; + + case PROT_THINKPS2: /* ThinkingMouse */ + { + static unsigned char seq[] = { 243, 10, 232, 0, 243, 20, 243, 60, + 243, 40, 243, 20, 243, 20, 243, 60, + 243, 40, 243, 20, 243, 20 }; + param = seq; + paramlen = sizeof(seq); + } + break; + case PROT_SYSMOUSE: + if (osInfo->SetMiscRes) + osInfo->SetMiscRes(pInfo, pMse->protocol, pMse->sampleRate, + pMse->resolution); + break; + + default: + /* Nothing to do. */ + break; + } + + if (pMse->class & (MSE_PS2 | MSE_XPS2)) { + /* + * If one part of the PS/2 mouse initialization fails + * redo complete initialization. There are mice which + * have occasional problems with initialization and + * are in an unknown state. + */ + if (ps2Init) { + REDO: + do_ps2Reset(pInfo); + if (paramlen > 0) { + if (!ps2SendPacket(pInfo,param,paramlen)) { + usleep(30000); + xf86FlushInput(pInfo->fd); + if (!count--) + return TRUE; + goto REDO; + } + ps2GetDeviceID(pInfo); + usleep(30000); + xf86FlushInput(pInfo->fd); + } + + if (osInfo->SetPS2Res) { + osInfo->SetPS2Res(pInfo, pMse->protocol, pMse->sampleRate, + pMse->resolution); + } else { + unsigned char c2[2]; + + c = 0xE6; /*230*/ /* 1:1 scaling */ + if (!ps2SendPacket(pInfo,&c,1)) { + if (!count--) + return TRUE; + goto REDO; + } + c2[0] = 0xF3; /*243*/ /* set sampling rate */ + if (pMse->sampleRate > 0) { + if (pMse->sampleRate >= 200) + c2[1] = 200; + else if (pMse->sampleRate >= 100) + c2[1] = 100; + else if (pMse->sampleRate >= 80) + c2[1] = 80; + else if (pMse->sampleRate >= 60) + c2[1] = 60; + else if (pMse->sampleRate >= 40) + c2[1] = 40; + else + c2[1] = 20; + } else { + c2[1] = 100; + } + if (!ps2SendPacket(pInfo,c2,2)) { + if (!count--) + return TRUE; + goto REDO; + } + c2[0] = 0xE8; /*232*/ /* set device resolution */ + if (pMse->resolution > 0) { + if (pMse->resolution >= 200) + c2[1] = 3; + else if (pMse->resolution >= 100) + c2[1] = 2; + else if (pMse->resolution >= 50) + c2[1] = 1; + else + c2[1] = 0; + } else { + c2[1] = 3; /* used to be 2, W. uses 3 */ + } + if (!ps2SendPacket(pInfo,c2,2)) { + if (!count--) + return TRUE; + goto REDO; + } + usleep(30000); + xf86FlushInput(pInfo->fd); + if (!ps2EnableDataReporting(pInfo)) { + xf86Msg(X_INFO, "%s: ps2EnableDataReporting: failed\n", + pInfo->name); + xf86FlushInput(pInfo->fd); + if (!count--) + return TRUE; + goto REDO; + } else { + xf86Msg(X_INFO, "%s: ps2EnableDataReporting: succeeded\n", + pInfo->name); + } + } + /* + * The PS/2 reset handling needs to be rechecked. + * We need to wait until after the 4.3 release. + */ + } + } else { + if (paramlen > 0) { + if (xf86WriteSerial(pInfo->fd, param, paramlen) != paramlen) + xf86Msg(X_ERROR, "%s: Mouse initialization failed\n", + pInfo->name); + usleep(30000); + xf86FlushInput(pInfo->fd); + } + } + + return TRUE; +} + +#ifdef SUPPORT_MOUSE_RESET +static Bool +mouseReset(InputInfoPtr pInfo, unsigned char val) +{ + MouseDevPtr pMse = pInfo->private; + mousePrivPtr mousepriv = (mousePrivPtr)pMse->mousePriv; + CARD32 prevEvent = mousepriv->lastEvent; + Bool expectReset = FALSE; + Bool ret = FALSE; + + mousepriv->lastEvent = GetTimeInMillis(); + +#ifdef EXTMOUSEDEBUG + ErrorF("byte: 0x%x time: %li\n",val,mousepriv->lastEvent); +#endif + /* + * We believe that the following is true: + * When the mouse is replugged it will send a reset package + * It takes several seconds to replug a mouse: We don't see + * events for several seconds before we see the replug event package. + * There is no significant delay between consecutive bytes + * of a replug event package. + * There are no bytes sent after the replug event package until + * the mouse is reset. + */ + + if (mousepriv->current == 0 + && (mousepriv->lastEvent - prevEvent) < 4000) + return FALSE; + + if (mousepriv->current > 0 + && (mousepriv->lastEvent - prevEvent) >= 1000) { + mousepriv->inReset = FALSE; + mousepriv->current = 0; + return FALSE; + } + + if (mousepriv->inReset) + mousepriv->inReset = FALSE; + +#ifdef EXTMOUSEDEBUG + ErrorF("Mouse Current: %i 0x%x\n",mousepriv->current, val); +#endif + + /* here we put the mouse specific reset detction */ + /* They need to do three things: */ + /* Check if byte may be a reset byte */ + /* If so: Set expectReset TRUE */ + /* If convinced: Set inReset TRUE */ + /* Register BlockAndWakeupHandler */ + + /* PS/2 */ + { + unsigned char seq[] = { 0xaa, 0x00 }; + int len = sizeof(seq); + + if (seq[mousepriv->current] == val) + expectReset = TRUE; + + if (len == mousepriv->current + 1) { + mousepriv->inReset = TRUE; + mousepriv->expires = GetTimeInMillis() + 1000; + +#ifdef EXTMOUSEDEBUG + ErrorF("Found PS/2 Reset string\n"); +#endif + RegisterBlockAndWakeupHandlers (ps2BlockHandler, + ps2WakeupHandler, (pointer) pInfo); + ret = TRUE; + } + } + + if (!expectReset) + mousepriv->current = 0; + else + mousepriv->current++; + return ret; +} + +static void +ps2BlockHandler(pointer data, struct timeval **waitTime, + pointer LastSelectMask) +{ + InputInfoPtr pInfo = (InputInfoPtr) data; + MouseDevPtr pMse = (MouseDevPtr) pInfo->private; + mousePrivPtr mousepriv = (mousePrivPtr)pMse->mousePriv; + int ms; + + if (mousepriv->inReset) { + ms = mousepriv->expires - GetTimeInMillis (); + if (ms <= 0) + ms = 0; + AdjustWaitForDelay (waitTime, ms); + } else + RemoveBlockAndWakeupHandlers (ps2BlockHandler, ps2WakeupHandler, + (pointer) pInfo); +} + +static void +ps2WakeupHandler(pointer data, int i, pointer LastSelectMask) +{ + InputInfoPtr pInfo = (InputInfoPtr) data; + MouseDevPtr pMse = (MouseDevPtr) pInfo->private; + mousePrivPtr mousepriv = (mousePrivPtr)pMse->mousePriv; + int ms; + + if (mousepriv->inReset) { + unsigned char val; + int blocked; + + ms = mousepriv->expires - GetTimeInMillis(); + if (ms > 0) + return; + + blocked = xf86BlockSIGIO (); + + xf86MsgVerb(X_INFO,3, + "Got reinsert event: reinitializing PS/2 mouse\n"); + val = 0xf4; + if (xf86WriteSerial(pInfo->fd, &val, 1) != 1) + xf86Msg(X_ERROR, "%s: Write to mouse failed\n", + pInfo->name); + xf86UnblockSIGIO(blocked); + } + RemoveBlockAndWakeupHandlers (ps2BlockHandler, ps2WakeupHandler, + (pointer) pInfo); +} +#endif /* SUPPORT_MOUSE_RESET */ + +/************************************************************ + * + * Autoprobe stuff + * + ************************************************************/ +#ifdef EXTMOUSEDEBUG +# define AP_DBG(x) { ErrorF("Autoprobe: "); ErrorF x; } +# define AP_DBGC(x) ErrorF x ; +# else +# define AP_DBG(x) +# define AP_DBGC(x) +#endif + +MouseProtocolID hardProtocolList[] = { PROT_MSC, PROT_MM, PROT_LOGI, + PROT_LOGIMAN, PROT_MMHIT, + PROT_GLIDE, PROT_IMSERIAL, + PROT_THINKING, PROT_ACECAD, + PROT_THINKPS2, PROT_MMPS2, + PROT_GLIDEPS2, + PROT_NETSCPS2, PROT_EXPPS2,PROT_IMPS2, + PROT_GENPS2, PROT_NETPS2, + PROT_MS, + PROT_UNKNOWN +}; + +MouseProtocolID softProtocolList[] = { PROT_MSC, PROT_MM, PROT_LOGI, + PROT_LOGIMAN, PROT_MMHIT, + PROT_GLIDE, PROT_IMSERIAL, + PROT_THINKING, PROT_ACECAD, + PROT_THINKPS2, PROT_MMPS2, + PROT_GLIDEPS2, + PROT_NETSCPS2 ,PROT_IMPS2, + PROT_GENPS2, + PROT_MS, + PROT_UNKNOWN +}; + +static const char * +autoOSProtocol(InputInfoPtr pInfo, int *protoPara) +{ + MouseDevPtr pMse = pInfo->private; + const char *name = NULL; + MouseProtocolID protocolID = PROT_UNKNOWN; + + /* Check if the OS has a detection mechanism. */ + if (osInfo->SetupAuto) { + name = osInfo->SetupAuto(pInfo, protoPara); + if (name) { + protocolID = ProtocolNameToID(name); + switch (protocolID) { + case PROT_UNKNOWN: + /* Check for a builtin OS-specific protocol. */ + if (osInfo->CheckProtocol && osInfo->CheckProtocol(name)) { + /* We can only come here if the protocol has been + * changed to auto thru the xf86misc extension + * and we have detected an OS specific builtin + * protocol. Currently we cannot handle this */ + name = NULL; + } else + name = NULL; + break; + case PROT_UNSUP: + name = NULL; + break; + default: + break; + } + } + } + if (!name) { + /* A PnP serial mouse? */ + protocolID = MouseGetPnpProtocol(pInfo); + if (protocolID >= 0 && protocolID < PROT_NUMPROTOS) { + name = ProtocolIDToName(protocolID); + xf86Msg(X_PROBED, "%s: PnP-detected protocol: \"%s\"\n", + pInfo->name, name); + } + } + if (!name && HAVE_GUESS_PROTOCOL && osInfo->GuessProtocol) { + name = osInfo->GuessProtocol(pInfo, 0); + if (name) + protocolID = ProtocolNameToID(name); + } + + if (name) { + pMse->protocolID = protocolID; + } + + return name; +} + +/* + * createProtocolList() -- create a list of protocols which may + * match on the incoming data stream. + */ +static void +createProtoList(MouseDevPtr pMse, MouseProtocolID *protoList) +{ + int i, j, k = 0; + MouseProtocolID prot; + unsigned char *para; + mousePrivPtr mPriv = (mousePrivPtr)pMse->mousePriv; + MouseProtocolID *tmplist = NULL; + int blocked; + + AP_DBGC(("Autoprobe: ")); + for (i = 0; i < mPriv->count; i++) + AP_DBGC(("%2.2x ", (unsigned char) mPriv->data[i])); + AP_DBGC(("\n")); + + blocked = xf86BlockSIGIO (); + + /* create a private copy first so we can write in the old list */ + if ((tmplist = xalloc(sizeof(MouseProtocolID) * NUM_AUTOPROBE_PROTOS))){ + for (i = 0; protoList[i] != PROT_UNKNOWN; i++) { + tmplist[i] = protoList[i]; + } + tmplist[i] = PROT_UNKNOWN; + protoList = tmplist; + } else + return; + + for (i = 0; ((prot = protoList[i]) != PROT_UNKNOWN + && (k < NUM_AUTOPROBE_PROTOS - 1)) ; i++) { + Bool bad = TRUE; + unsigned char byte = 0; + int count = 0; + int next_header_candidate = 0; + int header_count = 0; + + if (!GetProtocol(prot)) + continue; + para = proto[prot]; + + AP_DBG(("Protocol: %s ", ProtocolIDToName(prot))); + +#ifdef EXTMOUSEDEBUG + for (j = 0; j < 7; j++) + AP_DBGC(("%2.2x ", (unsigned char) para[j])); + AP_DBGC(("\n")); +#endif + j = 0; + while (1) { + /* look for header */ + while (j < mPriv->count) { + if (((byte = mPriv->data[j++]) & para[0]) == para[1]){ + AP_DBG(("found header %2.2x\n",byte)); + next_header_candidate = j; + count = 1; + break; + } else { + /* + * Bail ot if number of bytes per package have + * been tested for header. + * Take bytes per package of leading garbage into + * account. + */ + if (j > para[4] && ++header_count > para[4]) { + j = mPriv->count; + break; + } + } + } + /* check if remaining data matches protocol */ + while (j < mPriv->count) { + byte = mPriv->data[j++]; + if (count == para[4]) { + count = 0; + /* check and eat excess byte */ + if (((byte & para[0]) != para[1]) + && ((byte & para[5]) == para[6])) { + AP_DBG(("excess byte found\n")); + continue; + } + } + if (count == 0) { + /* validate next header */ + bad = FALSE; + AP_DBG(("Complete set found\n")); + if ((byte & para[0]) != para[1]) { + AP_DBG(("Autoprobe: header bad\n")); + bad = TRUE; + break; + } else { + count++; + continue; + } + } + /* validate data */ + else if (((byte & para[2]) != para[3]) + || ((para[7] & MPF_SAFE) + && ((byte & para[0]) == para[1]))) { + AP_DBG(("data bad\n")); + bad = TRUE; + break; + } else { + count ++; + continue; + } + } + if (!bad) { + /* this is a matching protocol */ + mPriv->protoList[k++] = prot; + AP_DBG(("Autoprobe: Adding protocol %s to list (entry %i)\n", + ProtocolIDToName(prot),k-1)); + break; + } + j = next_header_candidate; + next_header_candidate = 0; + /* we have tested number of bytes per package for header */ + if (j > para[4] && ++header_count > para[4]) + break; + /* we have not found anything that looks like a header */ + if (!next_header_candidate) + break; + AP_DBG(("Looking for new header\n")); + } + } + + xf86UnblockSIGIO(blocked); + + mPriv->protoList[k] = PROT_UNKNOWN; + + xfree(tmplist); +} + + +/* This only needs to be done once */ +void **serialDefaultsList = NULL; + +/* + * createSerialDefaultsLists() - create a list of the different default + * settings for the serial interface of the known protocols. + */ +static void +createSerialDefaultsList(void) +{ + int i = 0, j, k; + + serialDefaultsList = (void **)xnfalloc(sizeof(void*)); + serialDefaultsList[0] = NULL; + + for (j = 0; mouseProtocols[j].name; j++) { + if (!mouseProtocols[j].defaults) + continue; + for (k = 0; k < i; k++) + if (mouseProtocols[j].defaults == serialDefaultsList[k]) + continue; + i++; + serialDefaultsList = (void**)xnfrealloc(serialDefaultsList, + sizeof(void*)*(i+1)); + serialDefaultsList[i-1] = mouseProtocols[j].defaults; + serialDefaultsList[i] = NULL; + } +} + +typedef enum { + STATE_INVALID, + STATE_UNCERTAIN, + STATE_VALID +} validState; + +/* Probing threshold values */ +#define PROBE_UNCERTAINTY 50 +#define BAD_CERTAINTY 6 +#define BAD_INC_CERTAINTY 1 +#define BAD_INC_CERTAINTY_WHEN_SYNC_LOST 2 + +static validState +validCount(mousePrivPtr mPriv, Bool inSync, Bool lostSync) +{ + if (inSync) { + if (!--mPriv->goodCount) { + /* we are sure to have found the correct protocol */ + mPriv->badCount = 0; + return STATE_VALID; + } + AP_DBG(("%i successful rounds to go\n", + mPriv->goodCount)); + return STATE_UNCERTAIN; + } + + + /* We are out of sync again */ + mPriv->goodCount = PROBE_UNCERTAINTY; + /* We increase uncertainty of having the correct protocol */ + mPriv->badCount+= lostSync ? BAD_INC_CERTAINTY_WHEN_SYNC_LOST + : BAD_INC_CERTAINTY; + + if (mPriv->badCount < BAD_CERTAINTY) { + /* We are not convinced yet to have the wrong protocol */ + AP_DBG(("Changing protocol after: %i rounds\n", + BAD_CERTAINTY - mPriv->badCount)); + return STATE_UNCERTAIN; + } + return STATE_INVALID; +} + +#define RESET_VALIDATION mPriv->goodCount = PROBE_UNCERTAINTY;\ + mPriv->badCount = 0;\ + mPriv->prevDx = 0;\ + mPriv->prevDy = 0;\ + mPriv->accDx = 0;\ + mPriv->accDy = 0;\ + mPriv->acc = 0; + +static void +autoProbeMouse(InputInfoPtr pInfo, Bool inSync, Bool lostSync) +{ + MouseDevPtr pMse = pInfo->private; + mousePrivPtr mPriv = (mousePrivPtr)pMse->mousePriv; + + MouseProtocolID *protocolList = NULL; + + while (1) { + switch (mPriv->autoState) { + case AUTOPROBE_GOOD: + if (inSync) + return; + AP_DBG(("State GOOD\n")); + RESET_VALIDATION; + mPriv->autoState = AUTOPROBE_VALIDATE1; + return; + case AUTOPROBE_H_GOOD: + if (inSync) + return; + AP_DBG(("State H_GOOD\n")); + RESET_VALIDATION; + mPriv->autoState = AUTOPROBE_H_VALIDATE2; + return; + case AUTOPROBE_H_NOPROTO: + AP_DBG(("State H_NOPROTO\n")); + mPriv->protocolID = 0; + mPriv->autoState = AUTOPROBE_H_SETPROTO; + break; + case AUTOPROBE_H_SETPROTO: + AP_DBG(("State H_SETPROTO\n")); + if ((pMse->protocolID = hardProtocolList[mPriv->protocolID++]) + == PROT_UNKNOWN) { + mPriv->protocolID = 0; + break; + } else if (GetProtocol(pMse->protocolID) && SetupMouse(pInfo)) { + FlushButtons(pMse); + RESET_VALIDATION; + AP_DBG(("Autoprobe: Trying Protocol: %s\n", + ProtocolIDToName(pMse->protocolID))); + mPriv->autoState = AUTOPROBE_H_VALIDATE1; + return; + } + break; + case AUTOPROBE_H_VALIDATE1: + AP_DBG(("State H_VALIDATE1\n")); + switch (validCount(mPriv,inSync,lostSync)) { + case STATE_INVALID: + mPriv->autoState = AUTOPROBE_H_SETPROTO; + break; + case STATE_VALID: + xf86Msg(X_INFO,"Mouse autoprobe: selecting %s protocol\n", + ProtocolIDToName(pMse->protocolID)); + mPriv->autoState = AUTOPROBE_H_GOOD; + return; + case STATE_UNCERTAIN: + return; + default: + break; + } + break; + case AUTOPROBE_H_VALIDATE2: + AP_DBG(("State H_VALIDATE2\n")); + switch (validCount(mPriv,inSync,lostSync)) { + case STATE_INVALID: + mPriv->autoState = AUTOPROBE_H_AUTODETECT; + break; + case STATE_VALID: + xf86Msg(X_INFO,"Mouse autoprobe: selecting %s protocol\n", + ProtocolIDToName(pMse->protocolID)); + mPriv->autoState = AUTOPROBE_H_GOOD; + return; + case STATE_UNCERTAIN: + return; + } + break; + case AUTOPROBE_H_AUTODETECT: + AP_DBG(("State H_AUTODETECT\n")); + pMse->protocolID = PROT_AUTO; + AP_DBG(("Looking for PnP/OS mouse\n")); + mPriv->count = 0; + SetupMouse(pInfo); + if (pMse->protocolID != PROT_AUTO) + mPriv->autoState = AUTOPROBE_H_GOOD; + else + mPriv->autoState = AUTOPROBE_H_NOPROTO; + break; + case AUTOPROBE_NOPROTO: + AP_DBG(("State NOPROTO\n")); + mPriv->count = 0; + mPriv->serialDefaultsNum = -1; + mPriv->autoState = AUTOPROBE_COLLECT; + break; + case AUTOPROBE_COLLECT: + AP_DBG(("State COLLECT\n")); + if (mPriv->count <= NUM_MSE_AUTOPROBE_BYTES) + return; + protocolList = softProtocolList; + mPriv->autoState = AUTOPROBE_CREATE_PROTOLIST; + break; + case AUTOPROBE_CREATE_PROTOLIST: + AP_DBG(("State CREATE_PROTOLIST\n")); + createProtoList(pMse, protocolList); + mPriv->protocolID = 0; + mPriv->autoState = AUTOPROBE_SWITCH_PROTOCOL; + break; + case AUTOPROBE_AUTODETECT: + AP_DBG(("State AUTODETECT\n")); + pMse->protocolID = PROT_AUTO; + AP_DBG(("Looking for PnP/OS mouse\n")); + mPriv->count = 0; + SetupMouse(pInfo); + if (pMse->protocolID != PROT_AUTO) + mPriv->autoState = AUTOPROBE_GOOD; + else + mPriv->autoState = AUTOPROBE_NOPROTO; + break; + case AUTOPROBE_VALIDATE1: + AP_DBG(("State VALIDATE1\n")); + switch (validCount(mPriv,inSync,lostSync)) { + case STATE_INVALID: + mPriv->autoState = AUTOPROBE_AUTODETECT; + break; + case STATE_VALID: + xf86Msg(X_INFO,"Mouse autoprobe: selecting %s protocol\n", + ProtocolIDToName(pMse->protocolID)); + mPriv->autoState = AUTOPROBE_GOOD; + break; + case STATE_UNCERTAIN: + return; + } + break; + case AUTOPROBE_VALIDATE2: + AP_DBG(("State VALIDATE2\n")); + switch (validCount(mPriv,inSync,lostSync)) { + case STATE_INVALID: + protocolList = &mPriv->protoList[mPriv->protocolID]; + mPriv->autoState = AUTOPROBE_CREATE_PROTOLIST; + break; + case STATE_VALID: + xf86Msg(X_INFO,"Mouse autoprobe: selecting %s protocol\n", + ProtocolIDToName(pMse->protocolID)); + mPriv->autoState = AUTOPROBE_GOOD; + break; + case STATE_UNCERTAIN: + return; + } + break; + case AUTOPROBE_SWITCHSERIAL: + { + pointer serialDefaults; + AP_DBG(("State SWITCHSERIAL\n")); + + if (!serialDefaultsList) + createSerialDefaultsList(); + + AP_DBG(("Switching serial params\n")); + if ((serialDefaults = + serialDefaultsList[++mPriv->serialDefaultsNum]) == NULL) { + mPriv->serialDefaultsNum = 0; + } else { + pointer tmp = xf86OptionListCreate(serialDefaults, -1, 0); + xf86SetSerial(pInfo->fd, tmp); + xf86OptionListFree(tmp); + mPriv->count = 0; + mPriv->autoState = AUTOPROBE_COLLECT; + } + break; + } + case AUTOPROBE_SWITCH_PROTOCOL: + { + MouseProtocolID proto; + void *defaults; + AP_DBG(("State SWITCH_PROTOCOL\n")); + proto = mPriv->protoList[mPriv->protocolID++]; + if (proto == PROT_UNKNOWN) + mPriv->autoState = AUTOPROBE_SWITCHSERIAL; + else if (!(defaults = GetProtocol(proto)->defaults) + || (mPriv->serialDefaultsNum == -1 + && (defaults == msDefaults)) + || (mPriv->serialDefaultsNum != -1 + && serialDefaultsList[mPriv->serialDefaultsNum] + == defaults)) { + AP_DBG(("Changing Protocol to %s\n", + ProtocolIDToName(proto))); + SetMouseProto(pMse,proto); + FlushButtons(pMse); + RESET_VALIDATION; + mPriv->autoState = AUTOPROBE_VALIDATE2; + return; + } + break; + } + } + } +} + +static Bool +autoGood(MouseDevPtr pMse) +{ + mousePrivPtr mPriv = (mousePrivPtr)pMse->mousePriv; + + if (!pMse->autoProbe) + return TRUE; + + switch (mPriv->autoState) { + case AUTOPROBE_GOOD: + case AUTOPROBE_H_GOOD: + return TRUE; + case AUTOPROBE_VALIDATE1: /* @@@ */ + case AUTOPROBE_H_VALIDATE1: /* @@@ */ + case AUTOPROBE_VALIDATE2: + case AUTOPROBE_H_VALIDATE2: + if (mPriv->goodCount < PROBE_UNCERTAINTY/2) + return TRUE; + default: + return FALSE; + } +} + + +#define TOT_THRESHOLD 3000 +#define VAL_THRESHOLD 40 + +/* + * checkForErraticMovements() -- check if mouse 'jumps around'. + */ +static void +checkForErraticMovements(InputInfoPtr pInfo, int dx, int dy) +{ + MouseDevPtr pMse = pInfo->private; + mousePrivPtr mPriv = (mousePrivPtr)pMse->mousePriv; +#if 1 + if (!mPriv->goodCount) + return; +#endif +#if 0 + if (abs(dx - mPriv->prevDx) > 300 + || abs(dy - mPriv->prevDy) > 300) + AP_DBG(("erratic1 behaviour\n")); +#endif + if (abs(dx) > VAL_THRESHOLD) { + if (sign(dx) == sign(mPriv->prevDx)) { + mPriv->accDx += dx; + if (abs(mPriv->accDx) > mPriv->acc) { + mPriv->acc = abs(mPriv->accDx); + AP_DBG(("acc=%i\n",mPriv->acc)); + } + else + AP_DBG(("accDx=%i\n",mPriv->accDx)); + } else { + mPriv->accDx = 0; + } + } + + if (abs(dy) > VAL_THRESHOLD) { + if (sign(dy) == sign(mPriv->prevDy)) { + mPriv->accDy += dy; + if (abs(mPriv->accDy) > mPriv->acc) { + mPriv->acc = abs(mPriv->accDy); + AP_DBG(("acc: %i\n",mPriv->acc)); + } else + AP_DBG(("accDy=%i\n",mPriv->accDy)); + } else { + mPriv->accDy = 0; + } + } + mPriv->prevDx = dx; + mPriv->prevDy = dy; + if (mPriv->acc > TOT_THRESHOLD) { + mPriv->goodCount = PROBE_UNCERTAINTY; + mPriv->prevDx = 0; + mPriv->prevDy = 0; + mPriv->accDx = 0; + mPriv->accDy = 0; + mPriv->acc = 0; + AP_DBG(("erratic2 behaviour\n")); + autoProbeMouse(pInfo, FALSE,TRUE); + } +} + +static void +SetMouseProto(MouseDevPtr pMse, MouseProtocolID protocolID) +{ + pMse->protocolID = protocolID; + pMse->protocol = ProtocolIDToName(pMse->protocolID); + pMse->class = ProtocolIDToClass(pMse->protocolID); + if ((pMse->protocolID >= 0) && (pMse->protocolID < PROT_NUMPROTOS)) + memcpy(pMse->protoPara, proto[pMse->protocolID], + sizeof(pMse->protoPara)); + + if (pMse->emulate3ButtonsSoft) + pMse->emulate3Buttons = TRUE; +} + +/* + * collectData() -- collect data bytes sent by mouse. + */ +static Bool +collectData(MouseDevPtr pMse, unsigned char u) +{ + mousePrivPtr mPriv = (mousePrivPtr)pMse->mousePriv; + if (mPriv->count < NUM_MSE_AUTOPROBE_TOTAL) { + mPriv->data[mPriv->count++] = u; + if (mPriv->count <= NUM_MSE_AUTOPROBE_BYTES) { + return TRUE; + } + } + return FALSE; +} + +/**************** end of autoprobe stuff *****************/ + + + +#ifdef XFree86LOADER +ModuleInfoRec MouseInfo = { + 1, + "MOUSE", + NULL, + 0, + MouseAvailableOptions, +}; + +static void +xf86MouseUnplug(pointer p) +{ +} +static pointer +xf86MousePlug(pointer module, + pointer options, + int *errmaj, + int *errmin) +{ + static Bool Initialised = FALSE; + + if (!Initialised) { + Initialised = TRUE; +#ifndef REMOVE_LOADER_CHECK_MODULE_INFO + if (xf86LoaderCheckSymbol("xf86AddModuleInfo")) +#endif + xf86AddModuleInfo(&MouseInfo, module); + } + + xf86AddInputDriver(&MOUSE, module, 0); + + return module; +} + +static XF86ModuleVersionInfo xf86MouseVersionRec = +{ + "mouse", + MODULEVENDORSTRING, + MODINFOSTRING1, + MODINFOSTRING2, + XORG_VERSION_CURRENT, + 1, 1, 1, + ABI_CLASS_XINPUT, + ABI_XINPUT_VERSION, + MOD_CLASS_XINPUT, + {0, 0, 0, 0} /* signature, to be patched into the file by */ + /* a tool */ +}; + +_X_EXPORT XF86ModuleData mouseModuleData = { + &xf86MouseVersionRec, + xf86MousePlug, + xf86MouseUnplug +}; + +/* + Look at hitachi device stuff. +*/ +#endif /* XFree86LOADER */ + + diff --git a/driver/xf86-input-mouse/src/mouse.h b/driver/xf86-input-mouse/src/mouse.h new file mode 100644 index 000000000..16c5a8272 --- /dev/null +++ b/driver/xf86-input-mouse/src/mouse.h @@ -0,0 +1,15 @@ +/* $XFree86: xc/programs/Xserver/hw/xfree86/input/mouse/mouse.h,v 1.13 2003/11/03 05:11:49 tsi Exp $ */ + +/* + * Copyright (c) 1997-1999 by The XFree86 Project, Inc. + */ + +#ifndef MOUSE_H_ +#define MOUSE_H_ + +#include "xf86OSmouse.h" + +const char * xf86MouseProtocolIDToName(MouseProtocolID id); +MouseProtocolID xf86MouseProtocolNameToID(const char *name); + +#endif diff --git a/driver/xf86-input-mouse/src/mousePriv.h b/driver/xf86-input-mouse/src/mousePriv.h new file mode 100644 index 000000000..262d02963 --- /dev/null +++ b/driver/xf86-input-mouse/src/mousePriv.h @@ -0,0 +1,80 @@ +/* $XFree86: xc/programs/Xserver/hw/xfree86/input/mouse/mousePriv.h,v 1.11 2003/11/03 05:11:49 tsi Exp $ */ +/* + * Copyright (c) 1997-1999 by The XFree86 Project, Inc. + */ + +#ifndef _X_MOUSEPRIV_H +#define _X_MOUSEPRIV_H + +#if 0 +# define MOUSEINITDEBUG +# define MOUSEDATADEBUG +#endif + +#include "mouse.h" +#include "xf86Xinput.h" +/* Private interface for the mouse driver. */ + +typedef enum { + AUTOPROBE_H_NOPROTO, + AUTOPROBE_H_GOOD, + AUTOPROBE_H_AUTODETECT, + AUTOPROBE_H_VALIDATE1, + AUTOPROBE_H_VALIDATE2, + AUTOPROBE_H_SETPROTO, + AUTOPROBE_NOPROTO, + AUTOPROBE_COLLECT, + AUTOPROBE_CREATE_PROTOLIST, + AUTOPROBE_GOOD, + AUTOPROBE_AUTODETECT, + AUTOPROBE_VALIDATE1, + AUTOPROBE_VALIDATE2, + AUTOPROBE_SWITCHSERIAL, + AUTOPROBE_SWITCH_PROTOCOL +} mseAutoProbeStates; + +typedef struct { + const char * name; + int class; + const char ** defaults; + MouseProtocolID id; +} MouseProtocolRec, *MouseProtocolPtr; + +#define NUM_MSE_AUTOPROBE_BYTES 24 /* multiple of 3,4 and 6 byte packages */ +#define NUM_MSE_AUTOPROBE_TOTAL 64 +#define NUM_AUTOPROBE_PROTOS 17 + + +typedef struct { + int current; + Bool inReset; + CARD32 lastEvent; + CARD32 expires; + Bool soft; + int goodCount; + int badCount; + int protocolID; + int count; + char data[NUM_MSE_AUTOPROBE_TOTAL]; + mseAutoProbeStates autoState; + MouseProtocolID protoList[NUM_AUTOPROBE_PROTOS]; + int serialDefaultsNum; + int prevDx, prevDy; + int accDx, accDy; + int acc; + CARD32 pnpLast; + Bool disablePnPauto; +} mousePrivRec, *mousePrivPtr; + +/* mouse proto flags */ +#define MPF_NONE 0x00 +#define MPF_SAFE 0x01 + +/* pnp.c */ +MouseProtocolID MouseGetPnpProtocol(InputInfoPtr pInfo); +Bool ps2Reset(InputInfoPtr pInfo); +Bool ps2EnableDataReporting(InputInfoPtr pInfo); +Bool ps2SendPacket(InputInfoPtr pInfo, unsigned char *bytes, int len); +int ps2GetDeviceID(InputInfoPtr pInfo); + +#endif /* _X_MOUSE_H */ diff --git a/driver/xf86-input-mouse/src/pnp.c b/driver/xf86-input-mouse/src/pnp.c new file mode 100644 index 000000000..edbc694cf --- /dev/null +++ b/driver/xf86-input-mouse/src/pnp.c @@ -0,0 +1,792 @@ +/* $XFree86: xc/programs/Xserver/hw/xfree86/input/mouse/pnp.c,v 1.20tsi Exp $ */ +/* + * Copyright 1998 by Kazutaka YOKOTA <yokota@zodiac.mech.utsunomiya-u.ac.jp> + * + * Permission to use, copy, modify, distribute, and sell this software and its + * documentation for any purpose is hereby granted without fee, provided that + * the above copyright notice appear in all copies and that both that + * copyright notice and this permission notice appear in supporting + * documentation, and that the name of Kazutaka YOKOTA not be used in + * advertising or publicity pertaining to distribution of the software without + * specific, written prior permission. Kazutaka YOKOTA makes no representations + * about the suitability of this software for any purpose. It is provided + * "as is" without express or implied warranty. + * + * KAZUTAKA YOKOTA DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, + * INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO + * EVENT SHALL KAZUTAKA YOKOTA BE LIABLE FOR ANY SPECIAL, INDIRECT OR + * CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, + * DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER + * TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR + * PERFORMANCE OF THIS SOFTWARE. + */ + +#ifdef HAVE_CONFIG_H +#include "config.h" +#endif + +#include <stdio.h> +#include <string.h> +#include <unistd.h> +#define NEED_EVENTS +#include <X11/X.h> +#include <X11/Xproto.h> +#include "inputstr.h" +#include "scrnintstr.h" +#include "xf86.h" +#include "xf86Priv.h" +#include "xf86Xinput.h" +#include "xf86_OSproc.h" +#include "xf86OSmouse.h" +#include "mouse.h" +#include "mousePriv.h" + +#ifdef MOUSEINITDEBUG +# define DEBUG +# define EXTMOUSEDEBUG +#endif + +/* serial PnP ID string */ +typedef struct { + int revision; /* PnP revision, 100 for 1.00 */ + char *eisaid; /* EISA ID including mfr ID and product ID */ + char *serial; /* serial No, optional */ + char *class; /* device class, optional */ + char *compat; /* list of compatible drivers, optional */ + char *description; /* product description, optional */ + int neisaid; /* length of the above fields... */ + int nserial; + int nclass; + int ncompat; + int ndescription; +} pnpid_t; + +/* symbol table entry */ +typedef struct { + char *name; + MouseProtocolID val; +} symtab_t; + +/* PnP EISA/product IDs */ +static symtab_t pnpprod[] = { + { "KML0001", PROT_THINKING }, /* Kensignton ThinkingMouse */ + { "MSH0001", PROT_IMSERIAL }, /* MS IntelliMouse */ + { "MSH0004", PROT_IMSERIAL }, /* MS IntelliMouse TrackBall */ + { "KYEEZ00", PROT_MS }, /* Genius EZScroll */ + { "KYE0001", PROT_MS }, /* Genius PnP Mouse */ + { "KYE0002", PROT_MS }, /* MouseSystem (Genius?) SmartScroll */ + { "KYE0003", PROT_IMSERIAL }, /* Genius NetMouse */ + { "LGI800C", PROT_IMSERIAL }, /* Logitech MouseMan (4 button model) */ + { "LGI8033", PROT_IMSERIAL }, /* Logitech Cordless MouseMan Wheel */ + { "LGI8050", PROT_IMSERIAL }, /* Logitech MouseMan+ */ + { "LGI8051", PROT_IMSERIAL }, /* Logitech FirstMouse+ */ + { "LGI8001", PROT_LOGIMAN }, /* Logitech serial */ + { "A4W0005", PROT_IMSERIAL }, /* A4 Tech 4D/4D+ Mouse */ + { "PEC9802", PROT_IMSERIAL }, /* 8D Scroll Mouse */ + + { "PNP0F00", PROT_BM }, /* MS bus */ + { "PNP0F01", PROT_MS }, /* MS serial */ + { "PNP0F02", PROT_BM }, /* MS InPort */ + { "PNP0F03", PROT_PS2 }, /* MS PS/2 */ + /* + * EzScroll returns PNP0F04 in the compatible device field; but it + * doesn't look compatible... XXX + */ + { "PNP0F04", PROT_MSC }, /* MouseSystems */ + { "PNP0F05", PROT_MSC }, /* MouseSystems */ +#ifdef notyet + { "PNP0F06", PROT_??? }, /* Genius Mouse */ + { "PNP0F07", PROT_??? }, /* Genius Mouse */ +#endif + { "PNP0F08", PROT_LOGIMAN }, /* Logitech serial */ + { "PNP0F09", PROT_MS }, /* MS BallPoint serial */ + { "PNP0F0A", PROT_MS }, /* MS PnP serial */ + { "PNP0F0B", PROT_MS }, /* MS PnP BallPoint serial */ + { "PNP0F0C", PROT_MS }, /* MS serial comatible */ + { "PNP0F0D", PROT_BM }, /* MS InPort comatible */ + { "PNP0F0E", PROT_PS2 }, /* MS PS/2 comatible */ + { "PNP0F0F", PROT_MS }, /* MS BallPoint comatible */ +#ifdef notyet + { "PNP0F10", PROT_??? }, /* TI QuickPort */ +#endif + { "PNP0F11", PROT_BM }, /* MS bus comatible */ + { "PNP0F12", PROT_PS2 }, /* Logitech PS/2 */ + { "PNP0F13", PROT_PS2 }, /* PS/2 */ +#ifdef notyet + { "PNP0F14", PROT_??? }, /* MS Kids Mouse */ +#endif + { "PNP0F15", PROT_BM }, /* Logitech bus */ +#ifdef notyet + { "PNP0F16", PROT_??? }, /* Logitech SWIFT */ +#endif + { "PNP0F17", PROT_LOGIMAN }, /* Logitech serial compat */ + { "PNP0F18", PROT_BM }, /* Logitech bus compatible */ + { "PNP0F19", PROT_PS2 }, /* Logitech PS/2 compatible */ +#ifdef notyet + { "PNP0F1A", PROT_??? }, /* Logitech SWIFT compatible */ + { "PNP0F1B", PROT_??? }, /* HP Omnibook */ + { "PNP0F1C", PROT_??? }, /* Compaq LTE TrackBall PS/2 */ + { "PNP0F1D", PROT_??? }, /* Compaq LTE TrackBall serial */ + { "PNP0F1E", PROT_??? }, /* MS Kids Trackball */ +#endif + { NULL, PROT_UNKNOWN }, +}; + +static const char *pnpSerial[] = { + "BaudRate", "1200", + "DataBits", "7", + "StopBits", "1", + "Parity", "None", + "FlowControl", "None", + "VTime", "0", + "VMin", "1", + NULL +}; + +static int pnpgets(InputInfoPtr, char *, Bool *prePNP); +static int pnpparse(InputInfoPtr, pnpid_t *, char *, int); +static MouseProtocolID prepnpparse(InputInfoPtr pInfo, char *buf); +static symtab_t *pnpproto(pnpid_t *); +static symtab_t *gettoken(symtab_t *, char *, int); +static MouseProtocolID getPs2ProtocolPnP(InputInfoPtr pInfo); +static MouseProtocolID probePs2ProtocolPnP(InputInfoPtr pInfo); + +static MouseProtocolID +MouseGetSerialPnpProtocol(InputInfoPtr pInfo) +{ + char buf[256]; /* PnP ID string may be up to 256 bytes long */ + pnpid_t pnpid; + symtab_t *t; + int len; + Bool prePNP; + + if ((len = pnpgets(pInfo, buf, &prePNP)) > 0) + { + if (!prePNP) { + if (pnpparse(pInfo, &pnpid, buf, len) && + (t = pnpproto(&pnpid)) != NULL) { + xf86MsgVerb(X_INFO, 2, "%s: PnP-detected protocol ID: %d\n", + pInfo->name, t->val); + return (t->val); + } + } else + return prepnpparse(pInfo,buf); + } + return PROT_UNKNOWN; +} + +MouseProtocolID +MouseGetPnpProtocol(InputInfoPtr pInfo) +{ + MouseDevPtr pMse = pInfo->private; + mousePrivPtr mPriv = (mousePrivPtr)pMse->mousePriv; + MouseProtocolID val; + CARD32 last; + + if ((val = MouseGetSerialPnpProtocol(pInfo)) != PROT_UNKNOWN) { + if (val == MouseGetSerialPnpProtocol(pInfo)) + return val; + } + +#if 1 + last = mPriv->pnpLast; + mPriv->pnpLast = currentTime.milliseconds; + + if (last) { + if (last - currentTime.milliseconds < 100 + || (mPriv->disablePnPauto + && (last - currentTime.milliseconds < 10000))) { +#ifdef EXTMOUSEDEBUG + xf86ErrorF("Mouse: Disabling PnP\n"); +#endif + mPriv->disablePnPauto = TRUE; + return PROT_UNKNOWN; + } + } + +#ifdef EXTMOUSEDEBUG + if (mPriv->disablePnPauto) + xf86ErrorF("Mouse: Enabling PnP\n"); +#endif + mPriv->disablePnPauto = FALSE; + + if (mPriv->soft) + return getPs2ProtocolPnP(pInfo); + else + return probePs2ProtocolPnP(pInfo); +#else + return PROT_UNKNOWN; +#endif +} + +/* + * Try to elicit a PnP ID as described in + * Microsoft, Hayes: "Plug and Play External COM Device Specification, + * rev 1.00", 1995. + * + * The routine does not fully implement the COM Enumerator as per Section + * 2.1 of the document. In particular, we don't have idle state in which + * the driver software monitors the com port for dynamic connection or + * removal of a device at the port, because `moused' simply quits if no + * device is found. + * + * In addition, as PnP COM device enumeration procedure slightly has + * changed since its first publication, devices which follow earlier + * revisions of the above spec. may fail to respond if the rev 1.0 + * procedure is used. XXX + */ +static int +pnpgets(InputInfoPtr pInfo, char *buf, Bool *prePNP) +{ + int i; + char c; + pointer pnpOpts; + +#if 0 + /* + * This is the procedure described in rev 1.0 of PnP COM device spec. + * Unfortunately, some devices which comform to earlier revisions of + * the spec gets confused and do not return the ID string... + */ + + /* port initialization (2.1.2) */ + if ((i = xf86GetSerialModemState(pInfo->fd)) == -1) + return 0; + i |= XF86_M_DTR; /* DTR = 1 */ + i &= ~XF86_M_RTS; /* RTS = 0 */ + if (xf86SetSerialModemState(pInfo->fd, i) == -1) + goto disconnect_idle; + usleep(200000); + if ((i = xf86GetSerialModemState(pInfo->fd)) == -1 || + (i & XF86_M_DSR) == 0) + goto disconnect_idle; + + /* port setup, 1st phase (2.1.3) */ + pnpOpts = xf86OptionListCreate(pnpSerial, -1, 1); + xf86SetSerial(pInfo->fd, pnpOpts); + i = TIOCM_DTR | TIOCM_RTS; /* DTR = 0, RTS = 0 */ + xf86SerialModemClearBits(pInfo->fd, i); + usleep(200000); + i = TIOCM_DTR; /* DTR = 1, RTS = 0 */ + xf86SerialModemSetBits(pInfo->fd, i); + usleep(200000); + + /* wait for response, 1st phase (2.1.4) */ + xf86FlushInput(pInfo->fd); + i = TIOCM_RTS; /* DTR = 1, RTS = 1 */ + xf86SerialModemSetBits(pInfo->fd, i); + + /* try to read something */ + if (xf86WaitForInput(pInfo->fd, 200000) <= 0) { + + /* port setup, 2nd phase (2.1.5) */ + i = TIOCM_DTR | TIOCM_RTS; /* DTR = 0, RTS = 0 */ + xf86SerialModemClearBits(pInfo->fd, i); + usleep(200000); + + /* wait for respose, 2nd phase (2.1.6) */ + xf86FlushInput(pInfo->fd); + i = TIOCM_DTR | TIOCM_RTS; /* DTR = 1, RTS = 1 */ + xf86SerialModemSetBits(pInfo->fd, i); + + /* try to read something */ + if (xf86WaitForInput(pInfo->fd, 200000) <= 0) + goto connect_idle; + } +#else + /* + * This is a simplified procedure; it simply toggles RTS. + */ + + if ((i = xf86GetSerialModemState(pInfo->fd)) == -1) + return 0; + i |= XF86_M_DTR; /* DTR = 1 */ + i &= ~XF86_M_RTS; /* RTS = 0 */ + if (xf86SetSerialModemState(pInfo->fd, i) == -1) + goto disconnect_idle; + usleep(200000); + + pnpOpts = xf86OptionListCreate(pnpSerial, -1, 1); + xf86SetSerial(pInfo->fd, pnpOpts); + + /* wait for respose */ + xf86FlushInput(pInfo->fd); + i = XF86_M_DTR | XF86_M_RTS; /* DTR = 1, RTS = 1 */ + xf86SerialModemSetBits(pInfo->fd, i); + + /* try to read something */ + if (xf86WaitForInput(pInfo->fd, 200000) <= 0) + goto connect_idle; +#endif + + /* collect PnP COM device ID (2.1.7) */ + i = 0; + *prePNP = FALSE; + + usleep(200000); /* the mouse must send `Begin ID' within 200msec */ + while (xf86ReadSerial(pInfo->fd, &c, 1) == 1) { + /* we may see "M", or "M3..." before `Begin ID' */ + if (c == 'M') + *prePNP = TRUE; + + if ((c == 0x08) || (c == 0x28)) { /* Begin ID */ + *prePNP = FALSE; + buf[0] = c; + i = 1; + break; + } + if (*prePNP) + buf[i++] = c; + + if (xf86WaitForInput(pInfo->fd, 200000) <= 0) + break; + } + if (i <= 0) { + /* we haven't seen `Begin ID' in time... */ + goto connect_idle; + } + if (*prePNP) + return i; + + ++c; /* make it `End ID' */ + for (;;) { + if (xf86WaitForInput(pInfo->fd, 200000) <= 0) + break; + + xf86ReadSerial(pInfo->fd, &buf[i], 1); + if (buf[i++] == c) /* End ID */ + break; + if (i >= 256) + break; + } + if (buf[i - 1] != c) + goto connect_idle; + return i; + + /* + * According to PnP spec, we should set DTR = 1 and RTS = 0 while + * in idle state. But, `moused' shall set DTR = RTS = 1 and proceed, + * assuming there is something at the port even if it didn't + * respond to the PnP enumeration procedure. + */ +disconnect_idle: + i = XF86_M_DTR | XF86_M_RTS; /* DTR = 1, RTS = 1 */ + xf86SerialModemSetBits(pInfo->fd, i); +connect_idle: + return 0; +} + +static int +pnpparse(InputInfoPtr pInfo, pnpid_t *id, char *buf, int len) +{ + char s[3]; + int offset; + int sum = 0; + int i, j; + + id->revision = 0; + id->eisaid = NULL; + id->serial = NULL; + id->class = NULL; + id->compat = NULL; + id->description = NULL; + id->neisaid = 0; + id->nserial = 0; + id->nclass = 0; + id->ncompat = 0; + id->ndescription = 0; + + offset = 0x28 - buf[0]; + + /* calculate checksum */ + for (i = 0; i < len - 3; ++i) { + sum += buf[i]; + buf[i] += offset; + } + sum += buf[len - 1]; + for (; i < len; ++i) + buf[i] += offset; + xf86MsgVerb(X_INFO, 2, "%s: PnP ID string: `%*.*s'\n", pInfo->name, + len, len, buf); + + /* revision */ + buf[1] -= offset; + buf[2] -= offset; + id->revision = ((buf[1] & 0x3f) << 6) | (buf[2] & 0x3f); + xf86MsgVerb(X_INFO, 2, "%s: PnP rev %d.%02d\n", pInfo->name, + id->revision / 100, id->revision % 100); + + /* EISA vender and product ID */ + id->eisaid = &buf[3]; + id->neisaid = 7; + + /* option strings */ + i = 10; + if (buf[i] == '\\') { + /* device serial # */ + for (j = ++i; i < len; ++i) { + if (buf[i] == '\\') + break; + } + if (i >= len) + i -= 3; + if (i - j == 8) { + id->serial = &buf[j]; + id->nserial = 8; + } + } + if (buf[i] == '\\') { + /* PnP class */ + for (j = ++i; i < len; ++i) { + if (buf[i] == '\\') + break; + } + if (i >= len) + i -= 3; + if (i > j + 1) { + id->class = &buf[j]; + id->nclass = i - j; + } + } + if (buf[i] == '\\') { + /* compatible driver */ + for (j = ++i; i < len; ++i) { + if (buf[i] == '\\') + break; + } + /* + * PnP COM spec prior to v0.96 allowed '*' in this field, + * it's not allowed now; just ignore it. + */ + if (buf[j] == '*') + ++j; + if (i >= len) + i -= 3; + if (i > j + 1) { + id->compat = &buf[j]; + id->ncompat = i - j; + } + } + if (buf[i] == '\\') { + /* product description */ + for (j = ++i; i < len; ++i) { + if (buf[i] == ';') + break; + } + if (i >= len) + i -= 3; + if (i > j + 1) { + id->description = &buf[j]; + id->ndescription = i - j; + } + } + + /* checksum exists if there are any optional fields */ + if ((id->nserial > 0) || (id->nclass > 0) + || (id->ncompat > 0) || (id->ndescription > 0)) { + xf86MsgVerb(X_INFO, 4, "%s: PnP checksum: 0x%02X\n", pInfo->name, sum); + sprintf(s, "%02X", sum & 0x0ff); + if (strncmp(s, &buf[len - 3], 2) != 0) { +#if 0 + /* + * Checksum error!! + * I found some mice do not comply with the PnP COM device + * spec regarding checksum... XXX + */ + return FALSE; +#endif + } + } + + return TRUE; +} + +/* We can only identify MS at the moment */ +static MouseProtocolID +prepnpparse(InputInfoPtr pInfo, char *buf) +{ + if (buf[0] == 'M' && buf[1] == '3') + return PROT_MS; + return PROT_UNKNOWN; +} + + +static symtab_t * +pnpproto(pnpid_t *id) +{ + symtab_t *t; + int i, j; + + if (id->nclass > 0) + if (strncmp(id->class, "MOUSE", id->nclass) != 0) + /* this is not a mouse! */ + return NULL; + + if (id->neisaid > 0) { + t = gettoken(pnpprod, id->eisaid, id->neisaid); + if (t->val != -1) + return t; + } + + /* + * The 'Compatible drivers' field may contain more than one + * ID separated by ','. + */ + if (id->ncompat <= 0) + return NULL; + for (i = 0; i < id->ncompat; ++i) { + for (j = i; id->compat[i] != ','; ++i) + if (i >= id->ncompat) + break; + if (i > j) { + t = gettoken(pnpprod, id->compat + j, i - j); + if (t->val != -1) + return t; + } + } + + return NULL; +} + +/* name/val mapping */ + +static symtab_t * +gettoken(tab, s, len) +symtab_t *tab; +char *s; +int len; +{ + int i; + + for (i = 0; tab[i].name != NULL; ++i) { + if (strncmp(tab[i].name, s, len) == 0) + break; + } + return &tab[i]; +} + +/******************* PS/2 PnP probing ****************/ + +static int +readMouse(InputInfoPtr pInfo, unsigned char *u) +{ + + if (xf86WaitForInput(pInfo->fd, 200000) <= 0) + return FALSE; + + xf86ReadSerial(pInfo->fd, u, 1); + return TRUE; +} + +static void +ps2DisableWrapMode(InputInfoPtr pInfo) +{ + unsigned char reset_wrap_mode[] = { 0xEC }; + ps2SendPacket(pInfo, reset_wrap_mode, sizeof(reset_wrap_mode)); +} + +Bool +ps2SendPacket(InputInfoPtr pInfo, unsigned char *bytes, int len) +{ + unsigned char c; + int i,j; + +#ifdef DEBUG + xf86ErrorF("Ps/2 data package:"); + for (i = 0; i < len; i++) + xf86ErrorF(" %x", *(bytes + i)); + xf86ErrorF("\n"); +#endif + + for (i = 0; i < len; i++) { + for (j = 0; j < 10; j++) { + xf86WriteSerial(pInfo->fd, bytes + i, 1); + usleep(10000); + if (!readMouse(pInfo,&c)) { +#ifdef DEBUG + xf86ErrorF("sending 0x%x to PS/2 unsuccessful\n",*(bytes + i)); +#endif + return FALSE; + } +#ifdef DEBUG + xf86ErrorF("Recieved: 0x%x\n",c); +#endif + if (c == 0xFA) /* ACK */ + break; + + if (c == 0xFE) /* resend */ + continue; + + + if (c == 0xFC) /* error */ + return FALSE; + + /* Some mice accidently enter wrap mode during init */ + if (c == *(bytes + i) /* wrap mode */ + && (*(bytes + i) != 0xEC)) /* avoid recursion */ + ps2DisableWrapMode(pInfo); + + return FALSE; + } + if (j == 10) + return FALSE; + } + + return TRUE; +} + +static Bool +ps2DisableDataReporting(InputInfoPtr pInfo) +{ + unsigned char packet[] = { 0xF5 }; + return ps2SendPacket(pInfo, packet, sizeof(packet)); +} + +Bool +ps2EnableDataReporting(InputInfoPtr pInfo) +{ + unsigned char packet[] = { 0xF4 }; + return ps2SendPacket(pInfo, packet, sizeof(packet)); +} + +int +ps2GetDeviceID(InputInfoPtr pInfo) +{ + unsigned char u; + unsigned char packet[] = { 0xf2 }; + + usleep(30000); + xf86FlushInput(pInfo->fd); + if (!ps2SendPacket(pInfo, packet, sizeof(packet))) + return -1; + while (1) { + if (!readMouse(pInfo,&u)) + return -1; + if (u != 0xFA) + break; + } +#ifdef DEBUG + xf86ErrorF("Obtained Mouse Type: %x\n",u); +#endif + return (int) u; +} + +Bool +ps2Reset(InputInfoPtr pInfo) +{ + unsigned char u; + unsigned char packet[] = { 0xff }; + unsigned char reply[] = { 0xaa, 0x00 }; + unsigned int i; +#ifdef DEBUG + xf86ErrorF("PS/2 Mouse reset\n"); +#endif + if (!ps2SendPacket(pInfo, packet, sizeof(packet))) + return FALSE; + /* we need a little delay here */ + xf86WaitForInput(pInfo->fd, 500000); + for (i = 0; i < sizeof(reply) ; i++) { + if (!readMouse(pInfo,&u)) { + goto EXIT; + } + if (u != reply[i]) + goto EXIT; + } + return TRUE; + + EXIT: + xf86FlushInput(pInfo->fd); + return FALSE; +} + +static MouseProtocolID +probePs2ProtocolPnP(InputInfoPtr pInfo) +{ + unsigned char u; + MouseProtocolID ret = PROT_UNKNOWN; + + xf86FlushInput(pInfo->fd); + + ps2DisableDataReporting(pInfo); + + if (ps2Reset(pInfo)) { /* Reset PS2 device */ + unsigned char seq[] = { 243, 200, 243, 100, 243, 80 }; + /* Try to identify Intelli Mouse */ + if (ps2SendPacket(pInfo, seq, sizeof(seq))) { + u = ps2GetDeviceID(pInfo); + if (u == 0x03) { + /* found IntelliMouse now try IntelliExplorer */ + unsigned char seq[] = { 243, 200, 243, 200, 243, 80 }; + if (ps2SendPacket(pInfo,seq,sizeof(seq))) { + u = ps2GetDeviceID(pInfo); + if (u == 0x04) + ret = PROT_EXPPS2; + else + ret = PROT_IMPS2; + } + } else if (ps2Reset(pInfo)) /* reset again to find sane state */ + ret = PROT_PS2; + } + + if (ret != PROT_UNKNOWN) + ps2EnableDataReporting(pInfo); + } + return ret; +} + +static struct ps2protos { + int Id; + MouseProtocolID protoID; +} ps2 [] = { + { 0x0, PROT_PS2 }, + { 0x3, PROT_IMPS2 }, + { 0x4, PROT_EXPPS2 }, + { -1 , PROT_UNKNOWN } +}; + + +static MouseProtocolID +getPs2ProtocolPnP(InputInfoPtr pInfo) +{ + int Id; + int i; + MouseProtocolID proto; + int count = 4; + + xf86FlushInput(pInfo->fd); + + while (--count) + if (ps2DisableDataReporting(pInfo)) + break; + + if (!count) { + proto = PROT_UNKNOWN; + goto EXIT; + } + + if ((Id = ps2GetDeviceID(pInfo)) == -1) { + proto = PROT_UNKNOWN; + goto EXIT; + } + + if (-1 == ps2EnableDataReporting(pInfo)) { + proto = PROT_UNKNOWN; + goto EXIT; + } + + for (i = 0; ps2[i].protoID != PROT_UNKNOWN; i++) { + if (ps2[i].Id == Id) { + xf86MsgVerb(X_PROBED,2,"Found PS/2 proto ID %x\n",Id); + proto = ps2[i].protoID; + goto EXIT; + } + } + + proto = PROT_UNKNOWN; + xf86Msg(X_ERROR,"Found unknown PS/2 proto ID %x\n",Id); + + EXIT: + xf86FlushInput(pInfo->fd); + return proto; +} +